![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[SND]](/icons/sound2.gif) | Lemon.mp3 | 2022-05-16 04:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | PMK.mp3 | 2022-05-16 04:49 | 0 | |
![[SND]](/icons/sound2.gif) | asep.mp3 | 2022-05-16 04:48 | 1.2M | |
![[SND]](/icons/sound2.gif) | s11.mp3 | 2022-05-16 04:46 | 2.8M | |
![[SND]](/icons/sound2.gif) | Cid.mp3 | 2022-05-16 04:43 | 0 | |
![[SND]](/icons/sound2.gif) | s9.mp3 | 2022-05-16 04:43 | 904K | |
![[SND]](/icons/sound2.gif) | mon.mp3 | 2022-05-16 04:41 | 1.3M | |
![[SND]](/icons/sound2.gif) | fff.mp3 | 2022-05-16 04:41 | 2.4M | |
![[SND]](/icons/sound2.gif) | tom15.mp3 | 2022-05-16 04:41 | 0 | |
![[SND]](/icons/sound2.gif) | tomtom1.mp3 | 2022-05-16 04:40 | 0 | |
![[SND]](/icons/sound2.gif) | mondazee.mp3 | 2022-05-16 04:40 | 0 | |
![[SND]](/icons/sound2.gif) | monday.mp3 | 2022-05-16 04:39 | 0 | |
![[SND]](/icons/sound2.gif) | tom14.mp3 | 2022-05-16 04:39 | 0 | |
![[SND]](/icons/sound2.gif) | tom13.mp3 | 2022-05-16 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | Demons - Imagine Dragons.mp3 | 2022-05-16 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | mondaze.mp3 | 2022-05-16 04:36 | 0 | |
![[SND]](/icons/sound2.gif) | Desh Mere Bhuj - Arijit Singh.mp3 | 2022-05-16 04:36 | 0 | |
![[SND]](/icons/sound2.gif) | f1.mp3 | 2022-05-16 04:36 | 3.7M | |
![[SND]](/icons/sound2.gif) | s8.mp3 | 2022-05-16 04:35 | 3.2M | |
![[SND]](/icons/sound2.gif) | Miley Cyrus - Can`t Be Tamed(1).mp3 | 2022-05-16 04:35 | 0 | |
![[SND]](/icons/sound2.gif) | Udin.mp3 | 2022-05-16 04:34 | 2.0M | |
![[SND]](/icons/sound2.gif) | Dido - Here with Me (Official Video).mp3 | 2022-05-16 04:33 | 0 | |
![[SND]](/icons/sound2.gif) | toleransi.mp3 | 2022-05-16 04:29 | 4.7M | |
![[SND]](/icons/sound2.gif) | s7.mp3 | 2022-05-16 04:28 | 3.9M | |
![[SND]](/icons/sound2.gif) | AUD-20210621-WA0017.mp3 | 2022-05-16 04:28 | 0 | |
![[SND]](/icons/sound2.gif) | oo.mp3 | 2022-05-16 04:28 | 19M | |
![[SND]](/icons/sound2.gif) | JR.mp3 | 2022-05-16 04:28 | 0 | |
![[SND]](/icons/sound2.gif) | Rizz5.mp3 | 2022-05-16 04:25 | 0 | |
![[SND]](/icons/sound2.gif) | s6.mp3 | 2022-05-16 04:23 | 2.5M | |
![[SND]](/icons/sound2.gif) | Tiktok.mp3 | 2022-05-16 04:21 | 2.5M | |
![[SND]](/icons/sound2.gif) | Rizz4.mp3 | 2022-05-16 04:21 | 4.8M | |
![[SND]](/icons/sound2.gif) | f3.mp3 | 2022-05-16 04:19 | 0 | |
![[SND]](/icons/sound2.gif) | Love1.mp3 | 2022-05-16 04:19 | 0 | |
![[SND]](/icons/sound2.gif) | Akvelian.mp3 | 2022-05-16 04:18 | 2.4M | |
![[SND]](/icons/sound2.gif) | Soundtrack.mp3 | 2022-05-16 04:15 | 0 | |
![[SND]](/icons/sound2.gif) | ooc.mp3 | 2022-05-16 04:15 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - polisi beraksi lirik _ asli full version (128 kbps).mp3 | 2022-05-16 04:12 | 0 | |
![[SND]](/icons/sound2.gif) | lv_7085710379334126850_20220516110931.mp3 | 2022-05-16 04:12 | 0 | |
![[SND]](/icons/sound2.gif) | chingchong2.mp3 | 2022-05-16 04:10 | 0 | |
![[SND]](/icons/sound2.gif) | Pol.mp3 | 2022-05-16 04:08 | 0 | |
![[SND]](/icons/sound2.gif) | s5.mp3 | 2022-05-16 04:07 | 0 | |
![[SND]](/icons/sound2.gif) | uncleflexxx_-_camry_3.5_muzrecord.net.mp3 | 2022-05-16 04:07 | 0 | |
![[SND]](/icons/sound2.gif) | playdatee.mp3 | 2022-05-16 04:06 | 0 | |
![[SND]](/icons/sound2.gif) | mhcyuv.mp3 | 2022-05-16 04:05 | 0 | |
![[SND]](/icons/sound2.gif) | stereo.mp3 | 2022-05-16 04:05 | 0 | |
![[SND]](/icons/sound2.gif) | GPD.mp3 | 2022-05-16 04:01 | 0 | |
![[SND]](/icons/sound2.gif) | STB.mp3 | 2022-05-16 04:00 | 0 | |
![[SND]](/icons/sound2.gif) | zayn23.mp3 | 2022-05-16 04:00 | 0 | |
![[SND]](/icons/sound2.gif) | Parog1.mp3 | 2022-05-16 03:59 | 0 | |
![[SND]](/icons/sound2.gif) | 83d.mp3 | 2022-05-16 03:58 | 0 | |
![[SND]](/icons/sound2.gif) | ulol.mp3 | 2022-05-16 03:58 | 2.3M | |
![[SND]](/icons/sound2.gif) | Past1.mp3 | 2022-05-16 03:57 | 0 | |
![[SND]](/icons/sound2.gif) | abcdef.mp3 | 2022-05-16 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | SYKO3.mp3 | 2022-05-16 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | 0101.mp3 | 2022-05-16 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | LSPD.mp3 | 2022-05-16 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | 6789.mp3 | 2022-05-16 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | 4K.mp3 | 2022-05-16 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | s4.mp3 | 2022-05-16 03:55 | 3.5M | |
![[SND]](/icons/sound2.gif) | 1B.mp3 | 2022-05-16 03:55 | 0 | |
![[SND]](/icons/sound2.gif) | Sunandmoon.mp3 | 2022-05-16 03:54 | 2.3M | |
![[SND]](/icons/sound2.gif) | zayn21.mp3 | 2022-05-16 03:53 | 644K | |
![[SND]](/icons/sound2.gif) | 12345.mp3 | 2022-05-16 03:50 | 5.1M | |
![[SND]](/icons/sound2.gif) | ekky12.mp3 | 2022-05-16 03:50 | 0 | |
![[SND]](/icons/sound2.gif) | AS.mp3 | 2022-05-16 03:49 | 2.6M | |
![[SND]](/icons/sound2.gif) | 100d.mp3 | 2022-05-16 03:48 | 0 | |
![[SND]](/icons/sound2.gif) | wgt1.mp3 | 2022-05-16 03:48 | 0 | |
![[SND]](/icons/sound2.gif) | Todoroki4.mp3 | 2022-05-16 03:48 | 0 | |
![[SND]](/icons/sound2.gif) | 0d.mp3 | 2022-05-16 03:48 | 0 | |
![[SND]](/icons/sound2.gif) | yamateh.mp3 | 2022-05-16 03:47 | 0 | |
![[SND]](/icons/sound2.gif) | YYS.mp3 | 2022-05-16 03:46 | 0 | |
![[SND]](/icons/sound2.gif) | s10.mp3 | 2022-05-16 03:46 | 3.5M | |
![[SND]](/icons/sound2.gif) | bara.mp3 | 2022-05-16 03:40 | 0 | |
![[SND]](/icons/sound2.gif) | heyheyhey.mp3 | 2022-05-16 03:35 | 0 | |
![[SND]](/icons/sound2.gif) | Limzy.mp3 | 2022-05-16 03:26 | 0 | |
![[SND]](/icons/sound2.gif) | 2T.mp3 | 2022-05-16 03:24 | 116K | |
![[SND]](/icons/sound2.gif) | 13.mp3 | 2022-05-16 03:16 | 2.3M | |
![[SND]](/icons/sound2.gif) | karma.mp3 | 2022-05-16 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | Guys.mp3 | 2022-05-16 03:12 | 0 | |
![[SND]](/icons/sound2.gif) | sidik.mp3 | 2022-05-16 03:12 | 2.5M | |
![[SND]](/icons/sound2.gif) | Mengkane.mp3 | 2022-05-16 03:10 | 0 | |
![[SND]](/icons/sound2.gif) | 12.mp3 | 2022-05-16 03:07 | 760K | |
![[SND]](/icons/sound2.gif) | WindahBasudara.mp3 | 2022-05-16 03:06 | 0 | |
![[SND]](/icons/sound2.gif) | ry1.mp3 | 2022-05-16 03:02 | 0 | |
![[SND]](/icons/sound2.gif) | ooc1.mp3 | 2022-05-16 03:01 | 0 | |
![[SND]](/icons/sound2.gif) | ngentod.mp3 | 2022-05-16 02:57 | 0 | |
![[SND]](/icons/sound2.gif) | living.mp3 | 2022-05-16 02:56 | 0 | |
![[SND]](/icons/sound2.gif) | kipas.mp3 | 2022-05-16 02:52 | 0 | |
![[SND]](/icons/sound2.gif) | bosan4.mp3 | 2022-05-16 02:52 | 48K | |
![[SND]](/icons/sound2.gif) | Dj1.mp3 | 2022-05-16 02:50 | 3.3M | |
![[SND]](/icons/sound2.gif) | Itel.mp3 | 2022-05-16 02:50 | 0 | |
![[SND]](/icons/sound2.gif) | Noah.mp3 | 2022-05-16 02:47 | 0 | |
![[SND]](/icons/sound2.gif) | bosan8.mp3 | 2022-05-16 02:40 | 0 | |
![[SND]](/icons/sound2.gif) | WhatsApp-Audio-2022-05-16-at-9.29.27-AM.mp3 | 2022-05-16 02:39 | 0 | |
![[SND]](/icons/sound2.gif) | bosan7.mp3 | 2022-05-16 02:39 | 0 | |
![[SND]](/icons/sound2.gif) | Hot_Chelle_Rae_Tonight_Tonight.mp3 | 2022-05-16 02:38 | 0 | |
![[SND]](/icons/sound2.gif) | bosan6.mp3 | 2022-05-16 02:38 | 0 | |
![[SND]](/icons/sound2.gif) | ndx.mp3 | 2022-05-16 02:38 | 3.8M | |
![[SND]](/icons/sound2.gif) | AMIGDALA_-_KU_KIRA_KAU_RUMAH_(LIRIK)(256k).mp3 | 2022-05-16 02:37 | 0 | |
![[SND]](/icons/sound2.gif) | bosan5.mp3 | 2022-05-16 02:37 | 0 | |
![[SND]](/icons/sound2.gif) | Novan2.mp3 | 2022-05-16 02:35 | 0 | |
![[SND]](/icons/sound2.gif) | matangv2.mp3 | 2022-05-16 02:32 | 0 | |
![[SND]](/icons/sound2.gif) | djmatang2.mp3 | 2022-05-16 02:30 | 0 | |
![[SND]](/icons/sound2.gif) | rudekiko.mp3 | 2022-05-16 02:28 | 0 | |
![[SND]](/icons/sound2.gif) | djmatang.mp3 | 2022-05-16 02:27 | 3.3M | |
![[SND]](/icons/sound2.gif) | 6rm5wh.mp3 | 2022-05-16 02:26 | 15M | |
![[SND]](/icons/sound2.gif) | S1MBA ft. DTG - Rover (Lyrics) pull up in a rover now she say she wanna come over (128K).mp3 | 2022-05-16 02:26 | 2.6M | |
![[SND]](/icons/sound2.gif) | tes.mp3 | 2022-05-16 02:24 | 37K | |
![[SND]](/icons/sound2.gif) | DAVE.mp3 | 2022-05-16 02:23 | 0 | |
![[SND]](/icons/sound2.gif) | record_audio_05-16-2022_05-10-15.mp3 | 2022-05-16 02:23 | 0 | |
![[SND]](/icons/sound2.gif) | ridz1.mp3 | 2022-05-16 02:19 | 0 | |
![[SND]](/icons/sound2.gif) | DMH.mp3 | 2022-05-16 02:10 | 2.8M | |
![[SND]](/icons/sound2.gif) | satap.mp3 | 2022-05-16 02:07 | 0 | |
![[SND]](/icons/sound2.gif) | gembelpasbek.mp3 | 2022-05-16 02:01 | 0 | |
![[SND]](/icons/sound2.gif) | paraparaan.mp3.mp3 | 2022-05-16 01:59 | 0 | |
![[SND]](/icons/sound2.gif) | Industrial.mp3 | 2022-05-16 01:57 | 0 | |
![[SND]](/icons/sound2.gif) | Mark.mp3 | 2022-05-16 01:56 | 656K | |
![[SND]](/icons/sound2.gif) | pano.mp3.mp3 | 2022-05-16 01:54 | 0 | |
![[SND]](/icons/sound2.gif) | lagi.mp3.mp3 | 2022-05-16 01:54 | 0 | |
![[SND]](/icons/sound2.gif) | Lo Ki.mp3 | 2022-05-16 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | Binibini.mp3.mp3 | 2022-05-16 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - nospread session with $ crosh $ (320 kbps).mp3 | 2022-05-16 01:51 | 0 | |
![[SND]](/icons/sound2.gif) | ffs.mp3 | 2022-05-16 01:50 | 0 | |
![[SND]](/icons/sound2.gif) | ye.mp3 | 2022-05-16 01:49 | 0 | |
![[SND]](/icons/sound2.gif) | fivem_4966874186425906012.mp3 | 2022-05-16 01:45 | 54M | |
![[SND]](/icons/sound2.gif) | NO12.mp3 | 2022-05-16 01:44 | 3.8M | |
![[SND]](/icons/sound2.gif) | D12.mp3 | 2022-05-16 01:43 | 1.8M | |
![[SND]](/icons/sound2.gif) | windah.mp3 | 2022-05-16 01:43 | 1.6M | |
![[SND]](/icons/sound2.gif) | Broker.mp3 | 2022-05-16 01:39 | 2.8M | |
![[SND]](/icons/sound2.gif) | asu.mp3 | 2022-05-16 01:29 | 6.6M | |
![[SND]](/icons/sound2.gif) | parjo.mp3 | 2022-05-16 01:28 | 3.1M | |
![[SND]](/icons/sound2.gif) | dirjo.mp3 | 2022-05-16 01:28 | 2.3M | |
![[SND]](/icons/sound2.gif) | Cover.mp3 | 2022-05-16 01:21 | 3.3M | |
![[SND]](/icons/sound2.gif) | ZRA.mp3 | 2022-05-16 01:19 | 3.1M | |
![[SND]](/icons/sound2.gif) | LDR.mp3 | 2022-05-16 01:11 | 3.3M | |
![[SND]](/icons/sound2.gif) | Dark_Souls_start_menu_sound_(getmp3.pro).mp3 | 2022-05-16 01:10 | 157K | |
![[SND]](/icons/sound2.gif) | ATMOSPHERIC_GOTHIC_HORROR_READING_M_(getmp3.pro).mp3 | 2022-05-16 01:06 | 2.5M | |
![[SND]](/icons/sound2.gif) | kane.mp3 | 2022-05-16 01:01 | 111K | |
![[SND]](/icons/sound2.gif) | ATMOSPHERIC_GOTHIC_HORROR_READING_M_(getmp3.pro)-[AudioTrimmer.com].mp3 | 2022-05-16 01:01 | 0 | |
![[SND]](/icons/sound2.gif) | fast.mp3 | 2022-05-16 00:56 | 3.0M | |
![[SND]](/icons/sound2.gif) | LaguCUKY2.mp3 | 2022-05-16 00:56 | 0 | |
![[SND]](/icons/sound2.gif) | Musik.mp3 | 2022-05-16 00:55 | 0 | |
![[SND]](/icons/sound2.gif) | nane.mp3 | 2022-05-16 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | Biggie1.mp3 | 2022-05-16 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | Terindah hidupku.mp3 | 2022-05-16 00:50 | 0 | |
![[SND]](/icons/sound2.gif) | Ndut55.mp3 | 2022-05-16 00:49 | 0 | |
![[SND]](/icons/sound2.gif) | WOA1.mp3 | 2022-05-16 00:47 | 0 | |
![[SND]](/icons/sound2.gif) | vp2.mp3 | 2022-05-16 00:46 | 2.6M | |
![[SND]](/icons/sound2.gif) | H12T.mp3 | 2022-05-16 00:46 | 0 | |
![[SND]](/icons/sound2.gif) | Turkish.mp3 | 2022-05-16 00:45 | 4.9M | |
![[SND]](/icons/sound2.gif) | dalamo.mp3 | 2022-05-16 00:41 | 5.1M | |
![[SND]](/icons/sound2.gif) | vongvong.mp3 | 2022-05-16 00:38 | 0 | |
![[SND]](/icons/sound2.gif) | อ๊อดแอด.mp3 | 2022-05-16 00:36 | 0 | |
![[SND]](/icons/sound2.gif) | Partty.mp3 | 2022-05-16 00:29 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik_1652634420231.mp3 | 2022-05-16 00:28 | 0 | |
![[SND]](/icons/sound2.gif) | pak.mp3 | 2022-05-16 00:23 | 0 | |
![[SND]](/icons/sound2.gif) | c812ef8bd9efb456cf726c724299ac24 (online-audio-converter.com).mp3 | 2022-05-16 00:22 | 0 | |
![[VID]](/icons/movie.gif) | c812ef8bd9efb456cf726c724299ac24.mp4 | 2022-05-16 00:10 | 940K | |
![[SND]](/icons/sound2.gif) | toxic.mp3 | 2022-05-16 00:09 | 3.9M | |
![[SND]](/icons/sound2.gif) | DJToxicFriendsxPargoyTikTokRemixTerbaru2021(DJCantikRemix).mp3 | 2022-05-16 00:07 | 3.9M | |
![[SND]](/icons/sound2.gif) | oyaju7.mp3 | 2022-05-16 00:00 | 0 | |
![[SND]](/icons/sound2.gif) | yes1212.mp3 | 2022-05-15 23:59 | 0 | |
![[SND]](/icons/sound2.gif) | VAGOS PUTO - Berlin ft. Laroi, Lil Tenxi, Paff (Prod by NG).mp3 | 2022-05-15 23:58 | 0 | |
![[SND]](/icons/sound2.gif) | Tavenchi - Spotlight.mp3 | 2022-05-15 23:56 | 0 | |
![[SND]](/icons/sound2.gif) | rasta.mp3 | 2022-05-15 23:55 | 0 | |
![[SND]](/icons/sound2.gif) | Punten.mp3 | 2022-05-15 23:55 | 0 | |
![[SND]](/icons/sound2.gif) | Vp.3.mp3 | 2022-05-15 23:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | rukunrasta.mp3 | 2022-05-15 23:50 | 0 | |
![[SND]](/icons/sound2.gif) | C1.mp3 | 2022-05-15 23:45 | 480K | |
![[SND]](/icons/sound2.gif) | Babym.mp3 | 2022-05-15 23:45 | 0 | |
![[SND]](/icons/sound2.gif) | C.mp3 | 2022-05-15 23:42 | 2.8M | |
![[SND]](/icons/sound2.gif) | Troye.mp3 | 2022-05-15 23:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | Feby Putri Celengan Rindu Fiersa Besari Cover .mp3 | 2022-05-15 23:28 | 0 | |
![[SND]](/icons/sound2.gif) | 22.mp3 | 2022-05-15 23:20 | 952K | |
![[SND]](/icons/sound2.gif) | S7.mp3 | 2022-05-15 23:20 | 0 | |
![[SND]](/icons/sound2.gif) | S6.mp3 | 2022-05-15 23:11 | 0 | |
![[SND]](/icons/sound2.gif) | S5.mp3 | 2022-05-15 23:08 | 0 | |
![[SND]](/icons/sound2.gif) | 6Mehmet_Fikri-Hulyasi.mp3 | 2022-05-15 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | Abdulaziz_Valse-Davet.mp3 | 2022-05-15 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | 5Murat_Vals-In.mp3 | 2022-05-15 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | 4Murat_Huseyni-Pesrev.mp3 | 2022-05-15 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | 3Selim_Sehnaz-Sarki.mp3 | 2022-05-15 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | 2Mahmud_Hicaz-Kalender.mp3 | 2022-05-15 23:06 | 2.1M | |
![[SND]](/icons/sound2.gif) | perindo.mp3 | 2022-05-15 23:06 | 2.1M | |
![[SND]](/icons/sound2.gif) | 1Mahmud_Ussak-Pesrev.mp3 | 2022-05-15 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | 2Bayezid_Evc-Saz-Semaisi.mp3 | 2022-05-15 23:05 | 0 | |
![[SND]](/icons/sound2.gif) | jony-the-limba-boss (1).mp3 | 2022-05-15 23:04 | 0 | |
![[SND]](/icons/sound2.gif) | jjk0.mp3 | 2022-05-15 23:02 | 0 | |
![[SND]](/icons/sound2.gif) | WhatsApp Audio 2022-05-14 at 2.44.47 AM.mp3 | 2022-05-15 23:00 | 0 | |
![[SND]](/icons/sound2.gif) | Aysun Taşçeşme - Vurmayın.mp3 | 2022-05-15 22:58 | 0 | |
![[SND]](/icons/sound2.gif) | hobba ses yüksek müzik.mp3 | 2022-05-15 22:54 | 0 | |
![[SND]](/icons/sound2.gif) | 1-mp3cutnet_8Yoju2yn (online-audio-converter.com).mp3 | 2022-05-15 22:54 | 0 | |
![[SND]](/icons/sound2.gif) | gruppa-moj-dvor-nayomnik-v-zelenom-berete_(zzz.fm).mp3 | 2022-05-15 22:51 | 4.6M | |
![[SND]](/icons/sound2.gif) | S4.mp3 | 2022-05-15 22:49 | 4.9M | |
![[SND]](/icons/sound2.gif) | wesele piosenka.mp3 | 2022-05-15 22:49 | 0 | |
![[SND]](/icons/sound2.gif) | Brawl Bro - Champions (in Brawl Stars).mp3 | 2022-05-15 22:49 | 0 | |
![[SND]](/icons/sound2.gif) | SALLAMA HAVASI.mp3 | 2022-05-15 22:45 | 0 | |
![[SND]](/icons/sound2.gif) | S3.mp3 | 2022-05-15 22:45 | 1.9M | |
![[SND]](/icons/sound2.gif) | Chika Dance Full Song -「Chikatto Chika Chika♡」by Chika Fujiwara.mp3 | 2022-05-15 22:42 | 0 | |
![[SND]](/icons/sound2.gif) | S0.mp3 | 2022-05-15 22:42 | 0 | |
![[SND]](/icons/sound2.gif) | S2.mp3 | 2022-05-15 22:37 | 2.5M | |
![[SND]](/icons/sound2.gif) | hobba orjin müzik.mp3 | 2022-05-15 22:37 | 920K | |
![[SND]](/icons/sound2.gif) | sige.mp3 | 2022-05-15 22:35 | 3.5M | |
![[SND]](/icons/sound2.gif) | anees.mp3 | 2022-05-15 22:34 | 3.9M | |
![[SND]](/icons/sound2.gif) | V1.mp3 | 2022-05-15 22:29 | 0 | |
![[SND]](/icons/sound2.gif) | S1.mp3 | 2022-05-15 22:28 | 2.3M | |
![[SND]](/icons/sound2.gif) | magical_forest_-8154669087811352120.mp3 | 2022-05-15 22:21 | 96K | |
![[SND]](/icons/sound2.gif) | S.mp3 | 2022-05-15 22:21 | 2.8M | |
![[SND]](/icons/sound2.gif) | Alien Isolation - End Credits (128 kbps).mp3 | 2022-05-15 22:17 | 3.1M | |
![[SND]](/icons/sound2.gif) | V.mp3 | 2022-05-15 22:16 | 1.3M | |
![[VID]](/icons/movie.gif) | Song of the South (Rasict).mp4 | 2022-05-15 22:09 | 0 | |
![[SND]](/icons/sound2.gif) | Omo_Ebira_Mandykiss_Vs_Dj_ummie_Cruise_Beat[1].mp3 | 2022-05-15 22:00 | 0 | |
![[SND]](/icons/sound2.gif) | Dzharakhov_-_YA_v_momente_73039335.mp3 | 2022-05-15 21:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Danza del Osos (1).mp3 | 2022-05-15 21:50 | 0 | |
![[SND]](/icons/sound2.gif) | Teriyaki Boyz — Tokyo Drift (Fast & Furious).mp3 | 2022-05-15 21:43 | 0 | |
![[SND]](/icons/sound2.gif) | Vj.mp3 | 2022-05-15 21:42 | 0 | |
![[SND]](/icons/sound2.gif) | pala.mp3.mp3 | 2022-05-15 21:39 | 0 | |
![[SND]](/icons/sound2.gif) | nay1.mp3 | 2022-05-15 21:38 | 0 | |
![[SND]](/icons/sound2.gif) | y (mp3cut.net).mp3 | 2022-05-15 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | sat5.mp3 | 2022-05-15 21:31 | 0 | |
![[SND]](/icons/sound2.gif) | ayub.mp3 | 2022-05-15 21:30 | 0 | |
![[SND]](/icons/sound2.gif) | zapomnu_kogura_.mp3 | 2022-05-15 21:28 | 0 | |
![[SND]](/icons/sound2.gif) | samurai-japanese-lofi-hiphop-mix.mp3 | 2022-05-15 21:15 | 1.7M | |
![[SND]](/icons/sound2.gif) | dika.mp3 | 2022-05-15 21:04 | 2.9M | |
![[SND]](/icons/sound2.gif) | OVERDO$E.mp3 | 2022-05-15 21:03 | 0 | |
![[SND]](/icons/sound2.gif) | Linkin Park - In The End (HQ Audio) (256 kbps).mp3 | 2022-05-15 20:59 | 0 | |
![[SND]](/icons/sound2.gif) | ndik.mp3 | 2022-05-15 20:58 | 0 | |
![[SND]](/icons/sound2.gif) | 36.mp3 | 2022-05-15 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | KALUSH_Skofka_Dodomu_The_Faino_Remix.mp3 | 2022-05-15 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | zapomni-kozhura-mp3.mp3 | 2022-05-15 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | Nizkiz_-_Introvert_(musmore.com).mp3 | 2022-05-15 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | Ccc.mp3 | 2022-05-15 20:55 | 2.9M | |
![[SND]](/icons/sound2.gif) | Бутырка - Запахло Весной.mp3 | 2022-05-15 20:52 | 0 | |
![[SND]](/icons/sound2.gif) | ✵Блатная походка бандит✵ - ✵Блатная походка бандит✵.mp3 | 2022-05-15 20:50 | 0 | |
![[SND]](/icons/sound2.gif) | Skrip(1).mp3 | 2022-05-15 20:44 | 0 | |
![[SND]](/icons/sound2.gif) | _From Now On We Are Enemies_.mp3 | 2022-05-15 20:41 | 0 | |
![[SND]](/icons/sound2.gif) | s1.mp3 | 2022-05-15 20:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | Library of Ruina BGM - Theme 02.mp3 | 2022-05-15 20:37 | 0 | |
![[SND]](/icons/sound2.gif) | udin.mp3 | 2022-05-15 20:35 | 1.2M | |
![[SND]](/icons/sound2.gif) | Preview noboi.mp3 | 2022-05-15 20:24 | 0 | |
![[SND]](/icons/sound2.gif) | Excision X Wooli - Lockdown VIP EDIT THING IDK.mp3 | 2022-05-15 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | Sufjan_Stevens_-_Fourth_of_July_(musmore.com).mp3 | 2022-05-15 20:20 | 0 | |
![[SND]](/icons/sound2.gif) | 3000m - Fallen Down (t9music.ru).mp3 | 2022-05-15 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | Boom.mp3 | 2022-05-15 20:15 | 0 | |
![[SND]](/icons/sound2.gif) | Sufjan_Stevens_-_Fourth_of_July_67276263.mp3 | 2022-05-15 20:14 | 3.4M | |
![[SND]](/icons/sound2.gif) | Vendetta - Лепит нас (radio.lol).mp3 | 2022-05-15 20:11 | 3.7M | |
![[SND]](/icons/sound2.gif) | ngeso1.mp3 | 2022-05-15 20:09 | 3.2M | |
![[SND]](/icons/sound2.gif) | ngeso2.mp3 | 2022-05-15 20:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | СОЛДАТЫ - Здравствуй fisting в облаках, dungeon master в сапогах (mp3-2020.com) (1).mp3 | 2022-05-15 20:08 | 2.8M | |
![[SND]](/icons/sound2.gif) | Нурминский - За 105 двор.mp3 | 2022-05-15 20:06 | 6.8M | |
![[SND]](/icons/sound2.gif) | HEJOBOYS.mp3 | 2022-05-15 20:06 | 2.0M | |
![[SND]](/icons/sound2.gif) | Mary_(getmp3.pro).mp3 | 2022-05-15 20:04 | 0 | |
![[SND]](/icons/sound2.gif) | Xcho_-_Ty_i_YA_73979894.mp3 | 2022-05-15 19:56 | 0 | |
![[SND]](/icons/sound2.gif) | AF555.mp3 | 2022-05-15 19:55 | 1.6M | |
![[SND]](/icons/sound2.gif) | AF556.mp3 | 2022-05-15 19:55 | 0 | |
![[SND]](/icons/sound2.gif) | c.mp3 | 2022-05-15 19:51 | 1.3M | |
![[SND]](/icons/sound2.gif) | HEJO.mp3 | 2022-05-15 19:47 | 2.5M | |
![[SND]](/icons/sound2.gif) | y.mp3 | 2022-05-15 19:38 | 1.2M | |
![[SND]](/icons/sound2.gif) | d1.mp3 | 2022-05-15 19:28 | 3.6M | |
![[SND]](/icons/sound2.gif) | FinikFinya_ALEKS_ATAMAN_-_Dialogi_tet-a-tet_73193667.mp3 | 2022-05-15 19:27 | 6.9M | |
![[SND]](/icons/sound2.gif) | 1632744243068_1632054268_instasamka-lipsi-ha.mp3 | 2022-05-15 19:23 | 0 | |
![[SND]](/icons/sound2.gif) | cavbella.mp3 | 2022-05-15 19:23 | 0 | |
![[SND]](/icons/sound2.gif) | çavbella orjinal.mp3 | 2022-05-15 19:21 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Moja rodzina (128 kbps) (1).mp3 | 2022-05-15 19:18 | 0 | |
![[SND]](/icons/sound2.gif) | GAYAZOV_BROTHER_-_Uvezite_menya_na_Dip-khaus_66849050.mp3 | 2022-05-15 19:16 | 0 | |
![[SND]](/icons/sound2.gif) | raikaho-tuman-mp3.mp3 | 2022-05-15 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | TEST.mp3 | 2022-05-15 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Moja rodzina (128 kbps).mp3 | 2022-05-15 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | La belva.mp3 | 2022-05-15 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | Gdzl.mp3 | 2022-05-15 19:12 | 676K | |
![[SND]](/icons/sound2.gif) | yt1s.io - Piosenka o rodzinie (128 kbps).mp3 | 2022-05-15 19:12 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Piosenka - Rodzina (128 kbps).mp3 | 2022-05-15 19:10 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Piosenka - Moja wesoła rodzinka (128 kbps).mp3 | 2022-05-15 19:07 | 0 | |
![[SND]](/icons/sound2.gif) | Tutututititu (Tutu) Remix - Camilo, Shakira, Pedro Capó - Alma Zarza Cover _ Nhạc Hot Trend Tik Tok (256 kbps).mp3 | 2022-05-15 19:05 | 0 | |
![[SND]](/icons/sound2.gif) | takeru.mp3 | 2022-05-15 18:59 | 0 | |
![[SND]](/icons/sound2.gif) | ajas16.mp3 | 2022-05-15 18:56 | 0 | |
![[SND]](/icons/sound2.gif) | ajas15.mp3 | 2022-05-15 18:56 | 0 | |
![[SND]](/icons/sound2.gif) | Boney M. - Rasputin (12' Mix).mp3 | 2022-05-15 18:55 | 4.4M | |
![[SND]](/icons/sound2.gif) | Godisgood.mp3 | 2022-05-15 18:54 | 2.5M | |
![[SND]](/icons/sound2.gif) | takeru9.mp3 | 2022-05-15 18:53 | 7.0M | |
![[SND]](/icons/sound2.gif) | sound.mp3 | 2022-05-15 18:49 | 381K | |
![[SND]](/icons/sound2.gif) | UW.mp3 | 2022-05-15 18:48 | 5.7M | |
![[SND]](/icons/sound2.gif) | video_2022-05-15_13-42-19.mp3 | 2022-05-15 18:48 | 653K | |
![[SND]](/icons/sound2.gif) | X2Download.com - Valhalla Calling (Metal Version) (128 kbps).mp3 | 2022-05-15 18:46 | 3.5M | |
![[SND]](/icons/sound2.gif) | a1_describingpeople.mp3 | 2022-05-15 18:46 | 1.5M | |
![[SND]](/icons/sound2.gif) | wahyu.mp3 | 2022-05-15 18:44 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Hal Hebat Govinda cover by raffaaffar .mp3 | 2022-05-15 18:44 | 0 | |
![[SND]](/icons/sound2.gif) | FLORIN SALAM - CAP SI PAJURA.mp3 | 2022-05-15 18:41 | 0 | |
![[SND]](/icons/sound2.gif) | ajna-getagazova-eza-alal-hajn.mp3 | 2022-05-15 18:38 | 0 | |
![[SND]](/icons/sound2.gif) | jJjKk0.mp3 | 2022-05-15 18:37 | 0 | |
![[SND]](/icons/sound2.gif) | AsoD3h.mp3 | 2022-05-15 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | jJJkk0.mp3 | 2022-05-15 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | daddy.mp3 | 2022-05-15 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2matecom-french-montana-ft-swae.mp3 | 2022-05-15 18:27 | 0 | |
![[SND]](/icons/sound2.gif) | eza-alal-soyga-ayna-gatagazeva.mp3 | 2022-05-15 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | Coffin EDM, The Nightcore - Heat Waves (8D Slowed).mp3 | 2022-05-15 18:23 | 0 | |
![[SND]](/icons/sound2.gif) | ramjr2.mp3 | 2022-05-15 18:23 | 0 | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN__Eldjei_-_Cadillac_(right_version)_Gachi_Remix.mp3 | 2022-05-15 18:23 | 2.4M | |
![[SND]](/icons/sound2.gif) | DW.mp3 | 2022-05-15 18:23 | 3.6M | |
![[SND]](/icons/sound2.gif) | takeru8.mp3 | 2022-05-15 18:22 | 2.8M | |
![[SND]](/icons/sound2.gif) | bosan3.mp3 | 2022-05-15 18:22 | 7.0M | |
![[SND]](/icons/sound2.gif) | shajip2.mp3 | 2022-05-15 18:21 | 450K | |
![[SND]](/icons/sound2.gif) | takeru3.mp3 | 2022-05-15 18:21 | 2.6M | |
![[SND]](/icons/sound2.gif) | bosan2.mp3 | 2022-05-15 18:21 | 6.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Amma ee lokathil ulla ella swarnavum njan Ammak kond tharum (2).mp3 | 2022-05-15 18:20 | 450K | |
![[SND]](/icons/sound2.gif) | takeru2.mp3 | 2022-05-15 18:20 | 2.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Amma ee lokathil ulla ella swarnavum njan Ammak kond tharum (1) (1).mp3 | 2022-05-15 18:17 | 0 | |
![[SND]](/icons/sound2.gif) | DT.mp3 | 2022-05-15 18:17 | 3.3M | |
![[SND]](/icons/sound2.gif) | Amma ee lokathil ulla ella swarnavum njan Ammak kond tharum.mp3 | 2022-05-15 18:16 | 0 | |
![[SND]](/icons/sound2.gif) | y2matecom-Amma-ee-lokathil-ulla (2).mp3 | 2022-05-15 18:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2matecom-Amma-ee-lokathil-ulla (1).mp3 | 2022-05-15 18:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Amma ee lokathil ulla ella swarnavum njan Ammak kond tharum (1).mp3 | 2022-05-15 18:12 | 0 | |
![[SND]](/icons/sound2.gif) | y2matecom-Amma-ee-lokathil-ulla.mp3 | 2022-05-15 18:11 | 0 | |
![[SND]](/icons/sound2.gif) | kk.mp3 | 2022-05-15 18:11 | 2.6M | |
![[SND]](/icons/sound2.gif) | dion8.mp3 | 2022-05-15 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | dion7.mp3 | 2022-05-15 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | dion6.mp3 | 2022-05-15 18:08 | 0 | |
![[SND]](/icons/sound2.gif) | CV.mp3 | 2022-05-15 18:08 | 80K | |
![[SND]](/icons/sound2.gif) | dion5.mp3 | 2022-05-15 18:08 | 0 | |
![[SND]](/icons/sound2.gif) | dion4.mp3 | 2022-05-15 18:07 | 0 | |
![[SND]](/icons/sound2.gif) | dion3.mp3 | 2022-05-15 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | Ганвест - В сигаретных пачках.mp3 | 2022-05-15 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | Rauf & Faik - LUV.mp3 | 2022-05-15 18:04 | 1.4M | |
![[SND]](/icons/sound2.gif) | Shadowraze, babyswishh1 - psiblades.mp3 | 2022-05-15 18:04 | 5.0M | |
![[SND]](/icons/sound2.gif) | instasamka-i-chtoe-mp3.mp3 | 2022-05-15 18:04 | 4.4M | |
![[SND]](/icons/sound2.gif) | inbound5446998501457208982.mp3 | 2022-05-15 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | ostap-parfenov-ty-ne-koroleva-girl-version.mp3 | 2022-05-15 18:00 | 0 | |
![[SND]](/icons/sound2.gif) | Ostap_Parfjonov_Nvkrn134_-_TY_NE_KOROLEVA_73871542.mp3 | 2022-05-15 17:59 | 0 | |
![[SND]](/icons/sound2.gif) | BES.mp3 | 2022-05-15 17:56 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_-_astral_step_(musmore.com).mp3 | 2022-05-15 17:56 | 4.7M | |
![[SND]](/icons/sound2.gif) | footstep-sound-effects-walking-sound-effect 2.mp3 | 2022-05-15 17:55 | 0 | |
![[SND]](/icons/sound2.gif) | MAX.mp3 | 2022-05-15 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | A ROCKET TO THE MOON - GAVIN.D 「Official MV」.mp3 | 2022-05-15 17:53 | 0 | |
![[SND]](/icons/sound2.gif) | ฉบับปรับปรุง.mp3 | 2022-05-15 17:53 | 0 | |
![[SND]](/icons/sound2.gif) | A Universal Time — STWR Pose Music (www.lightaudio.ru) (6).mp3 | 2022-05-15 17:51 | 0 | |
![[SND]](/icons/sound2.gif) | jepri1.mp3 | 2022-05-15 17:51 | 0 | |
![[SND]](/icons/sound2.gif) | GHOSTEMANE - D(r)ead.mp3 | 2022-05-15 17:48 | 0 | |
![[SND]](/icons/sound2.gif) | playoff.mp3 | 2022-05-15 17:46 | 0 | |
![[SND]](/icons/sound2.gif) | zen34.mp3 | 2022-05-15 17:44 | 0 | |
![[SND]](/icons/sound2.gif) | zen33.mp3 | 2022-05-15 17:42 | 456K | |
![[SND]](/icons/sound2.gif) | Darkside.mp3 | 2022-05-15 17:31 | 0 | |
![[SND]](/icons/sound2.gif) | CB2.mp3 | 2022-05-15 17:31 | 3.9M | |
![[SND]](/icons/sound2.gif) | CB4.mp3 | 2022-05-15 17:30 | 1.5M | |
![[SND]](/icons/sound2.gif) | AK11.mp3 | 2022-05-15 17:30 | 0 | |
![[SND]](/icons/sound2.gif) | dion2.mp3 | 2022-05-15 17:30 | 0 | |
![[SND]](/icons/sound2.gif) | AK10.mp3 | 2022-05-15 17:30 | 0 | |
![[SND]](/icons/sound2.gif) | AK9.mp3 | 2022-05-15 17:29 | 0 | |
![[SND]](/icons/sound2.gif) | AK8.mp3 | 2022-05-15 17:29 | 0 | |
![[SND]](/icons/sound2.gif) | Ye.mp3 | 2022-05-15 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | 33 Встреча с Такхизис.mp3 | 2022-05-15 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | oper-style-sll.mp3 | 2022-05-15 17:22 | 0 | |
![[SND]](/icons/sound2.gif) | ᴏᴘᴇʀ sᴛʏʟᴇ.🏴(1471).mp3 | 2022-05-15 17:19 | 0 | |
![[SND]](/icons/sound2.gif) | ᴏᴘᴇʀ sᴛʏʟᴇ 500.🏴 (425).mp3 | 2022-05-15 17:19 | 0 | |
![[SND]](/icons/sound2.gif) | ᴏᴘᴇʀ sᴛʏʟᴇ 500.🏴 (90).mp3 | 2022-05-15 17:18 | 0 | |
![[SND]](/icons/sound2.gif) | siynabargoshkerchov.mp3 | 2022-05-15 17:17 | 0 | |
![[SND]](/icons/sound2.gif) | cid.mp3 | 2022-05-15 17:17 | 0 | |
![[SND]](/icons/sound2.gif) | ar.mp3 | 2022-05-15 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | 4_6010346297372974278.mp3 | 2022-05-15 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | WPP.mp3 | 2022-05-15 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | soloman2.mp3 | 2022-05-15 17:15 | 0 | |
![[SND]](/icons/sound2.gif) | Alone.mp3 | 2022-05-15 17:15 | 2.5M | |
![[SND]](/icons/sound2.gif) | รวมเพลงเพราะๆ.mp3 | 2022-05-15 17:13 | 0 | |
![[SND]](/icons/sound2.gif) | aa.mp3 | 2022-05-15 17:13 | 1.3M | |
![[SND]](/icons/sound2.gif) | sushi.mp3 | 2022-05-15 17:11 | 0 | |
![[SND]](/icons/sound2.gif) | Pipin.mp3 | 2022-05-15 17:10 | 0 | |
![[SND]](/icons/sound2.gif) | Angels - The Road To Evil.mp3 | 2022-05-15 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | dj kkn.mp3 | 2022-05-15 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | Alone1.mp3 | 2022-05-15 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | ll.mp3 | 2022-05-15 17:05 | 0 | |
![[SND]](/icons/sound2.gif) | ss13ambience_signal.mp3 | 2022-05-15 17:04 | 0 | |
![[SND]](/icons/sound2.gif) | เพลงแดนซ์.mp3 | 2022-05-15 17:03 | 3.0M | |
![[SND]](/icons/sound2.gif) | s3.mp3 | 2022-05-15 17:03 | 19M | |
![[SND]](/icons/sound2.gif) | Alone2.mp3 | 2022-05-15 17:02 | 0 | |
![[SND]](/icons/sound2.gif) | JANTHE.mp3 | 2022-05-15 17:01 | 0 | |
![[SND]](/icons/sound2.gif) | My g.mp3 | 2022-05-15 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | 2.mp3 | 2022-05-15 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | NEW.mp3 | 2022-05-15 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | Shadowraze, GENJUTSU - 1000-7.mp3 | 2022-05-15 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu Jorok Baon Cikadap.mp3 | 2022-05-15 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | Dark.mp3 | 2022-05-15 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | after dark.mp3 | 2022-05-15 16:57 | 0 | |
![[SND]](/icons/sound2.gif) | s2.mp3 | 2022-05-15 16:57 | 2.6M | |
![[SND]](/icons/sound2.gif) | ssstik_1652633543175.mp3 | 2022-05-15 16:56 | 0 | |
![[SND]](/icons/sound2.gif) | Vass20.mp3 | 2022-05-15 16:55 | 0 | |
![[SND]](/icons/sound2.gif) | remix.mp3 | 2022-05-15 16:55 | 568K | |
![[SND]](/icons/sound2.gif) | HBD.mp3 | 2022-05-15 16:55 | 3.5M | |
![[SND]](/icons/sound2.gif) | Vass10.mp3 | 2022-05-15 16:55 | 0 | |
![[SND]](/icons/sound2.gif) | Vass6.mp3 | 2022-05-15 16:55 | 0 | |
![[SND]](/icons/sound2.gif) | ck3.mp3 | 2022-05-15 16:55 | 0 | |
![[SND]](/icons/sound2.gif) | Vass5.mp3 | 2022-05-15 16:54 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1651665985478.mp3 | 2022-05-15 16:54 | 0 | |
![[SND]](/icons/sound2.gif) | Zion_Y_Lennox_Daddy_Yankee__Yo_Voy.mp3 | 2022-05-15 16:54 | 0 | |
![[SND]](/icons/sound2.gif) | Vass4.mp3 | 2022-05-15 16:54 | 0 | |
![[SND]](/icons/sound2.gif) | ss.mp3 | 2022-05-15 16:54 | 1.8M | |
![[SND]](/icons/sound2.gif) | Vass2.mp3 | 2022-05-15 16:54 | 0 | |
![[SND]](/icons/sound2.gif) | Zion Y Lennox, Daddy Yankee - Yo Voy.mp3 | 2022-05-15 16:53 | 0 | |
![[SND]](/icons/sound2.gif) | Bima Tarore - Selamat Ulang Tahun.mp3 | 2022-05-15 16:51 | 3.7M | |
![[VID]](/icons/movie.gif) | VID-20220513-WA0014.mp4 | 2022-05-15 16:48 | 0 | |
![[SND]](/icons/sound2.gif) | Maman.mp3 | 2022-05-15 16:46 | 0 | |
![[SND]](/icons/sound2.gif) | wel.mp3 | 2022-05-15 16:45 | 0 | |
![[SND]](/icons/sound2.gif) | bosan.mp3 | 2022-05-15 16:44 | 2.1M | |
![[SND]](/icons/sound2.gif) | MyHAR.mp3 | 2022-05-15 16:44 | 0 | |
![[SND]](/icons/sound2.gif) | memew.mp3 | 2022-05-15 16:42 | 0 | |
![[SND]](/icons/sound2.gif) | pesnya-pust-kartochnyj-moj-dom-netu-tachki-za-oknom.mp3 | 2022-05-15 16:42 | 0 | |
![[SND]](/icons/sound2.gif) | 私DIMA7IK. ТОЛЬКО ТЫ И Я.mp3 | 2022-05-15 16:42 | 0 | |
![[SND]](/icons/sound2.gif) | 33.mp3 | 2022-05-15 16:41 | 2.6M | |
![[SND]](/icons/sound2.gif) | aleks_ataman_-_devochka_banditka_(feat._finik.finya)_muzati.net.mp3 | 2022-05-15 16:40 | 0 | |
![[SND]](/icons/sound2.gif) | ATELLWULF - Перезвоню.mp3 | 2022-05-15 16:39 | 0 | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN - Номер.mp3 | 2022-05-15 16:38 | 4.5M | |
![[SND]](/icons/sound2.gif) | MON.mp3 | 2022-05-15 16:38 | 0 | |
![[SND]](/icons/sound2.gif) | DVRST - Autumn Wind.mp3 | 2022-05-15 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | Feluda Bombaiyer Bombete Satyajit Ray Mirchi Bangla.mp3 | 2022-05-15 16:36 | 0 | |
![[SND]](/icons/sound2.gif) | o10.mp3 | 2022-05-15 16:32 | 0 | |
![[SND]](/icons/sound2.gif) | รวมเพลงเศร้าในแอพTikTok.mp3 | 2022-05-15 16:31 | 600K | |
![[SND]](/icons/sound2.gif) | rel18.mp3 | 2022-05-15 16:30 | 2.8M | |
![[SND]](/icons/sound2.gif) | KK.mp3 | 2022-05-15 16:30 | 3.2M | |
![[SND]](/icons/sound2.gif) | bitch oten.mp3 | 2022-05-15 16:30 | 0 | |
![[SND]](/icons/sound2.gif) | รวมเพลงเศร้า.mp3 | 2022-05-15 16:28 | 776K | |
![[SND]](/icons/sound2.gif) | rel14.mp3 | 2022-05-15 16:27 | 2.2M | |
![[SND]](/icons/sound2.gif) | Lagu Selamat Ulang Tahun Kristen (Selamat Ulang Tahun covered by UKM POMK FKM USU) Lyric Video.mp3 | 2022-05-15 16:27 | 0 | |
![[SND]](/icons/sound2.gif) | Самолет - Время придет.mp3 | 2022-05-15 16:27 | 0 | |
![[SND]](/icons/sound2.gif) | $uicideboy$ - LTE.mp3 | 2022-05-15 16:26 | 0 | |
![[SND]](/icons/sound2.gif) | $uicideboy$ - Paris.mp3 | 2022-05-15 16:26 | 0 | |
![[SND]](/icons/sound2.gif) | lumutv2.mp3 | 2022-05-15 16:22 | 0 | |
![[SND]](/icons/sound2.gif) | Groove.mp3 | 2022-05-15 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | KKK.mp3 | 2022-05-15 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | lumut.mp3 | 2022-05-15 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | welp.mp3 | 2022-05-15 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | musikultah.mp3 | 2022-05-15 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | getupjawani.mp3 | 2022-05-15 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | manalitrance.mp3 | 2022-05-15 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | bichugang.mp3 | 2022-05-15 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | fnf.mp3 | 2022-05-15 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | yellowgang.mp3 | 2022-05-15 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | 1.mp3 | 2022-05-15 16:13 | 380K | |
![[SND]](/icons/sound2.gif) | djloce.mp3 | 2022-05-15 16:13 | 0 | |
![[SND]](/icons/sound2.gif) | zrkdjliving.mp3 | 2022-05-15 16:12 | 0 | |
![[SND]](/icons/sound2.gif) | oi.mp3 | 2022-05-15 16:10 | 2.0M | |
![[SND]](/icons/sound2.gif) | AST.mp3 | 2022-05-15 16:10 | 7.3M | |
![[SND]](/icons/sound2.gif) | MrKitty_-_After_Dark_(getmp3.pro) (1).mp3 | 2022-05-15 16:09 | 8.5M | |
![[SND]](/icons/sound2.gif) | miracle.mp3 | 2022-05-15 16:08 | 12M | |
![[SND]](/icons/sound2.gif) | FLASHEDUP----BY-----DUDE---OP--PASOORI-----------------------------------------BEAT-----OP---BEASTOPBY-----DUDE---OP.mp3 | 2022-05-15 16:04 | 3.5M | |
![[SND]](/icons/sound2.gif) | Biw.mp3 | 2022-05-15 16:04 | 3.3M | |
![[SND]](/icons/sound2.gif) | LDA.mp3 | 2022-05-15 16:01 | 9.6M | |
![[SND]](/icons/sound2.gif) | Bubbly.mp3 | 2022-05-15 16:01 | 3.0M | |
![[SND]](/icons/sound2.gif) | wwa.mp3 | 2022-05-15 16:00 | 6.5M | |
![[SND]](/icons/sound2.gif) | EasyOnMe.mp3.mp3 | 2022-05-15 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - suara ah ah ah ah (128 kbps).mp3 | 2022-05-15 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | DC.mp3 | 2022-05-15 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | heresyourperfect.mp3 | 2022-05-15 15:53 | 0 | |
![[SND]](/icons/sound2.gif) | OK.mp3 | 2022-05-15 15:52 | 2.7M | |
![[SND]](/icons/sound2.gif) | EasyOnMe.mp3 | 2022-05-15 15:48 | 0 | |
![[SND]](/icons/sound2.gif) | sant3.mp3 | 2022-05-15 15:48 | 0 | |
![[SND]](/icons/sound2.gif) | psy-ganji-feat-jessi-performance-video.mp3 | 2022-05-15 15:47 | 0 | |
![[SND]](/icons/sound2.gif) | ЛОКДАУН - MUTI, ТАТАРИН.mp3 | 2022-05-15 15:46 | 0 | |
![[SND]](/icons/sound2.gif) | Sage_The_Gemini_-_Gas_Pedal_(Suprafive_Remix).mp3 | 2022-05-15 15:44 | 0 | |
![[SND]](/icons/sound2.gif) | Walang tayo lyrics Flow G ft Bosx1ne(MP3_128K).mp3 | 2022-05-15 15:43 | 0 | |
![[SND]](/icons/sound2.gif) | memek.mp3 | 2022-05-15 15:43 | 700K | |
![[SND]](/icons/sound2.gif) | Bulat_Sahapov_-_RUSSIAN_CLUB_MIX_(vers._02).mp3 | 2022-05-15 15:41 | 0 | |
![[SND]](/icons/sound2.gif) | bosok.mp3 | 2022-05-15 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | Wild_West.mp3 | 2022-05-15 15:39 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Madison Beer Selfish Alan Walker Remix Jack Benjamin Edit_v144P.mp4 | 2022-05-15 15:37 | 0 | |
![[SND]](/icons/sound2.gif) | recording.mp3 | 2022-05-15 15:35 | 64K | |
![[SND]](/icons/sound2.gif) | Back of the Room Hang — Jingle Punks — мрачная мелодия.mp3 | 2022-05-15 15:35 | 0 | |
![[SND]](/icons/sound2.gif) | Dj the river.mp3 | 2022-05-15 15:31 | 0 | |
![[SND]](/icons/sound2.gif) | Mahen - LDR (Official Music Video).mp3 | 2022-05-15 15:30 | 4.7M | |
![[SND]](/icons/sound2.gif) | dg.mp3 | 2022-05-15 15:29 | 4.3M | |
![[SND]](/icons/sound2.gif) | joby31.mp3 | 2022-05-15 15:28 | 0 | |
![[SND]](/icons/sound2.gif) | haru.mp3 | 2022-05-15 15:27 | 792K | |
![[SND]](/icons/sound2.gif) | regea1.mp3 | 2022-05-15 15:26 | 4.1M | |
![[SND]](/icons/sound2.gif) | TIKTOK.mp3 | 2022-05-15 15:24 | 2.7M | |
![[SND]](/icons/sound2.gif) | Jamal.mp3 | 2022-05-15 15:22 | 2.1M | |
![[SND]](/icons/sound2.gif) | รวมเพลงแดนซ์.mp3 | 2022-05-15 15:20 | 54M | |
![[SND]](/icons/sound2.gif) | Diablo I & II Soundtrack - Tristram Village.mp3 | 2022-05-15 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | sephirothrain (2).mp3 | 2022-05-15 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | KKidolrain (2).mp3 | 2022-05-15 15:18 | 0 | |
![[SND]](/icons/sound2.gif) | Imnul_orasului_Chisinau_(getmp3.pro).mp3 | 2022-05-15 15:14 | 4.5M | |
![[SND]](/icons/sound2.gif) | vie.mp3 | 2022-05-15 15:14 | 6.5M | |
![[SND]](/icons/sound2.gif) | forme.mp3 | 2022-05-15 15:13 | 7.1M | |
![[SND]](/icons/sound2.gif) | rusher.mp3 | 2022-05-15 15:13 | 7.6M | |
![[SND]](/icons/sound2.gif) | dingin.mp3 | 2022-05-15 15:12 | 7.1M | |
![[SND]](/icons/sound2.gif) | pak_vong.mp3 | 2022-05-15 15:11 | 6.6M | |
![[SND]](/icons/sound2.gif) | Vp5.mp3 | 2022-05-15 15:11 | 2.4M | |
![[SND]](/icons/sound2.gif) | Mahalini - Kisah Sempurna.mp3 | 2022-05-15 15:06 | 1.2M | |
![[SND]](/icons/sound2.gif) | mn.mp3 | 2022-05-15 15:04 | 2.8M | |
![[SND]](/icons/sound2.gif) | Pak_Wong.mp3 | 2022-05-15 15:03 | 0 | |
![[SND]](/icons/sound2.gif) | cinta sampai mati.mp3 | 2022-05-15 15:02 | 0 | |
![[SND]](/icons/sound2.gif) | Recording_20.m4a | 2022-05-15 14:58 | 0 | |
![[SND]](/icons/sound2.gif) | zz.mp3 | 2022-05-15 14:57 | 1.3M | |
![[SND]](/icons/sound2.gif) | KKidolrain.mp3 | 2022-05-15 14:57 | 0 | |
![[SND]](/icons/sound2.gif) | KAIKAIKITAN (osanime.com).mp3 | 2022-05-15 14:57 | 0 | |
![[SND]](/icons/sound2.gif) | putaenamol.mp3 | 2022-05-15 14:56 | 0 | |
![[SND]](/icons/sound2.gif) | KNY.mp3 | 2022-05-15 14:56 | 0 | |
![[SND]](/icons/sound2.gif) | Demon Slayer_ Kimetsu no Yaiba - EP 19 Song『Kamado Tanjiro no Uta』.mp3 | 2022-05-15 14:55 | 2.1M | |
![[SND]](/icons/sound2.gif) | Kangen Band - Cinta Sampai Mati (Official Music Video).mp3 | 2022-05-15 14:54 | 3.5M | |
![[SND]](/icons/sound2.gif) | STORY WA 15 DETIK CINTA SAMPAI MATI COVER RAFFAAFFAR.mp3 | 2022-05-15 14:52 | 0 | |
![[SND]](/icons/sound2.gif) | FiveM.mp3 | 2022-05-15 14:49 | 42M | |
![[SND]](/icons/sound2.gif) | wong.mp3 | 2022-05-15 14:48 | 0 | |
![[SND]](/icons/sound2.gif) | KAITO & MEIKO — on the rocks (www.lightaudio.ru) (1).mp3 | 2022-05-15 14:48 | 0 | |
![[SND]](/icons/sound2.gif) | รวม.mp3 | 2022-05-15 14:46 | 0 | |
![[SND]](/icons/sound2.gif) | Ren1.mp3 | 2022-05-15 14:45 | 0 | |
![[SND]](/icons/sound2.gif) | Ren1.m4a | 2022-05-15 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | vp1.mp3 | 2022-05-15 14:42 | 0 | |
![[SND]](/icons/sound2.gif) | Kangen Band - CSM.mp3 | 2022-05-15 14:39 | 0 | |
![[SND]](/icons/sound2.gif) | yaukoshi_-_konchitsya_leto_(feat._lxst_cxntury__coy)_muzati.net.mp3 | 2022-05-15 14:38 | 6.4M | |
![[SND]](/icons/sound2.gif) | MACAN_-_YA_pytalsya_lyubit_tebya_72487944.mp3 | 2022-05-15 14:38 | 0 | |
![[SND]](/icons/sound2.gif) | ZippO_-_Tonirovka_72849344.mp3 | 2022-05-15 14:38 | 0 | |
![[SND]](/icons/sound2.gif) | elman-antigerojj.mp3 | 2022-05-15 14:38 | 4.5M | |
![[SND]](/icons/sound2.gif) | Cash_Cash_-_Hero_(Lyrics)_feat._Christina_Perri(256k).mp3 | 2022-05-15 14:37 | 0 | |
![[SND]](/icons/sound2.gif) | vp7.mp3 | 2022-05-15 14:35 | 2.8M | |
![[SND]](/icons/sound2.gif) | renais.mp3 | 2022-05-15 14:32 | 0 | |
![[SND]](/icons/sound2.gif) | Sentiasa_-_Firdaus_Rahmat_(Lyrics)(256k).mp3 | 2022-05-15 14:31 | 0 | |
![[SND]](/icons/sound2.gif) | tweetedalertefx.mp3 | 2022-05-15 14:30 | 0 | |
![[SND]](/icons/sound2.gif) | dearG.mp3 | 2022-05-15 14:30 | 0 | |
![[SND]](/icons/sound2.gif) | Yambu.mp3 | 2022-05-15 14:28 | 0 | |
![[SND]](/icons/sound2.gif) | Renai Circulation「恋愛サーキュレーション」歌ってみた【*なみりん】.mp3 | 2022-05-15 14:28 | 0 | |
![[SND]](/icons/sound2.gif) | Twitterefx123.mp3 | 2022-05-15 14:27 | 0 | |
![[SND]](/icons/sound2.gif) | Payin' Top Dolla - Airplane Mode (Airplane Mode).mp3 | 2022-05-15 14:27 | 0 | |
![[SND]](/icons/sound2.gif) | sephirothrain.mp3 | 2022-05-15 14:27 | 1.2M | |
![[SND]](/icons/sound2.gif) | Kontol.mp3 | 2022-05-15 14:26 | 531K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nightcore Kawaii TATARKA VIRAL TIKTOK 2022.mp3 | 2022-05-15 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | I'm cringe and that's based.mp3 | 2022-05-15 14:24 | 0 | |
![[SND]](/icons/sound2.gif) | ABHI1.mp3 | 2022-05-15 14:22 | 0 | |
![[SND]](/icons/sound2.gif) | full paradoks.mp3 | 2022-05-15 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | Akmal_-_Iz-za_tebya_73197601.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Tanir_Tyomcha_-_Poteryali_pacana_73251527.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Lyusya_CHebotina_-_SOLNCE_MONAKO_73236442.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Akmal_-_Vdol_dorog_73390024.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Gimny_-_Gosudarstvennyjj_gimn_Rossijjskojj_ederacii_48240966.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Akmal_-_Po_polyushku_73945237.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Lyusya_CHebotina_-_AJEROJEKSPRESS_73852465.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Minelli_-_Rampampam_72874060.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | HammAli_Navai_-_Ptichka_72965451.mp3 | 2022-05-15 14:18 | 7.4M | |
![[SND]](/icons/sound2.gif) | Oleg_Kenzov_-_Obstanovka_po-kajjfu_73325299.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Pesnya_voennykh_let_-_Vykhodila_na_bereg_Katyusha_28525816.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | Nina_Urgant_-_Zdes_Pticy_Ne_Poyut_19403551.mp3 | 2022-05-15 14:18 | 0 | |
![[SND]](/icons/sound2.gif) | เสียไม่ได้.mp3 | 2022-05-15 14:17 | 3.0M | |
![[SND]](/icons/sound2.gif) | Butch U - Feel The Vibe (Feel The Vibe).mp3 | 2022-05-15 14:17 | 3.1M | |
![[SND]](/icons/sound2.gif) | russ25.mp3 | 2022-05-15 14:17 | 0 | |
![[SND]](/icons/sound2.gif) | 2020_Year_End_-_South_Dance_Mashup_(getmp3.pro).mp3 | 2022-05-15 14:15 | 0 | |
![[SND]](/icons/sound2.gif) | APA01.mp3 | 2022-05-15 14:15 | 0 | |
![[SND]](/icons/sound2.gif) | HELP MEE!.mp3 | 2022-05-15 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | lennoxsdj120.mp3 | 2022-05-15 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | lennoxsdj130.mp3 | 2022-05-15 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | lennoxsdj140.mp3 | 2022-05-15 14:12 | 0 | |
![[SND]](/icons/sound2.gif) | ยิกยิก.mp3 | 2022-05-15 14:12 | 0 | |
![[SND]](/icons/sound2.gif) | MC.mp3 | 2022-05-15 14:11 | 2.9M | |
![[SND]](/icons/sound2.gif) | Käppee (128 kbps).mp3 | 2022-05-15 14:10 | 0 | |
![[SND]](/icons/sound2.gif) | WARNING.mp3 | 2022-05-15 14:10 | 0 | |
![[SND]](/icons/sound2.gif) | 654.mp3 | 2022-05-15 14:10 | 0 | |
![[SND]](/icons/sound2.gif) | lagu.mp3 | 2022-05-15 14:09 | 0 | |
![[SND]](/icons/sound2.gif) | AUD-20220515-WA0344.mp3 | 2022-05-15 14:07 | 0 | |
![[SND]](/icons/sound2.gif) | yeudonphuonglagiremix.mp3 | 2022-05-15 14:07 | 0 | |
![[SND]](/icons/sound2.gif) | ximangphovol2.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | ximangpho.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | hanhphucdoita.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | omemlancuoilofi.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | phaichiataythoi.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | darakiss.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | honcamaytroilofi.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | Miyagi_Tam_karavella_gandzha_pela_dari_dari_dej.mp3 | 2022-05-15 14:06 | 3.5M | |
![[SND]](/icons/sound2.gif) | baylen.mp3 | 2022-05-15 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | 888.mp3 | 2022-05-15 14:03 | 4.3M | |
![[SND]](/icons/sound2.gif) | Kangen Band - Cinta Sampai Mati (Official Music Video)_1.mp3 | 2022-05-15 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | bastaboi.mp3 | 2022-05-15 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | Shshi1.mp3 | 2022-05-15 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | superiot aku yang malang 4 + lirik(1).mp3 | 2022-05-15 14:01 | 3.8M | |
![[SND]](/icons/sound2.gif) | My G is HARAM _ Official MV.mp3 | 2022-05-15 14:01 | 3.7M | |
![[SND]](/icons/sound2.gif) | Maga, Gabidulin - WAKANDA (WAKANDA).mp3 | 2022-05-15 14:00 | 0 | |
![[SND]](/icons/sound2.gif) | 999.mp3 | 2022-05-15 13:59 | 3.4M | |
![[SND]](/icons/sound2.gif) | Kokoganzz.mp3 | 2022-05-15 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | Semipro.mp3 | 2022-05-15 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | basta.mp3 | 2022-05-15 13:58 | 0 | |
![[SND]](/icons/sound2.gif) | KEAN DYSSO, Sinny - LTE (LTE).mp3 | 2022-05-15 13:58 | 0 | |
![[SND]](/icons/sound2.gif) | Грибы - Копы (Копы).mp3 | 2022-05-15 13:57 | 0 | |
![[SND]](/icons/sound2.gif) | 4ЯR - Oh My (Oh My).mp3 | 2022-05-15 13:57 | 0 | |
![[SND]](/icons/sound2.gif) | MP5.mp3 | 2022-05-15 13:55 | 0 | |
![[SND]](/icons/sound2.gif) | Vp7.mp3 | 2022-05-15 13:54 | 200K | |
![[SND]](/icons/sound2.gif) | CityOfLies.mp3 | 2022-05-15 13:54 | 0 | |
![[SND]](/icons/sound2.gif) | salting_dj_topeng_remix_tiktok_dj_mos_2_-4129257961631973702.mp3 | 2022-05-15 13:54 | 0 | |
![[SND]](/icons/sound2.gif) | g1.mp3 | 2022-05-15 13:53 | 0 | |
![[SND]](/icons/sound2.gif) | sound_003.mp3 | 2022-05-15 13:53 | 0 | |
![[SND]](/icons/sound2.gif) | DW champion - TANTHAM x ATSNEE x DOH (Official MV).mp3 | 2022-05-15 13:51 | 0 | |
![[SND]](/icons/sound2.gif) | 3127903408.mp3 | 2022-05-15 13:49 | 0 | |
![[SND]](/icons/sound2.gif) | sehinsah-hidra-imza (mp3cut.net).mp3 | 2022-05-15 13:49 | 0 | |
![[SND]](/icons/sound2.gif) | apan6.mp3 | 2022-05-15 13:48 | 568K | |
![[SND]](/icons/sound2.gif) | MP3.mp3 | 2022-05-15 13:48 | 0 | |
![[VID]](/icons/movie.gif) | d5bf890f662366419fd7c4c1cd6a3aeb.mp4 | 2022-05-15 13:46 | 1.3M | |
![[SND]](/icons/sound2.gif) | apan7.mp3 | 2022-05-15 13:46 | 4.8M | |
![[SND]](/icons/sound2.gif) | opan.mp3 | 2022-05-15 13:43 | 7.9M | |
![[SND]](/icons/sound2.gif) | Unikkatil - Kuq E Zi feat. Klepto (1).mp3 | 2022-05-15 13:42 | 6.2M | |
![[SND]](/icons/sound2.gif) | Диман Брюханов - БПАН (1).mp3 | 2022-05-15 13:42 | 4.3M | |
![[SND]](/icons/sound2.gif) | ssstik_1652621023184.mp3 | 2022-05-15 13:38 | 859K | |
![[SND]](/icons/sound2.gif) | Pohodnyj_gimn_-_Lyuftvaffe_(iPleer.com).mp3 | 2022-05-15 13:37 | 4.6M | |
![[SND]](/icons/sound2.gif) | กลหน.mp3 | 2022-05-15 13:37 | 3.0M | |
![[SND]](/icons/sound2.gif) | ajas13.mp3 | 2022-05-15 13:36 | 3.2M | |
![[SND]](/icons/sound2.gif) | rhn117.mp3 | 2022-05-15 13:35 | 0 | |
![[SND]](/icons/sound2.gif) | Albania.MP3.mp3 | 2022-05-15 13:35 | 0 | |
![[SND]](/icons/sound2.gif) | sparky.mp3 | 2022-05-15 13:34 | 0 | |
![[SND]](/icons/sound2.gif) | rafiq3.mp3 | 2022-05-15 13:33 | 2.4M | |
![[SND]](/icons/sound2.gif) | AS8.mp3 | 2022-05-15 13:32 | 3.7M | |
![[SND]](/icons/sound2.gif) | PA6.mp3 | 2022-05-15 13:31 | 0 | |
![[SND]](/icons/sound2.gif) | lwe1.mp3 | 2022-05-15 13:30 | 0 | |
![[SND]](/icons/sound2.gif) | kk9.mp3 | 2022-05-15 13:29 | 0 | |
![[SND]](/icons/sound2.gif) | Zxcv.mp3 | 2022-05-15 13:24 | 0 | |
![[SND]](/icons/sound2.gif) | iyanstore.mp3 | 2022-05-15 13:24 | 552K | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Old Slow Bass Yang Kalian CariCari Cocok Buat Jedag Jedug Remix By Ucil Fvnky.mp3 | 2022-05-15 13:23 | 0 | |
![[SND]](/icons/sound2.gif) | som.mp3 | 2022-05-15 13:19 | 4.4M | |
![[SND]](/icons/sound2.gif) | Lean.mp3 | 2022-05-15 13:17 | 0 | |
![[SND]](/icons/sound2.gif) | HEAT WAVES.mp3.m4a | 2022-05-15 13:17 | 3.2M | |
![[SND]](/icons/sound2.gif) | MRE.mp3 | 2022-05-15 13:17 | 2.8M | |
![[SND]](/icons/sound2.gif) | rafiq4.mp3 | 2022-05-15 13:16 | 2.9M | |
![[SND]](/icons/sound2.gif) | endTime.mp3 | 2022-05-15 13:13 | 0 | |
![[SND]](/icons/sound2.gif) | Kaori.mp3 | 2022-05-15 13:10 | 0 | |
![[SND]](/icons/sound2.gif) | wnd.mp3 | 2022-05-15 13:09 | 0 | |
![[SND]](/icons/sound2.gif) | Compe.mp3 | 2022-05-15 13:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | Ice.mp3 | 2022-05-15 13:05 | 3.8M | |
![[SND]](/icons/sound2.gif) | uyy.mp3 | 2022-05-15 13:03 | 0 | |
![[SND]](/icons/sound2.gif) | cong.mp3 | 2022-05-15 13:02 | 0 | |
![[SND]](/icons/sound2.gif) | VID-20220515-WA0002 (1).mp3 | 2022-05-15 13:02 | 0 | |
![[SND]](/icons/sound2.gif) | Legend_MK_I'm_Blessed.mp3 | 2022-05-15 13:00 | 0 | |
![[SND]](/icons/sound2.gif) | fakhri.mp3 | 2022-05-15 12:58 | 0 | |
![[SND]](/icons/sound2.gif) | fucked.mp3 | 2022-05-15 12:58 | 0 | |
![[SND]](/icons/sound2.gif) | Mk1.mp3 | 2022-05-15 12:56 | 0 | |
![[SND]](/icons/sound2.gif) | Ghostemane_-_Fed_Up_71339681.mp3 | 2022-05-15 12:55 | 5.9M | |
![[SND]](/icons/sound2.gif) | Top.mp3 | 2022-05-15 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | n301.mp3 | 2022-05-15 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | zyan3.mp3 | 2022-05-15 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | IMG_3295.mp3 | 2022-05-15 12:49 | 0 | |
![[VID]](/icons/movie.gif) | IMG_3295.MP.mp4 | 2022-05-15 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | sky6.mp3 | 2022-05-15 12:48 | 960K | |
![[SND]](/icons/sound2.gif) | Hbd broh.mp3 | 2022-05-15 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | escobar.mp3 | 2022-05-15 12:47 | 920K | |
![[SND]](/icons/sound2.gif) | JAK.mp3 | 2022-05-15 12:47 | 3.5M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Stan - Slowed (Only dido) (128 kbps).mp3 | 2022-05-15 12:46 | 0 | |
![[SND]](/icons/sound2.gif) | OnlyRightVersions - Олег Газманов - Вперёд, Россия Right Version_(tropicmusic.ru).mp3 | 2022-05-15 12:45 | 0 | |
![[SND]](/icons/sound2.gif) | Top1.mp3 | 2022-05-15 12:43 | 0 | |
![[SND]](/icons/sound2.gif) | BUNDEM.mp3 | 2022-05-15 12:39 | 0 | |
![[SND]](/icons/sound2.gif) | 268.mp3 | 2022-05-15 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | STARK7.mp3 | 2022-05-15 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | PZx35.mp3 | 2022-05-15 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | Post Malone - Congratulations ft. Quavo.m4a | 2022-05-15 12:33 | 0 | |
![[SND]](/icons/sound2.gif) | Tate McRae rubberband.mp3 | 2022-05-15 12:32 | 0 | |
![[SND]](/icons/sound2.gif) | sosososo.mp3 | 2022-05-15 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | YK2.mp3 | 2022-05-15 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | YK3.mp3 | 2022-05-15 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | YK4.mp3 | 2022-05-15 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | ehthenao.mp3 | 2022-05-15 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | yyii.mp3 | 2022-05-15 12:28 | 52M | |
![[SND]](/icons/sound2.gif) | cover1.mp3 | 2022-05-15 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | hencit1.mp3 | 2022-05-15 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | Legend MK_Stay With Me.mp3 | 2022-05-15 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | hencit2.mp3 | 2022-05-15 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | hencit.mp3 | 2022-05-15 12:26 | 0 | |
![[SND]](/icons/sound2.gif) | sosososo1.mp3 | 2022-05-15 12:25 | 0 | |
![[SND]](/icons/sound2.gif) | tinh1.mp3 | 2022-05-15 12:25 | 0 | |
![[SND]](/icons/sound2.gif) | oop.mp3 | 2022-05-15 12:25 | 824K | |
![[SND]](/icons/sound2.gif) | CEST.mp3 | 2022-05-15 12:24 | 0 | |
![[SND]](/icons/sound2.gif) | FORME.mp3 | 2022-05-15 12:23 | 0 | |
![[SND]](/icons/sound2.gif) | zcx.mp3 | 2022-05-15 12:23 | 0 | |
![[SND]](/icons/sound2.gif) | 30.mp3 | 2022-05-15 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | Firza.mp3 | 2022-05-15 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | Rusher.mp3 | 2022-05-15 12:19 | 0 | |
![[SND]](/icons/sound2.gif) | giang.mp3 | 2022-05-15 12:19 | 0 | |
![[SND]](/icons/sound2.gif) | DINGIN.mp3 | 2022-05-15 12:19 | 0 | |
![[SND]](/icons/sound2.gif) | PAK_WONG.mp3 | 2022-05-15 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | kutinggalturun.mp3 | 2022-05-15 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | Bulat_Sahapov_-_RUSSIAN_CLUB_MIX_(vers. 02).mp3 | 2022-05-15 12:16 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik_1652616754897.mp3 | 2022-05-15 12:15 | 0 | |
![[SND]](/icons/sound2.gif) | et.mp3 | 2022-05-15 12:15 | 0 | |
![[SND]](/icons/sound2.gif) | tinh.mp3 | 2022-05-15 12:15 | 0 | |
![[SND]](/icons/sound2.gif) | SMOCK.mp3 | 2022-05-15 12:15 | 1.7M | |
![[SND]](/icons/sound2.gif) | Dika.mp3 | 2022-05-15 12:10 | 2.9M | |
![[SND]](/icons/sound2.gif) | MMH.mp3 | 2022-05-15 12:09 | 20K | |
![[SND]](/icons/sound2.gif) | YK1.mp3 | 2022-05-15 12:09 | 5.4M | |
![[SND]](/icons/sound2.gif) | Calvin Harris - Feels (Official Video) ft. Pharrell Williams, Katy Perry, Big Sean.mp3 | 2022-05-15 12:07 | 0 | |
![[SND]](/icons/sound2.gif) | Trippie Redd – Miss The Rage Feat. Playboi Carti (Instrumental).mp3 | 2022-05-15 12:05 | 0 | |
![[SND]](/icons/sound2.gif) | Aidil1.mp3 | 2022-05-15 12:02 | 0 | |
![[SND]](/icons/sound2.gif) | Fahri.mp3 | 2022-05-15 12:01 | 0 | |
![[SND]](/icons/sound2.gif) | che.mp3 | 2022-05-15 12:01 | 0 | |
![[SND]](/icons/sound2.gif) | mm.mp3 | 2022-05-15 11:57 | 79K | |
![[SND]](/icons/sound2.gif) | angell.mp3 | 2022-05-15 11:55 | 0 | |
![[SND]](/icons/sound2.gif) | felix.mp3 | 2022-05-15 11:55 | 0 | |
![[SND]](/icons/sound2.gif) | Zarr.mp3 | 2022-05-15 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - 천만명을 울린 타이타닉 ost 리코더ver (1).mp3 | 2022-05-15 11:53 | 3.9M | |
![[SND]](/icons/sound2.gif) | scott1.mp3 | 2022-05-15 11:52 | 0 | |
![[SND]](/icons/sound2.gif) | MARC3.mp3 | 2022-05-15 11:49 | 3.1M | |
![[SND]](/icons/sound2.gif) | wow.mp3 | 2022-05-15 11:48 | 12K | |
![[SND]](/icons/sound2.gif) | gta.mp3 | 2022-05-15 11:47 | 3.1M | |
![[SND]](/icons/sound2.gif) | 28169.mp3 | 2022-05-15 11:46 | 0 | |
![[SND]](/icons/sound2.gif) | Chill.mp3 | 2022-05-15 11:45 | 4.2M | |
![[SND]](/icons/sound2.gif) | XMAN-NDUGAL-We-Don-t-Care_-qfUClGbz-c.mp3 | 2022-05-15 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | arga.mp3 | 2022-05-15 11:42 | 0 | |
![[SND]](/icons/sound2.gif) | Johnny_I_Hardly_Knew_Ya_-_Dropkick_(getmp3.pro).mp3 | 2022-05-15 11:40 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Official MV MOMMY SON 마미손 소년점프 feat 배기성.mp3 | 2022-05-15 11:40 | 0 | |
![[SND]](/icons/sound2.gif) | Be1.mp3 | 2022-05-15 11:39 | 0 | |
![[SND]](/icons/sound2.gif) | Sıla Şahin - Dönüyorum Eve (Emin Bilen Remix) Lyrics-Sözleri (KELPETEN).mp3 | 2022-05-15 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | paaro2.mp3 | 2022-05-15 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | Basiaga - ОПАСНО_1.mp3 | 2022-05-15 11:31 | 0 | |
![[SND]](/icons/sound2.gif) | DROPKICK MURPHYS Johnny, I Hardly Knew Ya Lyrics.mp3 | 2022-05-15 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | kok.mp3 | 2022-05-15 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | pvp.mp3 | 2022-05-15 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | nhacmuaflo1.mp3 | 2022-05-15 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | vh4.mp3 | 2022-05-15 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | PP.mp3 | 2022-05-15 11:11 | 224K | |
![[SND]](/icons/sound2.gif) | NK2.mp3 | 2022-05-15 11:10 | 3.1M | |
![[SND]](/icons/sound2.gif) | cc.mp3 | 2022-05-15 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | Trams reducing city traffic.mp3 | 2022-05-15 11:08 | 0 | |
![[SND]](/icons/sound2.gif) | Tate-McRae-rubberband-Lyrics_6x_auS9HRQg.mp3 | 2022-05-15 11:05 | 0 | |
![[SND]](/icons/sound2.gif) | suicideboys.mp3 | 2022-05-15 11:04 | 0 | |
![[SND]](/icons/sound2.gif) | boombox.mp3 | 2022-05-15 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | plugwalk.mp3 | 2022-05-15 11:00 | 0 | |
![[SND]](/icons/sound2.gif) | goo.mp3 | 2022-05-15 10:57 | 3.4M | |
![[SND]](/icons/sound2.gif) | Rebas.mp3 | 2022-05-15 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | OAT.mp3 | 2022-05-15 10:54 | 3.4M | |
![[SND]](/icons/sound2.gif) | newflame.mp3 | 2022-05-15 10:53 | 3.1M | |
![[SND]](/icons/sound2.gif) | 163ONMYNECK - ЖМУРКИ.mp3 | 2022-05-15 10:53 | 4.9M | |
![[SND]](/icons/sound2.gif) | Tate McRae rubberband (128kbps).mp3 | 2022-05-15 10:53 | 0 | |
![[SND]](/icons/sound2.gif) | nigga-balls_wDfimCw.mp3 | 2022-05-15 10:52 | 0 | |
![[SND]](/icons/sound2.gif) | pmp3.mp3 | 2022-05-15 10:52 | 0 | |
![[SND]](/icons/sound2.gif) | arcade1.mp3 | 2022-05-15 10:49 | 2.7M | |
![[SND]](/icons/sound2.gif) | gariscinta.mp3 | 2022-05-15 10:47 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - The Magic Gang - Think (Official Video) (128 kbps).mp3 | 2022-05-15 10:47 | 0 | |
![[SND]](/icons/sound2.gif) | GwM MESE OFFICIAL VIDEOCLIP.mp3 | 2022-05-15 10:47 | 0 | |
![[SND]](/icons/sound2.gif) | co7.mp3 | 2022-05-15 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | Бумер - Седая Ночь (megapesni.com).mp3 | 2022-05-15 10:44 | 0 | |
![[SND]](/icons/sound2.gif) | nl8.mp3 | 2022-05-15 10:44 | 184K | |
![[SND]](/icons/sound2.gif) | Prodboris.mp3 | 2022-05-15 10:41 | 2.2M | |
![[SND]](/icons/sound2.gif) | tai.mp3 | 2022-05-15 10:37 | 562K | |
![[SND]](/icons/sound2.gif) | ah ah ah ah.mp3 | 2022-05-15 10:35 | 0 | |
![[SND]](/icons/sound2.gif) | Surah Ar Rahman THE MOST MERCIFUL Sheikh Mansour Al Salimi.mp3.m4a | 2022-05-15 10:33 | 0 | |
![[SND]](/icons/sound2.gif) | KANGEN BAND - TERBANG BERSAMAKU.mp3 | 2022-05-15 10:32 | 0 | |
![[SND]](/icons/sound2.gif) | mp3juice1s.cc - Cinta sai mati Kangen band (128kbps).mp3 | 2022-05-15 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | dj-emang-bener.mp3 | 2022-05-15 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | jhunred.24.mp3 | 2022-05-15 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | Mp3.mp3 | 2022-05-15 10:27 | 5.2M | |
![[SND]](/icons/sound2.gif) | coolio188.mp3 | 2022-05-15 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | в статус.mp3 | 2022-05-15 10:26 | 0 | |
![[SND]](/icons/sound2.gif) | Kokoganzz8.mp3 | 2022-05-15 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | Kokoganzz7.mp3 | 2022-05-15 10:24 | 0 | |
![[SND]](/icons/sound2.gif) | p.mp3 | 2022-05-15 10:22 | 268K | |
![[SND]](/icons/sound2.gif) | X2Download.com - Rider Bone - Retaliate (128 kbps).mp3 | 2022-05-15 10:22 | 0 | |
![[SND]](/icons/sound2.gif) | bugoknavendor.mp3 | 2022-05-15 10:18 | 0 | |
![[SND]](/icons/sound2.gif) | cantik.mp3 | 2022-05-15 10:17 | 0 | |
![[SND]](/icons/sound2.gif) | USA MOTIVES🍷 -Буйно Голова 5 «azZza remix»-kissvk.com.mp3 | 2022-05-15 10:17 | 0 | |
![[SND]](/icons/sound2.gif) | Ремикс🍃👋-даже не половина’-kissvk.com.mp3 | 2022-05-15 10:17 | 0 | |
![[SND]](/icons/sound2.gif) | ngaythol.mp3 | 2022-05-15 10:17 | 4.1M | |
![[SND]](/icons/sound2.gif) | blood123.mp3 | 2022-05-15 10:17 | 0 | |
![[SND]](/icons/sound2.gif) | Дени Ценроев-Лезгинка 6-kissvk.com.mp3 | 2022-05-15 10:16 | 0 | |
![[SND]](/icons/sound2.gif) | Lil.mp3 | 2022-05-15 10:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | sueta🐊-Сафари -104 - Truwer--kissvk.com.mp3 | 2022-05-15 10:16 | 0 | |
![[SND]](/icons/sound2.gif) | liltecca.mp3 | 2022-05-15 10:15 | 0 | |
![[SND]](/icons/sound2.gif) | komlev_music🍷-автор-kissvk.com.mp3 | 2022-05-15 10:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - GHOSTEMANE PHARAOH BLOOD OCEANS.mp3 | 2022-05-15 10:14 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze-zxcursed.mp3 | 2022-05-15 10:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - TIKTOK VIRAL SONG PAK PONG VONG CAMBODIA REMIX LAGU TERBARU TIKTOK VIRALTRUNGBAU1992 SLOWED.mp3 | 2022-05-15 10:10 | 2.7M | |
![[SND]](/icons/sound2.gif) | POH.mp3 | 2022-05-15 10:06 | 0 | |
![[VID]](/icons/movie.gif) | jovit123.mp4 | 2022-05-15 10:05 | 0 | |
![[SND]](/icons/sound2.gif) | hihar.mp3 | 2022-05-15 10:04 | 0 | |
![[SND]](/icons/sound2.gif) | Shadowraze_zxcursed.mp3 | 2022-05-15 10:02 | 712K | |
![[SND]](/icons/sound2.gif) | X2.mp3 | 2022-05-15 10:01 | 3.2M | |
![[SND]](/icons/sound2.gif) | Shouse - Love Tonight (Radio Edit).mp3 | 2022-05-15 10:00 | 0 | |
![[SND]](/icons/sound2.gif) | blind.mp3 | 2022-05-15 09:57 | 0 | |
![[SND]](/icons/sound2.gif) | illslick_official_lyrics_video_-8375409190951056375.mp3 | 2022-05-15 09:56 | 0 | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN - Номер (1).mp3 | 2022-05-15 09:54 | 1.6M | |
![[SND]](/icons/sound2.gif) | Auto_BC.mp3 | 2022-05-15 09:53 | 1.6M | |
![[SND]](/icons/sound2.gif) | a man.mp3 | 2022-05-15 09:51 | 0 | |
![[SND]](/icons/sound2.gif) | pogi.mp3 | 2022-05-15 09:51 | 0 | |
![[SND]](/icons/sound2.gif) | J_SON_Karavan_plana_Remix.mp3 | 2022-05-15 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | 16-aimoon-the_best_of_suanda_voice_2020_(continuous_dj_mix).mp3 | 2022-05-15 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | anton.mp3 | 2022-05-15 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | Rizz7.mp3 | 2022-05-15 09:48 | 0 | |
![[SND]](/icons/sound2.gif) | Troye_Sivan_-_Angel_Baby_(Lyrics)(128k).mp3 | 2022-05-15 09:47 | 0 | |
![[SND]](/icons/sound2.gif) | r11.mp3 | 2022-05-15 09:47 | 0 | |
![[SND]](/icons/sound2.gif) | Arcade.mp3 | 2022-05-15 09:46 | 0 | |
![[SND]](/icons/sound2.gif) | jam.mp3 | 2022-05-15 09:44 | 0 | |
![[SND]](/icons/sound2.gif) | 15-papulin_and_kate_miles-home_(aimoon_extended_remix).mp3 | 2022-05-15 09:44 | 0 | |
![[SND]](/icons/sound2.gif) | 14-adip_kiyoi_and_susie_ledge-wild_rose_(corrado_baggieri_extended_remix).mp3 | 2022-05-15 09:44 | 0 | |
![[SND]](/icons/sound2.gif) | 13-robert_maya-wait_for_you_(extended_mix).mp3 | 2022-05-15 09:43 | 0 | |
![[SND]](/icons/sound2.gif) | 12-papulin_and_maria_milewska-into_the_night_(extended_mix).mp3 | 2022-05-15 09:43 | 0 | |
![[SND]](/icons/sound2.gif) | 11-drival_ft._angel_falls-now_and_here_(extended_mix).mp3 | 2022-05-15 09:43 | 0 | |
![[SND]](/icons/sound2.gif) | 09-tom_exo_and_claire_willis-the_light_(extended_mix).mp3 | 2022-05-15 09:42 | 0 | |
![[SND]](/icons/sound2.gif) | 10-adip_kiyoi_and_anhydrite_ft._angel_falls-love_will_heal_you_(extended_mix).mp3 | 2022-05-15 09:42 | 0 | |
![[SND]](/icons/sound2.gif) | 08-tycoos_and_sandro_mireno_ft._alaera-want_you_to_go_(aimoon_extended_remix).mp3 | 2022-05-15 09:42 | 0 | |
![[SND]](/icons/sound2.gif) | The Magic Gang - Think (Official Video) (128 kbps).mp3 | 2022-05-15 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | A_Man_Without_Love_LYRICS_Video_Engelbert_Humperdinck_1968_🌙_Moon_Knight_Episode_1(256kbps).mp3 | 2022-05-15 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | Audio 20223315-033313.mp3 | 2022-05-15 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | 05-deme3us_and_dilara_gadel-like_a_bird_(extended_mix).mp3 | 2022-05-15 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | 01-aimoon_ft._alaera-summer_vibe_(extended_mix).mp3 | 2022-05-15 09:40 | 0 | |
![[SND]](/icons/sound2.gif) | 03-eximinds-take_my_hand_(extended_mix).mp3 | 2022-05-15 09:39 | 0 | |
![[SND]](/icons/sound2.gif) | 04-alexso_ft._stas_obukhov-if_youre_gone_(extended_mix).mp3 | 2022-05-15 09:39 | 4.8M | |
![[SND]](/icons/sound2.gif) | Low.mp3 | 2022-05-15 09:39 | 3.3M | |
![[SND]](/icons/sound2.gif) | 06-offshore_wind-aquatoria_(extended_mix).mp3 | 2022-05-15 09:39 | 0 | |
![[SND]](/icons/sound2.gif) | co.mp3 | 2022-05-15 09:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | Rhey1.mp3 | 2022-05-15 09:38 | 2.8M | |
![[SND]](/icons/sound2.gif) | L_-_feat._Real_girl_remix_cover.mp3 | 2022-05-15 09:38 | 0 | |
![[SND]](/icons/sound2.gif) | dau.mp3 | 2022-05-15 09:37 | 3.1M | |
![[SND]](/icons/sound2.gif) | angel.mp3 | 2022-05-15 09:34 | 1.8M | |
![[SND]](/icons/sound2.gif) | music.mp3 | 2022-05-15 09:32 | 32K | |
![[SND]](/icons/sound2.gif) | Track01.mp3 | 2022-05-15 09:27 | 0 | |
![[SND]](/icons/sound2.gif) | loveop.mp3 | 2022-05-15 09:26 | 0 | |
![[SND]](/icons/sound2.gif) | 1aaa.mp3 | 2022-05-15 09:22 | 0 | |
![[VID]](/icons/movie.gif) | video_20220515_162051.mp4 | 2022-05-15 09:21 | 0 | |
![[SND]](/icons/sound2.gif) | toui.mp3 | 2022-05-15 09:20 | 0 | |
![[SND]](/icons/sound2.gif) | pond.mp3 | 2022-05-15 09:19 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar.mp3 | 2022-05-15 09:19 | 0 | |
![[SND]](/icons/sound2.gif) | lv_7085710379334126850_20220515161434.mp3 | 2022-05-15 09:18 | 0 | |
![[SND]](/icons/sound2.gif) | RRQ.mp3 | 2022-05-15 09:15 | 0 | |
![[SND]](/icons/sound2.gif) | neira.mp3 | 2022-05-15 09:10 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar9.mp3 | 2022-05-15 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | robert_Jensen.mp3 | 2022-05-15 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | 250-milliseconds-of-silence.mp3 | 2022-05-15 09:07 | 36K | |
![[SND]](/icons/sound2.gif) | banda.mp3 | 2022-05-15 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | cuki.mp3 | 2022-05-15 09:03 | 4.3M | |
![[SND]](/icons/sound2.gif) | hadal1.mp3 | 2022-05-15 09:02 | 0 | |
![[SND]](/icons/sound2.gif) | lop.mp3 | 2022-05-15 09:02 | 0 | |
![[SND]](/icons/sound2.gif) | dear1.mp3 | 2022-05-15 09:02 | 0 | |
![[SND]](/icons/sound2.gif) | celeste.mp3 | 2022-05-15 08:59 | 0 | |
![[SND]](/icons/sound2.gif) | kontoks.mp3 | 2022-05-15 08:58 | 0 | |
![[SND]](/icons/sound2.gif) | Queen_-_Somebody_To_Love_47828505.mp3 | 2022-05-15 08:58 | 0 | |
![[SND]](/icons/sound2.gif) | Koko6.mp3 | 2022-05-15 08:57 | 0 | |
![[SND]](/icons/sound2.gif) | TT.mp3 | 2022-05-15 08:53 | 2.1M | |
![[SND]](/icons/sound2.gif) | tytyd.mp3 | 2022-05-15 08:50 | 2.2M | |
![[SND]](/icons/sound2.gif) | Hạ Màn - Southside Soldiers.mp3 | 2022-05-15 08:50 | 912K | |
![[SND]](/icons/sound2.gif) | stephen.mp3 | 2022-05-15 08:49 | 473K | |
![[SND]](/icons/sound2.gif) | tryout.mp3 | 2022-05-15 08:49 | 3.5M | |
![[SND]](/icons/sound2.gif) | AY.mp3 | 2022-05-15 08:47 | 3.8M | |
![[SND]](/icons/sound2.gif) | Tee13.mp3 | 2022-05-15 08:46 | 2.7M | |
![[SND]](/icons/sound2.gif) | Beautiful_Life_Remix_Xassa.mp3 | 2022-05-15 08:43 | 0 | |
![[SND]](/icons/sound2.gif) | Samolet_Osmos.mp3 | 2022-05-15 08:32 | 0 | |
![[SND]](/icons/sound2.gif) | Whazzy Lazzy 🌹 - Самолет, Osmos.mp3 | 2022-05-15 08:29 | 0 | |
![[SND]](/icons/sound2.gif) | Can't Help Falling In Love - Piano Karaoke _ Sing Along Cover with Lyrics.mp3 | 2022-05-15 08:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | angelbaby.mp3 | 2022-05-15 08:21 | 3.3M | |
![[SND]](/icons/sound2.gif) | Yatz1.mp3 | 2022-05-15 08:21 | 0 | |
![[SND]](/icons/sound2.gif) | love.mp3 | 2022-05-15 08:21 | 2.8M | |
![[SND]](/icons/sound2.gif) | Mc420.mp3 | 2022-05-15 08:19 | 0 | |
![[SND]](/icons/sound2.gif) | Amour128k.mp3 | 2022-05-15 08:18 | 0 | |
![[SND]](/icons/sound2.gif) | yatz11.mp3 | 2022-05-15 08:17 | 0 | |
![[SND]](/icons/sound2.gif) | yatz1.mp3 | 2022-05-15 08:15 | 0 | |
![[SND]](/icons/sound2.gif) | EYMADEFACKER.mp3 | 2022-05-15 08:14 | 0 | |
![[SND]](/icons/sound2.gif) | Jos1.mp3 | 2022-05-15 08:13 | 0 | |
![[SND]](/icons/sound2.gif) | narnia_soundtrack_narnia_lullaby_-8101248998352530235.mp3 | 2022-05-15 08:11 | 0 | |
![[SND]](/icons/sound2.gif) | ACRP_BGM.mp3 | 2022-05-15 08:11 | 0 | |
![[SND]](/icons/sound2.gif) | plerr.mp3 | 2022-05-15 08:11 | 464K | |
![[SND]](/icons/sound2.gif) | Y.mp3 | 2022-05-15 08:08 | 2.8M | |
![[SND]](/icons/sound2.gif) | baboymo.mp3 | 2022-05-15 08:08 | 0 | |
![[SND]](/icons/sound2.gif) | djhaha.mp3 | 2022-05-15 08:06 | 6.0M | |
![[SND]](/icons/sound2.gif) | wadapbitch.mp3 | 2022-05-15 08:06 | 6.4M | |
![[SND]](/icons/sound2.gif) | SE.mp3 | 2022-05-15 08:05 | 12M | |
![[SND]](/icons/sound2.gif) | CG.mp3 | 2022-05-15 08:04 | 13M | |
![[SND]](/icons/sound2.gif) | Wr.mp3 | 2022-05-15 08:03 | 2.6M | |
![[SND]](/icons/sound2.gif) | orangeyourlieinapril.mp3 | 2022-05-15 08:02 | 5.3M | |
![[SND]](/icons/sound2.gif) | masdanmgabata.mp3 | 2022-05-15 08:02 | 0 | |
![[SND]](/icons/sound2.gif) | lesgot.mp3 | 2022-05-15 08:01 | 0 | |
![[SND]](/icons/sound2.gif) | facereality.mp3 | 2022-05-15 08:01 | 0 | |
![[SND]](/icons/sound2.gif) | Basiaga - ОПАСНО.mp3 | 2022-05-15 08:01 | 0 | |
![[SND]](/icons/sound2.gif) | Neymar Jr ► Habibi ● Skills & Goals 2020-21 - HD.mp3 | 2022-05-15 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | Mar_14_2022_2_Premix.mp3 | 2022-05-15 07:58 | 0 | |
![[SND]](/icons/sound2.gif) | HAPPY.mp3 | 2022-05-15 07:57 | 1.8M | |
![[SND]](/icons/sound2.gif) | Defri1.mp3 | 2022-05-15 07:56 | 0 | |
![[SND]](/icons/sound2.gif) | Yuo.mp3 | 2022-05-15 07:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | ASW.mp3 | 2022-05-15 07:54 | 0 | |
![[SND]](/icons/sound2.gif) | ᴏᴘᴇʀ sᴛʏʟᴇ 500.🏴 (67).mp3 | 2022-05-15 07:54 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Cristiano Ronaldo 2022 ● Habibi - Dj Gimi - Albanian Remix (Slowed) Tiktok - Skills & Goals _ HD (320 kbps).mp3 | 2022-05-15 07:53 | 0 | |
![[SND]](/icons/sound2.gif) | mp3.mp3 | 2022-05-15 07:52 | 2.9M | |
![[SND]](/icons/sound2.gif) | C_C_Catch_-_Cause_You_Are_Young_53651809.mp3 | 2022-05-15 07:51 | 0 | |
![[SND]](/icons/sound2.gif) | (44-52hz) BRANYA, MACAN — Пополам [Low Bass by NS] (www.lightaudio.ru).mp3 | 2022-05-15 07:51 | 0 | |
![[SND]](/icons/sound2.gif) | Кара.mp3 | 2022-05-15 07:51 | 136K | |
![[SND]](/icons/sound2.gif) | Lone.mp3 | 2022-05-15 07:48 | 0 | |
![[SND]](/icons/sound2.gif) | RE.mp3 | 2022-05-15 07:48 | 0 | |
![[SND]](/icons/sound2.gif) | AX.mp3 | 2022-05-15 07:48 | 3.3M | |
![[SND]](/icons/sound2.gif) | Bass Music Soul - BRANYA, MACAN - Пополам [Bass Prod. by #Klёpa] (www.hotplayer.ru).mp3 | 2022-05-15 07:47 | 4.0K | |
![[SND]](/icons/sound2.gif) | hoiao6.mp3 | 2022-05-15 07:47 | 19M | |
![[SND]](/icons/sound2.gif) | maskoff.mp3 | 2022-05-15 07:47 | 4.5M | |
![[SND]](/icons/sound2.gif) | rolling.mp3 | 2022-05-15 07:47 | 2.9M | |
![[SND]](/icons/sound2.gif) | cotienxanh.mp3 | 2022-05-15 07:47 | 6.8M | |
![[SND]](/icons/sound2.gif) | hoiao7.mp3 | 2022-05-15 07:47 | 22M | |
![[SND]](/icons/sound2.gif) | lucnho.mp3 | 2022-05-15 07:47 | 2.4M | |
![[SND]](/icons/sound2.gif) | rotchovoibotsaulo.mp3 | 2022-05-15 07:47 | 2.9M | |
![[SND]](/icons/sound2.gif) | choi.mp3 | 2022-05-15 07:47 | 3.9M | |
![[SND]](/icons/sound2.gif) | ikigai.mp3 | 2022-05-15 07:47 | 3.7M | |
![[SND]](/icons/sound2.gif) | 121.mp3 | 2022-05-15 07:47 | 1.9M | |
![[SND]](/icons/sound2.gif) | nhungmonde.mp3 | 2022-05-15 07:47 | 3.2M | |
![[SND]](/icons/sound2.gif) | muonchoitao.mp3 | 2022-05-15 07:47 | 4.9M | |
![[SND]](/icons/sound2.gif) | buadi.mp3 | 2022-05-15 07:47 | 4.2M | |
![[SND]](/icons/sound2.gif) | give.mp3 | 2022-05-15 07:47 | 3.6M | |
![[SND]](/icons/sound2.gif) | cua.mp3 | 2022-05-15 07:47 | 3.0M | |
![[SND]](/icons/sound2.gif) | dat.mp3 | 2022-05-15 07:47 | 2.0M | |
![[SND]](/icons/sound2.gif) | drill.mp3 | 2022-05-15 07:47 | 2.4M | |
![[SND]](/icons/sound2.gif) | thanhxuan.mp3 | 2022-05-15 07:47 | 3.4M | |
![[SND]](/icons/sound2.gif) | homieweed.mp3 | 2022-05-15 07:46 | 6.2M | |
![[SND]](/icons/sound2.gif) | atlanta.mp3 | 2022-05-15 07:46 | 4.4M | |
![[SND]](/icons/sound2.gif) | industrybaby.mp3 | 2022-05-15 07:46 | 3.2M | |
![[SND]](/icons/sound2.gif) | what.mp3 | 2022-05-15 07:46 | 2.1M | |
![[SND]](/icons/sound2.gif) | nhumotnhangia.mp3 | 2022-05-15 07:46 | 4.8M | |
![[SND]](/icons/sound2.gif) | thuyenvang.mp3 | 2022-05-15 07:46 | 4.2M | |
![[SND]](/icons/sound2.gif) | lamthem.mp3 | 2022-05-15 07:46 | 3.1M | |
![[SND]](/icons/sound2.gif) | tien.mp3 | 2022-05-15 07:46 | 3.1M | |
![[SND]](/icons/sound2.gif) | Minin_Glaz_zelyonyj_glaz_vlyubilsya_v_tebya_tak_legko.mp3 | 2022-05-15 07:44 | 5.5M | |
![[SND]](/icons/sound2.gif) | Destroyer.mp3 | 2022-05-15 07:43 | 0 | |
![[SND]](/icons/sound2.gif) | Boss3.mp3 | 2022-05-15 07:42 | 0 | |
![[SND]](/icons/sound2.gif) | Reghdkt.mp3 | 2022-05-15 07:41 | 0 | |
![[SND]](/icons/sound2.gif) | ft.mp3 | 2022-05-15 07:41 | 0 | |
![[SND]](/icons/sound2.gif) | TE.mp3 | 2022-05-15 07:37 | 0 | |
![[SND]](/icons/sound2.gif) | lovers.mp3 | 2022-05-15 07:29 | 0 | |
![[SND]](/icons/sound2.gif) | Vp4.mp3 | 2022-05-15 07:27 | 80K | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN - El Problema.mp3 | 2022-05-15 07:27 | 0 | |
![[SND]](/icons/sound2.gif) | we.mp3 | 2022-05-15 07:23 | 2.0M | |
![[SND]](/icons/sound2.gif) | doa.mp3 | 2022-05-15 07:20 | 0 | |
![[SND]](/icons/sound2.gif) | Slash1.mp3 | 2022-05-15 07:20 | 2.9M | |
![[SND]](/icons/sound2.gif) | Vp3.mp3 | 2022-05-15 07:18 | 2.5M | |
![[SND]](/icons/sound2.gif) | Vp2.mp3 | 2022-05-15 07:17 | 4.1M | |
![[SND]](/icons/sound2.gif) | holdon.mp3 | 2022-05-15 07:16 | 3.1M | |
![[SND]](/icons/sound2.gif) | LOMO.mp3 | 2022-05-15 07:13 | 0 | |
![[SND]](/icons/sound2.gif) | Руки Вверх! Крошка моя.mp3 | 2022-05-15 07:13 | 0 | |
![[SND]](/icons/sound2.gif) | mre.mp3 | 2022-05-15 07:12 | 2.2M | |
![[SND]](/icons/sound2.gif) | DJ PLAY FOR ME X KU JATUH CINTA MAIMUNAH FULLBASS TERBARU 2021🎶 (128 kbps) (1).mp3 | 2022-05-15 07:11 | 0 | |
![[SND]](/icons/sound2.gif) | rana17.mp3 | 2022-05-15 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | jwzondag.mp3 | 2022-05-15 07:08 | 0 | |
![[SND]](/icons/sound2.gif) | dmh.mp3 | 2022-05-15 07:08 | 2.0M | |
![[SND]](/icons/sound2.gif) | cinta.mp3 | 2022-05-15 07:06 | 0 | |
![[SND]](/icons/sound2.gif) | minee1.mp3 | 2022-05-15 07:04 | 0 | |
![[SND]](/icons/sound2.gif) | vecina.mp3 | 2022-05-15 07:00 | 0 | |
![[SND]](/icons/sound2.gif) | LoKi.mp3 | 2022-05-15 06:58 | 0 | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Dj minefields slow beat Remix Tiktok Viral Terbaru 2022 (320kbps).mp3 | 2022-05-15 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | ranamine1.mp3 | 2022-05-15 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | My G is HARAM Official MV vp7.mp3 | 2022-05-15 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | VV2.mp3 | 2022-05-15 06:52 | 0 | |
![[SND]](/icons/sound2.gif) | Piyesa2.mp3 | 2022-05-15 06:50 | 0 | |
![[SND]](/icons/sound2.gif) | Stev.mp3 | 2022-05-15 06:49 | 0 | |
![[SND]](/icons/sound2.gif) | RRT.mp3 | 2022-05-15 06:45 | 0 | |
![[SND]](/icons/sound2.gif) | She - Joe Layne [Happiness 해피니스 OST] lyrics.mp3 | 2022-05-15 06:44 | 0 | |
![[SND]](/icons/sound2.gif) | ranamine.mp3 | 2022-05-15 06:43 | 0 | |
![[SND]](/icons/sound2.gif) | brixton.mp3 | 2022-05-15 06:43 | 0 | |
![[SND]](/icons/sound2.gif) | Tri.mp3 | 2022-05-15 06:43 | 0 | |
![[SND]](/icons/sound2.gif) | Piyesa.mp3 | 2022-05-15 06:43 | 0 | |
![[SND]](/icons/sound2.gif) | rana55.mp3 | 2022-05-15 06:42 | 0 | |
![[SND]](/icons/sound2.gif) | mareeze.mp3 | 2022-05-15 06:41 | 0 | |
![[SND]](/icons/sound2.gif) | РукиВверхArtikAstiПолечузатобою.mp3 | 2022-05-15 06:36 | 9.5M | |
![[SND]](/icons/sound2.gif) | ЭльдарДалгатовШамильСмолян.mp3 | 2022-05-15 06:36 | 6.8M | |
![[SND]](/icons/sound2.gif) | ЕГОРКРИДМакSимОтпускаю.mp3 | 2022-05-15 06:36 | 7.4M | |
![[SND]](/icons/sound2.gif) | миядзаки _ садаат - не убежать .mp3 | 2022-05-15 06:36 | 8.8M | |
![[SND]](/icons/sound2.gif) | Неговориолюбви.mp3 | 2022-05-15 06:36 | 7.1M | |
![[SND]](/icons/sound2.gif) | ИсламИтляшевКобра.mp3 | 2022-05-15 06:36 | 6.6M | |
![[SND]](/icons/sound2.gif) | КаспийскийГрузЧернаяВолга.mp3 | 2022-05-15 06:36 | 11M | |
![[SND]](/icons/sound2.gif) | TRUEтеньКукушка.mp3 | 2022-05-15 06:36 | 9.1M | |
![[SND]](/icons/sound2.gif) | Коктейль.mp3 | 2022-05-15 06:36 | 7.5M | |
![[SND]](/icons/sound2.gif) | БольшойРусскийБоссПогоня.mp3 | 2022-05-15 06:36 | 8.1M | |
![[SND]](/icons/sound2.gif) | dia.mp3 | 2022-05-15 06:35 | 3.3M | |
![[SND]](/icons/sound2.gif) | djtakkan.mp3 | 2022-05-15 06:22 | 2.7M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Dj Viral Terbaru __ Dj Selamat Ulang Tahun🍭Jedag Jedug Remix Terbaru 2021 (128 kbps).mp3 | 2022-05-15 06:21 | 5.0M | |
![[SND]](/icons/sound2.gif) | qq.mp3 | 2022-05-15 06:21 | 79K | |
![[SND]](/icons/sound2.gif) | OO.mp3 | 2022-05-15 06:20 | 2.0M | |
![[SND]](/icons/sound2.gif) | JessieVatutinWILDNIGHTSВсеМоиМыслиБабле.mp3 | 2022-05-15 06:19 | 7.0M | |
![[SND]](/icons/sound2.gif) | JessieVatutinWILDNIGHTSSTORIES.mp3 | 2022-05-15 06:19 | 10M | |
![[SND]](/icons/sound2.gif) | ArtikПривет.mp3 | 2022-05-15 06:19 | 7.8M | |
![[SND]](/icons/sound2.gif) | JessieVatutinЭдвард Билл.mp3 | 2022-05-15 06:19 | 4.9M | |
![[SND]](/icons/sound2.gif) | JessieVatutinСвевГолове.mp3 | 2022-05-15 06:19 | 0 | |
![[SND]](/icons/sound2.gif) | BigRussianBossJuniorГрязныйЮг.mp3 | 2022-05-15 06:19 | 8.9M | |
![[SND]](/icons/sound2.gif) | DenisKenzo.mp3 | 2022-05-15 06:19 | 8.8M | |
![[SND]](/icons/sound2.gif) | BenGoldTheCitySleepsTonight.mp3 | 2022-05-15 06:19 | 16M | |
![[SND]](/icons/sound2.gif) | BigRussianСмертвЯме.mp3 | 2022-05-15 06:19 | 7.6M | |
![[SND]](/icons/sound2.gif) | BIGRUSSIANBOSSКрасиваяжизнь.mp3 | 2022-05-15 06:19 | 9.2M | |
![[SND]](/icons/sound2.gif) | Wnd.mp3 | 2022-05-15 06:16 | 1.6M | |
![[SND]](/icons/sound2.gif) | stay.mp3 | 2022-05-15 06:16 | 779K | |
![[SND]](/icons/sound2.gif) | Boss.mp3 | 2022-05-15 06:15 | 3.1M | |
![[SND]](/icons/sound2.gif) | bae tamil song.mp3 | 2022-05-15 06:13 | 0 | |
![[SND]](/icons/sound2.gif) | trick.mp3 | 2022-05-15 06:12 | 0 | |
![[SND]](/icons/sound2.gif) | heymommy.mp3 | 2022-05-15 06:07 | 0 | |
![[SND]](/icons/sound2.gif) | cegacn.mp3 | 2022-05-15 06:07 | 0 | |
![[SND]](/icons/sound2.gif) | batchedo.mp3 | 2022-05-15 06:06 | 0 | |
![[SND]](/icons/sound2.gif) | 2022.mp3 | 2022-05-15 06:02 | 4.1M | |
![[SND]](/icons/sound2.gif) | R_p_t_t_r.mp3 | 2022-05-15 06:01 | 0 | |
![[SND]](/icons/sound2.gif) | k5Ax.mp3 | 2022-05-15 06:00 | 2.2M | |
![[SND]](/icons/sound2.gif) | con cua ba.mp3 | 2022-05-15 06:00 | 0 | |
![[SND]](/icons/sound2.gif) | Internship.mp3 | 2022-05-15 05:59 | 0 | |
![[SND]](/icons/sound2.gif) | Музыка для души (rmx).mp3 | 2022-05-15 05:59 | 0 | |
![[SND]](/icons/sound2.gif) | Бензема (rmx).mp3 | 2022-05-15 05:57 | 0 | |
![[SND]](/icons/sound2.gif) | Masked Wolf - Astronaut In The Ocean.mp3 | 2022-05-15 05:51 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Kiminoto เนื้อเพลง [SPRITE Feat. YOUNGOHM] ผมเจอผู้หญิงคนหนึ่ง เขาทำให้ใจผมไหว (128 kbps).mp3 | 2022-05-15 05:50 | 0 | |
![[SND]](/icons/sound2.gif) | ilhama.mp3 | 2022-05-15 05:50 | 0 | |
![[SND]](/icons/sound2.gif) | rawrr.mp3 | 2022-05-15 05:49 | 0 | |
![[SND]](/icons/sound2.gif) | ТАТАРИН, Татем - Пацаны из падиков (prod. by karmv) (prod. by karmv).mp3 | 2022-05-15 05:47 | 0 | |
![[SND]](/icons/sound2.gif) | Club.mp3 | 2022-05-15 05:45 | 0 | |
![[SND]](/icons/sound2.gif) | pilot-bratishka.mp3 | 2022-05-15 05:42 | 0 | |
![[SND]](/icons/sound2.gif) | Check_Please_-_Playboi_Carti_Unre_(getmp3.pro).mp3 | 2022-05-15 05:39 | 0 | |
![[SND]](/icons/sound2.gif) | intheend.mp3 | 2022-05-15 05:38 | 1.3M | |
![[SND]](/icons/sound2.gif) | ybn.mp3 | 2022-05-15 05:37 | 0 | |
![[SND]](/icons/sound2.gif) | hope.mp3 | 2022-05-15 05:36 | 1.6M | |
![[SND]](/icons/sound2.gif) | road123.mp3 | 2022-05-15 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | kompe.mp3 | 2022-05-15 05:33 | 3.0M | |
![[SND]](/icons/sound2.gif) | trickster.mp3 | 2022-05-15 05:32 | 0 | |
![[SND]](/icons/sound2.gif) | ocean.mp3 | 2022-05-15 05:30 | 0 | |
![[VID]](/icons/movie.gif) | Y2Mate.is - Perception-2d0brWJagoo-1080p-1652591731693.mp4 | 2022-05-15 05:30 | 0 | |
![[SND]](/icons/sound2.gif) | Nang tinh hay nang long.mp3 | 2022-05-15 05:27 | 0 | |
![[SND]](/icons/sound2.gif) | ganyang.mp3 | 2022-05-15 05:26 | 0 | |
![[SND]](/icons/sound2.gif) | beat_doan_tuyet_nang_di_remix_nhac_nen_florentino_khong_loi_hot_tiktok_va_day_la_florentino_-4820437926089827718.mp3 | 2022-05-15 05:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nặng Tình Hay Nhẹ Lòng WRC REMIX Tống Gia Vỹ Thà Rằng Người Hãy Nói Hết Để Anh Quay Lưng Bước Đi.mp3 | 2022-05-15 05:24 | 2.7M | |
![[SND]](/icons/sound2.gif) | apan1.mp3 | 2022-05-15 05:22 | 5.3M | |
![[SND]](/icons/sound2.gif) | cokasu4.mp3 | 2022-05-15 05:22 | 0 | |
![[SND]](/icons/sound2.gif) | cokasu5.mp3 | 2022-05-15 05:22 | 0 | |
![[SND]](/icons/sound2.gif) | Defri5.mp3 | 2022-05-15 05:22 | 0 | |
![[SND]](/icons/sound2.gif) | Defri4.mp3 | 2022-05-15 05:22 | 0 | |
![[SND]](/icons/sound2.gif) | Defri3.mp3 | 2022-05-15 05:21 | 0 | |
![[SND]](/icons/sound2.gif) | Defri2.mp3 | 2022-05-15 05:21 | 0 | |
![[SND]](/icons/sound2.gif) | em_van_chua_he_quen_duoc_ai_do_anh_chi_la_nguoi_thay_the_mr_siro_hui_remix_nhac_tik_tok_-2905908750671938245.mp3 | 2022-05-15 05:20 | 0 | |
![[SND]](/icons/sound2.gif) | Nahmir.mp3 | 2022-05-15 05:19 | 0 | |
![[SND]](/icons/sound2.gif) | reyy.mp3 | 2022-05-15 05:16 | 347K | |
![[SND]](/icons/sound2.gif) | Музыка для сабвуфера - track 70 cамая клубная музыка только у нас, заходи к нам http__vk.com_clubmusictlt (www.hotplayer.ru).mp3 | 2022-05-15 05:15 | 0 | |
![[SND]](/icons/sound2.gif) | 7077225980321975045.mp3 | 2022-05-15 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | Kaze2.mp3 | 2022-05-15 04:59 | 3.8M | |
![[SND]](/icons/sound2.gif) | Blue Bird.mp3 | 2022-05-15 04:57 | 0 | |
![[SND]](/icons/sound2.gif) | EzEzEz.mp3 | 2022-05-15 04:57 | 0 | |
![[SND]](/icons/sound2.gif) | Tony Kakkar - Dheeme Dheeme.mp3 | 2022-05-15 04:53 | 0 | |
![[SND]](/icons/sound2.gif) | Guni - lusavor husher 👐🏿 (premiere) ♥️_50k.mp3 | 2022-05-15 04:53 | 0 | |
![[SND]](/icons/sound2.gif) | Armenia_-_VNAS_-_Tap_tu_70375224.mp3 | 2022-05-15 04:52 | 0 | |
![[SND]](/icons/sound2.gif) | SLIZ - SIGE.mp3 | 2022-05-15 04:35 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - City of Winds and Idylls Disc 1 City of Winds and IdyllsGenshin Impact (2).mp3 | 2022-05-15 04:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nhạc donate mới của rambo chú ếch con remix.mp3.mp3 | 2022-05-15 04:33 | 0 | |
![[SND]](/icons/sound2.gif) | dre.mp3 | 2022-05-15 04:33 | 0 | |
![[SND]](/icons/sound2.gif) | Ascension.mp3 | 2022-05-15 04:31 | 0 | |
![[SND]](/icons/sound2.gif) | Ascension - Michele Nobler.mp3 | 2022-05-15 04:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - HOUSE LAK 2021 BE MY NICOTINE HOANGTAO.mp3 | 2022-05-15 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | husni8.mp3 | 2022-05-15 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | Nigger Ville.mp3 | 2022-05-15 04:20 | 0 | |
![[SND]](/icons/sound2.gif) | Comedoz_-_Ямайка.mp3 | 2022-05-15 04:19 | 0 | |
![[SND]](/icons/sound2.gif) | TY.mp3 | 2022-05-15 04:16 | 2.3M | |
![[SND]](/icons/sound2.gif) | epek.mp3 | 2022-05-15 04:08 | 0 | |
![[SND]](/icons/sound2.gif) | Sedih.mp3 | 2022-05-15 04:04 | 2.8M | |
![[SND]](/icons/sound2.gif) | 2 Pac - Hellrazor (Interscope Version Hook Mix).mp3 | 2022-05-15 03:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lagu Opening Ultraman Cosmos.mp3 | 2022-05-15 03:47 | 0 | |
![[SND]](/icons/sound2.gif) | GGG.mp3 | 2022-05-15 03:47 | 4.9M | |
![[SND]](/icons/sound2.gif) | abi15.mp3 | 2022-05-15 03:46 | 4.6M | |
![[SND]](/icons/sound2.gif) | abi14.mp3 | 2022-05-15 03:46 | 3.0M | |
![[SND]](/icons/sound2.gif) | abi13.mp3 | 2022-05-15 03:45 | 3.9M | |
![[SND]](/icons/sound2.gif) | ULT.mp3 | 2022-05-15 03:39 | 0 | |
![[SND]](/icons/sound2.gif) | disco.m4a | 2022-05-15 03:38 | 0 | |
![[SND]](/icons/sound2.gif) | sill.mp3 | 2022-05-15 03:35 | 0 | |
![[SND]](/icons/sound2.gif) | Subscribe yh Guys yh RULL edit 😀🙏.mp3 | 2022-05-15 03:34 | 0 | |
![[SND]](/icons/sound2.gif) | AkuSayangKamu.mp3 | 2022-05-15 03:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan lirik lagu NYAMAN Andmesh.mp3 | 2022-05-15 03:30 | 0 | |
![[SND]](/icons/sound2.gif) | Subscribe yh RULL Edit 😀🙏.mp3 | 2022-05-15 03:29 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu.mp3 | 2022-05-15 03:21 | 424K | |
![[SND]](/icons/sound2.gif) | music satu.mp3 | 2022-05-15 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | SQWOZ BAB ДЕТИ RAVE - КГБ (mp3store.cc).mp3 | 2022-05-15 03:11 | 0 | |
![[SND]](/icons/sound2.gif) | Dead_Rave_-_Devochka_2D_64657228.mp3 | 2022-05-15 03:05 | 0 | |
![[SND]](/icons/sound2.gif) | Conan.mp3 | 2022-05-15 03:03 | 0 | |
![[SND]](/icons/sound2.gif) | Conan Gray - Heather (Cover) with lyrics _ Arabelle Fegcan.mp3 | 2022-05-15 03:02 | 0 | |
![[SND]](/icons/sound2.gif) | Rock Me Baby (Finished).mp3 | 2022-05-15 03:02 | 0 | |
![[SND]](/icons/sound2.gif) | Sun8.mp3 | 2022-05-15 03:00 | 0 | |
![[SND]](/icons/sound2.gif) | Proyek+Baru+181+[5D31134].mp3 | 2022-05-15 02:58 | 0 | |
![[SND]](/icons/sound2.gif) | No1.mp3 | 2022-05-15 02:56 | 0 | |
![[SND]](/icons/sound2.gif) | vo1.mp3 | 2022-05-15 02:55 | 0 | |
![[SND]](/icons/sound2.gif) | kkkkkooo.mp3 | 2022-05-15 02:49 | 0 | |
![[SND]](/icons/sound2.gif) | fk.mp3 | 2022-05-15 02:47 | 0 | |
![[SND]](/icons/sound2.gif) | โกโรโกโส.mp3 | 2022-05-15 02:46 | 0 | |
![[SND]](/icons/sound2.gif) | 34khg.mp3 | 2022-05-15 02:46 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Owen - ในคืนที่ feat.อภิชัย [ Official Video] (128 kbps).mp3 | 2022-05-15 02:44 | 0 | |
![[SND]](/icons/sound2.gif) | vago.mp3 | 2022-05-15 02:44 | 3.0M | |
![[SND]](/icons/sound2.gif) | Skillibeng Binladenn.mp3 | 2022-05-15 02:43 | 0 | |
![[SND]](/icons/sound2.gif) | Skillibeng Not.mp3 | 2022-05-15 02:36 | 0 | |
![[SND]](/icons/sound2.gif) | congrats.mp3 | 2022-05-15 02:35 | 0 | |
![[SND]](/icons/sound2.gif) | congrats (online-audio-converter.com).mp3 | 2022-05-15 02:34 | 0 | |
![[SND]](/icons/sound2.gif) | flo.mp3 | 2022-05-15 02:33 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Bandaneira _Sampai Jadi Debu_ (unofficial music video) (128 kbps).mp3 | 2022-05-15 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | hh_sample.mp3 | 2022-05-15 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | Wuuha-ft закон каменных джунглей зкд ,zkd - Минус (instrumental) (Хип-хапчик).mp3 | 2022-05-15 02:28 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Rap do Naruto _ Tauz RapTributo 05 (320 kbps).mp3 | 2022-05-15 02:21 | 0 | |
![[SND]](/icons/sound2.gif) | Skillibeng Binladen.mp3 | 2022-05-15 02:21 | 576K | |
![[SND]](/icons/sound2.gif) | Lilx.mp3 | 2022-05-15 02:10 | 3.7M | |
![[SND]](/icons/sound2.gif) | Tuu_Tui.mp3 | 2022-05-15 02:09 | 0 | |
![[SND]](/icons/sound2.gif) | lKILL.mp3 | 2022-05-15 02:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | 1MILL.mp3 | 2022-05-15 02:09 | 0 | |
![[SND]](/icons/sound2.gif) | MILL.mp3 | 2022-05-15 02:05 | 3.0M | |
![[SND]](/icons/sound2.gif) | X2Download.com - instrumental baon cikadap (320 kbps).mp3 | 2022-05-15 01:56 | 0 | |
![[SND]](/icons/sound2.gif) | SARAN.mp3 | 2022-05-15 01:54 | 1.9M | |
![[SND]](/icons/sound2.gif) | GATV.mp3 | 2022-05-15 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - กล่องเสียง CJB-118K (128 kbps).mp3 | 2022-05-15 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | P6ICK.mp3 | 2022-05-15 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | Gmcar.mp3 | 2022-05-15 01:52 | 0 | |
![[SND]](/icons/sound2.gif) | FREE.mp3 | 2022-05-15 01:52 | 0 | |
![[SND]](/icons/sound2.gif) | Kodak Black - Gleerious [Official Audio].mp3 | 2022-05-15 01:51 | 0 | |
![[SND]](/icons/sound2.gif) | MEGA.mp3 | 2022-05-15 01:51 | 0 | |
![[SND]](/icons/sound2.gif) | latenight.mp3 | 2022-05-15 01:49 | 55M | |
![[SND]](/icons/sound2.gif) | ROV.mp3 | 2022-05-15 01:48 | 1.6M | |
![[SND]](/icons/sound2.gif) | Kareem12.mp3 | 2022-05-15 01:47 | 0 | |
![[SND]](/icons/sound2.gif) | Skofka - Не забудем і не пробачим.mp3 | 2022-05-15 01:45 | 0 | |
![[SND]](/icons/sound2.gif) | Drex1.mp3 | 2022-05-15 01:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Indila Love story Sped up.mp3 | 2022-05-15 01:44 | 0 | |
![[SND]](/icons/sound2.gif) | gta san.mp3 | 2022-05-15 01:43 | 0 | |
![[SND]](/icons/sound2.gif) | GTA.mp3 | 2022-05-15 01:40 | 2.6M | |
![[SND]](/icons/sound2.gif) | Mailbox.mp3 | 2022-05-15 01:36 | 0 | |
![[SND]](/icons/sound2.gif) | Uploader.mp3 | 2022-05-15 01:35 | 0 | |
![[SND]](/icons/sound2.gif) | Drive.mp3 | 2022-05-15 01:34 | 0 | |
![[SND]](/icons/sound2.gif) | the world.mp3 | 2022-05-15 01:33 | 0 | |
![[SND]](/icons/sound2.gif) | sun.mp3 | 2022-05-15 01:32 | 464K | |
![[SND]](/icons/sound2.gif) | Duang.mp3 | 2022-05-15 01:30 | 0 | |
![[SND]](/icons/sound2.gif) | Y16.mp3 | 2022-05-15 01:27 | 0 | |
![[SND]](/icons/sound2.gif) | AJB.mp3 | 2022-05-15 01:27 | 0 | |
![[SND]](/icons/sound2.gif) | minang123.mp3 | 2022-05-15 01:26 | 0 | |
![[SND]](/icons/sound2.gif) | minang.mp3 | 2022-05-15 01:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Workout Mix 2020 STOP x START Psytrance Mix 2020.mp3 | 2022-05-15 01:24 | 0 | |
![[SND]](/icons/sound2.gif) | Moon2.mp3 | 2022-05-15 01:23 | 0 | |
![[SND]](/icons/sound2.gif) | Free1.mp3 | 2022-05-15 01:22 | 0 | |
![[SND]](/icons/sound2.gif) | Free.mp3 | 2022-05-15 01:20 | 1.1M | |
![[SND]](/icons/sound2.gif) | Foo.mp3 | 2022-05-15 01:19 | 0 | |
![[SND]](/icons/sound2.gif) | Lo Ki - Kagome (Official Music Video).mp3 | 2022-05-15 01:18 | 3.8M | |
![[SND]](/icons/sound2.gif) | Ultraman Cosmos Op.mp3 | 2022-05-15 01:16 | 644K | |
![[SND]](/icons/sound2.gif) | armada.mp3 | 2022-05-15 01:15 | 6.5M | |
![[SND]](/icons/sound2.gif) | foon.mp3 | 2022-05-15 01:11 | 2.8M | |
![[SND]](/icons/sound2.gif) | Dong16.mp3 | 2022-05-15 01:11 | 0 | |
![[SND]](/icons/sound2.gif) | Dong10.mp3 | 2022-05-15 01:11 | 0 | |
![[SND]](/icons/sound2.gif) | Everything I wanted (Ivory Edit) Billie Eilish.mp3 | 2022-05-15 01:07 | 0 | |
![[SND]](/icons/sound2.gif) | FF.mp3 | 2022-05-15 01:05 | 0 | |
![[SND]](/icons/sound2.gif) | Jod.mp3 | 2022-05-15 01:05 | 0 | |
![[SND]](/icons/sound2.gif) | wesley1.mp3 | 2022-05-15 01:01 | 4.1M | |
![[SND]](/icons/sound2.gif) | wesley2.mp3 | 2022-05-15 01:00 | 0 | |
![[SND]](/icons/sound2.gif) | Happy-Birthday-Mother-song.mp3 | 2022-05-15 00:58 | 0 | |
![[SND]](/icons/sound2.gif) | HappyBirthdayM.mp3 | 2022-05-15 00:55 | 0 | |
![[SND]](/icons/sound2.gif) | madam1.mp3 | 2022-05-15 00:54 | 504K | |
![[SND]](/icons/sound2.gif) | NO SELF CONTROL (mastered 1).mp3 | 2022-05-15 00:52 | 0 | |
![[SND]](/icons/sound2.gif) | madam2.mp3 | 2022-05-15 00:50 | 0 | |
![[SND]](/icons/sound2.gif) | wesley.mp3 | 2022-05-15 00:44 | 3.9M | |
![[SND]](/icons/sound2.gif) | RealLife.mp3 | 2022-05-15 00:36 | 0 | |
![[SND]](/icons/sound2.gif) | sayaanimeh.mp3 | 2022-05-15 00:34 | 0 | |
![[SND]](/icons/sound2.gif) | Alan-Walker-vs-Coldplay-Hymn-For-The-Weekend-Remix_mOivOlP9GRk.mp3 | 2022-05-15 00:31 | 0 | |
![[SND]](/icons/sound2.gif) | DJ River Flows in You (Breakbeat Remix) 2019 (128 kbps).mp3 | 2022-05-15 00:28 | 0 | |
![[SND]](/icons/sound2.gif) | RP.mp3 | 2022-05-15 00:25 | 1.5M | |
![[SND]](/icons/sound2.gif) | Puisi raja.mp3 | 2022-05-15 00:22 | 0 | |
![[SND]](/icons/sound2.gif) | depp.mp3 | 2022-05-15 00:19 | 0 | |
![[SND]](/icons/sound2.gif) | arkaida_-_teper__vali_muzati.net.mp3 | 2022-05-15 00:15 | 0 | |
![[SND]](/icons/sound2.gif) | You'll_Never_Walk_Alone.mp3 | 2022-05-15 00:13 | 0 | |
![[SND]](/icons/sound2.gif) | Boris1.mp3 | 2022-05-15 00:08 | 0 | |
![[SND]](/icons/sound2.gif) | kenn1.mp3 | 2022-05-15 00:06 | 4.2M | |
![[SND]](/icons/sound2.gif) | ram11.mp3 | 2022-05-14 23:57 | 0 | |
![[SND]](/icons/sound2.gif) | ram10.mp3 | 2022-05-14 23:56 | 0 | |
![[SND]](/icons/sound2.gif) | ram6.mp3 | 2022-05-14 23:54 | 0 | |
![[SND]](/icons/sound2.gif) | ram5.mp3 | 2022-05-14 23:53 | 0 | |
![[SND]](/icons/sound2.gif) | Happy Hogwarts [Orchestral Version] - Jeremy Soule (Harry Potter 2001 Game OST).mp3 | 2022-05-14 23:49 | 0 | |
![[SND]](/icons/sound2.gif) | KBK.mp3 | 2022-05-14 23:45 | 4.5M | |
![[SND]](/icons/sound2.gif) | lofi2.mp3 | 2022-05-14 23:41 | 2.9M | |
![[SND]](/icons/sound2.gif) | lofi40.mp3 | 2022-05-14 23:40 | 0 | |
![[SND]](/icons/sound2.gif) | Sz.mp3 | 2022-05-14 23:39 | 2.9M | |
![[SND]](/icons/sound2.gif) | lofi28.mp3 | 2022-05-14 23:39 | 2.5M | |
![[SND]](/icons/sound2.gif) | lofi39.mp3 | 2022-05-14 23:39 | 6.8M | |
![[SND]](/icons/sound2.gif) | lofi38.mp3 | 2022-05-14 23:39 | 3.9M | |
![[SND]](/icons/sound2.gif) | ram4.mp3 | 2022-05-14 23:39 | 3.8M | |
![[SND]](/icons/sound2.gif) | lofi37.mp3 | 2022-05-14 23:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | lofi36.mp3 | 2022-05-14 23:38 | 2.9M | |
![[SND]](/icons/sound2.gif) | lofi35.mp3 | 2022-05-14 23:36 | 3.7M | |
![[SND]](/icons/sound2.gif) | lofi34.mp3 | 2022-05-14 23:36 | 6.3M | |
![[SND]](/icons/sound2.gif) | lofi33.mp3 | 2022-05-14 23:36 | 4.6M | |
![[SND]](/icons/sound2.gif) | lofi32.mp3 | 2022-05-14 23:35 | 2.4M | |
![[SND]](/icons/sound2.gif) | lofi1.mp3 | 2022-05-14 23:34 | 3.3M | |
![[SND]](/icons/sound2.gif) | lofi30.mp3 | 2022-05-14 23:33 | 0 | |
![[SND]](/icons/sound2.gif) | lofi29.mp3 | 2022-05-14 23:33 | 0 | |
![[SND]](/icons/sound2.gif) | Js.mp3 | 2022-05-14 23:32 | 1.0M | |
![[SND]](/icons/sound2.gif) | lofi31.mp3 | 2022-05-14 23:32 | 1.5M | |
![[SND]](/icons/sound2.gif) | On.mp3 | 2022-05-14 23:32 | 3.3M | |
![[SND]](/icons/sound2.gif) | lofi9.mp3 | 2022-05-14 23:30 | 2.7M | |
![[SND]](/icons/sound2.gif) | smoke.mp3 | 2022-05-14 23:28 | 0 | |
![[SND]](/icons/sound2.gif) | pklm.mp3 | 2022-05-14 23:27 | 0 | |
![[SND]](/icons/sound2.gif) | nicholas naison - smoke.mp3 | 2022-05-14 23:27 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ MINEFIELD SLOW ANGKLUNG VIRAL TIK TOK (128 kbps).mp3 | 2022-05-14 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Free Spooky Type Beat 2019 Venom TrapRap Instrument บทแรพหลอนๆ 2019.mp3 | 2022-05-14 22:55 | 0 | |
![[SND]](/icons/sound2.gif) | Mr Kredo - Чудная Долина.mp3 | 2022-05-14 22:52 | 3.7M | |
![[SND]](/icons/sound2.gif) | enos.mp3 | 2022-05-14 22:45 | 0 | |
![[SND]](/icons/sound2.gif) | favoritetextproject.mp3 | 2022-05-14 22:43 | 0 | |
![[SND]](/icons/sound2.gif) | Sweet.mp3 | 2022-05-14 22:43 | 0 | |
![[SND]](/icons/sound2.gif) | Lathi.mp3 | 2022-05-14 22:42 | 0 | |
![[SND]](/icons/sound2.gif) | rana15.mp3 | 2022-05-14 22:42 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Dj Old Minefield X Mashup Campuran Dj Campuran Viral Yang Kalian Cari Cari!! - DJ SANTUY (128 kbps)(1).mp3 | 2022-05-14 22:40 | 0 | |
![[SND]](/icons/sound2.gif) | narcos-mexican-latin-rap-beat-narcos-theme-instrumental-80.4-141.mp3 | 2022-05-14 22:37 | 0 | |
![[SND]](/icons/sound2.gif) | HappyBirthday_DuckSong.mp3 | 2022-05-14 22:31 | 0 | |
![[SND]](/icons/sound2.gif) | dj_old_minefield_x_mashup_selow_tik_tok_viral_terbaru_2021_389631984672264656.mp3 | 2022-05-14 22:07 | 0 | |
![[SND]](/icons/sound2.gif) | Неизвестен-Без названия-kissvk.com.mp3 | 2022-05-14 22:04 | 1.7M | |
![[SND]](/icons/sound2.gif) | Vip15.mp3 | 2022-05-14 22:03 | 0 | |
![[SND]](/icons/sound2.gif) | Vip14.mp3 | 2022-05-14 22:03 | 0 | |
![[SND]](/icons/sound2.gif) | Vip13.mp3 | 2022-05-14 22:03 | 0 | |
![[SND]](/icons/sound2.gif) | zeropride11.mp3 | 2022-05-14 21:54 | 0 | |
![[SND]](/icons/sound2.gif) | ZeroPride.mp3 | 2022-05-14 21:52 | 0 | |
![[SND]](/icons/sound2.gif) | ME_Blitz_Original Mix.mp3 | 2022-05-14 21:51 | 0 | |
![[SND]](/icons/sound2.gif) | Dreams - Fleetwood Mac (Lyrics) 🎵 (URBANOMP3.NET).mp3 | 2022-05-14 21:38 | 0 | |
![[SND]](/icons/sound2.gif) | Vdomemoem.mp3 | 2022-05-14 21:28 | 0 | |
![[SND]](/icons/sound2.gif) | arcade5.mp3 | 2022-05-14 21:18 | 0 | |
![[SND]](/icons/sound2.gif) | No Surprises - Radiohead.mp3 | 2022-05-14 21:04 | 0 | |
![[SND]](/icons/sound2.gif) | Nekoglai_-_Razryvnaya_73820019.mp3 | 2022-05-14 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | pockey.mp3 | 2022-05-14 20:54 | 0 | |
![[SND]](/icons/sound2.gif) | The_Weeknd_-_Blinding_Lights_67509023.mp3 | 2022-05-14 20:53 | 0 | |
![[SND]](/icons/sound2.gif) | Broccoli.mp3 | 2022-05-14 20:48 | 0 | |
![[SND]](/icons/sound2.gif) | Antonio.mp3 | 2022-05-14 20:44 | 0 | |
![[SND]](/icons/sound2.gif) | Gidayyat_Hovannii_-_Sombrero_64519704.mp3 | 2022-05-14 20:39 | 0 | |
![[SND]](/icons/sound2.gif) | ditjacha_tancjuvalna_muzika_-_ljali-pop_(z2.fm).mp3 | 2022-05-14 20:33 | 0 | |
![[SND]](/icons/sound2.gif) | joke_drum_effect (1).mp3 | 2022-05-14 20:30 | 0 | |
![[SND]](/icons/sound2.gif) | Bahh Tee - 10 лет спустя (Bonus track).mp3 | 2022-05-14 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | life-of-a-wandering-wizard-15549.mp3 | 2022-05-14 20:27 | 0 | |
![[SND]](/icons/sound2.gif) | Payung_Teduh_-_Resah(128k)(2).mp3 | 2022-05-14 20:20 | 0 | |
![[SND]](/icons/sound2.gif) | D9X.mp3 | 2022-05-14 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | neket.mp3 | 2022-05-14 20:11 | 0 | |
![[SND]](/icons/sound2.gif) | YT3.mp3 | 2022-05-14 20:06 | 0 | |
![[SND]](/icons/sound2.gif) | YT2.mp3 | 2022-05-14 20:05 | 432K | |
![[SND]](/icons/sound2.gif) | 163ONMYNECK, SEEMEE - ПЕРЕВЕС.mp3 | 2022-05-14 20:05 | 0 | |
![[SND]](/icons/sound2.gif) | ezel.mp3 | 2022-05-14 20:04 | 0 | |
![[SND]](/icons/sound2.gif) | BG0.mp3 | 2022-05-14 20:04 | 0 | |
![[SND]](/icons/sound2.gif) | B2B.mp3 | 2022-05-14 20:03 | 0 | |
![[SND]](/icons/sound2.gif) | RACHEL.mp3 | 2022-05-14 20:01 | 0 | |
![[SND]](/icons/sound2.gif) | 163ONMYNECK, SEEMEE - ПЕРЕВЕС (1).mp3 | 2022-05-14 20:01 | 0 | |
![[SND]](/icons/sound2.gif) | Axel3.mp3 | 2022-05-14 19:58 | 0 | |
![[SND]](/icons/sound2.gif) | Doglas1.mp3 | 2022-05-14 19:57 | 0 | |
![[SND]](/icons/sound2.gif) | sabaton-christmas-truce.mp3 | 2022-05-14 19:57 | 0 | |
![[SND]](/icons/sound2.gif) | insta.mp3 | 2022-05-14 19:54 | 0 | |
![[SND]](/icons/sound2.gif) | KENYA.mp3 | 2022-05-14 19:54 | 0 | |
![[SND]](/icons/sound2.gif) | BassHub [Bass Prod. by #bucksbunny] — NIGHTMORSS - SECRET (www.lightaudio.ru).mp3 | 2022-05-14 19:50 | 0 | |
![[SND]](/icons/sound2.gif) | chin-giz-stvol.mp3 | 2022-05-14 19:46 | 0 | |
![[SND]](/icons/sound2.gif) | SHAKE.mp3 | 2022-05-14 19:43 | 2.4M | |
![[SND]](/icons/sound2.gif) | 1652107735912.mp3 | 2022-05-14 19:40 | 0 | |
![[SND]](/icons/sound2.gif) | T2N.mp3 | 2022-05-14 19:36 | 0 | |
![[SND]](/icons/sound2.gif) | SP5.mp3 | 2022-05-14 19:33 | 0 | |
![[SND]](/icons/sound2.gif) | friday-the-13th-the-game-ki-ki-ki-ma-ma-ma-sound-effect.mp3 | 2022-05-14 19:30 | 0 | |
![[SND]](/icons/sound2.gif) | X1D.mp3 | 2022-05-14 19:22 | 0 | |
![[SND]](/icons/sound2.gif) | mp3indirdur-Mahmut-Tuncer-Kime-Ne-Faydasi-Var.mp3 | 2022-05-14 19:21 | 0 | |
![[SND]](/icons/sound2.gif) | kntl.mp3 | 2022-05-14 19:21 | 0 | |
![[SND]](/icons/sound2.gif) | AUTO DA BARCA DO INFERNO Teatro por Cultural Kids.mp3 | 2022-05-14 19:19 | 0 | |
![[SND]](/icons/sound2.gif) | isco5.mp3 | 2022-05-14 19:16 | 416K | |
![[SND]](/icons/sound2.gif) | lebur.mp3 | 2022-05-14 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | faz.mp3 | 2022-05-14 19:13 | 0 | |
![[SND]](/icons/sound2.gif) | X5D.mp3 | 2022-05-14 19:13 | 0 | |
![[SND]](/icons/sound2.gif) | mereka.mp3 | 2022-05-14 19:13 | 0 | |
![[SND]](/icons/sound2.gif) | Барби - А я барби герл я люблю футбол и дирол.mp3 | 2022-05-14 19:12 | 1.5M | |
![[SND]](/icons/sound2.gif) | roni.mp3 | 2022-05-14 19:11 | 0 | |
![[SND]](/icons/sound2.gif) | vagos2.mp3 | 2022-05-14 19:11 | 0 | |
![[SND]](/icons/sound2.gif) | Armenia🇦🇲-VNAS - Tap tu-textmp3.ru.mp3 | 2022-05-14 19:10 | 0 | |
![[SND]](/icons/sound2.gif) | pb4.mp3 | 2022-05-14 18:59 | 5.3M | |
![[SND]](/icons/sound2.gif) | MiyaGi ft. Эндшпиль - Бадабум.mp3 | 2022-05-14 18:56 | 0 | |
![[SND]](/icons/sound2.gif) | Bass Armenia🇦🇲-VNAS - Tap tu-textmp3.ru.mp3 | 2022-05-14 18:55 | 0 | |
![[SND]](/icons/sound2.gif) | JOGET.mp3 | 2022-05-14 18:54 | 0 | |
![[SND]](/icons/sound2.gif) | vnas-hly-mihat-tap-tu-lsi-heto-cap-tu-narkozz-remix-undershit-v3-album.mp3 | 2022-05-14 18:54 | 0 | |
![[SND]](/icons/sound2.gif) | HARRIES.mp3 | 2022-05-14 18:53 | 0 | |
![[SND]](/icons/sound2.gif) | Neulovimyj_Pust_mezhdu_nami_ad.mp3 | 2022-05-14 18:53 | 0 | |
![[SND]](/icons/sound2.gif) | Fugees - Killing Me Softly With His Song (Official Video).mp3 | 2022-05-14 18:52 | 0 | |
![[SND]](/icons/sound2.gif) | muzlome_Hipinoze_Counterparty_Original_Mix_TerritoryDeepHouse_57758150.mp3 | 2022-05-14 18:51 | 0 | |
![[SND]](/icons/sound2.gif) | Alta Ouses & Yungg Trip - Whine (feat. Kabaka Pyramid).mp3 | 2022-05-14 18:48 | 0 | |
![[SND]](/icons/sound2.gif) | Sirius - Amen Or Aman Or (2020) Www.mp3erger.com.mp3 | 2022-05-14 18:47 | 0 | |
![[SND]](/icons/sound2.gif) | Dj yayo Lento lento (by vanadzor.bass).mp3 | 2022-05-14 18:46 | 0 | |
![[VID]](/icons/movie.gif) | ba9fa89e9b70dea0c5c231cc1d697cf0.mp4 | 2022-05-14 18:43 | 0 | |
![[SND]](/icons/sound2.gif) | jingga.mp3 | 2022-05-14 18:41 | 0 | |
![[SND]](/icons/sound2.gif) | Hades Cherri.mp3 | 2022-05-14 18:40 | 0 | |
![[SND]](/icons/sound2.gif) | Gio_PiKa_-_ontanchik_s_delfinom_Adam_Maniac_Imanbek_Remix_68070636.mp3 | 2022-05-14 18:39 | 0 | |
![[SND]](/icons/sound2.gif) | kingdom-come-deliverance-music-of-the-land-soundtrack-high-quality-with-tracklist.mp3 | 2022-05-14 18:35 | 0 | |
![[SND]](/icons/sound2.gif) | Bloom ~ Intro.mp3 | 2022-05-14 18:33 | 0 | |
![[SND]](/icons/sound2.gif) | Debate Scrum.mp3 | 2022-05-14 18:31 | 0 | |
![[SND]](/icons/sound2.gif) | arya.mp3 | 2022-05-14 18:31 | 0 | |
![[SND]](/icons/sound2.gif) | Despair Searching.mp3 | 2022-05-14 18:30 | 0 | |
![[SND]](/icons/sound2.gif) | vagos.mp3 | 2022-05-14 18:28 | 0 | |
![[SND]](/icons/sound2.gif) | _Kemerovo_142_РФ_🦅🖤 - 💧капли с твоих щёк💧.mp3 | 2022-05-14 18:25 | 0 | |
![[SND]](/icons/sound2.gif) | Love Buzz - HSD.mp3 | 2022-05-14 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | ANTO.mp3 | 2022-05-14 18:21 | 0 | |
![[SND]](/icons/sound2.gif) | pososi.mp3 | 2022-05-14 18:20 | 0 | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN - Пососи.mp3 | 2022-05-14 18:20 | 0 | |
![[SND]](/icons/sound2.gif) | Unknown — Hop Along- Bruno is Orange Lyrics (www.lightaudio.ru).mp3 | 2022-05-14 18:20 | 0 | |
![[SND]](/icons/sound2.gif) | aft.mp3 | 2022-05-14 18:16 | 0 | |
![[SND]](/icons/sound2.gif) | Gyoo.mp3 | 2022-05-14 18:16 | 0 | |
![[SND]](/icons/sound2.gif) | pornofilmy-ya-tak-soskuchilsya-mp3.mp3 | 2022-05-14 18:14 | 0 | |
![[SND]](/icons/sound2.gif) | sigi(BERSSERKER flip)(www.hotplayer.ru).mp3 | 2022-05-14 18:13 | 0 | |
![[SND]](/icons/sound2.gif) | QWERTY.mp3 | 2022-05-14 18:12 | 0 | |
![[SND]](/icons/sound2.gif) | พวกกู¹ᴍ🔥สมิท★_★_.mp3 | 2022-05-14 18:11 | 0 | |
![[SND]](/icons/sound2.gif) | P6ICK - BENZ. Ft. SARAN , Black Heart , 1ST _ [เพลงที่ถูกลบ].mp3 | 2022-05-14 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | КиноПачкаСигарет(BERSSERKER flip)(www.hotplayer.ru).mp3 | 2022-05-14 18:10 | 0 | |
![[VID]](/icons/movie.gif) | Snaptik_7091690843307855131_youtube-kapten-asia.mp4 | 2022-05-14 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | Включай Микрофон! - Сам себе соперник.mp3 | 2022-05-14 18:08 | 0 | |
![[SND]](/icons/sound2.gif) | AA_Mail_Notification.mp3 | 2022-05-14 18:07 | 0 | |
![[SND]](/icons/sound2.gif) | Включай Микрофон! - Самый ужасный поступок на свете — копия.mp3 | 2022-05-14 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | rapapam.mp3.mp3 | 2022-05-14 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | Включай Микрофон! - Самый ужасный поступок на свете.mp3 | 2022-05-14 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | My Chemical Romance - The Foundations of Decay - better vocal mix.mp3 | 2022-05-14 18:02 | 0 | |
![[SND]](/icons/sound2.gif) | rana10.mp3 | 2022-05-14 18:02 | 3.5M | |
![[SND]](/icons/sound2.gif) | Audio 14-05-2022 19-59-01.m4a | 2022-05-14 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | yasnyj-moj-svet-ty-napishi-mne-tatyana-bulanova-velum-remix.mp3 | 2022-05-14 18:00 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursed_-_Never_Enough_73932138.mp3 | 2022-05-14 18:00 | 0 | |
![[SND]](/icons/sound2.gif) | длб - катка (buzsquez Remix).mp3 | 2022-05-14 17:56 | 6.6M | |
![[SND]](/icons/sound2.gif) | Минин - Зелёный Глаз.mp3 | 2022-05-14 17:56 | 4.4M | |
![[SND]](/icons/sound2.gif) | arya-1.mp3 | 2022-05-14 17:55 | 0 | |
![[SND]](/icons/sound2.gif) | Dj RIP Love Viral Tiktok 2022.mp3 | 2022-05-14 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | Maria V01.mp3 | 2022-05-14 17:44 | 0 | |
![[SND]](/icons/sound2.gif) | LIA1.mp3 | 2022-05-14 17:42 | 0 | |
![[SND]](/icons/sound2.gif) | YT4.mp3 | 2022-05-14 17:39 | 0 | |
![[SND]](/icons/sound2.gif) | LiA.mp3 | 2022-05-14 17:38 | 0 | |
![[SND]](/icons/sound2.gif) | YT1.mp3 | 2022-05-14 17:38 | 892K | |
![[SND]](/icons/sound2.gif) | ck1.mp3 | 2022-05-14 17:35 | 3.8M | |
![[SND]](/icons/sound2.gif) | litvinenko-op-musorok-mp3.mp3 | 2022-05-14 17:35 | 0 | |
![[SND]](/icons/sound2.gif) | Nat King Cole - Pick Yourself Up.mp3 | 2022-05-14 17:33 | 0 | |
![[SND]](/icons/sound2.gif) | serebro-not-enough-of-you-bassnpanda-remix.mp3 | 2022-05-14 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | alanwalkerlagu.mp3 | 2022-05-14 17:24 | 760K | |
![[SND]](/icons/sound2.gif) | OP.mp3 | 2022-05-14 17:23 | 2.3M | |
![[SND]](/icons/sound2.gif) | PO.mp3 | 2022-05-14 17:23 | 0 | |
![[SND]](/icons/sound2.gif) | AlanWalkerSingMeToSleep.mp3 | 2022-05-14 17:21 | 0 | |
![[SND]](/icons/sound2.gif) | Joe Layne — Portrait [ OST Счастье ] (www.lightaudio.ru).mp3 | 2022-05-14 17:19 | 0 | |
![[SND]](/icons/sound2.gif) | PussykillerEksiKontakt.mp3 | 2022-05-14 17:18 | 0 | |
![[SND]](/icons/sound2.gif) | Alan Walker Sing Me To Sleep.mp3 | 2022-05-14 17:18 | 0 | |
![[SND]](/icons/sound2.gif) | Pussykiller_Eksi_Kontakt.mp3 | 2022-05-14 17:17 | 0 | |
![[SND]](/icons/sound2.gif) | robbery cover.mp3 | 2022-05-14 17:17 | 0 | |
![[SND]](/icons/sound2.gif) | Alan Walker - Sing Me To Sleep (Lyrics).mp3 | 2022-05-14 17:12 | 0 | |
![[SND]](/icons/sound2.gif) | Ck2.mp3 | 2022-05-14 17:12 | 0 | |
![[SND]](/icons/sound2.gif) | Kamalayaan.mp3 | 2022-05-14 17:11 | 0 | |
![[SND]](/icons/sound2.gif) | Apo Hiking Society - When I Met You.mp3 | 2022-05-14 17:06 | 1.1M | |
![[SND]](/icons/sound2.gif) | Y2Mate.is - Civ 5 Wonder Sound-VgwFUA0ygqE-160k-1652547680784.mp3 | 2022-05-14 17:04 | 48K | |
![[SND]](/icons/sound2.gif) | faren.mp3 | 2022-05-14 16:58 | 0 | |
![[SND]](/icons/sound2.gif) | Lemonindo(koplo).mp3 | 2022-05-14 16:56 | 4.5M | |
![[SND]](/icons/sound2.gif) | markpr2.mp3 | 2022-05-14 16:56 | 0 | |
![[SND]](/icons/sound2.gif) | Zack Tabudlo - Give Me Your Forever.mp3 | 2022-05-14 16:55 | 0 | |
![[SND]](/icons/sound2.gif) | Jaman.mp3 | 2022-05-14 16:53 | 2.9M | |
![[SND]](/icons/sound2.gif) | decida_ao_vivo_-8178543979136234959.mp3 | 2022-05-14 16:53 | 0 | |
![[SND]](/icons/sound2.gif) | ram3.mp3 | 2022-05-14 16:53 | 1.9M | |
![[SND]](/icons/sound2.gif) | tian.mp3 | 2022-05-14 16:51 | 1.7M | |
![[SND]](/icons/sound2.gif) | ram2.mp3 | 2022-05-14 16:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | นี่หรือ คู่กรรม.mp3 | 2022-05-14 16:40 | 14M | |
![[SND]](/icons/sound2.gif) | DJ Ya Cuman amu.mp3 | 2022-05-14 16:39 | 374K | |
![[SND]](/icons/sound2.gif) | bagus.mp3 | 2022-05-14 16:37 | 2.8M | |
![[SND]](/icons/sound2.gif) | ram1.mp3 | 2022-05-14 16:36 | 2.7M | |
![[SND]](/icons/sound2.gif) | wow1.mp3 | 2022-05-14 16:35 | 2.2M | |
![[SND]](/icons/sound2.gif) | serakiaWz.mp3 | 2022-05-14 16:35 | 0 | |
![[SND]](/icons/sound2.gif) | cesta.mp3 | 2022-05-14 16:33 | 0 | |
![[SND]](/icons/sound2.gif) | DJ Ya Cuman Kamu.mp3 | 2022-05-14 16:32 | 0 | |
![[SND]](/icons/sound2.gif) | Denny Caknan SATRU 2 Official Music Video.mp3 | 2022-05-14 16:32 | 0 | |
![[SND]](/icons/sound2.gif) | OGLOCCO.mp3 | 2022-05-14 16:32 | 0 | |
![[SND]](/icons/sound2.gif) | morgenshtern-timati-el-problema-mp3.mp3 | 2022-05-14 16:31 | 5.3M | |
![[SND]](/icons/sound2.gif) | GANG2x.mp3 | 2022-05-14 16:30 | 0 | |
![[SND]](/icons/sound2.gif) | Curva Sud Casablanca _ Mi Corazon(MP3_320K).mp3 | 2022-05-14 16:29 | 0 | |
![[SND]](/icons/sound2.gif) | Ganggang.mp3 | 2022-05-14 16:28 | 0 | |
![[SND]](/icons/sound2.gif) | c1.mp3 | 2022-05-14 16:28 | 3.2M | |
![[SND]](/icons/sound2.gif) | Дора-—-Loverboy.mp3 | 2022-05-14 16:25 | 0 | |
![[SND]](/icons/sound2.gif) | needyou.mp3 | 2022-05-14 16:24 | 0 | |
![[SND]](/icons/sound2.gif) | need.mp3 | 2022-05-14 16:22 | 5.4M | |
![[SND]](/icons/sound2.gif) | gfdcrfyurfhyu.mp3 | 2022-05-14 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | DJ Ya Cuman Kamu X Beryanyi Jedag Jedug Viral TikTok 2022!! - Sahrul Ckn (mp3cut.net).mp3 | 2022-05-14 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | mark2.mp3 | 2022-05-14 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | mark1.mp3 | 2022-05-14 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | ximangpho69.mp3 | 2022-05-14 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | baylen96.mp3 | 2022-05-14 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | heyheyhey99.mp3 | 2022-05-14 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | hpdoita89.mp3 | 2022-05-14 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | phaichiataythoi98.mp3 | 2022-05-14 16:18 | 0 | |
![[VID]](/icons/movie.gif) | HD2022-05-14-11-08-53.mp4 | 2022-05-14 16:17 | 0 | |
![[SND]](/icons/sound2.gif) | Ibongadarna.mp3 | 2022-05-14 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | w000.mp3 | 2022-05-14 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | DJ Ya Cuman Kamu X Beryanyi Jedag Jedug Viral TikTok 2022!! - Sahrul Ckn.mp3 | 2022-05-14 16:11 | 2.6M | |
![[SND]](/icons/sound2.gif) | Jepri.mp3 | 2022-05-14 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | Шинанай шинанай - Ай ай ай девушки.mp3 | 2022-05-14 16:05 | 0 | |
![[SND]](/icons/sound2.gif) | W1.mp3 | 2022-05-14 15:59 | 0 | |
![[SND]](/icons/sound2.gif) | Cerimònia PERE BUSQUETS TORRA 13052022.mp3 | 2022-05-14 15:58 | 0 | |
![[SND]](/icons/sound2.gif) | Tiyo.mp3 | 2022-05-14 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | qarakesek-2022-kuragan-gul.mp3 | 2022-05-14 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | BASA3.mp3 | 2022-05-14 15:55 | 6.0M | |
![[SND]](/icons/sound2.gif) | BASA2.mp3 | 2022-05-14 15:55 | 5.1M | |
![[SND]](/icons/sound2.gif) | BASA1.mp3 | 2022-05-14 15:54 | 3.7M | |
![[SND]](/icons/sound2.gif) | cxc.mp3 | 2022-05-14 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | Z2.mp3 | 2022-05-14 15:52 | 2.5M | |
![[SND]](/icons/sound2.gif) | Pesnya_Zachem_ona_beryot_muzhskie_piski_v_rot_TRAP_remix.mp3 | 2022-05-14 15:49 | 0 | |
![[SND]](/icons/sound2.gif) | lo.mp3 | 2022-05-14 15:45 | 4.2M | |
![[SND]](/icons/sound2.gif) | videoplayback-_3_.mp3 | 2022-05-14 15:45 | 0 | |
![[SND]](/icons/sound2.gif) | icekub.mp3 | 2022-05-14 15:44 | 0 | |
![[SND]](/icons/sound2.gif) | ks.mp3 | 2022-05-14 15:41 | 5.7M | |
![[SND]](/icons/sound2.gif) | no.mp3 | 2022-05-14 15:41 | 4.9M | |
![[SND]](/icons/sound2.gif) | Mohammad-FlexFeat-Pawlos2_mdbmastered_High.mp3 | 2022-05-14 15:40 | 0 | |
![[SND]](/icons/sound2.gif) | Stephen Sanchez - Until I Found You (Lyrics)(MP3_160K).mp3 | 2022-05-14 15:38 | 0 | |
![[SND]](/icons/sound2.gif) | 4NonBlondes-What'sUp(OfficialMusicVideo)_1646034641195.mp3 | 2022-05-14 15:37 | 0 | |
![[SND]](/icons/sound2.gif) | afterdark.mp3 | 2022-05-14 15:37 | 3.8M | |
![[SND]](/icons/sound2.gif) | ravz4.mp3 | 2022-05-14 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | ravz2.mp3 | 2022-05-14 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | ravz3.mp3 | 2022-05-14 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | thuongco.mp3 | 2022-05-14 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | Police.mp3 | 2022-05-14 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | ravz1.mp3 | 2022-05-14 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | ravz.mp3 | 2022-05-14 15:35 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - M.O.O.N-Crystals (Hotline Miami OST_8D Audio, listen in headphones) (128 kbps).mp3 | 2022-05-14 15:34 | 0 | |
![[SND]](/icons/sound2.gif) | Mr.Kitty_-_After_Dark.mp3 | 2022-05-14 15:33 | 0 | |
![[SND]](/icons/sound2.gif) | navyalarm.mp3 | 2022-05-14 15:33 | 0 | |
![[SND]](/icons/sound2.gif) | Little Mix - Power (Official Video) ft. Stormzy.mp3 | 2022-05-14 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sono Bisque Doll wa Koi wo Suru Opening FullSan San Daysby Spira Spica.mp3 | 2022-05-14 15:30 | 0 | |
![[SND]](/icons/sound2.gif) | nonhau.mp3 | 2022-05-14 15:28 | 0 | |
![[SND]](/icons/sound2.gif) | DJIMUTIMUTALLNIGHTYANGLAGIVIRALTIKTOKDJENAENAK_1652541729722.mp3 | 2022-05-14 15:25 | 1.9M | |
![[SND]](/icons/sound2.gif) | Jerry-Heil-_МОСКАЛЬ_НЕКРАСІВИЙ-_ГЕТЬ-З-УКРАЇНИ_-_1_.mp3 | 2022-05-14 15:25 | 3.3M | |
![[SND]](/icons/sound2.gif) | f4.mp3 | 2022-05-14 15:24 | 11K | |
![[SND]](/icons/sound2.gif) | e4.mp3 | 2022-05-14 15:24 | 11K | |
![[SND]](/icons/sound2.gif) | c4.mp3 | 2022-05-14 15:24 | 11K | |
![[SND]](/icons/sound2.gif) | d4.mp3 | 2022-05-14 15:24 | 11K | |
![[SND]](/icons/sound2.gif) | g4.mp3 | 2022-05-14 15:24 | 11K | |
![[SND]](/icons/sound2.gif) | b4.mp3 | 2022-05-14 15:24 | 12K | |
![[SND]](/icons/sound2.gif) | a4.mp3 | 2022-05-14 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | unki, Smokkkii - Волга Бпан.mp3 | 2022-05-14 15:23 | 0 | |
![[SND]](/icons/sound2.gif) | Hesoyamnato.mp3 | 2022-05-14 15:23 | 0 | |
![[SND]](/icons/sound2.gif) | 44.mp3 | 2022-05-14 15:22 | 2.1M | |
![[SND]](/icons/sound2.gif) | AUD-20210630-WA0071.mp3 | 2022-05-14 15:22 | 0 | |
![[SND]](/icons/sound2.gif) | Pheromones.mp3 | 2022-05-14 15:21 | 0 | |
![[SND]](/icons/sound2.gif) | nigga.mp3 | 2022-05-14 15:21 | 0 | |
![[SND]](/icons/sound2.gif) | Galo.mp3 | 2022-05-14 15:18 | 0 | |
![[SND]](/icons/sound2.gif) | Ysabelle.mp3 | 2022-05-14 15:17 | 0 | |
![[SND]](/icons/sound2.gif) | Josephine feat. Anastasia - Tilefono x Amarties [MASHUP].mp3 | 2022-05-14 15:17 | 0 | |
![[SND]](/icons/sound2.gif) | auvanhai04.mp3 | 2022-05-14 15:16 | 0 | |
![[SND]](/icons/sound2.gif) | pb5.mp3 | 2022-05-14 15:16 | 12M | |
![[SND]](/icons/sound2.gif) | nikola.mp3 | 2022-05-14 15:16 | 0 | |
![[SND]](/icons/sound2.gif) | pb3.mp3 | 2022-05-14 15:15 | 9.5M | |
![[SND]](/icons/sound2.gif) | pb2.mp3 | 2022-05-14 15:15 | 5.9M | |
![[SND]](/icons/sound2.gif) | The Kid LAROI, Justin Bieber - STAY (Official Video) (320 kbps).mp3 | 2022-05-14 15:15 | 0 | |
![[SND]](/icons/sound2.gif) | tin.mp3 | 2022-05-14 15:15 | 236K | |
![[SND]](/icons/sound2.gif) | pb9.mp3 | 2022-05-14 15:14 | 5.3M | |
![[SND]](/icons/sound2.gif) | pb8.mp3 | 2022-05-14 15:14 | 7.5M | |
![[SND]](/icons/sound2.gif) | pb10.mp3 | 2022-05-14 15:14 | 5.8M | |
![[SND]](/icons/sound2.gif) | pb7.mp3 | 2022-05-14 15:14 | 7.9M | |
![[SND]](/icons/sound2.gif) | pb6.mp3 | 2022-05-14 15:14 | 3.4M | |
![[SND]](/icons/sound2.gif) | pb1.mp3 | 2022-05-14 15:14 | 8.3M | |
![[SND]](/icons/sound2.gif) | sky5.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky7.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky11.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky9.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky10.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | Jonathan.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky8.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky3.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky4.mp3 | 2022-05-14 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | sky2.mp3 | 2022-05-14 15:12 | 0 | |
![[SND]](/icons/sound2.gif) | sky1.mp3 | 2022-05-14 15:12 | 968K | |
![[SND]](/icons/sound2.gif) | d11.mp3 | 2022-05-14 15:11 | 1.4M | |
![[SND]](/icons/sound2.gif) | ❤😈🍒OPERSKIE🍒😈❤ - Ты и Я (Remix).mp3 | 2022-05-14 15:11 | 0 | |
![[SND]](/icons/sound2.gif) | bkv.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | haiau003.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | haiau005.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | haiau007.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | เพลงแดนซ์ โอเค อายูเลดี้ (วอเอ๊ะๆ วอเอๆ) V.สามช่ามันส์ๆเบสแน่นๆ DJ MUN REMIX.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | haiau004.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | haiau002.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | haiau001.mp3 | 2022-05-14 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | no_nhau_mot_loi_orinn_remix_phuc_chinh_nhac_tre_remix_hot_tik_tok_gay_nghien_2022_893725142207473891.mp3 | 2022-05-14 15:08 | 0 | |
![[SND]](/icons/sound2.gif) | dau_o_day_nay_orinn_remix_nal_ta_nhu_lan_may_troi_ve_cuoi_bau_troi_remix_tiktok_hay_nhat_2022_-7041950494541180618.mp3 | 2022-05-14 15:08 | 0 | |
![[SND]](/icons/sound2.gif) | chanh_long_thuong_co_2_huy_vac_wint_remix_nho_deo_tai_nghe_1010972304487637453.mp3 | 2022-05-14 15:08 | 0 | |
![[SND]](/icons/sound2.gif) | aeae.mp3 | 2022-05-14 15:07 | 0 | |
![[SND]](/icons/sound2.gif) | ik.mp3 | 2022-05-14 15:05 | 0 | |
![[SND]](/icons/sound2.gif) | Never Gonna Give You Up Original.mp3 | 2022-05-14 15:05 | 0 | |
![[SND]](/icons/sound2.gif) | วิสกี้แดนซ์.mp3 | 2022-05-14 15:04 | 1.3M | |
![[SND]](/icons/sound2.gif) | JOP2.mp3 | 2022-05-14 15:02 | 4.4M | |
![[SND]](/icons/sound2.gif) | jpn.mp3 | 2022-05-14 14:59 | 4.7M | |
![[SND]](/icons/sound2.gif) | gpd.mp3 | 2022-05-14 14:58 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - ZENTYARB x PUNYARB - ฉบับปรับปรุง Ft. LAZYLOXY Prod. By 1Rock [Official Audio] (128 kbps).mp3 | 2022-05-14 14:57 | 0 | |
![[SND]](/icons/sound2.gif) | Lynzie5.mp3 | 2022-05-14 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | shizu1.mp3 | 2022-05-14 14:48 | 0 | |
![[SND]](/icons/sound2.gif) | yv.mp3 | 2022-05-14 14:48 | 572K | |
![[SND]](/icons/sound2.gif) | DJ.mp3 | 2022-05-14 14:46 | 0 | |
![[SND]](/icons/sound2.gif) | mits1.mp3 | 2022-05-14 14:45 | 0 | |
![[SND]](/icons/sound2.gif) | zxen.mp3 | 2022-05-14 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | punyaxann.mp3 | 2022-05-14 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | VinzzSAMP1.mp3 | 2022-05-14 14:43 | 0 | |
![[SND]](/icons/sound2.gif) | Don Phenom - Def (Prod. By Edward Skera).mp3 | 2022-05-14 14:42 | 0 | |
![[SND]](/icons/sound2.gif) | Brytod.m4a | 2022-05-14 14:39 | 0 | |
![[SND]](/icons/sound2.gif) | Suara 004.m4a | 2022-05-14 14:38 | 0 | |
![[SND]](/icons/sound2.gif) | df.mp3 | 2022-05-14 14:37 | 3.7M | |
![[SND]](/icons/sound2.gif) | MAX2950.mp3 | 2022-05-14 14:36 | 0 | |
![[SND]](/icons/sound2.gif) | Kokoganzz5.mp3 | 2022-05-14 14:36 | 3.8M | |
![[SND]](/icons/sound2.gif) | GG.mp3 | 2022-05-14 14:32 | 0 | |
![[SND]](/icons/sound2.gif) | DJ TIKTOK TERBARU 2022 DJ MENIMISU x POK AME AME x RIP LOVE FAOUZIA REMIX VIRAL TIKTOK 2022.mp3 | 2022-05-14 14:29 | 0 | |
![[SND]](/icons/sound2.gif) | SRN.mp3 | 2022-05-14 14:27 | 2.5M | |
![[SND]](/icons/sound2.gif) | Happy Birthday (320 kbps) (mp3cut.net).mp3 | 2022-05-14 14:26 | 10M | |
![[SND]](/icons/sound2.gif) | LW.mp3 | 2022-05-14 14:26 | 2.4M | |
![[SND]](/icons/sound2.gif) | zida.mp3 | 2022-05-14 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | JOP1.mp3 | 2022-05-14 14:26 | 3.0M | |
![[SND]](/icons/sound2.gif) | 15.mp3 | 2022-05-14 14:25 | 1.0M | |
![[SND]](/icons/sound2.gif) | 么TIHANOV~ EDITS. - 🖤ПẪЧКẪ СИГẪРЕ† 💔.mp3 | 2022-05-14 14:22 | 0 | |
![[SND]](/icons/sound2.gif) | 夔❥彡R E L A X ༄🥵🖕 - 🥵БУ́КВÂ Ю́🥵.mp3 | 2022-05-14 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | SNORLALALA-arabix.mp3 | 2022-05-14 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | LOK.mp3 | 2022-05-14 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | ZiD.mp3 | 2022-05-14 14:19 | 0 | |
![[SND]](/icons/sound2.gif) | glock.mp3 | 2022-05-14 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | Rajendra.mp3 | 2022-05-14 14:11 | 0 | |
![[SND]](/icons/sound2.gif) | VID-20220510-WA0000.mp3 | 2022-05-14 14:11 | 0 | |
![[SND]](/icons/sound2.gif) | sweet.mp3 | 2022-05-14 14:10 | 3.3M | |
![[SND]](/icons/sound2.gif) | lathi.mp3 | 2022-05-14 14:10 | 0 | |
![[SND]](/icons/sound2.gif) | Connorss1.mp3 | 2022-05-14 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | Zui MengThe Untamed OST.mp3 | 2022-05-14 14:00 | 0 | |
![[SND]](/icons/sound2.gif) | DFR.mp3 | 2022-05-14 13:58 | 0 | |
![[SND]](/icons/sound2.gif) | Z.mp3 | 2022-05-14 13:57 | 1.2M | |
![[SND]](/icons/sound2.gif) | anjir.mp3 | 2022-05-14 13:57 | 0 | |
![[SND]](/icons/sound2.gif) | J.mp3 | 2022-05-14 13:55 | 2.6M | |
![[SND]](/icons/sound2.gif) | Alan Walker x Jack Benjamin - Far From Home (Sky).mp3 | 2022-05-14 13:54 | 0 | |
![[SND]](/icons/sound2.gif) | BROKENN_-_Perezvonyu_73451874.mp3 | 2022-05-14 13:49 | 0 | |
![[SND]](/icons/sound2.gif) | falsemirrorggg.mp3 | 2022-05-14 13:48 | 0 | |
![[SND]](/icons/sound2.gif) | dd.mp3.mp3 | 2022-05-14 13:48 | 0 | |
![[SND]](/icons/sound2.gif) | IShowSpeed.mp3 | 2022-05-14 13:46 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - The White Stripes - Seven Nation Army (Official Music Video) (128 kbps).mp3 | 2022-05-14 13:46 | 0 | |
![[SND]](/icons/sound2.gif) | false_mirror_lizerandflesh_legendi.mp3 | 2022-05-14 13:45 | 0 | |
![[SND]](/icons/sound2.gif) | Bnm.mp3 | 2022-05-14 13:44 | 0 | |
![[SND]](/icons/sound2.gif) | yudodo.mp3 | 2022-05-14 13:44 | 0 | |
![[SND]](/icons/sound2.gif) | Flesh-Lizer_-_False-mirror_(muziqa.ru).mp3 | 2022-05-14 13:44 | 0 | |
![[SND]](/icons/sound2.gif) | miyagi-jendshpil-kolizejj.mp3 | 2022-05-14 13:43 | 0 | |
![[SND]](/icons/sound2.gif) | erra1.mp3 | 2022-05-14 13:41 | 0 | |
![[SND]](/icons/sound2.gif) | AA.mp3 | 2022-05-14 13:39 | 0 | |
![[SND]](/icons/sound2.gif) | seeYa.mp3 | 2022-05-14 13:38 | 0 | |
![[SND]](/icons/sound2.gif) | Ade.mp3 | 2022-05-14 13:37 | 240K | |
![[SND]](/icons/sound2.gif) | Z3.mp3 | 2022-05-14 13:35 | 3.2M | |
![[SND]](/icons/sound2.gif) | Zxcl.mp3 | 2022-05-14 13:33 | 0 | |
![[SND]](/icons/sound2.gif) | AUSTIN.mp3 | 2022-05-14 13:33 | 0 | |
![[SND]](/icons/sound2.gif) | JONY - Пустота (Пустота).mp3 | 2022-05-14 13:30 | 0 | |
![[SND]](/icons/sound2.gif) | QO.mp3 | 2022-05-14 13:29 | 0 | |
![[SND]](/icons/sound2.gif) | SH_Kera_Adam_Maniac_-_Volchok_(Adam_Maniac_Remix).mp3 | 2022-05-14 13:29 | 0 | |
![[SND]](/icons/sound2.gif) | D.mp3 | 2022-05-14 13:23 | 2.8M | |
![[SND]](/icons/sound2.gif) | B.mp3 | 2022-05-14 13:22 | 2.3M | |
![[SND]](/icons/sound2.gif) | Time.mp3 | 2022-05-14 13:22 | 2.2M | |
![[SND]](/icons/sound2.gif) | Hailey.mp3 | 2022-05-14 13:19 | 0 | |
![[SND]](/icons/sound2.gif) | X.mp3 | 2022-05-14 13:15 | 2.5M | |
![[SND]](/icons/sound2.gif) | Line Without A Hook (Cover by Karlo & Alyssa).mp3 | 2022-05-14 13:15 | 0 | |
![[SND]](/icons/sound2.gif) | Gamon.mp3 | 2022-05-14 13:15 | 0 | |
![[SND]](/icons/sound2.gif) | River.mp3 | 2022-05-14 13:15 | 0 | |
![[SND]](/icons/sound2.gif) | Onepiece.mp3 | 2022-05-14 13:14 | 0 | |
![[SND]](/icons/sound2.gif) | FL.mp3 | 2022-05-14 13:13 | 152K | |
![[SND]](/icons/sound2.gif) | Boss_3.mp3 | 2022-05-14 13:12 | 0 | |
![[SND]](/icons/sound2.gif) | La.mp3.mp3 | 2022-05-14 13:11 | 0 | |
![[SND]](/icons/sound2.gif) | SA.mp3 | 2022-05-14 13:10 | 2.4M | |
![[SND]](/icons/sound2.gif) | CharCreationMusic.mp3 | 2022-05-14 13:08 | 0 | |
![[SND]](/icons/sound2.gif) | MT2.mp3 | 2022-05-14 13:07 | 0 | |
![[SND]](/icons/sound2.gif) | MT.mp3 | 2022-05-14 13:07 | 0 | |
![[SND]](/icons/sound2.gif) | Алёна Швец - Первое Свидание.mp3 | 2022-05-14 13:07 | 0 | |
![[SND]](/icons/sound2.gif) | Genji.mp3 | 2022-05-14 13:05 | 2.2M | |
![[SND]](/icons/sound2.gif) | 🍒 sᴀᴍᴏɪʟᴏᴠ 🍒 - - Шёлкавая простынь..mp3 | 2022-05-14 13:00 | 0 | |
![[SND]](/icons/sound2.gif) | shake.mp3 | 2022-05-14 12:59 | 2.4M | |
![[SND]](/icons/sound2.gif) | Sparkle.mp3 | 2022-05-14 12:58 | 0 | |
![[SND]](/icons/sound2.gif) | долина .mp3 | 2022-05-14 12:58 | 0 | |
![[SND]](/icons/sound2.gif) | RIU.mp3 | 2022-05-14 12:58 | 1.4M | |
![[SND]](/icons/sound2.gif) | синие розы31-35hz.mp3 | 2022-05-14 12:57 | 0 | |
![[SND]](/icons/sound2.gif) | peach.mp3 | 2022-05-14 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | dr1ch.mp3 | 2022-05-14 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | tokyio.mp3 | 2022-05-14 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | Kawayyy.mp3 | 2022-05-14 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | tokioshit.mp3 | 2022-05-14 12:50 | 0 | |
![[SND]](/icons/sound2.gif) | Bor1s.mp3 | 2022-05-14 12:50 | 0 | |
![[SND]](/icons/sound2.gif) | Песня - У коровы нет других забот (Remix).mp3 | 2022-05-14 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | Ace_of_Base_-_The_Sign_Qoret.com.mp3 | 2022-05-14 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | SherstianoeHudi.mp3 | 2022-05-14 12:47 | 0 | |
![[SND]](/icons/sound2.gif) | NWC.mp3 | 2022-05-14 12:46 | 0 | |
![[SND]](/icons/sound2.gif) | Su1.mp3 | 2022-05-14 12:46 | 0 | |
![[SND]](/icons/sound2.gif) | jamik__pussykiller_-_francija_(z2.fm).mp3 | 2022-05-14 12:41 | 0 | |
![[SND]](/icons/sound2.gif) | Genji2.mp3 | 2022-05-14 12:39 | 0 | |
![[SND]](/icons/sound2.gif) | Dang13.mp3 | 2022-05-14 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | Soft Relaxing Baby Sleep Music Best Bedtime Lullabies For Toddlers Good Night Sweet Dreams.mp3 | 2022-05-14 12:35 | 50M | |
![[SND]](/icons/sound2.gif) | Lullabies For Kids - Sleep Baby Nursery Rhymes and Kids Songs Baby Songs Little Baby Bum.mp3 | 2022-05-14 12:34 | 46M | |
![[SND]](/icons/sound2.gif) | Siti Nurhaliza - Aisyah Istri Rasulullah ( Cover ).mp3 | 2022-05-14 12:34 | 5.5M | |
![[SND]](/icons/sound2.gif) | Sayyidah Aisyah Istri Rasulullah - Anisa Rahman (Cover).mp3 | 2022-05-14 12:34 | 4.4M | |
![[SND]](/icons/sound2.gif) | SABYAN - AISYAH ISTRI RASULULLAHCOVER.mp3 | 2022-05-14 12:34 | 6.0M | |
![[SND]](/icons/sound2.gif) | Aisyah Istri Rasulullah versi Upin Ipin Terbaru 2020.mp3 | 2022-05-14 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | AISYAH ISTRI RASULULLAH - ANISA RAHMAN (Cover).mp3 | 2022-05-14 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | KHAI BAHAR - AISYAH ISTRI RASULULLAH (COVER) DENGAN LIRIK.mp3 | 2022-05-14 12:34 | 6.3M | |
![[SND]](/icons/sound2.gif) | Mr Bie -Aisyah Istri RasulullahLagu Asal Projector Band Aisyah.mp3 | 2022-05-14 12:34 | 4.3M | |
![[SND]](/icons/sound2.gif) | AISYAH ISTRI RASULULLAH - SYAKIR DAULAY[COVER].mp3 | 2022-05-14 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | AISYAH ISTRI RASULULLAH COVER BY BABY SHIMA.mp3 | 2022-05-14 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | Aisyah Istri Rasulullah (cover by Sheryl Shazwanie).mp3 | 2022-05-14 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | AISYAH ISTRI RASULULLAH - PUTIH ABU ABU COVER.mp3 | 2022-05-14 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | Siomet.mp3 | 2022-05-14 12:33 | 0 | |
![[VID]](/icons/movie.gif) | Jeff_Kaale_-_Strawberry(144p).mp4 | 2022-05-14 12:31 | 0 | |
![[SND]](/icons/sound2.gif) | r1.mp3 | 2022-05-14 12:30 | 4.5M | |
![[SND]](/icons/sound2.gif) | hbdd.mp3 | 2022-05-14 12:30 | 0 | |
![[SND]](/icons/sound2.gif) | r2.mp3 | 2022-05-14 12:30 | 2.0M | |
![[VID]](/icons/movie.gif) | Mr.Kitty_-_After_Dark(144p).mp4 | 2022-05-14 12:30 | 0 | |
![[VID]](/icons/movie.gif) | The_Neighbourhood_-_Sweater_Weather_(Official_Video)(144p).mp4 | 2022-05-14 12:29 | 0 | |
![[VID]](/icons/movie.gif) | Tove_Lo_-_Habits_(Stay_High)_(Lyrics)(144p).mp4 | 2022-05-14 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | MV.mp3 | 2022-05-14 12:28 | 348K | |
![[SND]](/icons/sound2.gif) | Su.mp3 | 2022-05-14 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | Genji1.mp3 | 2022-05-14 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | g2.mp3 | 2022-05-14 12:25 | 0 | |
![[SND]](/icons/sound2.gif) | siomet.mp3 | 2022-05-14 12:24 | 0 | |
![[SND]](/icons/sound2.gif) | so1.mp3 | 2022-05-14 12:23 | 0 | |
![[SND]](/icons/sound2.gif) | so2.mp3 | 2022-05-14 12:22 | 0 | |
![[SND]](/icons/sound2.gif) | 142_0s_to_10_0142_0s_SHINee__Get_The_Treasur.mp3 | 2022-05-14 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | cuka2.mp3 | 2022-05-14 12:20 | 3.2M | |
![[SND]](/icons/sound2.gif) | sorinel.mp3 | 2022-05-14 12:19 | 0 | |
![[SND]](/icons/sound2.gif) | paw5.mp3 | 2022-05-14 12:19 | 0 | |
![[SND]](/icons/sound2.gif) | sorinel2.mp3 | 2022-05-14 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | paw6.mp3 | 2022-05-14 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | paw4.mp3 | 2022-05-14 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | AG.mp3 | 2022-05-14 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | paw3.mp3 | 2022-05-14 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | paw2.mp3 | 2022-05-14 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | paw.mp3 | 2022-05-14 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | Anees_-_Sun_and_Moon_(Lyrics)(128k).m4a | 2022-05-14 12:09 | 0 | |
![[SND]](/icons/sound2.gif) | feoluM9m.mp3 | 2022-05-14 12:08 | 0 | |
![[SND]](/icons/sound2.gif) | Windah Basudara Nyanyi Lagu Kimi No Nawa Kalo Rekamnya Di Studio(MP3_320K).mp3 | 2022-05-14 12:05 | 0 | |
![[SND]](/icons/sound2.gif) | han.mp3 | 2022-05-14 12:04 | 0 | |
![[SND]](/icons/sound2.gif) | Farhan3.mp3 | 2022-05-14 12:02 | 0 | |
![[SND]](/icons/sound2.gif) | Kawai.mp3 | 2022-05-14 12:00 | 0 | |
![[SND]](/icons/sound2.gif) | haiz.mp3 | 2022-05-14 11:58 | 0 | |
![[SND]](/icons/sound2.gif) | Familie City.mp3 | 2022-05-14 11:58 | 0 | |
![[SND]](/icons/sound2.gif) | coaynoi.mp3 | 2022-05-14 11:57 | 4.1M | |
![[SND]](/icons/sound2.gif) | haimusic05.mp3 | 2022-05-14 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | haimusic06.mp3 | 2022-05-14 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | haimusic02.mp3 | 2022-05-14 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | haimusic07.mp3 | 2022-05-14 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | haimusic04.mp3 | 2022-05-14 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | haimusic01.mp3 | 2022-05-14 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | AF.mp3 | 2022-05-14 11:51 | 2.4M | |
![[SND]](/icons/sound2.gif) | takeru24.mp3 | 2022-05-14 11:50 | 0 | |
![[SND]](/icons/sound2.gif) | Struktur (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-05-14 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | takeru23.mp3 | 2022-05-14 11:46 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Show Me The Money777 5회 Team 코드 쿤스트 팔로알토 pH1 키드밀리 루피 콸라 Good Dayfeat 팔로알토prod 코드쿤스트.mp3 | 2022-05-14 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | takeru21.mp3 | 2022-05-14 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | takeru25.mp3 | 2022-05-14 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TIKTOK TERBARU 2022 DJ LO MATI GUE PARTY COY X DJ YA CUMAN KAMU REMIX VIRAL TIKTOK 2022(1).mp3 | 2022-05-14 11:43 | 0 | |
![[SND]](/icons/sound2.gif) | nls.mp3 | 2022-05-14 11:43 | 0 | |
![[SND]](/icons/sound2.gif) | takeru22.mp3 | 2022-05-14 11:43 | 1.1M | |
![[SND]](/icons/sound2.gif) | luna.mp3 | 2022-05-14 11:36 | 55K | |
![[SND]](/icons/sound2.gif) | BONES - Playa.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - Projec.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - SoupLyson.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - NoOtherOption.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - Mossberg.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - BlackBandana.m4a | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - Jordan.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - ICameUp.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - GetRichOrDieTrying.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - HangMeOutToDry.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - BothEyesClosed.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | BONES - FlowTooCrazy.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | Bones - GotItBadderThanUsher.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | Tacoshott.mp3 | 2022-05-14 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | Rauf Faik - детство (Official audio).mp3 | 2022-05-14 11:32 | 4.3M | |
![[SND]](/icons/sound2.gif) | Jackie-O feat. B-Lion - Goodbye (From Arcane_ League of Legends).mp3 | 2022-05-14 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | Lil Tjay2.mp3 | 2022-05-14 11:24 | 0 | |
![[SND]](/icons/sound2.gif) | AD.mp3 | 2022-05-14 11:19 | 3.7M | |
![[SND]](/icons/sound2.gif) | apip1.mp3 | 2022-05-14 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | nhaccang.mp3 | 2022-05-14 11:14 | 0 | |
![[SND]](/icons/sound2.gif) | Davv.mp3 | 2022-05-14 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | Aleks_Ataman_-_A_muzyka_igraet_gromko_73621122.mp3 | 2022-05-14 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | Bm.mp3 | 2022-05-14 11:04 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Azteca - A Â Feat. Amuly, RAVA & Jakoban (Official Video) (320 kbps) (1).mp3 | 2022-05-14 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - RAVA - $P$ (Studio Session #02) (128 kbps).mp3 | 2022-05-14 11:02 | 2.0M | |
![[SND]](/icons/sound2.gif) | Hg.mp3 | 2022-05-14 10:59 | 4.4M | |
![[SND]](/icons/sound2.gif) | Mc.mp3 | 2022-05-14 10:55 | 2.5M | |
![[SND]](/icons/sound2.gif) | ssstiktok_1651371422272.mp3 | 2022-05-14 10:50 | 0 | |
![[VID]](/icons/movie.gif) | story.rzl-20220513-0001.mp4 | 2022-05-14 10:49 | 0 | |
![[SND]](/icons/sound2.gif) | DJ LOVE TONIGHT X DIDUNIA INI TENANG AJA MENGKANE.mp3 | 2022-05-14 10:45 | 0 | |
![[SND]](/icons/sound2.gif) | bass1.mp3 | 2022-05-14 10:45 | 3.3M | |
![[SND]](/icons/sound2.gif) | adin.mp3 | 2022-05-14 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | arcade4.mp3 | 2022-05-14 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | Dreas3.mp3 | 2022-05-14 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | romansad.mp3 | 2022-05-14 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | Dreas0.mp3 | 2022-05-14 10:40 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1651183128126.mp3 | 2022-05-14 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | kingdom.mp3 | 2022-05-14 10:37 | 0 | |
![[SND]](/icons/sound2.gif) | FTR.mp3 | 2022-05-14 10:36 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu_TikTok_Happy_Birthday___Lagu_TikTok_Ulang_Tahun(256k).mp3 | 2022-05-14 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | sanfdj6.mp3 | 2022-05-14 10:26 | 664K | |
![[SND]](/icons/sound2.gif) | Lagu_TikTok_Happy_Birthday___Lagu_TikTok_Ulang_Tahun(128k).m4a | 2022-05-14 10:24 | 0 | |
![[SND]](/icons/sound2.gif) | Rahat_track. - blazilen..mp3 | 2022-05-14 10:22 | 0 | |
![[SND]](/icons/sound2.gif) | Mua-Yeu-Dau-Dinh-Manh-Ninh.mp3 | 2022-05-14 10:22 | 1.3M | |
![[SND]](/icons/sound2.gif) | sue11.mp3 | 2022-05-14 10:18 | 3.0M | |
![[SND]](/icons/sound2.gif) | sue1.mp3 | 2022-05-14 10:18 | 3.0M | |
![[SND]](/icons/sound2.gif) | Bulldogs2.mp3 | 2022-05-14 10:16 | 257K | |
![[SND]](/icons/sound2.gif) | cuka1.mp3 | 2022-05-14 10:13 | 4.3M | |
![[SND]](/icons/sound2.gif) | dj4.mp3 | 2022-05-14 10:13 | 4.0M | |
![[SND]](/icons/sound2.gif) | dj10.mp3 | 2022-05-14 10:13 | 5.1M | |
![[SND]](/icons/sound2.gif) | cuki5.mp3 | 2022-05-14 10:13 | 5.7M | |
![[SND]](/icons/sound2.gif) | cuki8.mp3 | 2022-05-14 10:13 | 5.8M | |
![[SND]](/icons/sound2.gif) | cuki9.mp3 | 2022-05-14 10:13 | 5.5M | |
![[SND]](/icons/sound2.gif) | cuki15.mp3 | 2022-05-14 10:13 | 15M | |
![[SND]](/icons/sound2.gif) | cuki7.mp3 | 2022-05-14 10:13 | 4.0M | |
![[SND]](/icons/sound2.gif) | dj1.mp3 | 2022-05-14 10:13 | 2.0M | |
![[SND]](/icons/sound2.gif) | cuki4.mp3 | 2022-05-14 10:12 | 5.1M | |
![[SND]](/icons/sound2.gif) | cuki2.mp3 | 2022-05-14 10:12 | 6.4M | |
![[SND]](/icons/sound2.gif) | cuki3.mp3 | 2022-05-14 10:12 | 2.7M | |
![[SND]](/icons/sound2.gif) | cuki13.mp3 | 2022-05-14 10:12 | 24M | |
![[SND]](/icons/sound2.gif) | cuki17.mp3 | 2022-05-14 10:12 | 4.4M | |
![[SND]](/icons/sound2.gif) | cuki18.mp3 | 2022-05-14 10:12 | 4.1M | |
![[SND]](/icons/sound2.gif) | cuki19.mp3 | 2022-05-14 10:12 | 4.0M | |
![[SND]](/icons/sound2.gif) | cuka3.mp3 | 2022-05-14 10:12 | 3.2M | |
![[SND]](/icons/sound2.gif) | cuki16.mp3 | 2022-05-14 10:12 | 3.5M | |
![[SND]](/icons/sound2.gif) | cuki11.mp3 | 2022-05-14 10:12 | 6.7M | |
![[SND]](/icons/sound2.gif) | cuki12.mp3 | 2022-05-14 10:12 | 4.1M | |
![[SND]](/icons/sound2.gif) | cuki14.mp3 | 2022-05-14 10:12 | 468K | |
![[SND]](/icons/sound2.gif) | cuki10.mp3 | 2022-05-14 10:12 | 3.0M | |
![[SND]](/icons/sound2.gif) | cuki1.mp3 | 2022-05-14 10:11 | 0 | |
![[SND]](/icons/sound2.gif) | Bulldogs1.mp3 | 2022-05-14 10:11 | 0 | |
![[VID]](/icons/movie.gif) | fd7c1093a492d32aac8026b6c369ef8d.mp4 | 2022-05-14 10:08 | 0 | |
![[SND]](/icons/sound2.gif) | Жуки - Батарейка.mp3 | 2022-05-14 10:07 | 5.9M | |
![[VID]](/icons/movie.gif) | 7de808482f06f2faa580e198302fea15.mp4 | 2022-05-14 10:07 | 0 | |
![[VID]](/icons/movie.gif) | dcf0b9fa9952f83786ea4b131d7451cf.mp4 | 2022-05-14 10:06 | 0 | |
![[SND]](/icons/sound2.gif) | 03 Flight (Orchestra).mp3 | 2022-05-14 10:06 | 428K | |
![[SND]](/icons/sound2.gif) | kadavi1.mp3 | 2022-05-14 09:59 | 0 | |
![[SND]](/icons/sound2.gif) | XXXTENTACION - remedy of the broken heart(slow by white.sun) (www.hotplayer.ru).mp3 | 2022-05-14 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | MAN.mp3 | 2022-05-14 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | dav1.mp3 | 2022-05-14 09:40 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Azteca - A Â Feat. Amuly, RAVA & Jakoban (Official Video) (320 kbps).mp3 | 2022-05-14 09:35 | 0 | |
![[SND]](/icons/sound2.gif) | Azteca Feat. Amuly, RAVA & Jakoban - A Â ( Original Radio Edit ) [ MuzicaX.Online ].mp3 | 2022-05-14 09:33 | 0 | |
![[SND]](/icons/sound2.gif) | samzkanpää.mp3 | 2022-05-14 09:32 | 0 | |
![[SND]](/icons/sound2.gif) | 99.mp3 | 2022-05-14 09:31 | 3.3M | |
![[SND]](/icons/sound2.gif) | [Waploaded]_Foreigner_-_I_Want_to_Know_What_Love_is-1540219923.mp3 | 2022-05-14 09:26 | 380K | |
![[SND]](/icons/sound2.gif) | dj_old_burn_tiktok_music_id_tiktok_-629578610282543984.mp3 | 2022-05-14 09:23 | 0 | |
![[VID]](/icons/movie.gif) | Screen_Recording_20220126-132815_YouTube.mp4 | 2022-05-14 09:23 | 0 | |
![[SND]](/icons/sound2.gif) | Rihad1.mp3 | 2022-05-14 09:19 | 628K | |
![[SND]](/icons/sound2.gif) | eli_ppl.mp3 | 2022-05-14 09:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Elley Duhé Middle of the Night Lyrics.mp3 | 2022-05-14 09:18 | 0 | |
![[SND]](/icons/sound2.gif) | Gta.mp3 | 2022-05-14 09:14 | 0 | |
![[SND]](/icons/sound2.gif) | lil_nas_x_old_town_road_not_your_dope_remix_XRsv7XIByoK-gucZZmJ1.mp3 | 2022-05-14 09:13 | 0 | |
![[SND]](/icons/sound2.gif) | trfn-u-do-feat_-siadou.mp3 | 2022-05-14 09:12 | 0 | |
![[SND]](/icons/sound2.gif) | morgenshtern-eldzhej-kadillak-mp3.mp3 | 2022-05-14 09:11 | 6.8M | |
![[SND]](/icons/sound2.gif) | KUBA_Vstavaj_Donbass.mp3 | 2022-05-14 09:08 | 0 | |
![[SND]](/icons/sound2.gif) | rana11.mp3 | 2022-05-14 09:04 | 2.4M | |
![[SND]](/icons/sound2.gif) | RAVA feat. IUSTIN - IN LIPSA TA ( Original Radio Edit ) [ MuzicaX.Com ].mp3 | 2022-05-14 08:51 | 0 | |
![[SND]](/icons/sound2.gif) | RAVAfeat.IUSTIN-INLIPSATA(Original RadioEdit)[MuzicaX.Com].mp3 | 2022-05-14 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | RAVAfeat.IUSTIN-INLIPSATA(Original Radio Edit)[MuzicaX.Com ].mp3 | 2022-05-14 08:47 | 0 | |
![[SND]](/icons/sound2.gif) | BrotherLouie1.mp3 | 2022-05-14 08:46 | 0 | |
![[SND]](/icons/sound2.gif) | RAVAfeat.IUSTIN-INLIPSATA(Original Radio Edit )[ MuzicaX.Com ].mp3 | 2022-05-14 08:46 | 0 | |
![[SND]](/icons/sound2.gif) | niga.mp3 | 2022-05-14 08:45 | 0 | |
![[SND]](/icons/sound2.gif) | Jonamusic1.mp3 | 2022-05-14 08:42 | 0 | |
![[SND]](/icons/sound2.gif) | jona1.mp3 | 2022-05-14 08:39 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - WUT – ภาพความหลัง Ft. B4S OZONE x lmmaST ( Pkn peat th ) (128 kbps).mp3 | 2022-05-14 08:38 | 0 | |
![[SND]](/icons/sound2.gif) | Rav.mp3 | 2022-05-14 08:38 | 0 | |
![[VID]](/icons/movie.gif) | Rava.mp4 | 2022-05-14 08:37 | 0 | |
![[SND]](/icons/sound2.gif) | BL1.mp3 | 2022-05-14 08:37 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - ImmaST - ทำได้แค่มองขึ้นไปบนฟ้า ft WUT ' B4S OZONE (128 kbps).mp3 | 2022-05-14 08:35 | 0 | |
![[VID]](/icons/movie.gif) | x2mate.com-RAVA - $P$ (Studio Session .mp4 | 2022-05-14 08:32 | 0 | |
![[SND]](/icons/sound2.gif) | konfuz_-_kaif_ty_poimala_muzrecord.net.mp3 | 2022-05-14 08:28 | 5.6M | |
![[SND]](/icons/sound2.gif) | Broken.mp3 | 2022-05-14 08:27 | 200K | |
![[SND]](/icons/sound2.gif) | tulus.mp3 | 2022-05-14 08:25 | 3.9M | |
![[SND]](/icons/sound2.gif) | onepiece.mp3 | 2022-05-14 08:25 | 2.8M | |
![[SND]](/icons/sound2.gif) | naruto.mp3 | 2022-05-14 08:24 | 3.7M | |
![[SND]](/icons/sound2.gif) | tulus_hati_hati_di_jalan_official_music_video_-260741655545209261.mp3 | 2022-05-14 08:24 | 0 | |
![[SND]](/icons/sound2.gif) | keju.mp3 | 2022-05-14 08:18 | 3.6M | |
![[SND]](/icons/sound2.gif) | ReyGZ.mp3 | 2022-05-14 08:16 | 0 | |
![[SND]](/icons/sound2.gif) | nolove.mp3 | 2022-05-14 08:14 | 0 | |
![[SND]](/icons/sound2.gif) | ReyGZ.mp3.mp3 | 2022-05-14 08:13 | 0 | |
![[SND]](/icons/sound2.gif) | sabilulungan.mp3 | 2022-05-14 08:08 | 0 | |
![[SND]](/icons/sound2.gif) | Gods & Monsters.mp3 | 2022-05-14 08:03 | 0 | |
![[SND]](/icons/sound2.gif) | Payp.mp3 | 2022-05-14 07:55 | 0 | |
![[SND]](/icons/sound2.gif) | Moto Nation — Бегает по полю весело кабанчик (Trap Remix by DJ CRAB1K) (www.lightaudio.ru).mp3 | 2022-05-14 07:54 | 0 | |
![[SND]](/icons/sound2.gif) | Gods & Monsters (192 kbps).mp3 | 2022-05-14 07:54 | 0 | |
![[SND]](/icons/sound2.gif) | ILMI SELAMAT DATANG.mp3 | 2022-05-14 07:51 | 0 | |
![[SND]](/icons/sound2.gif) | ILMI BISNIS UDAH JADI.mp3 | 2022-05-14 07:50 | 0 | |
![[SND]](/icons/sound2.gif) | buler.mp3 | 2022-05-14 07:48 | 0 | |
![[SND]](/icons/sound2.gif) | Aeck.mp3 | 2022-05-14 07:44 | 0 | |
![[SND]](/icons/sound2.gif) | 2in1remix.mp3 | 2022-05-14 07:44 | 4.7M | |
![[SND]](/icons/sound2.gif) | shitposting1.mp3 | 2022-05-14 07:43 | 0 | |
![[SND]](/icons/sound2.gif) | shitposting2.mp3 | 2022-05-14 07:43 | 0 | |
![[SND]](/icons/sound2.gif) | yellowen.mp3 | 2022-05-14 07:43 | 3.2M | |
![[SND]](/icons/sound2.gif) | shitposting.mp3 | 2022-05-14 07:43 | 0 | |
![[SND]](/icons/sound2.gif) | maripossa.mp3 | 2022-05-14 07:43 | 0 | |
![[SND]](/icons/sound2.gif) | tinder.mp3 | 2022-05-14 07:43 | 0 | |
![[SND]](/icons/sound2.gif) | OKE.mp3 | 2022-05-14 07:42 | 0 | |
![[SND]](/icons/sound2.gif) | Eri1.mp3 | 2022-05-14 07:42 | 0 | |
![[SND]](/icons/sound2.gif) | musicposhlaymolli.mp3 | 2022-05-14 07:41 | 0 | |
![[SND]](/icons/sound2.gif) | Dilivio - Ale ft Rio (2022).mp3 | 2022-05-14 07:39 | 1.8M | |
![[SND]](/icons/sound2.gif) | Todoroki1.mp3 | 2022-05-14 07:38 | 3.2M | |
![[SND]](/icons/sound2.gif) | 101d.mp3 | 2022-05-14 07:38 | 0 | |
![[SND]](/icons/sound2.gif) | 91d.mp3 | 2022-05-14 07:38 | 2.3M | |
![[SND]](/icons/sound2.gif) | Anees - Sun and Moon (Official Audio).mp3 | 2022-05-14 07:36 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Squidward Tentacles Tiki Land Lirik Lagu Terjemahan (1).mp3 | 2022-05-14 07:33 | 0 | |
![[SND]](/icons/sound2.gif) | beep9.mp3 | 2022-05-14 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | beep8.mp3 | 2022-05-14 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | beep7.mp3 | 2022-05-14 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | beep6.mp3 | 2022-05-14 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | FF _ Toni Fowler x Makagago.mp3 | 2022-05-14 07:30 | 0 | |
![[SND]](/icons/sound2.gif) | beep5.mp3 | 2022-05-14 07:30 | 0 | |
![[SND]](/icons/sound2.gif) | beep4.mp3 | 2022-05-14 07:30 | 0 | |
![[SND]](/icons/sound2.gif) | @wrs x @İlkan Günüç - Amore _ official music video.mp3 | 2022-05-14 07:30 | 0 | |
![[SND]](/icons/sound2.gif) | wrs - Llámame _ official music video 2.mp3 | 2022-05-14 07:30 | 0 | |
![[SND]](/icons/sound2.gif) | beep3.mp3 | 2022-05-14 07:30 | 0 | |
![[SND]](/icons/sound2.gif) | beep2.mp3 | 2022-05-14 07:29 | 0 | |
![[SND]](/icons/sound2.gif) | beep19.mp3 | 2022-05-14 07:29 | 0 | |
![[SND]](/icons/sound2.gif) | framed_-_drowning_FFM_mix_slowreverb_73913816.mp3 | 2022-05-14 07:29 | 0 | |
![[SND]](/icons/sound2.gif) | inbound412321620154295645.mp3 | 2022-05-14 07:28 | 0 | |
![[SND]](/icons/sound2.gif) | beep18.mp3 | 2022-05-14 07:28 | 0 | |
![[SND]](/icons/sound2.gif) | beep17.mp3 | 2022-05-14 07:28 | 0 | |
![[SND]](/icons/sound2.gif) | inbound4270812075452932004.mp3 | 2022-05-14 07:28 | 0 | |
![[SND]](/icons/sound2.gif) | beep16.mp3 | 2022-05-14 07:27 | 0 | |
![[SND]](/icons/sound2.gif) | beep15.mp3 | 2022-05-14 07:27 | 0 | |
![[SND]](/icons/sound2.gif) | beep14.mp3 | 2022-05-14 07:27 | 0 | |
![[SND]](/icons/sound2.gif) | beep13.mp3 | 2022-05-14 07:26 | 0 | |
![[SND]](/icons/sound2.gif) | Thunder.mp3 | 2022-05-14 07:26 | 3.8M | |
![[SND]](/icons/sound2.gif) | beep12.mp3 | 2022-05-14 07:26 | 3.2M | |
![[SND]](/icons/sound2.gif) | beep11.mp3 | 2022-05-14 07:25 | 0 | |
![[SND]](/icons/sound2.gif) | vagosls.mp3 | 2022-05-14 07:24 | 0 | |
![[SND]](/icons/sound2.gif) | before.mp3 | 2022-05-14 07:22 | 1.7M | |
![[SND]](/icons/sound2.gif) | Godzilla-EminemJuiceWRLD-6910047 (1).mp3 | 2022-05-14 07:22 | 0 | |
![[SND]](/icons/sound2.gif) | yorunikakeru.mp3 | 2022-05-14 07:16 | 0 | |
![[SND]](/icons/sound2.gif) | Ridho1.mp3 | 2022-05-14 07:14 | 668K | |
![[SND]](/icons/sound2.gif) | FUNG.mp3 | 2022-05-14 07:12 | 0 | |
![[SND]](/icons/sound2.gif) | 08. Harry Styles - Adore You.mp3 | 2022-05-14 07:12 | 0 | |
![[SND]](/icons/sound2.gif) | beep1.mp3 | 2022-05-14 07:11 | 1.2M | |
![[SND]](/icons/sound2.gif) | beep.mp3 | 2022-05-14 07:10 | 2.5M | |
![[SND]](/icons/sound2.gif) | WindowsXPShutdown.mp3 | 2022-05-14 07:05 | 77K | |
![[SND]](/icons/sound2.gif) | Buon.mp3 | 2022-05-14 07:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | DAVI1.mp3 | 2022-05-14 07:01 | 0 | |
![[SND]](/icons/sound2.gif) | phai chia tay thoi tone nu.mp3 | 2022-05-14 06:58 | 3.2M | |
![[SND]](/icons/sound2.gif) | koko5.mp3 | 2022-05-14 06:57 | 0 | |
![[SND]](/icons/sound2.gif) | INTROBFR.mp3 | 2022-05-14 06:57 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik9.mp3 | 2022-05-14 06:56 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik8.mp3 | 2022-05-14 06:56 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik7.mp3 | 2022-05-14 06:56 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik6.mp3 | 2022-05-14 06:56 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik5.mp3 | 2022-05-14 06:56 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik4.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik10.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | karina.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik15.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik13.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik3.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik12.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik2.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | cr11.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | cr20.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik14.mp3 | 2022-05-14 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik11.mp3 | 2022-05-14 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik1.mp3 | 2022-05-14 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | Fedrik.mp3 | 2022-05-14 06:54 | 1.2M | |
![[SND]](/icons/sound2.gif) | camqn.mp3 | 2022-05-14 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | haha.mp3 | 2022-05-14 06:54 | 396K | |
![[SND]](/icons/sound2.gif) | 1652449853275.mp3 | 2022-05-14 06:51 | 453K | |
![[SND]](/icons/sound2.gif) | bluebird.mp3 | 2022-05-14 06:51 | 3.3M | |
![[SND]](/icons/sound2.gif) | payp.mp3 | 2022-05-14 06:50 | 0 | |
![[SND]](/icons/sound2.gif) | ren2.mp3 | 2022-05-14 06:50 | 568K | |
![[SND]](/icons/sound2.gif) | orange7.mp3 | 2022-05-14 06:50 | 5.4M | |
![[SND]](/icons/sound2.gif) | gemaa9.mp3 | 2022-05-14 06:50 | 0 | |
![[SND]](/icons/sound2.gif) | ren1.mp3 | 2022-05-14 06:50 | 0 | |
![[SND]](/icons/sound2.gif) | memoriesop.mp3 | 2022-05-14 06:49 | 0 | |
![[SND]](/icons/sound2.gif) | lagunaruto.mp3 | 2022-05-14 06:49 | 0 | |
![[SND]](/icons/sound2.gif) | Ynn.mp3 | 2022-05-14 06:49 | 0 | |
![[SND]](/icons/sound2.gif) | tok1o2.mp3 | 2022-05-14 06:41 | 0 | |
![[SND]](/icons/sound2.gif) | tok1o3.mp3 | 2022-05-14 06:41 | 0 | |
![[SND]](/icons/sound2.gif) | tok1o.mp3 | 2022-05-14 06:41 | 0 | |
![[SND]](/icons/sound2.gif) | bor1s1.mp3 | 2022-05-14 06:41 | 0 | |
![[SND]](/icons/sound2.gif) | wibu.mp3 | 2022-05-14 06:38 | 692K | |
![[SND]](/icons/sound2.gif) | Biola Elita-2019.mp3 | 2022-05-14 06:36 | 0 | |
![[SND]](/icons/sound2.gif) | camquyen.mp3 | 2022-05-14 06:35 | 0 | |
![[SND]](/icons/sound2.gif) | Rizz6.mp3 | 2022-05-14 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | 3b9fc83887d44cf8bb48ec81e6eba0cb.mp3 | 2022-05-14 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | mayhongdualoi.mp3 | 2022-05-14 06:29 | 0 | |
![[SND]](/icons/sound2.gif) | Наутилус Помпилиус - Хлоп хлоп (mp3store.cc).mp3 | 2022-05-14 06:22 | 5.5M | |
![[SND]](/icons/sound2.gif) | NautilusPompilius.mp3 | 2022-05-14 06:22 | 128K | |
![[SND]](/icons/sound2.gif) | Nautilus Pompilius - Хлоп-хлоп.mp3 | 2022-05-14 06:20 | 9.5M | |
![[SND]](/icons/sound2.gif) | animesad.mp3 | 2022-05-14 06:19 | 0 | |
![[SND]](/icons/sound2.gif) | sun1.mp3 | 2022-05-14 06:17 | 2.4M | |
![[SND]](/icons/sound2.gif) | empire-of-geese-undertale-mettaton-song-hard-drive-rus-goblinskaya-versiya.mp3 | 2022-05-14 06:17 | 0 | |
![[SND]](/icons/sound2.gif) | wag.mp3 | 2022-05-14 06:15 | 0 | |
![[SND]](/icons/sound2.gif) | abc1.mp3 | 2022-05-14 06:11 | 0 | |
![[SND]](/icons/sound2.gif) | cr7.mp3 | 2022-05-14 06:08 | 0 | |
![[SND]](/icons/sound2.gif) | xrazer - CRAVELCHILL $ (PHONK).mp3 | 2022-05-14 06:08 | 0 | |
![[SND]](/icons/sound2.gif) | cr6.mp3 | 2022-05-14 06:07 | 0 | |
![[SND]](/icons/sound2.gif) | cr5.mp3 | 2022-05-14 06:07 | 0 | |
![[SND]](/icons/sound2.gif) | cr1.mp3 | 2022-05-14 06:06 | 0 | |
![[SND]](/icons/sound2.gif) | judullagu.mp3 | 2022-05-14 06:01 | 0 | |
![[SND]](/icons/sound2.gif) | djbhai.mp3 | 2022-05-14 06:00 | 0 | |
![[SND]](/icons/sound2.gif) | LGW.mp3 | 2022-05-14 05:59 | 0 | |
![[SND]](/icons/sound2.gif) | wizz.mp3 | 2022-05-14 05:56 | 0 | |
![[SND]](/icons/sound2.gif) | cr10.mp3 | 2022-05-14 05:55 | 0 | |
![[SND]](/icons/sound2.gif) | cr9.mp3 | 2022-05-14 05:55 | 1.7M | |
![[SND]](/icons/sound2.gif) | jomblo.mp3 | 2022-05-14 05:54 | 4.0M | |
![[SND]](/icons/sound2.gif) | locco9.mp3 | 2022-05-14 05:51 | 8.4M | |
![[SND]](/icons/sound2.gif) | locco10.mp3 | 2022-05-14 05:49 | 9.4M | |
![[SND]](/icons/sound2.gif) | ecrp1.mp3 | 2022-05-14 05:49 | 1.7M | |
![[SND]](/icons/sound2.gif) | locco13.mp3 | 2022-05-14 05:49 | 0 | |
![[SND]](/icons/sound2.gif) | wrf.mp3 | 2022-05-14 05:48 | 0 | |
![[SND]](/icons/sound2.gif) | 2022-05-06T11_08_35_568Z.mp3 | 2022-05-14 05:45 | 0 | |
![[SND]](/icons/sound2.gif) | EmpireofгeeseнardDrive (RUS).mp3 | 2022-05-14 05:44 | 0 | |
![[SND]](/icons/sound2.gif) | fv.mp3 | 2022-05-14 05:44 | 860K | |
![[SND]](/icons/sound2.gif) | Cash.mp3 | 2022-05-14 05:44 | 3.9M | |
![[SND]](/icons/sound2.gif) | cr4.mp3 | 2022-05-14 05:43 | 0 | |
![[SND]](/icons/sound2.gif) | cr3.mp3 | 2022-05-14 05:43 | 0 | |
![[SND]](/icons/sound2.gif) | Aa1.mp3 | 2022-05-14 05:42 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 你是我唯一的執着 其他.mp3 | 2022-05-14 05:37 | 0 | |
![[SND]](/icons/sound2.gif) | yell2.mp3 | 2022-05-14 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | Itsmylive.mp3 | 2022-05-14 05:33 | 1.3M | |
![[SND]](/icons/sound2.gif) | F.mp3 | 2022-05-14 05:31 | 1.8M | |
![[SND]](/icons/sound2.gif) | 10d.mp3 | 2022-05-14 05:29 | 4.8M | |
![[SND]](/icons/sound2.gif) | 60d.mp3 | 2022-05-14 05:29 | 0 | |
![[SND]](/icons/sound2.gif) | 55d.mp3 | 2022-05-14 05:29 | 0 | |
![[SND]](/icons/sound2.gif) | random33.mp3 | 2022-05-14 05:29 | 3.0M | |
![[SND]](/icons/sound2.gif) | kenn3.mp3 | 2022-05-14 05:29 | 1.0M | |
![[SND]](/icons/sound2.gif) | dande.mp3 | 2022-05-14 05:28 | 0 | |
![[SND]](/icons/sound2.gif) | happier.mp3 | 2022-05-14 05:27 | 2.4M | |
![[SND]](/icons/sound2.gif) | heatwavess.mp3 | 2022-05-14 05:27 | 0 | |
![[SND]](/icons/sound2.gif) | Tanya Markova- Jacuzzi.mp3 | 2022-05-14 05:23 | 0 | |
![[VID]](/icons/movie.gif) | pri5.mp4 | 2022-05-14 05:19 | 0 | |
![[VID]](/icons/movie.gif) | download.mp4 | 2022-05-14 05:19 | 560K | |
![[SND]](/icons/sound2.gif) | MBS LSTN TAHAP 2.mp3 | 2022-05-14 05:18 | 0 | |
![[SND]](/icons/sound2.gif) | mydicksmall.mp3 | 2022-05-14 05:16 | 0 | |
![[VID]](/icons/movie.gif) | ssstiktok_1646242470.mp4 | 2022-05-14 05:15 | 0 | |
![[SND]](/icons/sound2.gif) | Ozzy_Osbourne_-_Crazy_Train_(musmore.com).mp3 | 2022-05-14 05:15 | 11M | |
![[SND]](/icons/sound2.gif) | Nik3.mp3 | 2022-05-14 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | Nik7.mp3 | 2022-05-14 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | Nik8.mp3 | 2022-05-14 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | Nik6.mp3 | 2022-05-14 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | Nik5.mp3 | 2022-05-14 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | Nik4.mp3 | 2022-05-14 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | Nik2.mp3 | 2022-05-14 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | Nik1.mp3 | 2022-05-14 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | Empire_of_Geese_-_Hard_Drive_Undertale_RUS_63193828 (1).mp3 | 2022-05-14 05:12 | 0 | |
![[SND]](/icons/sound2.gif) | songforyou.mp3 | 2022-05-14 05:09 | 0 | |
![[SND]](/icons/sound2.gif) | พ่อมึงตาย.mp3 | 2022-05-14 05:08 | 0 | |
![[SND]](/icons/sound2.gif) | erode.mp3 | 2022-05-14 05:06 | 0 | |
![[SND]](/icons/sound2.gif) | DAY.mp3 | 2022-05-14 05:04 | 1.8M | |
![[SND]](/icons/sound2.gif) | NN.mp3 | 2022-05-14 05:04 | 1.3M | |
![[SND]](/icons/sound2.gif) | gayang777.mp3 | 2022-05-14 05:03 | 0 | |
![[SND]](/icons/sound2.gif) | ofing.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | Crazy.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | Shessh.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | teka.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | Gwolf.mp3 | 2022-05-14 05:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | Flowg2.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | FLOW.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | Bars.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | Ako lang to.mp3 | 2022-05-14 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | Fee.mp3 | 2022-05-14 05:01 | 2.8M | |
![[SND]](/icons/sound2.gif) | Xd2.mp3 | 2022-05-14 05:00 | 0 | |
![[SND]](/icons/sound2.gif) | Oat.mp3 | 2022-05-14 04:56 | 268K | |
![[SND]](/icons/sound2.gif) | seeyou.mp3 | 2022-05-14 04:55 | 485K | |
![[SND]](/icons/sound2.gif) | Xd.mp3 | 2022-05-14 04:55 | 0 | |
![[SND]](/icons/sound2.gif) | haims1.mp3 | 2022-05-14 04:55 | 0 | |
![[SND]](/icons/sound2.gif) | turn.mp3 | 2022-05-14 04:54 | 80K | |
![[SND]](/icons/sound2.gif) | Jeff Kaale Strawberry Royalty Free.mp3 | 2022-05-14 04:52 | 0 | |
![[SND]](/icons/sound2.gif) | farel.mp3 | 2022-05-14 04:51 | 0 | |
![[SND]](/icons/sound2.gif) | Rapz.mp3 | 2022-05-14 04:50 | 0 | |
![[SND]](/icons/sound2.gif) | gws.mp3 | 2022-05-14 04:48 | 0 | |
![[SND]](/icons/sound2.gif) | kontol111.mp3 | 2022-05-14 04:47 | 0 | |
![[SND]](/icons/sound2.gif) | Powerful-Emotional-Trailer.mp3 | 2022-05-14 04:47 | 0 | |
![[SND]](/icons/sound2.gif) | riken1.mp3 | 2022-05-14 04:47 | 0 | |
![[SND]](/icons/sound2.gif) | konto.mp3 | 2022-05-14 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | kkทักครับ.mp3 | 2022-05-14 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | Steady.mp3 | 2022-05-14 04:44 | 0 | |
![[SND]](/icons/sound2.gif) | Water.mp3 | 2022-05-14 04:44 | 0 | |
![[SND]](/icons/sound2.gif) | pet777.mp3 | 2022-05-14 04:42 | 0 | |
![[SND]](/icons/sound2.gif) | Moon1.mp3 | 2022-05-14 04:42 | 0 | |
![[SND]](/icons/sound2.gif) | see-you-again-ft-charlie-puth-official-video-furious-7-soundtrack.mp3 | 2022-05-14 04:41 | 0 | |
![[SND]](/icons/sound2.gif) | MOON1.mp3 | 2022-05-14 04:40 | 0 | |
![[SND]](/icons/sound2.gif) | alas.mp3 | 2022-05-14 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | luck.mp3 | 2022-05-14 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - monokrom, tulus (slowed down + reverb) (128 kbps).mp3 | 2022-05-14 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | alas (1).mp3 | 2022-05-14 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | Phoom1.mp3 | 2022-05-14 04:37 | 0 | |
![[SND]](/icons/sound2.gif) | Night in paris.mp3 | 2022-05-14 04:36 | 0 | |
![[SND]](/icons/sound2.gif) | meneketehe.mp3 | 2022-05-14 04:35 | 0 | |
![[SND]](/icons/sound2.gif) | pu111.mp3 | 2022-05-14 04:34 | 0 | |
![[SND]](/icons/sound2.gif) | Rama.mp3 | 2022-05-14 04:34 | 0 | |
![[SND]](/icons/sound2.gif) | Moon.mp3 | 2022-05-14 04:31 | 2.2M | |
![[SND]](/icons/sound2.gif) | Sad.mp3 | 2022-05-14 04:30 | 80K | |
![[SND]](/icons/sound2.gif) | puk777.mp3 | 2022-05-14 04:30 | 0 | |
![[SND]](/icons/sound2.gif) | AY1.mp3 | 2022-05-14 04:30 | 0 | |
![[SND]](/icons/sound2.gif) | GGS.mp3 | 2022-05-14 04:30 | 964K | |
![[SND]](/icons/sound2.gif) | pik777.mp3 | 2022-05-14 04:28 | 3.5M | |
![[SND]](/icons/sound2.gif) | ANGELBABY.mp3 | 2022-05-14 04:25 | 0 | |
![[SND]](/icons/sound2.gif) | pak777.mp3 | 2022-05-14 04:24 | 2.7M | |
![[SND]](/icons/sound2.gif) | ppaa.mp3 | 2022-05-14 04:23 | 1.0M | |
![[SND]](/icons/sound2.gif) | medek.mp3 | 2022-05-14 04:22 | 1.0M | |
![[SND]](/icons/sound2.gif) | Asw.mp3 | 2022-05-14 04:20 | 302K | |
![[SND]](/icons/sound2.gif) | y2mate.com - dadidau.mp3 | 2022-05-14 04:17 | 0 | |
![[SND]](/icons/sound2.gif) | ilham.mp3 | 2022-05-14 04:16 | 2.8M | |
![[SND]](/icons/sound2.gif) | On Melancholy Hill.mp3 | 2022-05-14 04:09 | 0 | |
![[SND]](/icons/sound2.gif) | TRICKSTER.mp3 | 2022-05-14 04:03 | 3.0M | |
![[SND]](/icons/sound2.gif) | dear diary cut.mp3 | 2022-05-14 04:01 | 882K | |
![[SND]](/icons/sound2.gif) | Gorillaz - On Melancholy Hill.mp3 | 2022-05-14 03:57 | 0 | |
![[SND]](/icons/sound2.gif) | ra2.mp3 | 2022-05-14 03:56 | 2.4M | |
![[SND]](/icons/sound2.gif) | 3.mp3 | 2022-05-14 03:56 | 7.5M | |
![[SND]](/icons/sound2.gif) | ra1.mp3 | 2022-05-14 03:56 | 3.2M | |
![[SND]](/icons/sound2.gif) | Alka.mp3 | 2022-05-14 03:53 | 519K | |
![[SND]](/icons/sound2.gif) | 2.1.mp3 | 2022-05-14 03:53 | 1.3M | |
![[SND]](/icons/sound2.gif) | (DownloadLagu321.Net) Dinda jangan marah marah nanti lekas tua MASDO Lyrics (128kpbs).mp3 | 2022-05-14 03:51 | 3.1M | |
![[SND]](/icons/sound2.gif) | aruta.mp3 | 2022-05-14 03:47 | 2.8M | |
![[SND]](/icons/sound2.gif) | 321.mp3 | 2022-05-14 03:47 | 3.5M | |
![[SND]](/icons/sound2.gif) | 76d.mp3 | 2022-05-14 03:45 | 6.8M | |
![[SND]](/icons/sound2.gif) | pang.mp3 | 2022-05-14 03:45 | 3.6M | |
![[SND]](/icons/sound2.gif) | PORQUE.mp3 | 2022-05-14 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | 75d.mp3 | 2022-05-14 03:41 | 4.3M | |
![[SND]](/icons/sound2.gif) | bintang.mp3 | 2022-05-14 03:41 | 664K | |
![[SND]](/icons/sound2.gif) | 65d.mp3 | 2022-05-14 03:40 | 5.1M | |
![[SND]](/icons/sound2.gif) | 46d.mp3 | 2022-05-14 03:40 | 3.1M | |
![[VID]](/icons/movie.gif) | A44E8B7479F84FE43821147D48EB5489_video_dashinit.mp4 | 2022-05-14 03:39 | 443K | |
![[SND]](/icons/sound2.gif) | ILLSLICK .mp3 | 2022-05-14 03:38 | 3.6M | |
![[SND]](/icons/sound2.gif) | 001.mp3 | 2022-05-14 03:35 | 2.3M | |
![[SND]](/icons/sound2.gif) | Cueshe- Ulan.mp3 | 2022-05-14 03:33 | 4.9M | |
![[SND]](/icons/sound2.gif) | ddd.mp3 | 2022-05-14 03:32 | 4.9M | |
![[SND]](/icons/sound2.gif) | SeddYen.mp3 | 2022-05-14 03:30 | 0 | |
![[SND]](/icons/sound2.gif) | teh111.mp3 | 2022-05-14 03:29 | 0 | |
![[SND]](/icons/sound2.gif) | Jonathan (128 kbps).mp3 | 2022-05-14 03:29 | 0 | |
![[SND]](/icons/sound2.gif) | goy111.mp3 | 2022-05-14 03:29 | 0 | |
![[SND]](/icons/sound2.gif) | cuk111.mp3 | 2022-05-14 03:28 | 0 | |
![[SND]](/icons/sound2.gif) | Cueshe- Ulan (Lyrics).mp3 | 2022-05-14 03:27 | 0 | |
![[SND]](/icons/sound2.gif) | SeddyIsSoInloveWithYen.mp3 | 2022-05-14 03:27 | 0 | |
![[SND]](/icons/sound2.gif) | zayn4.mp3 | 2022-05-14 03:26 | 0 | |
![[SND]](/icons/sound2.gif) | alexander-nakarada-medieval-loop-one.mp3 | 2022-05-14 03:23 | 0 | |
![[SND]](/icons/sound2.gif) | zayn6.mp3 | 2022-05-14 03:17 | 0 | |
![[SND]](/icons/sound2.gif) | zayn5.mp3 | 2022-05-14 03:16 | 0 | |
![[SND]](/icons/sound2.gif) | itashi.mp3 | 2022-05-14 03:12 | 0 | |
![[SND]](/icons/sound2.gif) | LELALAUE VOU NAMORAR PRA QUE FIM DO ANO TÁ CHEGANDO - TIK TOK (Com Grave) Download(MP3_320K).mp3 | 2022-05-14 03:10 | 0 | |
![[SND]](/icons/sound2.gif) | sad.mp3 | 2022-05-14 03:03 | 5.3M | |
![[SND]](/icons/sound2.gif) | DJ MAIMUNAH X TAPI RASA PERAWAN AKBAR HARJASAPUTRA VIRAL TIK TOK TERBARU 2022 !! (1).mp3 | 2022-05-14 03:00 | 0 | |
![[SND]](/icons/sound2.gif) | Mp2.mp3 | 2022-05-14 02:57 | 3.0M | |
![[SND]](/icons/sound2.gif) | DADA - ARWASS Ft Aykonz (Live Performance) I Aloha Live(MP3_320K).mp3 | 2022-05-14 02:51 | 0 | |
![[SND]](/icons/sound2.gif) | DAK - Bared (Explicite)(MP3_320K).mp3 | 2022-05-14 02:46 | 0 | |
![[SND]](/icons/sound2.gif) | Nightcore - Do Me (Lyrics) (320 kbps).mp3 | 2022-05-14 02:39 | 0 | |
![[SND]](/icons/sound2.gif) | sadboy.mp3 | 2022-05-14 02:37 | 2.8M | |
![[SND]](/icons/sound2.gif) | Mishlawi - All Night 𝘴 𝘭 𝘰 𝘸 𝘦 𝘥.mp3 | 2022-05-14 02:36 | 0 | |
![[SND]](/icons/sound2.gif) | Alok, Bruno Martini, Zeeba - Hear Me Now (slow & reverb prod. by LaCorone).mp3 | 2022-05-14 02:34 | 0 | |
![[SND]](/icons/sound2.gif) | added a melodie at the into to add more atmosphere.mp3 | 2022-05-14 02:31 | 0 | |
![[SND]](/icons/sound2.gif) | Mp5.mp3 | 2022-05-14 02:23 | 0 | |
![[SND]](/icons/sound2.gif) | SAD BOY.mp3 | 2022-05-14 02:22 | 0 | |
![[SND]](/icons/sound2.gif) | CC.mp3 | 2022-05-14 02:21 | 0 | |
![[SND]](/icons/sound2.gif) | final_627f0f3fc34ca70087f25f7e_356695.mp3 | 2022-05-14 02:18 | 0 | |
![[SND]](/icons/sound2.gif) | Mp4.mp3 | 2022-05-14 02:13 | 3.1M | |
![[SND]](/icons/sound2.gif) | until-it-happens-to-you-sasha-sloan.mp3 | 2022-05-14 01:52 | 0 | |
![[SND]](/icons/sound2.gif) | wedok.mp3 | 2022-05-14 01:51 | 0 | |
![[SND]](/icons/sound2.gif) | lanang2.mp3 | 2022-05-14 01:50 | 0 | |
![[SND]](/icons/sound2.gif) | lanang1.mp3 | 2022-05-14 01:50 | 0 | |
![[SND]](/icons/sound2.gif) | Glass Animals - Heat Waves (Official Video).mp3 | 2022-05-14 01:49 | 3.6M | |
![[SND]](/icons/sound2.gif) | Zavyazhi_glaza_pokrepche_ne_bojsya_Qontrast_cover_by_Cvetocek.mp3 | 2022-05-14 01:33 | 0 | |
![[VID]](/icons/movie.gif) | xvideos.com_8634c2f6ebb0cb8ec592eb4d53a7395b.mp4 | 2022-05-14 01:26 | 0 | |
![[SND]](/icons/sound2.gif) | lkDX.mp3 | 2022-05-14 01:20 | 0 | |
![[SND]](/icons/sound2.gif) | Xcho_-_bere-beregi_moyu_lyubov_74156850.mp3 | 2022-05-14 01:19 | 0 | |
![[SND]](/icons/sound2.gif) | 7 years X latch.mp3 | 2022-05-14 01:18 | 0 | |
![[SND]](/icons/sound2.gif) | Defo.mp3 | 2022-05-14 01:17 | 0 | |
![[SND]](/icons/sound2.gif) | Xcho - Бере береги мою любовь (slowed) (mp3zen.net).mp3 | 2022-05-14 01:16 | 0 | |
![[SND]](/icons/sound2.gif) | wantme.mp3 | 2022-05-14 01:11 | 0 | |
![[SND]](/icons/sound2.gif) | loveyou.mp3 | 2022-05-14 01:11 | 0 | |
![[SND]](/icons/sound2.gif) | Kinda half able to play snow hey oh.mp3 | 2022-05-14 01:10 | 0 | |
![[SND]](/icons/sound2.gif) | Hw.mp3 | 2022-05-14 01:05 | 0 | |
![[SND]](/icons/sound2.gif) | Ax.mp3 | 2022-05-14 01:02 | 0 | |
![[SND]](/icons/sound2.gif) | HW.mp3 | 2022-05-14 01:02 | 3.1M | |
![[SND]](/icons/sound2.gif) | until i found you.mp3 | 2022-05-14 01:02 | 0 | |
![[SND]](/icons/sound2.gif) | POU.mp3 | 2022-05-14 01:01 | 0 | |
![[SND]](/icons/sound2.gif) | HPR.mp3 | 2022-05-14 01:01 | 500K | |
![[SND]](/icons/sound2.gif) | Da.mp3 | 2022-05-14 00:54 | 3.2M | |
![[SND]](/icons/sound2.gif) | Chekuthan.mp3 | 2022-05-14 00:50 | 3.0M | |
![[SND]](/icons/sound2.gif) | mehbooba123.mp3 | 2022-05-14 00:49 | 356K | |
![[SND]](/icons/sound2.gif) | Ko.mp3 | 2022-05-14 00:46 | 3.1M | |
![[SND]](/icons/sound2.gif) | dj9.mp3 | 2022-05-14 00:39 | 9.6M | |
![[SND]](/icons/sound2.gif) | Pk.mp3 | 2022-05-14 00:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Avanged sevenfold So Far Away Remix MelodinYa Bikin Ketagihannn X Dj Irfans.mp3 | 2022-05-14 00:23 | 0 | |
![[SND]](/icons/sound2.gif) | ok1.mp3 | 2022-05-14 00:13 | 0 | |
![[SND]](/icons/sound2.gif) | OnlyMP3.to - Young Maylay aka CJ - Grove Street Rap - GTA San Andreas-pQHr6ZE2j08-192k-1650321441417.mp3 | 2022-05-14 00:00 | 0 | |
![[SND]](/icons/sound2.gif) | YNY Sebi X @Petre Stefan - Lux (Official Music Video).mp3 | 2022-05-13 23:59 | 220K | |
![[SND]](/icons/sound2.gif) | hbd.mp3 | 2022-05-13 23:57 | 328K | |
![[SND]](/icons/sound2.gif) | ssstiktok_1642355115.mp3 | 2022-05-13 23:51 | 0 | |
![[SND]](/icons/sound2.gif) | chil17.mp3 | 2022-05-13 23:49 | 0 | |
![[SND]](/icons/sound2.gif) | Instagram video.mp3 | 2022-05-13 23:43 | 0 | |
![[SND]](/icons/sound2.gif) | Cmt.mp3 | 2022-05-13 23:42 | 0 | |
![[SND]](/icons/sound2.gif) | r4f.mp3 | 2022-05-13 23:42 | 0 | |
![[SND]](/icons/sound2.gif) | Harga Diri Wali Band cover by Indah Yastami story wa.mp3 | 2022-05-13 23:40 | 0 | |
![[SND]](/icons/sound2.gif) | Tricksteranthem.mp3 | 2022-05-13 23:35 | 0 | |
![[SND]](/icons/sound2.gif) | Raf4.mp3 | 2022-05-13 23:29 | 0 | |
![[SND]](/icons/sound2.gif) | AIW.mp3 | 2022-05-13 23:26 | 0 | |
![[SND]](/icons/sound2.gif) | Animals Bird Solitary Vireo Chirp Single.mp3 | 2022-05-13 23:15 | 0 | |
![[SND]](/icons/sound2.gif) | Rafka.mp3 | 2022-05-13 23:12 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Relaxing morning songs Morning vibes chill mix music morning.mp3 | 2022-05-13 23:07 | 0 | |
![[SND]](/icons/sound2.gif) | Shadowraze - showdown.mp3 | 2022-05-13 23:01 | 44K | |
![[SND]](/icons/sound2.gif) | videoplayback (2) (online-audio-converter.com).mp3 | 2022-05-13 22:58 | 1.7M | |
![[SND]](/icons/sound2.gif) | UNDERGROUND CULT - LET EM ROTT (PROD. BY SOLACE KAI)_(MP3Ball.ru).mp3 | 2022-05-13 22:57 | 0 | |
![[SND]](/icons/sound2.gif) | SymphonicSuite[AoT]Part1-3rdBARRIchestra - Attack on Titan Season 3 OST [TubeRipper.com].mp3 | 2022-05-13 22:53 | 0 | |
![[SND]](/icons/sound2.gif) | Barricades [TubeRipper.com].mp3 | 2022-05-13 22:53 | 0 | |
![[SND]](/icons/sound2.gif) | Fairuz - Sabah Wu Masa_no_vocals_split_by_lalalai.mp3 | 2022-05-13 22:44 | 0 | |
![[SND]](/icons/sound2.gif) | Dafa.mp3 | 2022-05-13 22:31 | 0 | |
![[SND]](/icons/sound2.gif) | Jeff Kaale- Strawberry (Royalty Free).mp3 | 2022-05-13 22:15 | 0 | |
![[SND]](/icons/sound2.gif) | VagosS.mp3 | 2022-05-13 22:08 | 0 | |
![[SND]](/icons/sound2.gif) | LAGU_LUNAR_PRIDE_CREDIT_@24Rie_[Dah_Ye_Makasih_Yang_Udah_Tag_Pembuatnya😁](256k).mp3 | 2022-05-13 22:07 | 0 | |
![[SND]](/icons/sound2.gif) | Flower_Killer_Sounddesign_mixdown (1) (1).mp3 | 2022-05-13 22:05 | 0 | |
![[SND]](/icons/sound2.gif) | roddyrich43.mp3 | 2022-05-13 21:52 | 0 | |
![[SND]](/icons/sound2.gif) | Toton_Caribo_-_RINDU_ft._Chesylino_x_Fez_Lamere_x_Lit_Go_x_Jacson_Zeran_(Official_MV)(256k).mp3 | 2022-05-13 21:46 | 44K | |
![[SND]](/icons/sound2.gif) | ebanko-landyshi-s-matom-mp3.mp3 | 2022-05-13 21:43 | 4.3M | |
![[SND]](/icons/sound2.gif) | Silver Pozzoli - Around My Dream • TopPop (NUEVOEXITO.ORG).mp3 | 2022-05-13 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | LO.mp3 | 2022-05-13 21:27 | 2.9M | |
![[SND]](/icons/sound2.gif) | ارسمني في ليلك نجمة♥اليسا ـ سعد المجرد من اول دقيقة حالات واتس اب حب ـ اغاني رومنسية مقاطع قصيره حب (192 kbps).mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | Unknown_artist_-_Comedoz_-_YAmajjka_hip-hop_remix_73727176.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | Vektor_A_-_Lirika_73829315.mp3 | 2022-05-13 21:27 | 6.7M | |
![[SND]](/icons/sound2.gif) | kalvados_-_Prostyni_73829379.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | OBLADAET_-_BLIND_ZONE_72874000.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | Neizvestnyjj_-_JEkspajjn_-_Ne_razdevajjsya_74135125.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | MACAN_-_GIRI_74140547.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | By_Indiya_-_lyubi_menya_tak_73145464.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | Miyagi_Andy_Panda_TumaniYO_-_Brooklyn_69553060.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | PUSSYKILLER_JEksi_-_Kontakt_73768860.mp3 | 2022-05-13 21:27 | 5.3M | |
![[SND]](/icons/sound2.gif) | Tik_Tok_Mix_-_Za_cvet_golubykh_ochejj_Tik_Tok_remix_73980200.mp3 | 2022-05-13 21:27 | 0 | |
![[SND]](/icons/sound2.gif) | zvyozdnie_vojni_-_temukovski_gimn_(zf.fm).mp3 | 2022-05-13 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | Patatata.mp3 | 2022-05-13 21:20 | 0 | |
![[SND]](/icons/sound2.gif) | KIZARU_-_Dezhavyu_66123347.mp3 | 2022-05-13 21:19 | 6.7M | |
![[SND]](/icons/sound2.gif) | FELIX SELALU ADA (BLACKOUT).mp3 | 2022-05-13 21:14 | 0 | |
![[SND]](/icons/sound2.gif) | happy (Gustixa ft. Nida Havia).mp3 | 2022-05-13 21:10 | 1.1M | |
![[SND]](/icons/sound2.gif) | X2D.mp3 | 2022-05-13 21:04 | 2.1M | |
![[SND]](/icons/sound2.gif) | Моргенштерн - Хаммер.mp3 | 2022-05-13 21:02 | 0 | |
![[SND]](/icons/sound2.gif) | miyabi.mp3 | 2022-05-13 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | Alan Walker x Winona Oak - World We Used To Know (Jack Benjamin Remix) .mp4.mp3 | 2022-05-13 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | PPCG.mp3 | 2022-05-13 20:52 | 44K | |
![[SND]](/icons/sound2.gif) | Promethazine - SARAN X Black Heart X Pondering (OFFICIAL MV).mp3 | 2022-05-13 20:49 | 3.6M | |
![[SND]](/icons/sound2.gif) | Kids (feat. MKLA).mp3 | 2022-05-13 20:48 | 0 | |
![[SND]](/icons/sound2.gif) | VZ.mp3 | 2022-05-13 20:47 | 0 | |
![[SND]](/icons/sound2.gif) | 1233.mp3 | 2022-05-13 20:46 | 0 | |
![[SND]](/icons/sound2.gif) | ZA123.mp3 | 2022-05-13 20:45 | 0 | |
![[SND]](/icons/sound2.gif) | eth-maakabphaw-feat-jack-wc-and-manr-office-music-video.mp3 | 2022-05-13 20:44 | 0 | |
![[SND]](/icons/sound2.gif) | alok-love_again.mp3 | 2022-05-13 20:41 | 0 | |
![[SND]](/icons/sound2.gif) | pai4.mp3 | 2022-05-13 20:39 | 0 | |
![[SND]](/icons/sound2.gif) | file-[AudioTrimmer.com].mp3 | 2022-05-13 20:37 | 0 | |
![[SND]](/icons/sound2.gif) | เรื่องฝนฝน.mp3 | 2022-05-13 20:36 | 0 | |
![[SND]](/icons/sound2.gif) | raven4.mp3 | 2022-05-13 20:34 | 0 | |
![[SND]](/icons/sound2.gif) | Boney M - Ma baker (HQ Sound Flac) (Audio) (320 kbps).mp3 | 2022-05-13 20:34 | 0 | |
![[SND]](/icons/sound2.gif) | raven3.mp3 | 2022-05-13 20:33 | 0 | |
![[SND]](/icons/sound2.gif) | raven2.mp3 | 2022-05-13 20:32 | 0 | |
![[SND]](/icons/sound2.gif) | Agonía de amor - Dilbert Aguilar y La Tribu (Letra) (URBANOMP3.NET).mp3 | 2022-05-13 20:30 | 0 | |
![[SND]](/icons/sound2.gif) | raven1.mp3 | 2022-05-13 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_zambian-eas-alarm-youtubemp3free.org.mp3 | 2022-05-13 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | dom97.mp3 | 2022-05-13 20:28 | 0 | |
![[SND]](/icons/sound2.gif) | raven.mp3 | 2022-05-13 20:27 | 0 | |
![[SND]](/icons/sound2.gif) | Charlie Pryce - Nibzys Pocast 6.mp3 | 2022-05-13 20:23 | 0 | |
![[SND]](/icons/sound2.gif) | accord01.mp3 | 2022-05-13 20:22 | 0 | |
![[SND]](/icons/sound2.gif) | file.mp3 | 2022-05-13 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | Zambian EAS Alarm.mp3 | 2022-05-13 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | poddy6.mp3 | 2022-05-13 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | Buju Baston & Pure_Filth - Feeling You.mp3 | 2022-05-13 20:18 | 0 | |
![[SND]](/icons/sound2.gif) | XI.mp3 | 2022-05-13 20:16 | 136K | |
![[SND]](/icons/sound2.gif) | markovich-gimn-anonimusov-mp3.mp3 | 2022-05-13 20:13 | 0 | |
![[SND]](/icons/sound2.gif) | Arabic Nokia Ringtone EARRAPE.mp3 | 2022-05-13 20:12 | 0 | |
![[SND]](/icons/sound2.gif) | PAI01.mp3 | 2022-05-13 20:12 | 0 | |
![[SND]](/icons/sound2.gif) | Kaito_Shoma_DJ_Paul_-_Scary_Garry_(musmore.com).mp3 | 2022-05-13 20:11 | 0 | |
![[SND]](/icons/sound2.gif) | Shoffy - I Can't Help (Asti Remix).mp3 | 2022-05-13 20:08 | 0 | |
![[SND]](/icons/sound2.gif) | Halogen - U Got That.mp3 | 2022-05-13 20:07 | 2.1M | |
![[SND]](/icons/sound2.gif) | Resident Evil - Main Theme.mp3 | 2022-05-13 20:06 | 0 | |
![[SND]](/icons/sound2.gif) | AMOGUS — SUS ! (www.lightaudio.ru).mp3 | 2022-05-13 20:05 | 0 | |
![[SND]](/icons/sound2.gif) | Cobus - Chumbawamba - Tubthumping (NUEVOEXITO.ORG).mp3 | 2022-05-13 20:00 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Justin Bieber - Ghost (Lyrics) (128 kbps).mp3 | 2022-05-13 19:59 | 0 | |
![[SND]](/icons/sound2.gif) | Jambo Jambo - Magic Life + lyrics (URBANOMP3.NET).mp3 | 2022-05-13 19:59 | 0 | |
![[VID]](/icons/movie.gif) | ukraine wave _war edit (online-video-cutter.com).mp4 | 2022-05-13 19:57 | 0 | |
![[SND]](/icons/sound2.gif) | _kizaru & Big Baby Tape - Baby Walker (1).mp3 | 2022-05-13 19:53 | 0 | |
![[SND]](/icons/sound2.gif) | Enchanted.mp3 | 2022-05-13 19:52 | 3.5M | |
![[SND]](/icons/sound2.gif) | intervjuer fra boligmessa.mp3 | 2022-05-13 19:45 | 0 | |
![[VID]](/icons/movie.gif) | Alan Walker x Winona Oak - World We Used To Know (Jack Benjamin Remix) .mp4.mp4 | 2022-05-13 19:39 | 0 | |
![[SND]](/icons/sound2.gif) | 18. Narkotyki, narkomani, narkomanie.mp3 | 2022-05-13 19:37 | 0 | |
![[SND]](/icons/sound2.gif) | A Universal Time — STWR Pose Music (www.lightaudio.ru).mp3 | 2022-05-13 19:37 | 0 | |
![[SND]](/icons/sound2.gif) | Glas 001.m4a | 2022-05-13 19:35 | 0 | |
![[SND]](/icons/sound2.gif) | pap.mp3 | 2022-05-13 19:34 | 3.1M | |
![[SND]](/icons/sound2.gif) | Macklemore_-_Cant_Hold_Us_48060074.mp3 | 2022-05-13 19:34 | 0 | |
![[SND]](/icons/sound2.gif) | Angel.mp3 | 2022-05-13 19:33 | 4.3M | |
![[SND]](/icons/sound2.gif) | Party.mp3 | 2022-05-13 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | geroi-mecha-i-magii-3-propusk-hoda-3.mp3 | 2022-05-13 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | AUT - STWR theme (www.hotplayer.ru).mp3 | 2022-05-13 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | kk2.mp3 | 2022-05-13 19:30 | 0 | |
![[SND]](/icons/sound2.gif) | ASG.mp3 | 2022-05-13 19:29 | 3.1M | |
![[SND]](/icons/sound2.gif) | Репер FACE Зачитал Под Олдовый Драм Энд Басс.mp3 | 2022-05-13 19:27 | 0 | |
![[SND]](/icons/sound2.gif) | Репер FACE — Зачитал Под Олдовый Драм Энд Басс (www.lightaudio.ru).mp3 | 2022-05-13 19:27 | 0 | |
![[SND]](/icons/sound2.gif) | Giornotheme(bestpart)JoJosBizarreAdventure_(ComedySong.ru).mp3 | 2022-05-13 19:26 | 0 | |
![[SND]](/icons/sound2.gif) | Miyagi_-_Captain_57155728.mp3 | 2022-05-13 19:22 | 8.3M | |
![[SND]](/icons/sound2.gif) | AfifInTheEnd.mp3 | 2022-05-13 19:19 | 0 | |
![[SND]](/icons/sound2.gif) | KUBUR.mp3 | 2022-05-13 19:13 | 0 | |
![[SND]](/icons/sound2.gif) | Diatasmeja.mp3 | 2022-05-13 19:12 | 0 | |
![[SND]](/icons/sound2.gif) | ASIK.mp3 | 2022-05-13 19:12 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Payung Teduh - Di Atas Meja (Official Lyric Video) (128 kbps).mp3 | 2022-05-13 19:12 | 0 | |
![[SND]](/icons/sound2.gif) | Tidurlah.mp3 | 2022-05-13 19:11 | 0 | |
![[SND]](/icons/sound2.gif) | Home Free - Sea Shanty Medley.mp3 | 2022-05-13 19:11 | 0 | |
![[SND]](/icons/sound2.gif) | Alan Walker x Winona Oak - World We Used To Know (Jack Benjamin Remix).mp3 | 2022-05-13 19:05 | 0 | |
![[SND]](/icons/sound2.gif) | cokasu9.mp3 | 2022-05-13 19:03 | 0 | |
![[SND]](/icons/sound2.gif) | apan3.mp3 | 2022-05-13 19:01 | 3.8M | |
![[SND]](/icons/sound2.gif) | Tilman vd - Я ПОМНЮ ПЕНИС БОЛЬШОЙ (Remix)_(AndroSound.ru).mp3 | 2022-05-13 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | ayang1.mp3 | 2022-05-13 18:54 | 0 | |
![[SND]](/icons/sound2.gif) | derron8.mp3 | 2022-05-13 18:50 | 0 | |
![[SND]](/icons/sound2.gif) | Big_Baby_Tape_-_Balaclava_Prod_DJ_Tape_Serge_Laconic_64107518.mp3 | 2022-05-13 18:48 | 0 | |
![[SND]](/icons/sound2.gif) | bark bark - Listen here I don't like you I am now going to bark at you.mp3 | 2022-05-13 18:40 | 0 | |
![[SND]](/icons/sound2.gif) | FFVII.mp3 | 2022-05-13 18:36 | 0 | |
![[SND]](/icons/sound2.gif) | EZ1.mp3 | 2022-05-13 18:33 | 0 | |
![[SND]](/icons/sound2.gif) | Oxxxymiron ft. Eminem - Stan [mashup].mp3 | 2022-05-13 18:28 | 0 | |
![[SND]](/icons/sound2.gif) | [MP3FY] Serenade (Ständchen)_Schubert [Music Box].mp3 | 2022-05-13 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | minorrrrmiyagiiiui.mp3 | 2022-05-13 18:16 | 0 | |
![[SND]](/icons/sound2.gif) | Rakhim_-_Кто_тебе_сказал.mp3.mp3 | 2022-05-13 18:11 | 0 | |
![[SND]](/icons/sound2.gif) | Eduardo XD - My Neck My Back Turkish (Remix) .mp3 | 2022-05-13 18:08 | 0 | |
![[SND]](/icons/sound2.gif) | Roza Chechen music_ Роза.mp3 | 2022-05-13 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | albob.mp3 | 2022-05-13 18:06 | 0 | |
![[SND]](/icons/sound2.gif) | laguold1998.mp3 | 2022-05-13 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | Shadowraze Juggernaut - Dead inside (Tik Tok music).mp3 | 2022-05-13 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | vazhna_lish_stepen_iskrennosti_-_i_ja_govorju_tebe_mislenno_prosti_(z2.fm).mp3 | 2022-05-13 17:49 | 0 | |
![[SND]](/icons/sound2.gif) | bigbabytapekizarubigtymersmp.mp3 | 2022-05-13 17:43 | 0 | |
![[SND]](/icons/sound2.gif) | A01.mp3 | 2022-05-13 17:39 | 0 | |
![[SND]](/icons/sound2.gif) | ♚💔🎲2107🎲💔♚ - errbody sleeping-1.mp3 | 2022-05-13 17:39 | 0 | |
![[SND]](/icons/sound2.gif) | tm.mp3 | 2022-05-13 17:38 | 500K | |
![[SND]](/icons/sound2.gif) | DA.mp3 | 2022-05-13 17:37 | 712K | |
![[SND]](/icons/sound2.gif) | LP.mp3 | 2022-05-13 17:33 | 0 | |
![[SND]](/icons/sound2.gif) | Cg20.mp3 | 2022-05-13 17:32 | 600K | |
![[SND]](/icons/sound2.gif) | lightswitch.mp3 | 2022-05-13 17:32 | 2.3M | |
![[SND]](/icons/sound2.gif) | BG.mp3 | 2022-05-13 17:31 | 2.0M | |
![[SND]](/icons/sound2.gif) | Wizz.mp3 | 2022-05-13 17:31 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - CG 2.0 (128 kbps).mp3 | 2022-05-13 17:28 | 0 | |
![[SND]](/icons/sound2.gif) | 🎶низкие частоты 🎶 - Slow bass в машину 😈 (www.hotplayer.ru).mp3 | 2022-05-13 17:17 | 0 | |
![[SND]](/icons/sound2.gif) | Djkeren.mp3 | 2022-05-13 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | nocturne-es-dur.mp3 | 2022-05-13 17:15 | 0 | |
![[SND]](/icons/sound2.gif) | djkeren.mp3 | 2022-05-13 17:12 | 0 | |
![[SND]](/icons/sound2.gif) | 7002166467143781146.mp3 | 2022-05-13 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | Ken.mp3 | 2022-05-13 17:00 | 5.9M | |
![[SND]](/icons/sound2.gif) | kha.mp3 | 2022-05-13 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | Unstoppable(PaglaSongs).mp3 | 2022-05-13 16:58 | 0 | |
![[SND]](/icons/sound2.gif) | Alex.mp3 | 2022-05-13 16:57 | 2.8M | |
![[VID]](/icons/movie.gif) | y2mate.com - Roddy Ricch Down Below Official Music Video Dir by JMP_480p.mp4 | 2022-05-13 16:52 | 0 | |
![[SND]](/icons/sound2.gif) | zkids.mp3 | 2022-05-13 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | roddyrich.mp3 | 2022-05-13 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | ndrax.mp3 | 2022-05-13 16:42 | 0 | |
![[SND]](/icons/sound2.gif) | Bones - RIBS (mp3store.cc).mp3 | 2022-05-13 16:41 | 0 | |
![[SND]](/icons/sound2.gif) | saw_soundtracks_4364287297919837881.mp3 | 2022-05-13 16:36 | 0 | |
![[SND]](/icons/sound2.gif) | abta1.mp3 | 2022-05-13 16:31 | 0 | |
![[SND]](/icons/sound2.gif) | Yanix - Все пати за счет папы (zaycev.net).mp3 | 2022-05-13 16:31 | 0 | |
![[SND]](/icons/sound2.gif) | 🇷🇺ᴏᴘᴇʀsᴋᴀʏᴀ🇷🇺 - Улетай сгу 🦅.mp3 | 2022-05-13 16:29 | 0 | |
![[SND]](/icons/sound2.gif) | ♚💔🎲2107🎲💔♚ - ʀᴀsᴛᴀfᴀʀɪ.mp3 | 2022-05-13 16:28 | 0 | |
![[SND]](/icons/sound2.gif) | on.mp3 | 2022-05-13 16:28 | 2.7M | |
![[SND]](/icons/sound2.gif) | ♚💔🎲2107🎲💔♚ - errbody sleeping.mp3 | 2022-05-13 16:27 | 0 | |
![[SND]](/icons/sound2.gif) | Debeh.mp3 | 2022-05-13 16:27 | 0 | |
![[SND]](/icons/sound2.gif) | test2.mp3 | 2022-05-13 16:27 | 0 | |
![[SND]](/icons/sound2.gif) | XXXX.mp3 | 2022-05-13 16:24 | 0 | |
![[SND]](/icons/sound2.gif) | Oddball_2016.mp3 | 2022-05-13 16:24 | 0 | |
![[SND]](/icons/sound2.gif) | ғᴀᴇʀɪᴄᴏ | ᴍᴜsɪᴄ 🦈 - ʙᴏʟ'ꜱʜɪʏᴇ ɢᴏʀᴏᴅᴀ %22ꜰᴀᴇʀɪᴄᴏ ꜱʟᴏᴡ%22.mp3 | 2022-05-13 16:23 | 0 | |
![[SND]](/icons/sound2.gif) | MiyaGi & Andy Panda - Kosandra.mp3 | 2022-05-13 16:22 | 0 | |
![[SND]](/icons/sound2.gif) | Test.Mp.mp3 | 2022-05-13 16:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Happy Birthday Mkartikawati Official lyric Video.mp3 | 2022-05-13 16:21 | 0 | |
![[SND]](/icons/sound2.gif) | Hellyeahh.mp3 | 2022-05-13 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | fajri.mp3 | 2022-05-13 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | Диман Брюханов - Со лбом затянута карета.mp3 | 2022-05-13 16:14 | 3.7M | |
![[SND]](/icons/sound2.gif) | gabungan1.mp3 | 2022-05-13 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | Диман Брюханов - БПАН.mp3 | 2022-05-13 16:12 | 1.5M | |
![[SND]](/icons/sound2.gif) | 11171104.mp3 | 2022-05-13 16:11 | 0 | |
![[SND]](/icons/sound2.gif) | 1652457.mp3 | 2022-05-13 16:08 | 0 | |
![[SND]](/icons/sound2.gif) | DJ LO MATI GUE PARTY COY SAMPE BAWAH REMIX TIKTOK VIRAL FULL BASS TERBARU 2022.mp3 | 2022-05-13 16:06 | 38M | |
![[SND]](/icons/sound2.gif) | AfterDark.mp3 | 2022-05-13 16:04 | 2.2M | |
![[SND]](/icons/sound2.gif) | loading.mp3 | 2022-05-13 16:03 | 552K | |
![[SND]](/icons/sound2.gif) | enak1.mp3 | 2022-05-13 16:01 | 964K | |
![[SND]](/icons/sound2.gif) | ДАЛЬТОНИК, DEXDLYPLAYA - Yamete Kudasai.mp3 | 2022-05-13 16:00 | 0 | |
![[SND]](/icons/sound2.gif) | mimsky.mp3 | 2022-05-13 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | Scally Milano, uglystephan - Я хочу тебя трахать.mp3 | 2022-05-13 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | virgountinggal.mp3 | 2022-05-13 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | DJ ALWAYS STRONG ANTI DROP SOUND DROOPSAY LAGU YANG LAGI VIRAL YANG KALIAN CARI!!!.mp3 | 2022-05-13 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | selamattinggal.mp3 | 2022-05-13 15:55 | 0 | |
![[SND]](/icons/sound2.gif) | george.mp3 | 2022-05-13 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | george1.mp3 | 2022-05-13 15:54 | 3.2M | |
![[SND]](/icons/sound2.gif) | first lovee.mp3 | 2022-05-13 15:51 | 742K | |
![[SND]](/icons/sound2.gif) | brook3.mp3 | 2022-05-13 15:50 | 3.0M | |
![[SND]](/icons/sound2.gif) | hew9.mp3 | 2022-05-13 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | TM.mp3 | 2022-05-13 15:49 | 4.8M | |
![[SND]](/icons/sound2.gif) | WhatsApp Audio 2022-05-08 at 11.52.11 AM.mp3 | 2022-05-13 15:49 | 0 | |
![[SND]](/icons/sound2.gif) | brook7.mp3 | 2022-05-13 15:47 | 2.6M | |
![[SND]](/icons/sound2.gif) | gay2.mp3 | 2022-05-13 15:44 | 560K | |
![[SND]](/icons/sound2.gif) | carlo5.mp3 | 2022-05-13 15:43 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1652149940231 (1).mp3 | 2022-05-13 15:42 | 0 | |
![[SND]](/icons/sound2.gif) | lagu dj buat jgrp.mp3 | 2022-05-13 15:42 | 37M | |
![[SND]](/icons/sound2.gif) | hpvol2.mp3 | 2022-05-13 15:40 | 0 | |
![[SND]](/icons/sound2.gif) | carlo4.mp3 | 2022-05-13 15:38 | 0 | |
![[SND]](/icons/sound2.gif) | brook10.mp3 | 2022-05-13 15:38 | 452K | |
![[SND]](/icons/sound2.gif) | XD.mp3 | 2022-05-13 15:36 | 2.8M | |
![[SND]](/icons/sound2.gif) | carlo3.mp3 | 2022-05-13 15:34 | 0 | |
![[SND]](/icons/sound2.gif) | Artur.mp3 | 2022-05-13 15:33 | 0 | |
![[SND]](/icons/sound2.gif) | AL.mp3 | 2022-05-13 15:33 | 0 | |
![[SND]](/icons/sound2.gif) | carlo1.mp3 | 2022-05-13 15:32 | 440K | |
![[SND]](/icons/sound2.gif) | brook8.mp3 | 2022-05-13 15:31 | 3.0M | |
![[SND]](/icons/sound2.gif) | ccc.mp3 | 2022-05-13 15:30 | 0 | |
![[SND]](/icons/sound2.gif) | DJ-POK-AME-AME-BELALANG-KUPU-KUPU-REMIX-FULL-BASS-♫-LAGU-DJ-TERBARU-REMIX-ORIGINAL-2022.mp3 | 2022-05-13 15:29 | 2.3M | |
![[SND]](/icons/sound2.gif) | serhat-durmus-turkum-turkish-music-trap-beat-[AudioTrimmer.com].mp3 | 2022-05-13 15:29 | 4.8M | |
![[SND]](/icons/sound2.gif) | I_Love_You.mp3 | 2022-05-13 15:29 | 1.9M | |
![[SND]](/icons/sound2.gif) | ZL.mp3 | 2022-05-13 15:28 | 3.7M | |
![[SND]](/icons/sound2.gif) | Murda.mp3 | 2022-05-13 15:25 | 0 | |
![[SND]](/icons/sound2.gif) | GL.mp3 | 2022-05-13 15:25 | 0 | |
![[SND]](/icons/sound2.gif) | Fly Me To The Moon (Backing Tarck).mp3 | 2022-05-13 15:25 | 0 | |
![[SND]](/icons/sound2.gif) | djd2.mp3 | 2022-05-13 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | djd1.mp3 | 2022-05-13 15:23 | 0 | |
![[SND]](/icons/sound2.gif) | carlo2.mp3 | 2022-05-13 15:23 | 1.1M | |
![[SND]](/icons/sound2.gif) | NL.mp3 | 2022-05-13 15:23 | 1.0M | |
![[SND]](/icons/sound2.gif) | X2Download.com - ธรณีกรรแสงแดนซ์ (128 kbps).mp3 | 2022-05-13 15:22 | 1.0M | |
![[SND]](/icons/sound2.gif) | CJ.mp3 | 2022-05-13 15:20 | 3.9M | |
![[SND]](/icons/sound2.gif) | Linkin_Park_-_Numb_47828673.mp3 | 2022-05-13 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | ximangvolpho2.mp3 | 2022-05-13 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | Cầm Quyền 2.mp3 | 2022-05-13 15:20 | 80K | |
![[SND]](/icons/sound2.gif) | X2Download.com - MIBULA - TKD DRILL FT. P4M! @Produced by lejJA x bandoface (64 kbps).mp3 | 2022-05-13 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1652149940231.mp3 | 2022-05-13 15:15 | 0 | |
![[SND]](/icons/sound2.gif) | Lexy.mp3 | 2022-05-13 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | ᴍᴀʀɪᴠᴀɴɴᴀ🌹_я_ʏҕᴇrᴀю_«ᴋᴇᴇᴘ».mp3 | 2022-05-13 15:09 | 0 | |
![[SND]](/icons/sound2.gif) | MM.mp3 | 2022-05-13 15:07 | 2.3M | |
![[SND]](/icons/sound2.gif) | MIRBRO - Кома (Konfuz).mp3 | 2022-05-13 15:07 | 0 | |
![[SND]](/icons/sound2.gif) | CoverSnowbell .mp3 | 2022-05-13 15:04 | 3.0M | |
![[SND]](/icons/sound2.gif) | Lynzie.mp3 | 2022-05-13 15:00 | 3.1M | |
![[SND]](/icons/sound2.gif) | X2Download.com - รวมเพลงSARANใหมล่าสุด รวมเพลงแร็พคมๆ _ ลืมแทบไม่ไหว,ปีใหม่ปีนี้ (64 kbps).mp3 | 2022-05-13 14:57 | 0 | |
![[SND]](/icons/sound2.gif) | #ulangtahun_#ucapanultah.m4a | 2022-05-13 14:57 | 676K | |
![[SND]](/icons/sound2.gif) | dodi.mp3 | 2022-05-13 14:57 | 429K | |
![[SND]](/icons/sound2.gif) | y2mate.com - AGIG TEAM MANGBORIS ft NotBrian Lyric Video.mp3 | 2022-05-13 14:55 | 0 | |
![[SND]](/icons/sound2.gif) | gor.mp3 | 2022-05-13 14:53 | 0 | |
![[SND]](/icons/sound2.gif) | jam_20181004.mp3 | 2022-05-13 14:52 | 0 | |
![[SND]](/icons/sound2.gif) | Bo.mp3 | 2022-05-13 14:50 | 60M | |
![[SND]](/icons/sound2.gif) | So.mp3 | 2022-05-13 14:50 | 4.0M | |
![[SND]](/icons/sound2.gif) | To.mp3 | 2022-05-13 14:50 | 2.8M | |
![[SND]](/icons/sound2.gif) | Ro.mp3 | 2022-05-13 14:50 | 3.5M | |
![[SND]](/icons/sound2.gif) | Oo.mp3 | 2022-05-13 14:50 | 728K | |
![[SND]](/icons/sound2.gif) | Po.mp3 | 2022-05-13 14:50 | 3.8M | |
![[SND]](/icons/sound2.gif) | Qo.mp3 | 2022-05-13 14:50 | 3.1M | |
![[SND]](/icons/sound2.gif) | Mo.mp3 | 2022-05-13 14:50 | 4.0M | |
![[SND]](/icons/sound2.gif) | No.mp3 | 2022-05-13 14:50 | 2.8M | |
![[SND]](/icons/sound2.gif) | Lo.mp3 | 2022-05-13 14:50 | 3.2M | |
![[SND]](/icons/sound2.gif) | Eo.mp3 | 2022-05-13 14:50 | 5.1M | |
![[SND]](/icons/sound2.gif) | Jo.mp3 | 2022-05-13 14:50 | 3.5M | |
![[SND]](/icons/sound2.gif) | Do.mp3 | 2022-05-13 14:50 | 3.2M | |
![[SND]](/icons/sound2.gif) | Io.mp3 | 2022-05-13 14:50 | 2.2M | |
![[SND]](/icons/sound2.gif) | Go.mp3 | 2022-05-13 14:50 | 3.4M | |
![[SND]](/icons/sound2.gif) | Ho.mp3 | 2022-05-13 14:50 | 2.5M | |
![[SND]](/icons/sound2.gif) | Ao.mp3 | 2022-05-13 14:50 | 3.7M | |
![[SND]](/icons/sound2.gif) | Fo.mp3 | 2022-05-13 14:50 | 2.4M | |
![[SND]](/icons/sound2.gif) | Co.mp3 | 2022-05-13 14:50 | 2.3M | |
![[SND]](/icons/sound2.gif) | inbound176865670565059135.mp3 | 2022-05-13 14:49 | 3.4M | |
![[SND]](/icons/sound2.gif) | lala.mp3 | 2022-05-13 14:49 | 3.9M | |
![[SND]](/icons/sound2.gif) | inbound3686789410905048830.mp3 | 2022-05-13 14:47 | 3.4M | |
![[SND]](/icons/sound2.gif) | Koko4.mp3 | 2022-05-13 14:46 | 3.0M | |
![[SND]](/icons/sound2.gif) | bmw.mp3 | 2022-05-13 14:46 | 2.4M | |
![[SND]](/icons/sound2.gif) | Golo.mp3 | 2022-05-13 14:46 | 2.8M | |
![[SND]](/icons/sound2.gif) | Bronze Radio Return - Everything Moves.mp3 | 2022-05-13 14:44 | 4.7M | |
![[SND]](/icons/sound2.gif) | danya-milohin-lapki-nikita-mercurial-remix.mp3 | 2022-05-13 14:40 | 3.1M | |
![[SND]](/icons/sound2.gif) | DjGodzila.mp3 | 2022-05-13 14:40 | 1.1M | |
![[SND]](/icons/sound2.gif) | Wilbur Soot - I am very smart_(audiohunter.ru).mp3 | 2022-05-13 14:38 | 8.3M | |
![[SND]](/icons/sound2.gif) | nt.mp3 | 2022-05-13 14:36 | 2.8M | |
![[SND]](/icons/sound2.gif) | Dasar lo Anjay (Lyrics)(MP3_160K).mp3 | 2022-05-13 14:29 | 0 | |
![[SND]](/icons/sound2.gif) | gayazov_brother_-_malinovaya_lada_muzati.net.mp3 | 2022-05-13 14:28 | 8.2M | |
![[SND]](/icons/sound2.gif) | gayazov_brother_-_malinovaja_lada_(z2.fm).mp3 | 2022-05-13 14:28 | 0 | |
![[SND]](/icons/sound2.gif) | fem.love_-_fotografiruyu_zakat_muzati.net.mp3 | 2022-05-13 14:28 | 0 | |
![[SND]](/icons/sound2.gif) | kalush_-_stefanija_(z2.fm).mp3 | 2022-05-13 14:28 | 32K | |
![[SND]](/icons/sound2.gif) | NOTHING BRUNO MAJOR COVER.mp3 | 2022-05-13 14:27 | 2.3M | |
![[SND]](/icons/sound2.gif) | Gives - นิทานในฝัน.mp3 | 2022-05-13 14:26 | 2.8M | |
![[VID]](/icons/movie.gif) | VIDEO_1652450846821.mp4 | 2022-05-13 14:25 | 0 | |
![[SND]](/icons/sound2.gif) | Raihan10.mp3 | 2022-05-13 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | 01 Back In The Day.mp3 | 2022-05-13 14:19 | 420K | |
![[SND]](/icons/sound2.gif) | Lynzie4.mp3 | 2022-05-13 14:19 | 3.5M | |
![[SND]](/icons/sound2.gif) | chedobaylen.mp3 | 2022-05-13 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | DJ Scott Hardtrance Production Promo Set 320kbps.mp3 | 2022-05-13 14:12 | 0 | |
![[SND]](/icons/sound2.gif) | Trickster15.mp3 | 2022-05-13 14:12 | 0 | |
![[SND]](/icons/sound2.gif) | inbound7348176658074563676.mp3 | 2022-05-13 14:10 | 0 | |
![[SND]](/icons/sound2.gif) | inbound4473106894204768013.mp3 | 2022-05-13 14:09 | 0 | |
![[SND]](/icons/sound2.gif) | beep-horn (online-audio-converter.com).mp3 | 2022-05-13 14:08 | 0 | |
![[SND]](/icons/sound2.gif) | HamzX Sound Serem #110 [5004ED0].mp3 | 2022-05-13 14:07 | 0 | |
![[SND]](/icons/sound2.gif) | baylenn.mp3 | 2022-05-13 14:05 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu preset 2.mp3 | 2022-05-13 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | lap.mp3 | 2022-05-13 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | ZX.mp3 | 2022-05-13 13:57 | 2.3M | |
![[SND]](/icons/sound2.gif) | Лёша Джей - Дует.mp3 | 2022-05-13 13:56 | 0 | |
![[SND]](/icons/sound2.gif) | AUD-20220513-WA0019.mp3 | 2022-05-13 13:54 | 0 | |
![[SND]](/icons/sound2.gif) | Never Gonna Give You Up (8 Bit Remix Cover Version) [Tribute to Rick Astley] - 8 Bit Universe.mp3 | 2022-05-13 13:51 | 0 | |
![[SND]](/icons/sound2.gif) | Justin_Bieber_-_Despacito_(Lyrics)_ft._Luis_Fonsi_Daddy_Yankee.mp3 | 2022-05-13 13:49 | 0 | |
![[SND]](/icons/sound2.gif) | ER4.mp3 | 2022-05-13 13:48 | 0 | |
![[SND]](/icons/sound2.gif) | Mabruuk-Alfa-mabruuk-Selamat-ulang-tahun-dari-Upin-Ipin-dan-Kawan-kawan_6MFOXFNzwGI.mp3 | 2022-05-13 13:45 | 0 | |
![[SND]](/icons/sound2.gif) | Jakomo_AVG_-_Platina_73881376.mp3 | 2022-05-13 13:44 | 4.0M | |
![[SND]](/icons/sound2.gif) | Лёша Джей - ВАЛИТ Я ЕБУ.mp3 | 2022-05-13 13:43 | 0 | |
![[SND]](/icons/sound2.gif) | Лёша Джей feat. Adam Jamar - Давят низа.mp3 | 2022-05-13 13:42 | 0 | |
![[SND]](/icons/sound2.gif) | Лёша Джей - Avtokasta.mp3 | 2022-05-13 13:42 | 0 | |
![[SND]](/icons/sound2.gif) | YAMAKASI - Fukk Sleep(remix).mp3 | 2022-05-13 13:42 | 3.0M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Troye Sivan - Angel Baby (Lyrics) (128 kbps).mp3 | 2022-05-13 13:42 | 331K | |
![[VID]](/icons/movie.gif) | 6283148117841_status_46c9c8f469614e3a846bc751421ca490.mp4 | 2022-05-13 13:41 | 0 | |
![[SND]](/icons/sound2.gif) | wine.mp3 | 2022-05-13 13:41 | 0 | |
![[SND]](/icons/sound2.gif) | ZM.mp3 | 2022-05-13 13:41 | 1.0M | |
![[SND]](/icons/sound2.gif) | LOVE.mp3 | 2022-05-13 13:40 | 4.3M | |
![[SND]](/icons/sound2.gif) | ER5.mp3 | 2022-05-13 13:40 | 0 | |
![[SND]](/icons/sound2.gif) | КлоуКома-Душевный покой-kissvk.com.mp3 | 2022-05-13 13:39 | 0 | |
![[SND]](/icons/sound2.gif) | SR.mp3 | 2022-05-13 13:39 | 2.4M | |
![[SND]](/icons/sound2.gif) | TVETH-PARAMEDIC-kissvk.com.mp3 | 2022-05-13 13:39 | 0 | |
![[SND]](/icons/sound2.gif) | BB1.mp3 | 2022-05-13 13:39 | 2.1M | |
![[SND]](/icons/sound2.gif) | ER3.mp3 | 2022-05-13 13:35 | 1.4M | |
![[SND]](/icons/sound2.gif) | Lil Salmonela x Crygen - Ratna Anjink (Diss Irfan Gapreh x Ratna Kosonkduasatu).mp3 | 2022-05-13 13:35 | 2.9M | |
![[SND]](/icons/sound2.gif) | ER.mp3 | 2022-05-13 13:31 | 3.4M | |
![[SND]](/icons/sound2.gif) | Farhan2.mp3 | 2022-05-13 13:29 | 4.5M | |
![[SND]](/icons/sound2.gif) | ahok.mp3 | 2022-05-13 13:25 | 564K | |
![[SND]](/icons/sound2.gif) | panalo.mp3 | 2022-05-13 13:25 | 492K | |
![[SND]](/icons/sound2.gif) | Tak_berjudul_19_540p.mp3 | 2022-05-13 13:20 | 0 | |
![[SND]](/icons/sound2.gif) | ZA.mp3 | 2022-05-13 13:19 | 4.2M | |
![[SND]](/icons/sound2.gif) | SMD.mp3 | 2022-05-13 13:14 | 0 | |
![[SND]](/icons/sound2.gif) | SV.mp3 | 2022-05-13 13:12 | 0 | |
![[SND]](/icons/sound2.gif) | Macky gee - tour Remix by oooxide - Macky Ngee - nigger.mp3 | 2022-05-13 13:05 | 0 | |
![[SND]](/icons/sound2.gif) | No Copyright Gaming Music - Annihilate _ Fusion Cube Music [FREE].mp3 | 2022-05-13 13:04 | 0 | |
![[SND]](/icons/sound2.gif) | Jaxtin.mp3 | 2022-05-13 13:00 | 0 | |
![[SND]](/icons/sound2.gif) | pcold.mp3 | 2022-05-13 12:59 | 728K | |
![[SND]](/icons/sound2.gif) | Taco Tuesdays.mp3 | 2022-05-13 12:57 | 0 | |
![[SND]](/icons/sound2.gif) | Piano Beat(1x).mp3 | 2022-05-13 12:56 | 0 | |
![[SND]](/icons/sound2.gif) | joa10.mp3 | 2022-05-13 12:55 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - MAGIC! - Rude (Lyrics) _Can I have your daughter for the rest of my life__ [Tiktok Song] (128 kbps).mp3 | 2022-05-13 12:54 | 0 | |
![[SND]](/icons/sound2.gif) | mikhalovlawak1.mp3 | 2022-05-13 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | Suara 002.m4a | 2022-05-13 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | yk1.mp3 | 2022-05-13 12:50 | 0 | |
![[SND]](/icons/sound2.gif) | ghofamrohim.mp3 | 2022-05-13 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | mystery noise.mp3 | 2022-05-13 12:47 | 0 | |
![[SND]](/icons/sound2.gif) | JA.mp3 | 2022-05-13 12:44 | 304K | |
![[SND]](/icons/sound2.gif) | cokasu1.mp3 | 2022-05-13 12:43 | 0 | |
![[SND]](/icons/sound2.gif) | MK.mp3 | 2022-05-13 12:39 | 0 | |
![[SND]](/icons/sound2.gif) | AUD-20220403-WA0051.mp3 | 2022-05-13 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | AUD-20211109-WA0106.mp3 | 2022-05-13 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | yk2.mp3 | 2022-05-13 12:37 | 0 | |
![[SND]](/icons/sound2.gif) | yk3.mp3 | 2022-05-13 12:37 | 0 | |
![[SND]](/icons/sound2.gif) | Opet.mp3 | 2022-05-13 12:37 | 0 | |
![[SND]](/icons/sound2.gif) | inpo.mp3 | 2022-05-13 12:30 | 0 | |
![[SND]](/icons/sound2.gif) | esb2.mp3 | 2022-05-13 12:28 | 3.3M | |
![[SND]](/icons/sound2.gif) | Santiz__Daleko_za_zakatom_tyanu_jetot_sladkijj_dym_62133316.mp3 | 2022-05-13 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | AchaSeptr.mp3 | 2022-05-13 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | Big Keed - Skybox.mp3 | 2022-05-13 12:14 | 0 | |
![[SND]](/icons/sound2.gif) | diosdelamorylabelleza.mp3 | 2022-05-13 12:11 | 0 | |
![[SND]](/icons/sound2.gif) | Broker1.mp3 | 2022-05-13 12:10 | 208K | |
![[SND]](/icons/sound2.gif) | XX.mp3 | 2022-05-13 12:10 | 2.1M | |
![[SND]](/icons/sound2.gif) | ASB.mp3 | 2022-05-13 12:05 | 3.2M | |
![[SND]](/icons/sound2.gif) | nervy-schaste.mp3 | 2022-05-13 12:03 | 3.0M | |
![[SND]](/icons/sound2.gif) | Eve5.mp3 | 2022-05-13 12:02 | 4.1M | |
![[SND]](/icons/sound2.gif) | kamu.mp3 | 2022-05-13 12:02 | 24M | |
![[SND]](/icons/sound2.gif) | Kula Shaker - Love B (With U).mp3 | 2022-05-13 12:00 | 6.7M | |
![[SND]](/icons/sound2.gif) | alz-x-38.mp3 | 2022-05-13 11:59 | 423K | |
![[SND]](/icons/sound2.gif) | Sau.mp3 | 2022-05-13 11:57 | 843K | |
![[SND]](/icons/sound2.gif) | ASD.mp3 | 2022-05-13 11:57 | 4.0M | |
![[SND]](/icons/sound2.gif) | Udaramana.mp3 | 2022-05-13 11:55 | 0 | |
![[SND]](/icons/sound2.gif) | cuma.mp3 | 2022-05-13 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Mn.mp3 | 2022-05-13 11:53 | 0 | |
![[VID]](/icons/movie.gif) | KK.mp4 | 2022-05-13 11:49 | 0 | |
![[SND]](/icons/sound2.gif) | kujarathi.mp3 | 2022-05-13 11:47 | 0 | |
![[SND]](/icons/sound2.gif) | 17. The Mask.mp3 | 2022-05-13 11:42 | 0 | |
![[SND]](/icons/sound2.gif) | AlPha1 (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-05-13 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | AsepSongs.mp3.mp3 | 2022-05-13 11:34 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze-genjutsu-1000-7.mp3 | 2022-05-13 11:34 | 0 | |
![[SND]](/icons/sound2.gif) | Lk56.mp3 | 2022-05-13 11:34 | 2.1M | |
![[SND]](/icons/sound2.gif) | video-1652437066-1.mp3 | 2022-05-13 11:32 | 0 | |
![[SND]](/icons/sound2.gif) | video-1652437051.mp3 | 2022-05-13 11:32 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_-_showdown_73909739.mp3 | 2022-05-13 11:31 | 112K | |
![[SND]](/icons/sound2.gif) | bn.mp3 | 2022-05-13 11:29 | 1.5M | |
![[SND]](/icons/sound2.gif) | BUBA.mp3 | 2022-05-13 11:27 | 0 | |
![[SND]](/icons/sound2.gif) | Dog31.mp3 | 2022-05-13 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | adhi2.mp3 | 2022-05-13 11:19 | 0 | |
![[SND]](/icons/sound2.gif) | adhi1.mp3 | 2022-05-13 11:19 | 0 | |
![[SND]](/icons/sound2.gif) | Ride.mp3 | 2022-05-13 11:18 | 4.1M | |
![[SND]](/icons/sound2.gif) | Goodbye.mp3 | 2022-05-13 11:18 | 3.2M | |
![[VID]](/icons/movie.gif) | Y2Mate.is - Eagle gaming Discord Trolls 😂 (EP-1) firoz ikaa🔥 ഉയിരേ 🔥😈-3olRBLNov_g-144p-1652261967896.mp4 | 2022-05-13 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | tan13.mp3 | 2022-05-13 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | Duel_in_the_Mist_Inazuma_Battle_BGM_IV_Genshin_Impact.mp3 | 2022-05-13 11:14 | 0 | |
![[SND]](/icons/sound2.gif) | Acha Septriasa - Berdua Lebih Baik [UNOFFICIAL LYRICS].mp3 | 2022-05-13 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | somewhere not.mp3 | 2022-05-13 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | A2.mp3 | 2022-05-13 11:12 | 2.6M | |
![[SND]](/icons/sound2.gif) | A1.mp3 | 2022-05-13 11:12 | 364K | |
![[SND]](/icons/sound2.gif) | vip.mp3 | 2022-05-13 11:10 | 485K | |
![[SND]](/icons/sound2.gif) | Allofme.mp3 | 2022-05-13 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | It'smylive.mp3 | 2022-05-13 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | ad1.mp3 | 2022-05-13 11:07 | 256K | |
![[SND]](/icons/sound2.gif) | Changes.mp3 | 2022-05-13 11:04 | 0 | |
![[SND]](/icons/sound2.gif) | cypis-ebat-putina-file.mp3 | 2022-05-13 11:00 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan ccp lirik lagu Tri Suaka melamarmu trisuaka melamarmucover kinemaster.mp3 | 2022-05-13 10:55 | 0 | |
![[SND]](/icons/sound2.gif) | ygy12.mp3 | 2022-05-13 10:55 | 16M | |
![[SND]](/icons/sound2.gif) | Novan1.mp3 | 2022-05-13 10:54 | 3.0M | |
![[SND]](/icons/sound2.gif) | Lynziedj.mp3 | 2022-05-13 10:48 | 4.5M | |
![[SND]](/icons/sound2.gif) | Lynzie2.mp3 | 2022-05-13 10:47 | 4.2M | |
![[SND]](/icons/sound2.gif) | Lynzie1.mp3 | 2022-05-13 10:46 | 3.5M | |
![[SND]](/icons/sound2.gif) | 1652438440894-voicemaker.in-speech.mp3 | 2022-05-13 10:44 | 81K | |
![[SND]](/icons/sound2.gif) | aprp.mp3 | 2022-05-13 10:44 | 1.3M | |
![[SND]](/icons/sound2.gif) | 1-hour-of-music-to-put-your-baby-to-sleep-music-box-lullaby-happy-birthday-relax-your-baby.mp3 | 2022-05-13 10:43 | 5.0M | |
![[SND]](/icons/sound2.gif) | yss.mp3 | 2022-05-13 10:42 | 4.6M | |
![[SND]](/icons/sound2.gif) | slavegirl.mp3 | 2022-05-13 10:41 | 2.0M | |
![[SND]](/icons/sound2.gif) | agoy.mp3 | 2022-05-13 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | Yoi4.mp3 | 2022-05-13 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | katanya.mp3 | 2022-05-13 10:40 | 0 | |
![[SND]](/icons/sound2.gif) | Yoi1.mp3 | 2022-05-13 10:39 | 3.3M | |
![[SND]](/icons/sound2.gif) | pakpong.mp3 | 2022-05-13 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | albanian.mp3 | 2022-05-13 10:38 | 0 | |
![[SND]](/icons/sound2.gif) | partycoy.mp3 | 2022-05-13 10:38 | 0 | |
![[SND]](/icons/sound2.gif) | tiko.mp3 | 2022-05-13 10:37 | 1.9M | |
![[SND]](/icons/sound2.gif) | pambasilet.mp3 | 2022-05-13 10:36 | 0 | |
![[SND]](/icons/sound2.gif) | Peekaboo (3).mp3 | 2022-05-13 10:30 | 0 | |
![[SND]](/icons/sound2.gif) | java.mp3 | 2022-05-13 10:29 | 680K | |
![[SND]](/icons/sound2.gif) | bav.mp3 | 2022-05-13 10:28 | 0 | |
![[SND]](/icons/sound2.gif) | bah.mp3 | 2022-05-13 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | bas.mp3 | 2022-05-13 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | ttp.mp3 | 2022-05-13 10:26 | 0 | |
![[SND]](/icons/sound2.gif) | pp.mp3 | 2022-05-13 10:26 | 0 | |
![[SND]](/icons/sound2.gif) | memay.mp3 | 2022-05-13 10:24 | 0 | |
![[SND]](/icons/sound2.gif) | Enchanted - Taylor Swift [Lyrics].mp3 | 2022-05-13 10:12 | 0 | |
![[SND]](/icons/sound2.gif) | jj1.mp3 | 2022-05-13 10:09 | 3.3M | |
![[SND]](/icons/sound2.gif) | MENTAHAN OVERLAY LAGU ANGEL BABY - TROYE SIVAN.mp3 | 2022-05-13 10:05 | 0 | |
![[SND]](/icons/sound2.gif) | Slade_-_Cum_On_Feel_The_Noize_(musmore.com).mp3 | 2022-05-13 10:02 | 10M | |
![[SND]](/icons/sound2.gif) | PLOHOYPAREN - Таблетка.mp3 | 2022-05-13 09:43 | 0 | |
![[SND]](/icons/sound2.gif) | THRILLMANE - Hate.mp3 | 2022-05-13 09:40 | 0 | |
![[SND]](/icons/sound2.gif) | m i n v a z o v s k i e.-ʀᴀʜᴀᴛ🖤-kissvk.com.mp3 | 2022-05-13 09:35 | 0 | |
![[SND]](/icons/sound2.gif) | LuckScipio1.mp3 | 2022-05-13 09:32 | 0 | |
![[SND]](/icons/sound2.gif) | CélineDion-ThePowerOfLove(OfficialVideo)_1646059614435.mp3 | 2022-05-13 09:30 | 0 | |
![[SND]](/icons/sound2.gif) | Raphael12.mp3 | 2022-05-13 09:29 | 0 | |
![[SND]](/icons/sound2.gif) | THRILLMANE - Hate (1).mp3 | 2022-05-13 09:28 | 0 | |
![[SND]](/icons/sound2.gif) | Я ебу czech конечно - FACE - Лабиринт (speed up).mp3 | 2022-05-13 09:28 | 0 | |
![[SND]](/icons/sound2.gif) | VP7.mp3 | 2022-05-13 09:27 | 3.0M | |
![[SND]](/icons/sound2.gif) | Luck1.mp3 | 2022-05-13 09:27 | 28K | |
![[SND]](/icons/sound2.gif) | Pondering - เพลงนี้ก็เขียนให้เธออีกแล้ว (Audio).mp3 | 2022-05-13 09:24 | 2.2M | |
![[SND]](/icons/sound2.gif) | SAM.mp3 | 2022-05-13 09:22 | 0 | |
![[SND]](/icons/sound2.gif) | leviA1.mp3 | 2022-05-13 09:21 | 0 | |
![[SND]](/icons/sound2.gif) | Jet-Lookwhatyou'vedone_1641670019211.mp3 | 2022-05-13 09:20 | 0 | |
![[SND]](/icons/sound2.gif) | ringing2.mp3 | 2022-05-13 09:17 | 0 | |
![[SND]](/icons/sound2.gif) | LM.mp3 | 2022-05-13 09:17 | 0 | |
![[SND]](/icons/sound2.gif) | HanzGz.mp3 | 2022-05-13 09:17 | 0 | |
![[SND]](/icons/sound2.gif) | TeF.mp3 | 2022-05-13 09:15 | 0 | |
![[SND]](/icons/sound2.gif) | Shaggy - Mr. Bombastic (Original) [HD] (320 kbps).mp3 | 2022-05-13 09:15 | 0 | |
![[SND]](/icons/sound2.gif) | FLOWGEBEB.mp3.mp3 | 2022-05-13 09:14 | 0 | |
![[SND]](/icons/sound2.gif) | da1.mp3 | 2022-05-13 09:14 | 0 | |
![[SND]](/icons/sound2.gif) | kk3.mp3 | 2022-05-13 09:13 | 1.6M | |
![[SND]](/icons/sound2.gif) | heat.mp3 | 2022-05-13 09:11 | 3.9M | |
![[SND]](/icons/sound2.gif) | Lemonade (Ukulele Version).mp3 | 2022-05-13 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | scipio1.mp3 | 2022-05-13 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | ringing.mp3 | 2022-05-13 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji5.mp3 | 2022-05-13 09:07 | 0 | |
![[SND]](/icons/sound2.gif) | jeremy passion - lemonade _ lyrics (1).mp3 | 2022-05-13 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | Luck50.mp3 | 2022-05-13 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji2.mp3 | 2022-05-13 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | HEAT WAVES.mp3 | 2022-05-13 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | Suara 255.mp3 | 2022-05-13 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - മണവാളൻ rocks 😂😂×gujarathi kalthala kettiya song. pulival kalyanam movie.. (128 kbps).mp3 | 2022-05-13 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji6.mp3 | 2022-05-13 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji7.mp3 | 2022-05-13 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji9.mp3 | 2022-05-13 09:04 | 0 | |
![[SND]](/icons/sound2.gif) | HEAT WAVES - GLASS ANIMALS (SLOWED REVERB) (128 kbps).mp3 | 2022-05-13 09:04 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji14.mp3 | 2022-05-13 09:04 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji13.mp3 | 2022-05-13 09:04 | 0 | |
![[SND]](/icons/sound2.gif) | Медвежонок И Бобёр - Таракан Вадим (cdn.2mz.me).mp3 | 2022-05-13 09:03 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji12.mp3 | 2022-05-13 09:03 | 0 | |
![[SND]](/icons/sound2.gif) | Yeji11.mp3 | 2022-05-13 09:03 | 0 | |
![[SND]](/icons/sound2.gif) | Untung.mp3 | 2022-05-13 08:57 | 0 | |
![[SND]](/icons/sound2.gif) | Dj Komang Rimex - Dj Angel Baby Jedag Jedug Full Beat Viral Tiktok Terbaru 2022.mp3 | 2022-05-13 08:54 | 0 | |
![[SND]](/icons/sound2.gif) | Pierrev14.m4a | 2022-05-13 08:52 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Ice Mum - Four Guys ft.Snoop Teng (128 kbps).mp3 | 2022-05-13 08:49 | 0 | |
![[SND]](/icons/sound2.gif) | CKP.mp3 | 2022-05-13 08:45 | 3.5M | |
![[SND]](/icons/sound2.gif) | abc2.mp3 | 2022-05-13 08:44 | 656K | |
![[SND]](/icons/sound2.gif) | Ar.mp3 | 2022-05-13 08:43 | 0 | |
![[SND]](/icons/sound2.gif) | RICK.mp3 | 2022-05-13 08:42 | 3.2M | |
![[SND]](/icons/sound2.gif) | DJGENJER.mp3 | 2022-05-13 08:42 | 4.3M | |
![[SND]](/icons/sound2.gif) | FLOW G - EBEB (Official Music Video) (320 kbps).mp3 | 2022-05-13 08:42 | 0 | |
![[SND]](/icons/sound2.gif) | ANB.mp3 | 2022-05-13 08:37 | 4.1M | |
![[SND]](/icons/sound2.gif) | Raphael9.mp3 | 2022-05-13 08:36 | 1.4M | |
![[SND]](/icons/sound2.gif) | Raphael10.mp3 | 2022-05-13 08:35 | 1.4M | |
![[SND]](/icons/sound2.gif) | LEW.mp3 | 2022-05-13 08:35 | 6.3M | |
![[SND]](/icons/sound2.gif) | Raphael8.mp3 | 2022-05-13 08:34 | 835K | |
![[SND]](/icons/sound2.gif) | mandaluyong.mp3 | 2022-05-13 08:34 | 2.6M | |
![[SND]](/icons/sound2.gif) | 𝐻𝑎𝑟𝑑 2 𝑓𝑎𝑐𝑒 𝑟𝑒𝑎𝑙𝑖𝑡𝑦m.mp3 | 2022-05-13 08:33 | 1.7M | |
![[SND]](/icons/sound2.gif) | initice.mp3 | 2022-05-13 08:33 | 3.7M | |
![[SND]](/icons/sound2.gif) | Raphael7.mp3 | 2022-05-13 08:32 | 3.6M | |
![[SND]](/icons/sound2.gif) | Raphael6.mp3 | 2022-05-13 08:31 | 4.2M | |
![[SND]](/icons/sound2.gif) | Raphael5.mp3 | 2022-05-13 08:30 | 1.7M | |
![[SND]](/icons/sound2.gif) | Raphael4.mp3 | 2022-05-13 08:30 | 3.5M | |
![[SND]](/icons/sound2.gif) | 555.mp3 | 2022-05-13 08:30 | 3.9M | |
![[SND]](/icons/sound2.gif) | Raphael3.mp3 | 2022-05-13 08:29 | 366K | |
![[SND]](/icons/sound2.gif) | Raphael2.mp3 | 2022-05-13 08:29 | 2.1M | |
![[SND]](/icons/sound2.gif) | Raphael1.mp3 | 2022-05-13 08:28 | 1.1M | |
![[SND]](/icons/sound2.gif) | Sekolah1998.mp3 | 2022-05-13 08:27 | 4.5M | |
![[SND]](/icons/sound2.gif) | itsyou.mp3 | 2022-05-13 08:27 | 3.3M | |
![[SND]](/icons/sound2.gif) | na.mp3 | 2022-05-13 08:26 | 2.3M | |
![[SND]](/icons/sound2.gif) | Trickster.mp3 | 2022-05-13 08:26 | 7.2M | |
![[SND]](/icons/sound2.gif) | 454.mp3 | 2022-05-13 08:24 | 4.2M | |
![[SND]](/icons/sound2.gif) | riezky.mp3 | 2022-05-13 08:22 | 8.2M | |
![[SND]](/icons/sound2.gif) | yhk.mp3 | 2022-05-13 08:18 | 87M | |
![[SND]](/icons/sound2.gif) | arcade3.mp3 | 2022-05-13 08:16 | 4.8M | |
![[SND]](/icons/sound2.gif) | abcd.mp3 | 2022-05-13 08:15 | 755K | |
![[SND]](/icons/sound2.gif) | Zx5.mp3 | 2022-05-13 08:13 | 1.4K | |
![[SND]](/icons/sound2.gif) | 777.mp3 | 2022-05-13 08:12 | 3.5M | |
![[SND]](/icons/sound2.gif) | Novan.mp3 | 2022-05-13 08:12 | 1.4M | |
![[SND]](/icons/sound2.gif) | 425556__planetronik__rock-808-beat.mp3 | 2022-05-13 08:06 | 213K | |
![[SND]](/icons/sound2.gif) | 123.mp3 | 2022-05-13 08:06 | 2.6M | |
![[SND]](/icons/sound2.gif) | abc.mp3 | 2022-05-13 08:06 | 601K | |
![[SND]](/icons/sound2.gif) | 789.mp3 | 2022-05-13 08:03 | 79K | |
![[SND]](/icons/sound2.gif) | 111.mp3 | 2022-05-13 08:01 | 79K | |
![[SND]](/icons/sound2.gif) | ichi9.mp3 | 2022-05-13 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik_1652415498996.mp3 | 2022-05-13 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | 0.mp3 | 2022-05-13 07:58 | 1.8M | |
![[SND]](/icons/sound2.gif) | tukkas.mp3 | 2022-05-13 07:55 | 0 | |
![[SND]](/icons/sound2.gif) | lilnasx.mp3 | 2022-05-13 07:53 | 2.5M | |
![[SND]](/icons/sound2.gif) | SHA.mp3 | 2022-05-13 07:53 | 3.4M | |
![[SND]](/icons/sound2.gif) | wq.mp3 | 2022-05-13 07:33 | 80K | |
![[SND]](/icons/sound2.gif) | marakaa.mp3 | 2022-05-13 07:32 | 0 | |
![[SND]](/icons/sound2.gif) | uio1919.mp3 | 2022-05-13 07:28 | 692K | |
![[SND]](/icons/sound2.gif) | bbb.mp3 | 2022-05-13 07:28 | 3.4M | |
![[SND]](/icons/sound2.gif) | YOUNGOHM - คนตาย (Official Video).mp3 | 2022-05-13 07:26 | 0 | |
![[SND]](/icons/sound2.gif) | DJ MENIMISU REMIX FULL BASS X AKON RIGHT NOW X CUKI CUKI ♫ LAGU DJ TERBARU REMIX ORIGINAL 2022.mp3 | 2022-05-13 07:20 | 0 | |
![[SND]](/icons/sound2.gif) | Erika2.mp3 | 2022-05-13 07:17 | 0 | |
![[SND]](/icons/sound2.gif) | Robion2최종.mp3 | 2022-05-13 07:14 | 0 | |
![[SND]](/icons/sound2.gif) | Grind__Make_Love__Mashup___Emiway_Bantai___David_Guetta___Sean_Paul___DJ_HARSH_SHARMA___SUNIX_THAKOR(128k).mp3 | 2022-05-13 07:11 | 1.1M | |
![[SND]](/icons/sound2.gif) | Battotai.mp3 | 2022-05-13 06:56 | 704K | |
![[SND]](/icons/sound2.gif) | Tomboati.mp3 | 2022-05-13 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | radio.mp3 | 2022-05-13 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | Djradio.mp3 | 2022-05-13 06:53 | 0 | |
![[SND]](/icons/sound2.gif) | G3.mp3 | 2022-05-13 06:52 | 0 | |
![[SND]](/icons/sound2.gif) | boat1.mp3 | 2022-05-13 06:50 | 0 | |
![[SND]](/icons/sound2.gif) | optn.mp3 | 2022-05-13 06:50 | 3.5M | |
![[SND]](/icons/sound2.gif) | Eroplano.mp3 | 2022-05-13 06:46 | 0 | |
![[SND]](/icons/sound2.gif) | hansad.mp3 | 2022-05-13 06:46 | 0 | |
![[SND]](/icons/sound2.gif) | SARI.mp3 | 2022-05-13 06:43 | 484K | |
![[SND]](/icons/sound2.gif) | Kathang Isip.mp3 | 2022-05-13 06:34 | 0 | |
![[SND]](/icons/sound2.gif) | hariini.mp3 | 2022-05-13 06:32 | 0 | |
![[SND]](/icons/sound2.gif) | intro P fkn R.mp3 | 2022-05-13 06:32 | 0 | |
![[SND]](/icons/sound2.gif) | Lambing.mp3 | 2022-05-13 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | Background Music for Presentations, Speeches, Lectures and Videos 12 min (mp3cut.net).mp3 | 2022-05-13 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | laguuu.mp3 | 2022-05-13 06:27 | 0 | |
![[SND]](/icons/sound2.gif) | Hijau-Daun-Sesuatu-Yang-Sempurna-Official-Video-Clip_5znpiuX56WM.mp3 | 2022-05-13 06:21 | 0 | |
![[SND]](/icons/sound2.gif) | a.mp3.mp3 | 2022-05-13 06:20 | 0 | |
![[SND]](/icons/sound2.gif) | 78.mp3 | 2022-05-13 06:15 | 0 | |
![[SND]](/icons/sound2.gif) | Yogi Rolande Bach Party Mix 2.mp3 | 2022-05-13 06:15 | 19M | |
![[SND]](/icons/sound2.gif) | Erika.mp3 | 2022-05-13 06:12 | 705K | |
![[SND]](/icons/sound2.gif) | 100.mp3 | 2022-05-13 06:09 | 2.1M | |
![[SND]](/icons/sound2.gif) | FKVPkIUYh5807025b687cb0d9eee4bcf4c056a055NwR60uhzd (1).mp3 | 2022-05-13 06:06 | 0 | |
![[SND]](/icons/sound2.gif) | 6csTXgLVla3481ba9c6fff5daccd6d9e2ce65ee22bGExsUJWA (1).mp3 | 2022-05-13 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | Zyy1.mp3 | 2022-05-13 05:48 | 0 | |
![[SND]](/icons/sound2.gif) | Eagle.mp3 | 2022-05-13 05:47 | 0 | |
![[SND]](/icons/sound2.gif) | odin.mp3 | 2022-05-13 05:44 | 0 | |
![[SND]](/icons/sound2.gif) | Darrio.mp3 | 2022-05-13 05:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Coldplay Paradise Terjemahan Lirik Lagu.mp3 | 2022-05-13 05:37 | 0 | |
![[SND]](/icons/sound2.gif) | chill2.mp3 | 2022-05-13 05:31 | 3.6M | |
![[SND]](/icons/sound2.gif) | Darrio1.mp3 | 2022-05-13 05:31 | 0 | |
![[SND]](/icons/sound2.gif) | sl3.mp3 | 2022-05-13 05:29 | 0 | |
![[SND]](/icons/sound2.gif) | box.mp3 | 2022-05-13 05:26 | 0 | |
![[SND]](/icons/sound2.gif) | SLW.mp3 | 2022-05-13 05:20 | 0 | |
![[SND]](/icons/sound2.gif) | xxxtentacion.mp3 | 2022-05-13 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | bac.mp3 | 2022-05-13 05:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | bat.mp3 | 2022-05-13 05:09 | 174K | |
![[SND]](/icons/sound2.gif) | abcxyz.mp3 | 2022-05-13 05:07 | 0 | |
![[SND]](/icons/sound2.gif) | abcxy.mp3 | 2022-05-13 05:07 | 0 | |
![[SND]](/icons/sound2.gif) | inbound7076962986533382741.mp3 | 2022-05-13 05:03 | 0 | |
![[VID]](/icons/movie.gif) | VID-20220512-WA0059.mp4 | 2022-05-13 05:03 | 0 | |
![[SND]](/icons/sound2.gif) | Till I Collapse.mp3 | 2022-05-13 04:59 | 0 | |
![[SND]](/icons/sound2.gif) | LOVV66, MAYOT - Ловв и Майот.mp3 | 2022-05-13 04:57 | 0 | |
![[SND]](/icons/sound2.gif) | Mre.mp3 | 2022-05-13 04:56 | 732K | |
![[SND]](/icons/sound2.gif) | Vp8.mp3 | 2022-05-13 04:55 | 3.2M | |
![[SND]](/icons/sound2.gif) | aaa.mp3 | 2022-05-13 04:54 | 3.0M | |
![[SND]](/icons/sound2.gif) | samp3.mp3 | 2022-05-13 04:50 | 0 | |
![[SND]](/icons/sound2.gif) | PRETTY WOMAN (Audio) (NUEVOEXITO.ORG).mp3 | 2022-05-13 04:48 | 0 | |
![[SND]](/icons/sound2.gif) | mySong.mp3 | 2022-05-13 04:47 | 0 | |
![[SND]](/icons/sound2.gif) | Zall1.mp3 | 2022-05-13 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | HoldOn.mp3 | 2022-05-13 04:46 | 2.1M | |
![[SND]](/icons/sound2.gif) | yy.mp3 | 2022-05-13 04:44 | 716K | |
![[SND]](/icons/sound2.gif) | qq1.mp3 | 2022-05-13 04:44 | 0 | |
![[SND]](/icons/sound2.gif) | HH.mp3 | 2022-05-13 04:43 | 3.1M | |
![[SND]](/icons/sound2.gif) | ll1.mp3 | 2022-05-13 04:42 | 0 | |
![[SND]](/icons/sound2.gif) | ร๊อคทองแดง.mp3 | 2022-05-13 04:41 | 0 | |
![[SND]](/icons/sound2.gif) | 4king.mp3 | 2022-05-13 04:40 | 0 | |
![[SND]](/icons/sound2.gif) | LJ56.mp3 | 2022-05-13 04:40 | 0 | |
![[SND]](/icons/sound2.gif) | LJ55.mp3 | 2022-05-13 04:39 | 0 | |
![[SND]](/icons/sound2.gif) | lum.mp3 | 2022-05-13 04:37 | 0 | |
![[SND]](/icons/sound2.gif) | sosmon.mp3 | 2022-05-13 04:37 | 0 | |
![[SND]](/icons/sound2.gif) | turnsosad.mp3 | 2022-05-13 04:36 | 3.7M | |
![[SND]](/icons/sound2.gif) | 21mv.mp3 | 2022-05-13 04:34 | 0 | |
![[SND]](/icons/sound2.gif) | mo1.mp3 | 2022-05-13 04:31 | 0 | |
![[SND]](/icons/sound2.gif) | Gabung Ghost with Birthday.mp3 | 2022-05-13 04:30 | 0 | |
![[SND]](/icons/sound2.gif) | K1.mp3 | 2022-05-13 04:28 | 0 | |
![[SND]](/icons/sound2.gif) | 331mpa.mp3 | 2022-05-13 04:27 | 0 | |
![[SND]](/icons/sound2.gif) | jeremy passion - lemonade _ lyrics.mp3 | 2022-05-13 04:26 | 920K | |
![[SND]](/icons/sound2.gif) | a4a47ff05da709556b1b77655daf9c29.mp3 | 2022-05-13 04:25 | 1.3M | |
![[SND]](/icons/sound2.gif) | 45d.mp3 | 2022-05-13 04:25 | 3.0M | |
![[SND]](/icons/sound2.gif) | ken1.mp3 | 2022-05-13 04:23 | 0 | |
![[SND]](/icons/sound2.gif) | kenn4.mp3 | 2022-05-13 04:23 | 0 | |
![[SND]](/icons/sound2.gif) | GANGGA-Blue-Jeans-Official-Lyric-Video_UzKdy75GqXQ.mp3 | 2022-05-13 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | mo.mp3 | 2022-05-13 04:21 | 2.4M | |
![[SND]](/icons/sound2.gif) | Kamalayan.mp3 | 2022-05-13 04:21 | 0 | |
![[SND]](/icons/sound2.gif) | 33mo.mp3 | 2022-05-13 04:21 | 3.5M | |
![[SND]](/icons/sound2.gif) | Enlig.mp3 | 2022-05-13 04:20 | 0 | |
![[SND]](/icons/sound2.gif) | Gellen-Martadinata-Selamat-Ulang-Tahun-cover-by-Moyy_ey6liV1yP2E (2).mp3 | 2022-05-13 04:16 | 0 | |
![[SND]](/icons/sound2.gif) | ToThe.mp3 | 2022-05-13 04:15 | 0 | |
![[SND]](/icons/sound2.gif) | melobytes(1).mp3 | 2022-05-13 04:13 | 1.6M | |
![[SND]](/icons/sound2.gif) | kenn2.mp3 | 2022-05-13 04:11 | 1.8M | |
![[SND]](/icons/sound2.gif) | JoJosBizarreAdventureSteelBallRunOSTMainThemeJohnnysThemeFanMade_(allmp3.su).mp3 | 2022-05-13 04:10 | 0 | |
![[SND]](/icons/sound2.gif) | xk100.mp3 | 2022-05-13 04:08 | 0 | |
![[SND]](/icons/sound2.gif) | w1.mp3 | 2022-05-13 04:08 | 2.1M | |
![[SND]](/icons/sound2.gif) | DJ BREAK BEAT KOPI LAMBADA FULL BASS TERBARU 2021_ By Zull Berbeey.mp3 | 2022-05-13 04:05 | 0 | |
![[SND]](/icons/sound2.gif) | GRIZ.mp3 | 2022-05-13 04:04 | 0 | |
![[SND]](/icons/sound2.gif) | TACO.mp3 | 2022-05-13 04:02 | 0 | |
![[SND]](/icons/sound2.gif) | Natoy1.mp3 | 2022-05-13 04:01 | 0 | |
![[SND]](/icons/sound2.gif) | jabilee.mp3 | 2022-05-13 04:01 | 0 | |
![[SND]](/icons/sound2.gif) | 1D.mp3 | 2022-05-13 04:01 | 0 | |
![[SND]](/icons/sound2.gif) | Major Lazer & DJ Snake - Lean On (feat. MØ) (Official Music Video) (2).mp3 | 2022-05-13 04:00 | 0 | |
![[SND]](/icons/sound2.gif) | 1652413805067.mp3 | 2022-05-13 03:57 | 0 | |
![[SND]](/icons/sound2.gif) | Nooo.mp3 | 2022-05-13 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | samp4.mp3 | 2022-05-13 03:50 | 0 | |
![[SND]](/icons/sound2.gif) | HijauDaun-SesuatuYangSempurna(OfficialVideoClip).mp3 | 2022-05-13 03:35 | 0 | |
![[SND]](/icons/sound2.gif) | samp2.mp3 | 2022-05-13 03:34 | 816K | |
![[SND]](/icons/sound2.gif) | Gellen-Martadinata-Selamat-Ulang-Tahun-cover-by-Moyy_ey6liV1yP2E.mp3 | 2022-05-13 03:29 | 1.1M | |
![[SND]](/icons/sound2.gif) | samp1.mp3 | 2022-05-13 03:22 | 2.2M | |
![[SND]](/icons/sound2.gif) | anjink.mp3 | 2022-05-13 03:15 | 0 | |
![[SND]](/icons/sound2.gif) | laso1.mp3 | 2022-05-13 03:15 | 0 | |
![[SND]](/icons/sound2.gif) | D9.mp3 | 2022-05-13 03:14 | 2.4M | |
![[SND]](/icons/sound2.gif) | Amar Pelos Dois.mp3 | 2022-05-13 03:14 | 6.0M | |
![[SND]](/icons/sound2.gif) | Dido.mp3 | 2022-05-13 03:12 | 359K | |
![[SND]](/icons/sound2.gif) | puucchaan-l-ngaimkh-keesamus-cover.mp3 | 2022-05-13 03:09 | 0 | |
![[SND]](/icons/sound2.gif) | fikribeforeyougo.mp3 | 2022-05-13 03:08 | 0 | |
![[SND]](/icons/sound2.gif) | ratna.mp3 | 2022-05-13 03:07 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar19.mp3 | 2022-05-13 03:06 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar2.mp3 | 2022-05-13 03:06 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar18.mp3 | 2022-05-13 03:06 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar20.mp3 | 2022-05-13 03:06 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar17.mp3 | 2022-05-13 03:05 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar11.mp3 | 2022-05-13 03:05 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar12.mp3 | 2022-05-13 03:05 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar1.mp3 | 2022-05-13 03:04 | 0 | |
![[SND]](/icons/sound2.gif) | GoyangEnak.mp3 | 2022-05-13 02:59 | 0 | |
![[SND]](/icons/sound2.gif) | Bryen.mp3 | 2022-05-13 02:56 | 0 | |
![[SND]](/icons/sound2.gif) | Country_Music_Playlist_2021_-_Top_N_(getmp3.pro).mp3 | 2022-05-13 02:56 | 0 | |
![[SND]](/icons/sound2.gif) | Pv5.mp3 | 2022-05-13 02:52 | 0 | |
![[SND]](/icons/sound2.gif) | happy-birthday-relax-.mp3 | 2022-05-13 02:52 | 0 | |
![[SND]](/icons/sound2.gif) | Yannze1.mp3 | 2022-05-13 02:49 | 0 | |
![[SND]](/icons/sound2.gif) | Until.mp3 | 2022-05-13 02:48 | 0 | |
![[SND]](/icons/sound2.gif) | Pn8.mp3 | 2022-05-13 02:46 | 0 | |
![[SND]](/icons/sound2.gif) | Yanndx4.mp3 | 2022-05-13 02:45 | 0 | |
![[SND]](/icons/sound2.gif) | joy2.mp3 | 2022-05-13 02:45 | 0 | |
![[SND]](/icons/sound2.gif) | Rayz2.mp3 | 2022-05-13 02:45 | 1.3M | |
![[SND]](/icons/sound2.gif) | joy1.mp3 | 2022-05-13 02:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | Rianz1.mp3 | 2022-05-13 02:43 | 0 | |
![[SND]](/icons/sound2.gif) | Ynndx11.mp3 | 2022-05-13 02:42 | 0 | |
![[SND]](/icons/sound2.gif) | Ynndx2.mp3 | 2022-05-13 02:41 | 0 | |
![[SND]](/icons/sound2.gif) | Se Me Fue Myriam Hernández letra) (NUEVOEXITO.ORG).mp3 | 2022-05-13 02:41 | 0 | |
![[SND]](/icons/sound2.gif) | Yanndx3.mp3 | 2022-05-13 02:40 | 0 | |
![[SND]](/icons/sound2.gif) | Yanndx2.mp3 | 2022-05-13 02:39 | 0 | |
![[SND]](/icons/sound2.gif) | Polo Montañez - Un Montón De Estrellas (Original Version) (URBANOMP3.NET).mp3 | 2022-05-13 02:38 | 0 | |
![[SND]](/icons/sound2.gif) | B1.mp3 | 2022-05-13 02:30 | 4.4M | |
![[SND]](/icons/sound2.gif) | 4444.mp3 | 2022-05-13 02:22 | 4.7M | |
![[SND]](/icons/sound2.gif) | Yanndx1.mp3 | 2022-05-13 02:22 | 4.0M | |
![[SND]](/icons/sound2.gif) | P9.mp3 | 2022-05-13 02:18 | 0 | |
![[SND]](/icons/sound2.gif) | zone-h hacker song.mp3 | 2022-05-13 02:15 | 0 | |
![[SND]](/icons/sound2.gif) | 21.mp3 | 2022-05-13 02:15 | 396K | |
![[SND]](/icons/sound2.gif) | Eri6.mp3 | 2022-05-13 02:14 | 0 | |
![[SND]](/icons/sound2.gif) | ghost.mp3 | 2022-05-13 02:13 | 0 | |
![[SND]](/icons/sound2.gif) | V8.mp3 | 2022-05-13 02:13 | 0 | |
![[SND]](/icons/sound2.gif) | output_2022_05_13_02_09_04_xabty3e.mp3 | 2022-05-13 02:09 | 0 | |
![[SND]](/icons/sound2.gif) | CPU.mp3 | 2022-05-13 02:08 | 0 | |
![[SND]](/icons/sound2.gif) | Ráfaga - Una Cerveza (Versión 2018) (320 kbps).mp3 | 2022-05-13 02:05 | 0 | |
![[SND]](/icons/sound2.gif) | barbar.mp3 | 2022-05-13 02:00 | 0 | |
![[SND]](/icons/sound2.gif) | La 5a Estación - El Sol No Regresa (320 kbps).mp3 | 2022-05-13 01:58 | 6.1M | |
![[SND]](/icons/sound2.gif) | locco11.mp3 | 2022-05-13 01:53 | 10M | |
![[SND]](/icons/sound2.gif) | ngo1.mp3 | 2022-05-13 01:51 | 10M | |
![[SND]](/icons/sound2.gif) | A TODA MAQUINA - MIAMI SOUND MACHINE (320 kbps).mp3 | 2022-05-13 01:42 | 0 | |
![[SND]](/icons/sound2.gif) | cut changing ga.mp3 | 2022-05-13 01:42 | 0 | |
![[SND]](/icons/sound2.gif) | DD.mp3 | 2022-05-13 01:41 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - #🚀สายปาร์ตี้ ⚡️Níu Duyên Remix🚀⚡️202k By_DJ Thong Rmx _DJ SAY BB_ DJ KK _DJ R JAY (128 kbps).mp3 | 2022-05-13 01:40 | 0 | |
![[SND]](/icons/sound2.gif) | gop.mp3 | 2022-05-13 01:39 | 1.6M | |
![[SND]](/icons/sound2.gif) | Carlos Vives, Shakira - La Bicicleta (Cover Audio) (MP3CHIDO.COM).mp3 | 2022-05-13 01:36 | 3.5M | |
![[SND]](/icons/sound2.gif) | hensem.mp3 | 2022-05-13 01:35 | 78K | |
![[SND]](/icons/sound2.gif) | DB.mp3 | 2022-05-13 01:34 | 1.9M | |
![[SND]](/icons/sound2.gif) | Bogart1.mp3 | 2022-05-13 01:33 | 4.6M | |
![[VID]](/icons/movie.gif) | ngek.mp3.mp4 | 2022-05-13 01:31 | 120K | |
![[SND]](/icons/sound2.gif) | Huh.mp3 | 2022-05-13 01:31 | 4.6M | |
![[SND]](/icons/sound2.gif) | SS.mp3 | 2022-05-13 00:58 | 2.8M | |
![[SND]](/icons/sound2.gif) | Mister.mp3 | 2022-05-13 00:57 | 4.3M | |
![[SND]](/icons/sound2.gif) | V9.mp3 | 2022-05-13 00:54 | 17M | |
![[SND]](/icons/sound2.gif) | Ace.mp3 | 2022-05-13 00:54 | 3.6M | |
![[SND]](/icons/sound2.gif) | pe.mp3 | 2022-05-13 00:53 | 2.4M | |
![[SND]](/icons/sound2.gif) | pok.mp3 | 2022-05-13 00:53 | 8.3M | |
![[SND]](/icons/sound2.gif) | yessimar4.mp3 | 2022-05-13 00:53 | 4.4M | |
![[SND]](/icons/sound2.gif) | SYL.mp3 | 2022-05-13 00:50 | 0 | |
![[SND]](/icons/sound2.gif) | SKILLET - MONSTER (Metal Cover) by Caleb Hyles and Jonathan Young.mp3 | 2022-05-13 00:49 | 4.2M | |
![[SND]](/icons/sound2.gif) | HYP.mp3 | 2022-05-13 00:49 | 880K | |
![[SND]](/icons/sound2.gif) | Vn.mp3 | 2022-05-13 00:48 | 0 | |
![[SND]](/icons/sound2.gif) | GAK.mp3 | 2022-05-13 00:45 | 1.0M | |
![[SND]](/icons/sound2.gif) | 2FilesMerged_13052022.mp3 | 2022-05-13 00:44 | 278K | |
![[VID]](/icons/movie.gif) | lv_7091233322810084609_20220501220328.mp4 | 2022-05-13 00:35 | 15M | |
![[SND]](/icons/sound2.gif) | Jak.mp3 | 2022-05-13 00:34 | 3.5M | |
![[SND]](/icons/sound2.gif) | po.mp3 | 2022-05-13 00:29 | 2.0M | |
![[VID]](/icons/movie.gif) | 278288627_504124304590809_805793379413651146_n.mp4 | 2022-05-13 00:23 | 0 | |
![[SND]](/icons/sound2.gif) | mt.mp3 | 2022-05-13 00:15 | 2.6M | |
![[SND]](/icons/sound2.gif) | Ji1.mp3 | 2022-05-13 00:13 | 0 | |
![[SND]](/icons/sound2.gif) | hey.mp3 | 2022-05-13 00:07 | 2.7M | |
![[SND]](/icons/sound2.gif) | Générique 2001, l'Odyssée de l'espace de Stanley Kubrick 1968.mp3 | 2022-05-13 00:06 | 0 | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN.mp3 | 2022-05-12 23:58 | 0 | |
![[SND]](/icons/sound2.gif) | cicak01.mp3 | 2022-05-12 23:49 | 0 | |
![[SND]](/icons/sound2.gif) | Hollywood_Vampires_Heroes_from_th_(getmp3.pro).mp3 | 2022-05-12 23:47 | 0 | |
![[SND]](/icons/sound2.gif) | generique-2001-lodyssee-de-lespace-de-stanley-kubrick-1968.mp3 | 2022-05-12 23:46 | 0 | |
![[SND]](/icons/sound2.gif) | A-Ha - Take On Me (Dj KaktuZ Nu Disco Remix).mp3 | 2022-05-12 23:43 | 1.2M | |
![[SND]](/icons/sound2.gif) | so.mp3 | 2022-05-12 23:40 | 767K | |
![[SND]](/icons/sound2.gif) | X2Download.com - MAAFKAN AKU - ENDA (LIVE COVER INDAH YASTAMI) (128 kbps).mp3 | 2022-05-12 23:31 | 0 | |
![[SND]](/icons/sound2.gif) | Freedom Fighters.mp3 | 2022-05-12 23:28 | 0 | |
![[SND]](/icons/sound2.gif) | Big Baby Tape и Молодой Платон - Влюбилась.mp3 | 2022-05-12 23:13 | 0 | |
![[SND]](/icons/sound2.gif) | Crazier.mp3 | 2022-05-12 22:55 | 0 | |
![[SND]](/icons/sound2.gif) | 001 - vip remix`.mp3 | 2022-05-12 22:52 | 0 | |
![[SND]](/icons/sound2.gif) | [VS][35hz] Kashin - Что происходит _ screwed _ low by vavilon.mp3 | 2022-05-12 22:52 | 0 | |
![[SND]](/icons/sound2.gif) | not a home.mp3 | 2022-05-12 22:51 | 0 | |
![[SND]](/icons/sound2.gif) | triageatdawn.mp3 | 2022-05-12 22:47 | 0 | |
![[SND]](/icons/sound2.gif) | Half-Life 2 - Triage at Dawn (synthwave remix).mp3 | 2022-05-12 22:45 | 0 | |
![[SND]](/icons/sound2.gif) | sebi proiect nefinalizat test.mp3 | 2022-05-12 22:30 | 0 | |
![[SND]](/icons/sound2.gif) | A8.mp3 | 2022-05-12 22:24 | 0 | |
![[SND]](/icons/sound2.gif) | A5.mp3 | 2022-05-12 22:23 | 0 | |
![[SND]](/icons/sound2.gif) | Legend From Heaven - Lifes Happy Journey.mp3 | 2022-05-12 22:07 | 0 | |
![[SND]](/icons/sound2.gif) | 21 Law Of Attraction.mp3 | 2022-05-12 22:04 | 0 | |
![[SND]](/icons/sound2.gif) | 11.mp3 | 2022-05-12 21:59 | 2.6M | |
![[SND]](/icons/sound2.gif) | A10.mp3 | 2022-05-12 21:57 | 0 | |
![[SND]](/icons/sound2.gif) | A9.mp3 | 2022-05-12 21:57 | 0 | |
![[SND]](/icons/sound2.gif) | A7.mp3 | 2022-05-12 21:57 | 0 | |
![[SND]](/icons/sound2.gif) | A6.mp3 | 2022-05-12 21:57 | 0 | |
![[SND]](/icons/sound2.gif) | бх1.mp3 | 2022-05-12 21:43 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Aram Shaida Karim Gulani 2016 new-1.mp3 | 2022-05-12 21:42 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - OğuzhanIbrahim Kız Biz Senin Bip BipYetenek Siz Siniz Türkiye_360p.mp3 | 2022-05-12 21:41 | 1.0M | |
![[SND]](/icons/sound2.gif) | Este_1 (2).mp3 | 2022-05-12 21:40 | 773K | |
![[SND]](/icons/sound2.gif) | rr.mp3 | 2022-05-12 21:39 | 231K | |
![[SND]](/icons/sound2.gif) | bh.mp3 | 2022-05-12 21:37 | 0 | |
![[SND]](/icons/sound2.gif) | Este_1 (1).mp3 | 2022-05-12 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | 86677421(2).mp3 | 2022-05-12 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | 86677421(3).mp3 | 2022-05-12 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | 86677421(1).mp3 | 2022-05-12 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | 1652391115.mp3 | 2022-05-12 21:33 | 0 | |
![[SND]](/icons/sound2.gif) | 86677421.mp3 | 2022-05-12 21:33 | 0 | |
![[SND]](/icons/sound2.gif) | gkgfg.mp3 | 2022-05-12 21:30 | 0 | |
![[SND]](/icons/sound2.gif) | MC Хованский - В долгий путь.mp3 | 2022-05-12 21:29 | 0 | |
![[SND]](/icons/sound2.gif) | kizaru - Дежавю.mp3 | 2022-05-12 21:20 | 0 | |
![[SND]](/icons/sound2.gif) | Russianvillage.mp3 | 2022-05-12 21:12 | 0 | |
![[SND]](/icons/sound2.gif) | alizade-gucci.mp3 | 2022-05-12 21:08 | 0 | |
![[SND]](/icons/sound2.gif) | mix.mp3 | 2022-05-12 21:07 | 0 | |
![[SND]](/icons/sound2.gif) | Ghost Piano Cover_2_1.mp3 | 2022-05-12 21:05 | 0 | |
![[SND]](/icons/sound2.gif) | xcho-bere-beregi-moyu-lyubov-file.mp3 | 2022-05-12 21:00 | 0 | |
![[SND]](/icons/sound2.gif) | fukksleep.mp3 | 2022-05-12 20:59 | 7.5M | |
![[SND]](/icons/sound2.gif) | курящих нет- СМЫСЛА.net-Котики-kissvk.com.mp3 | 2022-05-12 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | aloeming.mp3 | 2022-05-12 20:56 | 26K | |
![[SND]](/icons/sound2.gif) | metan-ya-ebu-a-ty-celuesh-ya-ne-krashu-nogti-lakom-file.mp3 | 2022-05-12 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | MARO – “saudade, saudade” _ Final _ Festival da Canção 2022.mp3 | 2022-05-12 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | avecleton.mp3 | 2022-05-12 20:54 | 0 | |
![[SND]](/icons/sound2.gif) | Deta01.mp3 | 2022-05-12 20:45 | 0 | |
![[SND]](/icons/sound2.gif) | Este_1.mp3 | 2022-05-12 20:42 | 0 | |
![[SND]](/icons/sound2.gif) | jovy.mp3 | 2022-05-12 20:39 | 0 | |
![[SND]](/icons/sound2.gif) | PENANTIAN - ARMADA (LIRIK) COVER BY NABILA MAHARANI FEAT TRI SUAKA.mp3 | 2022-05-12 20:37 | 0 | |
![[SND]](/icons/sound2.gif) | Lagupop.mp3 | 2022-05-12 20:36 | 0 | |
![[SND]](/icons/sound2.gif) | KEY4050 Plumb I Love You (128kbps).mp3 | 2022-05-12 20:36 | 3.6M | |
![[SND]](/icons/sound2.gif) | Ghost with birthday 20220513_033423.mp3 | 2022-05-12 20:34 | 0 | |
![[SND]](/icons/sound2.gif) | Este_1.m4a | 2022-05-12 20:31 | 0 | |
![[SND]](/icons/sound2.gif) | araara.mp3 | 2022-05-12 20:31 | 0 | |
![[SND]](/icons/sound2.gif) | Виктор Цой - Пачка сигарет.mp3 | 2022-05-12 20:30 | 10M | |
![[SND]](/icons/sound2.gif) | David Guetta - Without You (Lyrics) ft. Usher.mp3 | 2022-05-12 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | LAGU POP TERBARU 2022 TERPOPULER SAAT INI _ SPOTIFY HITS INDONESIA _ TIKTOK VIRAL 2022(MP3_70K).mp3 | 2022-05-12 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | EMIX.mp3 | 2022-05-12 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | djslow.mp3 | 2022-05-12 20:26 | 0 | |
![[SND]](/icons/sound2.gif) | kincii.mp3 | 2022-05-12 20:26 | 0 | |
![[SND]](/icons/sound2.gif) | Justin Bieber - Ghost Piano Cover with Strings (with Lyrics & PIANO SHEET)_1_2_1 20220513_032201.mp3 | 2022-05-12 20:23 | 0 | |
![[SND]](/icons/sound2.gif) | Marzz.mp3 | 2022-05-12 20:22 | 0 | |
![[SND]](/icons/sound2.gif) | kenzz.mp3 | 2022-05-12 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | d.p.m.b_ndasmu_video_lyric_mp3_27397.mp3 | 2022-05-12 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | ghostemane_mercury_aac_27077.m4a | 2022-05-12 20:16 | 80K | |
![[SND]](/icons/sound2.gif) | trippythakid_leedle_leedle_lee_official_music_video_aac_27057.m4a | 2022-05-12 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | central_cee_loading_instrumental_mp3_27024.mp3 | 2022-05-12 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | ghostemane_mercury_mp3_27547.mp3 | 2022-05-12 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | uicideboy_paris_mp3_27572.mp3 | 2022-05-12 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | 2pac_still_ballin_mp3_34173.mp3 | 2022-05-12 20:15 | 0 | |
![[SND]](/icons/sound2.gif) | uicideboy_you_re_now_tuning_in_to_66.6_fm_with_dj_rapture_the_hottest_hour_of_the_evening_mp3_27616.mp3 | 2022-05-12 20:15 | 880K | |
![[SND]](/icons/sound2.gif) | js1.mp3 | 2022-05-12 20:15 | 3.5M | |
![[SND]](/icons/sound2.gif) | Este_1 (online-audio-converter.com) (1).mp3 | 2022-05-12 20:13 | 0 | |
![[SND]](/icons/sound2.gif) | o.mp3 | 2022-05-12 20:08 | 3.8M | |
![[SND]](/icons/sound2.gif) | Cj1.mp3 | 2022-05-12 20:06 | 0 | |
![[SND]](/icons/sound2.gif) | nwantiti.mp3 | 2022-05-12 20:05 | 0 | |
![[SND]](/icons/sound2.gif) | pop.mp3 | 2022-05-12 20:02 | 2.6M | |
![[SND]](/icons/sound2.gif) | Nokia Tune (1994 bis 2001) als MP3-Klingelton (1).mp3 | 2022-05-12 20:00 | 0 | |
![[SND]](/icons/sound2.gif) | R.mp3 | 2022-05-12 19:58 | 3.3M | |
![[SND]](/icons/sound2.gif) | mojang.mp3 | 2022-05-12 19:45 | 0 | |
![[SND]](/icons/sound2.gif) | 2022-05-12 15-46-19.mp3 | 2022-05-12 19:41 | 0 | |
![[SND]](/icons/sound2.gif) | Адвайта - Счастье.mp3 | 2022-05-12 19:34 | 0 | |
![[SND]](/icons/sound2.gif) | 600 - Ехал я домой с работы В Мерседесе шестисотом _)))))).mp3 | 2022-05-12 19:33 | 0 | |
![[SND]](/icons/sound2.gif) | ⭐⭐⭐Darci ー On My Own⭐⭐⭐(Neutrino Remix)⭐⭐⭐.mp3 | 2022-05-12 19:32 | 0 | |
![[SND]](/icons/sound2.gif) | INNA x Sean Paul - Up (Official Video).mp3 | 2022-05-12 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | dai dai.mp3 | 2022-05-12 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | ssr90.mp3 | 2022-05-12 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | Soulchef Write this down x Dead wrong Biggie Smalls Lyrics.mp3 | 2022-05-12 19:28 | 0 | |
![[SND]](/icons/sound2.gif) | m1.mp3 | 2022-05-12 19:28 | 396K | |
![[SND]](/icons/sound2.gif) | f9.mp3 | 2022-05-12 19:28 | 0 | |
![[SND]](/icons/sound2.gif) | hai0.mp3 | 2022-05-12 19:28 | 516K | |
![[SND]](/icons/sound2.gif) | vraynn.mp3 | 2022-05-12 19:27 | 0 | |
![[SND]](/icons/sound2.gif) | sicandselasaseara.mp3 | 2022-05-12 19:27 | 0 | |
![[SND]](/icons/sound2.gif) | nrzaxs.mp3 | 2022-05-12 19:25 | 0 | |
![[SND]](/icons/sound2.gif) | 123123123.mp3 | 2022-05-12 19:24 | 0 | |
![[SND]](/icons/sound2.gif) | Alex1555.mp3 | 2022-05-12 19:22 | 0 | |
![[SND]](/icons/sound2.gif) | The Future Sound Of London - Glass.mp3 | 2022-05-12 19:20 | 0 | |
![[SND]](/icons/sound2.gif) | jelbrus-dzhanmirzoev-feat.-alexandros-brodjaga.mp3 | 2022-05-12 19:16 | 0 | |
![[SND]](/icons/sound2.gif) | pmk1.mp3 | 2022-05-12 19:16 | 0 | |
![[SND]](/icons/sound2.gif) | ANT00DD.mp3 | 2022-05-12 19:08 | 0 | |
![[SND]](/icons/sound2.gif) | barbatu.mp3 | 2022-05-12 19:03 | 0 | |
![[SND]](/icons/sound2.gif) | Voice_001 (1).mp3 | 2022-05-12 19:02 | 0 | |
![[SND]](/icons/sound2.gif) | cklhdjxzl.mp3 | 2022-05-12 19:02 | 0 | |
![[SND]](/icons/sound2.gif) | pl.mp3 | 2022-05-12 18:59 | 650K | |
![[SND]](/icons/sound2.gif) | NEW-Electro-House-Music-Mix-2021-DANCE-PARTY-CLUB-MIX-33-Dj-Drop-G_D2WHIMlPAKc.mp3 | 2022-05-12 18:59 | 0 | |
![[SND]](/icons/sound2.gif) | s0.mp3 | 2022-05-12 18:59 | 0 | |
![[SND]](/icons/sound2.gif) | s69.mp3 | 2022-05-12 18:59 | 0 | |
![[SND]](/icons/sound2.gif) | BB.mp3 | 2022-05-12 18:58 | 160K | |
![[SND]](/icons/sound2.gif) | nebunake.mp3 | 2022-05-12 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | Krap_PANTERA_polnaya_versiya.mp3 | 2022-05-12 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | Naygad.mp3 | 2022-05-12 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | mikebliss 146 BPM A#m.mp3 | 2022-05-12 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | Xcho_Bere_beregi_moyu_lyubov_vpere_vperedi_moya_dusha.mp3 | 2022-05-12 18:57 | 0 | |
![[SND]](/icons/sound2.gif) | DJ-BASSNYA-NGAJAK-JOGET_AzX8yt79R8Y.mp3 | 2022-05-12 18:52 | 0 | |
![[SND]](/icons/sound2.gif) | BEAUTY AND A BEAT (AUDIO LAB) AUDIO EDIT.mp3 | 2022-05-12 18:50 | 0 | |
![[SND]](/icons/sound2.gif) | BbhDng1.mp3 | 2022-05-12 18:49 | 0 | |
![[SND]](/icons/sound2.gif) | deta3.mp3 | 2022-05-12 18:45 | 3.6M | |
![[SND]](/icons/sound2.gif) | TEMOLA.mp3 | 2022-05-12 18:44 | 0 | |
![[SND]](/icons/sound2.gif) | deta2.mp3 | 2022-05-12 18:43 | 0 | |
![[SND]](/icons/sound2.gif) | deta1.mp3 | 2022-05-12 18:43 | 0 | |
![[SND]](/icons/sound2.gif) | Adeksat_remix_-_Cvet_golubykh_ochejj_73633203.mp3 | 2022-05-12 18:42 | 0 | |
![[SND]](/icons/sound2.gif) | jk..mp3 | 2022-05-12 18:37 | 0 | |
![[SND]](/icons/sound2.gif) | jak.mp3 | 2022-05-12 18:35 | 0 | |
![[SND]](/icons/sound2.gif) | DJ Enzmeister - Stumpy Aus Tirol lauter.mp3 | 2022-05-12 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | GCN Baby Park - Mario Kart 8 Music Extended lauter.mp3 | 2022-05-12 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | jakkkk.mp3 | 2022-05-12 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | jkkk.mp3 | 2022-05-12 18:33 | 0 | |
![[SND]](/icons/sound2.gif) | Duka.mp3 | 2022-05-12 18:32 | 5.2M | |
![[SND]](/icons/sound2.gif) | ud.mp3 | 2022-05-12 18:31 | 2.0M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Gustixa - lemon tree (128 kbps).mp3 | 2022-05-12 18:30 | 1.9M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Duka last child (slowed+reverb) sad vibes _mode full pasif yss_ (128 kbps).mp3 | 2022-05-12 18:30 | 0 | |
![[SND]](/icons/sound2.gif) | Mood-24kgoldn.mp3 | 2022-05-12 18:30 | 0 | |
![[SND]](/icons/sound2.gif) | mk.mp3 | 2022-05-12 18:28 | 2.4M | |
![[SND]](/icons/sound2.gif) | ANT00D.mp3 | 2022-05-12 18:28 | 320K | |
![[SND]](/icons/sound2.gif) | wave+of+emotions.mp3 | 2022-05-12 18:24 | 2.3M | |
![[SND]](/icons/sound2.gif) | INSTASAMKA_-_LIPSI_HA_73156409.mp3 | 2022-05-12 18:21 | 124K | |
![[SND]](/icons/sound2.gif) | ALONE.mp3 | 2022-05-12 18:17 | 0 | |
![[SND]](/icons/sound2.gif) | young_loov_-_Itachi_Versace_73502377.mp3 | 2022-05-12 18:16 | 0 | |
![[SND]](/icons/sound2.gif) | alpdiss222.mp3 | 2022-05-12 18:14 | 0 | |
![[SND]](/icons/sound2.gif) | alpdiss.mp3 | 2022-05-12 18:13 | 0 | |
![[SND]](/icons/sound2.gif) | G.mp3 | 2022-05-12 18:12 | 3.6M | |
![[SND]](/icons/sound2.gif) | KNT.mp3 | 2022-05-12 18:12 | 4.7M | |
![[SND]](/icons/sound2.gif) | pcl.mp3 | 2022-05-12 18:09 | 3.5M | |
![[SND]](/icons/sound2.gif) | nceln.mp3 | 2022-05-12 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | nadlxl.mp3 | 2022-05-12 18:09 | 5.0M | |
![[SND]](/icons/sound2.gif) | mann.mp3 | 2022-05-12 18:09 | 4.2M | |
![[SND]](/icons/sound2.gif) | eods.mp3 | 2022-05-12 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | ktdas.mp3 | 2022-05-12 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | ekgh.mp3 | 2022-05-12 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | dodn.mp3 | 2022-05-12 18:09 | 3.4M | |
![[SND]](/icons/sound2.gif) | can.mp3 | 2022-05-12 18:09 | 5.0M | |
![[SND]](/icons/sound2.gif) | ctsn.mp3 | 2022-05-12 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | pchsrb.mp3 | 2022-05-12 18:09 | 3.8M | |
![[SND]](/icons/sound2.gif) | haipcl.mp3 | 2022-05-12 18:05 | 0 | |
![[SND]](/icons/sound2.gif) | L.mp3 | 2022-05-12 18:03 | 3.6M | |
![[SND]](/icons/sound2.gif) | yt1s.io - Lata ptaszek -piosenka ludowa (128 kbps).mp3 | 2022-05-12 18:02 | 0 | |
![[SND]](/icons/sound2.gif) | 62542.mp3 | 2022-05-12 18:02 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ HOW DO YOU DO BREAKBEAT NGULAR SOUND PRODUK_CIKUYA_LEBAK MENGKANE X DJ AKU YANG MALANG (128 kbps).mp3 | 2022-05-12 17:59 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - „Ptaszki fruwają” – zabawa muzyczno-ruchowa do piosenki (128 kbps).mp3 | 2022-05-12 17:58 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ GODZILLA V2 SLOW REMIX __ viral FYP tiktok 2022🎶🎧 (128 kbps).mp3 | 2022-05-12 17:58 | 1.1M | |
![[SND]](/icons/sound2.gif) | DJ SIMPONY X PALE PALE_1.m4a | 2022-05-12 17:58 | 421K | |
![[SND]](/icons/sound2.gif) | H.mp3 | 2022-05-12 17:58 | 3.5M | |
![[SND]](/icons/sound2.gif) | DJ GOYANG CHIKA.mp3 | 2022-05-12 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | Havana.mp3 | 2022-05-12 17:52 | 8.5M | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ GORENG GORENG X CUKY CUKY X MASHUP OLD VIRAL MENGKANE (128 kbps).mp3 | 2022-05-12 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | radowl.mp3 | 2022-05-12 17:51 | 0 | |
![[SND]](/icons/sound2.gif) | O.mp3 | 2022-05-12 17:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | yt1s.io - Lecą ptaki (128 kbps).mp3 | 2022-05-12 17:48 | 0 | |
![[SND]](/icons/sound2.gif) | Ебанько - Черная пизда.mp3 | 2022-05-12 17:43 | 0 | |
![[VID]](/icons/movie.gif) | Snaptik_7085400196259138843_pa-aiiiiii.mp4 | 2022-05-12 17:43 | 0 | |
![[SND]](/icons/sound2.gif) | Ahmad.mp3 | 2022-05-12 17:42 | 0 | |
![[SND]](/icons/sound2.gif) | FLASHUPPASOORI------------OP---BEASTOPBY-----DUDE---OP.mp3..mp3 | 2022-05-12 17:39 | 0 | |
![[SND]](/icons/sound2.gif) | fagan-stu-kevpee-owen.mp3 | 2022-05-12 17:37 | 0 | |
![[SND]](/icons/sound2.gif) | PASOORI_________BY______-AWM--------DUDE_OP---------NRP.mp3 | 2022-05-12 17:37 | 0 | |
![[SND]](/icons/sound2.gif) | Leon3.mp3 | 2022-05-12 17:35 | 0 | |
![[SND]](/icons/sound2.gif) | rillorfek08.mp3 | 2022-05-12 17:33 | 0 | |
![[SND]](/icons/sound2.gif) | imonzz.mp3 | 2022-05-12 17:32 | 0 | |
![[SND]](/icons/sound2.gif) | wrkz.mp3 | 2022-05-12 17:31 | 808K | |
![[SND]](/icons/sound2.gif) | wolfgang.mp3 | 2022-05-12 17:31 | 0 | |
![[SND]](/icons/sound2.gif) | xomet.mp3 | 2022-05-12 17:31 | 5.5M | |
![[SND]](/icons/sound2.gif) | kuduro.mp3 | 2022-05-12 17:29 | 700K | |
![[SND]](/icons/sound2.gif) | 02601.mp3 | 2022-05-12 17:28 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Ptaków śpiew - Piosenki dla dzieci bajubaju.tv (128 kbps) (1).mp3 | 2022-05-12 17:28 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_-_shawdawn_73909739.mp3 | 2022-05-12 17:26 | 0 | |
![[VID]](/icons/movie.gif) | Snaptik_7092304007766789403_1080p.mp4 | 2022-05-12 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | Mini Mix #1.mp3 | 2022-05-12 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | Big Baby Tape - KARI.mp3 | 2022-05-12 17:22 | 0 | |
![[SND]](/icons/sound2.gif) | 01 midas.mp3 | 2022-05-12 17:22 | 0 | |
![[SND]](/icons/sound2.gif) | Би-2 - Большие города [bassboosted by Den4ik] (zaycev.net) (www.hotplayer.ru).mp3 | 2022-05-12 17:21 | 0 | |
![[SND]](/icons/sound2.gif) | 1595919716_alan-walker-fade-ncs-release.mp3 | 2022-05-12 17:21 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Nasi Skrzydlaci Przyjaciele. (128 kbps).mp3 | 2022-05-12 17:18 | 0 | |
![[SND]](/icons/sound2.gif) | Big_Baby_mq_mq_-_Big_Tymers_73212022.mp3 | 2022-05-12 17:18 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_-_showdown_33909739.mp3 | 2022-05-12 17:14 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_-_showdown_739097341273182339.mp3 | 2022-05-12 17:13 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Piosenka o Samolotach- Szkrab TV-Piosenki dla Dzieci 😍😍😍😍 (128 kbps).mp3 | 2022-05-12 17:12 | 3.6M | |
![[SND]](/icons/sound2.gif) | el-primo-vyipal.mp3 | 2022-05-12 17:10 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Leci SAMOLOT __ DrobNutki __ Piosenki DLA DZIECI (128 kbps).mp3 | 2022-05-12 17:09 | 0 | |
![[SND]](/icons/sound2.gif) | suetu-navesti-ohota (1).mp3 | 2022-05-12 17:09 | 0 | |
![[SND]](/icons/sound2.gif) | suetu-navesti-ohota.mp3 | 2022-05-12 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | mq.mp3 | 2022-05-12 17:03 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Co lata w powietrzu (128 kbps).mp3 | 2022-05-12 17:03 | 0 | |
![[SND]](/icons/sound2.gif) | Big Baby Tape feat. Kizaru - 99 Problems.mp3 | 2022-05-12 17:03 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_Shinra_-_stockholm_74195857.mp3 | 2022-05-12 17:03 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Ptaszek (sł. i muz. M. Majewska) (128 kbps).mp3 | 2022-05-12 17:01 | 0 | |
![[SND]](/icons/sound2.gif) | Vaathi Coming Master 320 Kbps.mp3 | 2022-05-12 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | nixuya.mp3 | 2022-05-12 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | t.mp3 | 2022-05-12 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | НИХУЯ СЕБЕ БЛЯТЬ, УЕБАЛ.mp3 | 2022-05-12 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | mkk.mp3 | 2022-05-12 16:52 | 2.3M | |
![[SND]](/icons/sound2.gif) | mcdonalds-mil-horas-sped-up_456239903.mp3 | 2022-05-12 16:51 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Co fruwa, a co lata_ (128 kbps).mp3 | 2022-05-12 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | Phone message.mp3 | 2022-05-12 16:46 | 0 | |
![[SND]](/icons/sound2.gif) | Friday Night Funkin Vs Dave & Bambi OST - Unfairness (Cótiles REMIX).mp3 | 2022-05-12 16:45 | 0 | |
![[SND]](/icons/sound2.gif) | Angel Baby - Story Wa Lirik Lagu Barat.mp3 | 2022-05-12 16:45 | 0 | |
![[SND]](/icons/sound2.gif) | Sweet01.mp3 | 2022-05-12 16:39 | 0 | |
![[SND]](/icons/sound2.gif) | SANZ.mp3 | 2022-05-12 16:36 | 0 | |
![[SND]](/icons/sound2.gif) | ax1.mp3 | 2022-05-12 16:33 | 0 | |
![[SND]](/icons/sound2.gif) | NEW_SONICEXE_MOD_TEASER_Triple_T_(getmp3.pro).mp3 | 2022-05-12 16:33 | 0 | |
![[SND]](/icons/sound2.gif) | vibe.mp3 | 2022-05-12 16:27 | 884K | |
![[SND]](/icons/sound2.gif) | yt1s.io - Bajka Muzyczna _ Ptasie przygody_ Wróbelek (128 kbps).mp3 | 2022-05-12 16:21 | 0 | |
![[SND]](/icons/sound2.gif) | Be Notorious.mp3 | 2022-05-12 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | hee.mp3 | 2022-05-12 16:14 | 1.8M | |
![[SND]](/icons/sound2.gif) | yt1s.io - Świstunka leśna, Wood Warbler , (Phylloscopus sibilatrix) (128 kbps).mp3 | 2022-05-12 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | Z1.mp3 | 2022-05-12 16:13 | 3.7M | |
![[SND]](/icons/sound2.gif) | ultraman1.mp3 | 2022-05-12 16:12 | 0 | |
![[SND]](/icons/sound2.gif) | Demon Slayer_ Kimetsu no Yaiba - OP Full _Gurenge_.mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | Please.mp3 | 2022-05-12 16:10 | 2.6M | |
![[SND]](/icons/sound2.gif) | ultraman4.mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | Tea Time - Ofshane.mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | ultraman5.mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | Mrs. GREEN APPLE (Inferno).mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | Howmuch.mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | LISA - 'LALISA' M_V.mp3 | 2022-05-12 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | Jujutsu Kaisen - Opening Full『Kaikai Kitan』by Eve.mp3 | 2022-05-12 16:09 | 0 | |
![[SND]](/icons/sound2.gif) | BLACKPINK - 'Lovesick Girls' M_V.mp3 | 2022-05-12 16:09 | 0 | |
![[SND]](/icons/sound2.gif) | (DownloadLagu321.Net) Dj Can we kiss forever x I m not angry anymore Slow by zain prodaksen (128kpbs).mp3 | 2022-05-12 16:05 | 4.5M | |
![[SND]](/icons/sound2.gif) | aam.mp3 | 2022-05-12 16:05 | 0 | |
![[SND]](/icons/sound2.gif) | skill.mp3 | 2022-05-12 16:04 | 0 | |
![[SND]](/icons/sound2.gif) | baran.mp3 | 2022-05-12 16:03 | 0 | |
![[SND]](/icons/sound2.gif) | inbound9214242465374275406.mp3 | 2022-05-12 16:02 | 1.5M | |
![[SND]](/icons/sound2.gif) | yt1s.io - Bzyczenie pszczół - odgłosy pszczoły - jak robi pszczoła_ (128 kbps) (2).mp3 | 2022-05-12 16:02 | 1.6M | |
![[SND]](/icons/sound2.gif) | 1652370669190-voicemaker.in-speech.mp3 | 2022-05-12 16:01 | 51K | |
![[SND]](/icons/sound2.gif) | yt1s.io - śpiew rudzika (128 kbps).mp3 | 2022-05-12 15:58 | 730K | |
![[SND]](/icons/sound2.gif) | ultraman2.mp3 | 2022-05-12 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | bassboostedhdbassvandals.mp3 | 2022-05-12 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | locs2.mp3 | 2022-05-12 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | pwedeba.mp3 | 2022-05-12 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | ultraman3.mp3 | 2022-05-12 15:56 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Piękny śpiew kosa (128 kbps).mp3 | 2022-05-12 15:55 | 0 | |
![[SND]](/icons/sound2.gif) | 1.mp3.mp3 | 2022-05-12 15:55 | 0 | |
![[VID]](/icons/movie.gif) | kurdm.mp4 | 2022-05-12 15:55 | 0 | |
![[SND]](/icons/sound2.gif) | gaico%12fos%32clso%wock%pwi%21fksjs.mp3 | 2022-05-12 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | 9convert.com - Bring Me The Horizon Pray For Plagues HQ.mp3 | 2022-05-12 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | LaguKelly.mp3 | 2022-05-12 15:53 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Odgłosy ptaków. (128 kbps) (1).mp3 | 2022-05-12 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | dimeo1.mp3 | 2022-05-12 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | ripki.mp3 | 2022-05-12 15:50 | 4.4M | |
![[SND]](/icons/sound2.gif) | jimy123.mp3 | 2022-05-12 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Śpiew skowronka (128 kbps).mp3 | 2022-05-12 15:49 | 64K | |
![[SND]](/icons/sound2.gif) | Kambulat - Томас Шелби.mp3 | 2022-05-12 15:47 | 0 | |
![[SND]](/icons/sound2.gif) | ff.mp3 | 2022-05-12 15:47 | 2.0M | |
![[SND]](/icons/sound2.gif) | ultraman6.mp3 | 2022-05-12 15:45 | 0 | |
![[SND]](/icons/sound2.gif) | ultraman8.mp3 | 2022-05-12 15:44 | 0 | |
![[SND]](/icons/sound2.gif) | ultraman7.mp3 | 2022-05-12 15:40 | 0 | |
![[SND]](/icons/sound2.gif) | G2M.mp3 | 2022-05-12 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | M2U.mp3 | 2022-05-12 15:38 | 0 | |
![[SND]](/icons/sound2.gif) | adecvat_production_-_za_cvet_golubyh_ochei_(remix)_muzati.net.mp3 | 2022-05-12 15:38 | 3.8M | |
![[SND]](/icons/sound2.gif) | Lengserwengixnxx.mp3 | 2022-05-12 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | vagosicrp.mp3 | 2022-05-12 15:35 | 0 | |
![[SND]](/icons/sound2.gif) | Lengser wengi xnxx.mp3 | 2022-05-12 15:34 | 0 | |
![[SND]](/icons/sound2.gif) | apan0.mp3 | 2022-05-12 15:33 | 0 | |
![[SND]](/icons/sound2.gif) | 7068998739222186779.mp3 | 2022-05-12 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | MUM.mp3 | 2022-05-12 15:27 | 0 | |
![[SND]](/icons/sound2.gif) | TSR.mp3 | 2022-05-12 15:25 | 0 | |
![[SND]](/icons/sound2.gif) | Archi_-_A_tvoya_mama_a_tvoya_mama_govorit_73726718.mp3 | 2022-05-12 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | Paraluman.mp3 | 2022-05-12 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | apan5.mp3 | 2022-05-12 15:22 | 0 | |
![[SND]](/icons/sound2.gif) | goodbye.mp3 | 2022-05-12 15:22 | 0 | |
![[SND]](/icons/sound2.gif) | hpok.mp3 | 2022-05-12 15:21 | 0 | |
![[SND]](/icons/sound2.gif) | Asedeh.mp3 | 2022-05-12 15:15 | 0 | |
![[SND]](/icons/sound2.gif) | Ultraman Nexus opening (Doa-Eiyuu).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | TAKE ME HIGHER Ultraman Tiga (320 kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Ultraman Dyna ウルトラマンダイナ Theme (128kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu Opening Ultraman Cosmos (128kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Itsumo Kokoro ni Taiyō o (320 kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Tobitatenai Watashi ni Anata ga Tsubasa o Kureta (128 kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | LAGU ULTRAMAN MEBIUS (320 kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Kimi dake wo mamoritai - Solo a ti quiero proteger [Sub español_Romaji] (320 kbps).mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | bhjei1.mp3 | 2022-05-12 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | HO.mp3 | 2022-05-12 15:10 | 2.4M | |
![[SND]](/icons/sound2.gif) | denver finished may12.mp3 | 2022-05-12 14:56 | 45M | |
![[SND]](/icons/sound2.gif) | FILV - Clandestina (feat. Edmofo).mp3 | 2022-05-12 14:54 | 5.7M | |
![[SND]](/icons/sound2.gif) | jk.mp3 | 2022-05-12 14:53 | 3.8M | |
![[SND]](/icons/sound2.gif) | au.mp3 | 2022-05-12 14:52 | 0 | |
![[SND]](/icons/sound2.gif) | s15.mp3 | 2022-05-12 14:49 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Indah Cintaku Cover - (Story WA) (128 kbps).mp3 | 2022-05-12 14:49 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Enkanomiya OST (Final Versions) - Genshin Impact 2.4 (128 kbps).mp3 | 2022-05-12 14:49 | 0 | |
![[SND]](/icons/sound2.gif) | DJE.mp3 | 2022-05-12 14:47 | 0 | |
![[SND]](/icons/sound2.gif) | Lupitaaaa.mp3 | 2022-05-12 14:47 | 0 | |
![[SND]](/icons/sound2.gif) | Vnasakar - Ura Gnum (Remix) (2020) MuzicMp3.net.mp3 | 2022-05-12 14:46 | 0 | |
![[SND]](/icons/sound2.gif) | ulet.mp3 | 2022-05-12 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | Can.mp3 | 2022-05-12 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | rick5.mp3 | 2022-05-12 14:43 | 0 | |
![[SND]](/icons/sound2.gif) | dijesantuy.mp3 | 2022-05-12 14:43 | 0 | |
![[SND]](/icons/sound2.gif) | djrimex.mp3 | 2022-05-12 14:39 | 0 | |
![[SND]](/icons/sound2.gif) | DJRIMEX.mp3 | 2022-05-12 14:34 | 0 | |
![[SND]](/icons/sound2.gif) | BMC.mp3 | 2022-05-12 14:29 | 0 | |
![[SND]](/icons/sound2.gif) | inbound1029047026352811790.mp3 | 2022-05-12 14:28 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Dane Amar - Candy Feat. MEYOU (128 kbps).mp3 | 2022-05-12 14:28 | 0 | |
![[SND]](/icons/sound2.gif) | musik.mp3 | 2022-05-12 14:27 | 907K | |
![[SND]](/icons/sound2.gif) | late night vibes.mp3 | 2022-05-12 14:25 | 2.9M | |
![[SND]](/icons/sound2.gif) | aa3.mp3 | 2022-05-12 14:25 | 354K | |
![[SND]](/icons/sound2.gif) | ไอสัสเอก.mp3 | 2022-05-12 14:24 | 0 | |
![[SND]](/icons/sound2.gif) | aa1.mp3 | 2022-05-12 14:23 | 3.3M | |
![[SND]](/icons/sound2.gif) | Louise.mp3 | 2022-05-12 14:23 | 0 | |
![[SND]](/icons/sound2.gif) | aa2.mp3 | 2022-05-12 14:23 | 4.3M | |
![[SND]](/icons/sound2.gif) | Dane Amar - Candy Feat. MEYOU.mp3 | 2022-05-12 14:22 | 0 | |
![[VID]](/icons/movie.gif) | lv_0_20220507185001.mp4 | 2022-05-12 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | Luv1.mp3 | 2022-05-12 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | VERBEE_-_Davajj_vzorvjom_64630049.mp3 | 2022-05-12 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | เพลง วันพรุ่งนี้.mp3 | 2022-05-12 14:19 | 0 | |
![[SND]](/icons/sound2.gif) | Until i found you.mp3 | 2022-05-12 14:18 | 188K | |
![[SND]](/icons/sound2.gif) | nn.mp3 | 2022-05-12 14:14 | 2.8M | |
![[SND]](/icons/sound2.gif) | Interview (online-audio-converter.com).mp3 | 2022-05-12 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | รายการวิทยุสุดฮา.mp3 | 2022-05-12 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | uuu.mp3 | 2022-05-12 14:12 | 0 | |
![[SND]](/icons/sound2.gif) | taras.mp3 | 2022-05-12 14:11 | 0 | |
![[SND]](/icons/sound2.gif) | fizi.mp3 | 2022-05-12 14:08 | 0 | |
![[SND]](/icons/sound2.gif) | thai.mp3 | 2022-05-12 14:08 | 1.0M | |
![[SND]](/icons/sound2.gif) | lesmana1.mp3 | 2022-05-12 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | #เพลงแดนซ์2021 ★เปิดดังๆ เอาให้ลำโพงพังไปเล้ยย★ วัยรุ่นกำลังมันส์ ❗ _ #REUP【By ตื๊ดตามใจ】.mp3 | 2022-05-12 14:00 | 72K | |
![[SND]](/icons/sound2.gif) | Ram Ranch - 320.mp3 | 2022-05-12 13:56 | 0 | |
![[SND]](/icons/sound2.gif) | snv204.mp3 | 2022-05-12 13:54 | 505K | |
![[SND]](/icons/sound2.gif) | snv206.mp3 | 2022-05-12 13:54 | 312K | |
![[SND]](/icons/sound2.gif) | snv205.mp3 | 2022-05-12 13:54 | 211K | |
![[SND]](/icons/sound2.gif) | snv208.mp3 | 2022-05-12 13:54 | 301K | |
![[SND]](/icons/sound2.gif) | snv207.mp3 | 2022-05-12 13:53 | 380K | |
![[SND]](/icons/sound2.gif) | chill1.mp3 | 2022-05-12 13:53 | 1.6M | |
![[SND]](/icons/sound2.gif) | Chill2.mp3 | 2022-05-12 13:53 | 0 | |
![[SND]](/icons/sound2.gif) | snv38.mp3 | 2022-05-12 13:52 | 706K | |
![[SND]](/icons/sound2.gif) | kiendao2006.mp3 | 2022-05-12 13:50 | 0 | |
![[SND]](/icons/sound2.gif) | SHOLAWAT.mp3 | 2022-05-12 13:44 | 0 | |
![[SND]](/icons/sound2.gif) | Stephen Sanchez - Until I Found You (Lyrics).mp3 | 2022-05-12 13:42 | 0 | |
![[SND]](/icons/sound2.gif) | j.mp3 | 2022-05-12 13:40 | 0 | |
![[SND]](/icons/sound2.gif) | Jomblo.mp3 | 2022-05-12 13:37 | 0 | |
![[SND]](/icons/sound2.gif) | k1.mp3 | 2022-05-12 13:35 | 0 | |
![[SND]](/icons/sound2.gif) | D10.mp3 | 2022-05-12 13:34 | 4.5M | |
![[SND]](/icons/sound2.gif) | Orange.mp3 | 2022-05-12 13:33 | 0 | |
![[SND]](/icons/sound2.gif) | Dzmk.mp3 | 2022-05-12 13:33 | 0 | |
![[SND]](/icons/sound2.gif) | [ DJ Mos ].mp3 | 2022-05-12 13:30 | 104K | |
![[VID]](/icons/movie.gif) | ssstik_1652322800018.mp4 | 2022-05-12 13:30 | 476K | |
![[SND]](/icons/sound2.gif) | Pv1.mp3 | 2022-05-12 13:27 | 2.0M | |
![[SND]](/icons/sound2.gif) | ZZ.mp3 | 2022-05-12 13:26 | 944K | |
![[SND]](/icons/sound2.gif) | LK.mp3 | 2022-05-12 13:25 | 3.9M | |
![[SND]](/icons/sound2.gif) | ee.mp3 | 2022-05-12 13:22 | 272K | |
![[SND]](/icons/sound2.gif) | Zinoleesky_-_Loving_You_Peaceloadedcom_.mp3 | 2022-05-12 13:21 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik_1652329671485.mp3 | 2022-05-12 13:21 | 0 | |
![[SND]](/icons/sound2.gif) | Samsung GALAXY S4 Alarms Morning Flower.mp3 | 2022-05-12 13:17 | 0 | |
![[SND]](/icons/sound2.gif) | brook.mp3 | 2022-05-12 13:16 | 380K | |
![[SND]](/icons/sound2.gif) | arum.mp3 | 2022-05-12 13:12 | 4.6M | |
![[SND]](/icons/sound2.gif) | เพลงแบกโลง ประเทศกาน่า (Ghana dancing pallbearers Official MVHD).mp3 | 2022-05-12 13:11 | 0 | |
![[SND]](/icons/sound2.gif) | AML.mp3 | 2022-05-12 13:06 | 4.6M | |
![[SND]](/icons/sound2.gif) | Rybattotai.mp3 | 2022-05-12 13:06 | 2.6M | |
![[SND]](/icons/sound2.gif) | EE.mp3 | 2022-05-12 13:04 | 3.1M | |
![[SND]](/icons/sound2.gif) | yap.mp3 | 2022-05-12 13:04 | 0 | |
![[SND]](/icons/sound2.gif) | Cecchigori.mp3 | 2022-05-12 12:55 | 0 | |
![[SND]](/icons/sound2.gif) | Colorit_-_Bystro_72746373.mp3 | 2022-05-12 12:54 | 0 | |
![[SND]](/icons/sound2.gif) | diaz1.mp3 | 2022-05-12 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | WhatsApp-Audio-2022-05-10-at-8.12.11-PM.mp3 | 2022-05-12 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | Benci_Untuk_Mencinta(256k).mp3 | 2022-05-12 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | ss!1.mp3 | 2022-05-12 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | Finn1.mp3 | 2022-05-12 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | Гамора - Дыхание улиц slow version (mp3-2020.com).mp3 | 2022-05-12 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | ELNAIN-Автоваз-kissvk.com.mp3 | 2022-05-12 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | tt.mp3 | 2022-05-12 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | Rex_jeux-de-sophia.mp3 | 2022-05-12 12:46 | 0 | |
![[SND]](/icons/sound2.gif) | Shahmen_Mark_Libercio_Remix.mp3 | 2022-05-12 12:39 | 5.6M | |
![[SND]](/icons/sound2.gif) | 6f3963101579d7b1816537068979b15b+(mp3cut.net)_ssstiktok_1652110502732.mp3 | 2022-05-12 12:36 | 0 | |
![[SND]](/icons/sound2.gif) | Vo4.mp3 | 2022-05-12 12:35 | 0 | |
![[SND]](/icons/sound2.gif) | diaz.mp3 | 2022-05-12 12:24 | 0 | |
![[SND]](/icons/sound2.gif) | zajabys.mp3 | 2022-05-12 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | Mnky.mp3 | 2022-05-12 12:19 | 0 | |
![[SND]](/icons/sound2.gif) | nonno12.mp3 | 2022-05-12 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | naif1.mp3 | 2022-05-12 12:16 | 0 | |
![[SND]](/icons/sound2.gif) | KANAN KIRI.mp3 | 2022-05-12 12:14 | 0 | |
![[SND]](/icons/sound2.gif) | kenzo1.mp3 | 2022-05-12 12:13 | 0 | |
![[SND]](/icons/sound2.gif) | This Feeling.mp3 | 2022-05-12 12:12 | 0 | |
![[SND]](/icons/sound2.gif) | monkey.mp3 | 2022-05-12 12:12 | 0 | |
![[SND]](/icons/sound2.gif) | vyshel-pokurit-kladbishe.mp3 | 2022-05-12 12:12 | 0 | |
![[SND]](/icons/sound2.gif) | tc.mp3 | 2022-05-12 12:11 | 2.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANAN KIRI KANAN KIRI VERSI SLOW FULL BASS VIRAL TIKTOK 2021.mp3 | 2022-05-12 12:09 | 0 | |
![[SND]](/icons/sound2.gif) | Nonno Fiorucci Compilation - YouTube [144p].mp3 | 2022-05-12 12:07 | 0 | |
![[SND]](/icons/sound2.gif) | Gus-Teja-World-Music-Album-Music-Penenang-Hati_-5ThPXyx3v4.mp3 | 2022-05-12 12:00 | 0 | |
![[SND]](/icons/sound2.gif) | nonno13.mp3 | 2022-05-12 12:00 | 0 | |
![[SND]](/icons/sound2.gif) | Official Music Video.mp3 | 2022-05-12 11:59 | 2.3M | |
![[SND]](/icons/sound2.gif) | Vp6.mp3 | 2022-05-12 11:59 | 79K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Stephen Sanchez Until I Found You Lyrics_480p (1).mp3 | 2022-05-12 11:57 | 0 | |
![[SND]](/icons/sound2.gif) | slides.mp3 | 2022-05-12 11:57 | 0 | |
![[SND]](/icons/sound2.gif) | wiegohtsdir.mp3 | 2022-05-12 11:55 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar8.mp3 | 2022-05-12 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar5.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar26.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar6.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar16.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Slide8.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Slide3.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Slide7.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Slide5.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Slide4.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | Slide6.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar13.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar25.mp3 | 2022-05-12 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar7.mp3 | 2022-05-12 11:52 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar3.mp3 | 2022-05-12 11:52 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar24.mp3 | 2022-05-12 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar4.mp3 | 2022-05-12 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar22.mp3 | 2022-05-12 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar23.mp3 | 2022-05-12 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar21.mp3 | 2022-05-12 11:50 | 196K | |
![[SND]](/icons/sound2.gif) | Drill.mp3 | 2022-05-12 11:50 | 3.7M | |
![[SND]](/icons/sound2.gif) | 16.mp3 | 2022-05-12 11:48 | 688K | |
![[SND]](/icons/sound2.gif) | jabbar10.mp3 | 2022-05-12 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | jabbar15.mp3 | 2022-05-12 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | lv_0_20220512184245.mp3 | 2022-05-12 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1651585158341.mp3 | 2022-05-12 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Heat Waves Glass Animals Slowed And Reverb Lirik Dan Terjemahan.mp3 | 2022-05-12 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ruth b dandelions slowed tiktok version.mp3 | 2022-05-12 11:43 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ DANZA KUDURO SLOW TIKTOK TERBARU 2021 FULL BASS JEDAG JEDUG TIKTOK.mp3 | 2022-05-12 11:42 | 0 | |
![[SND]](/icons/sound2.gif) | R7.mp3 | 2022-05-12 11:42 | 30M | |
![[SND]](/icons/sound2.gif) | F1.mp3 | 2022-05-12 11:41 | 2.3M | |
![[SND]](/icons/sound2.gif) | D2.mp3 | 2022-05-12 11:41 | 3.6M | |
![[SND]](/icons/sound2.gif) | D1.mp3 | 2022-05-12 11:41 | 2.1M | |
![[SND]](/icons/sound2.gif) | X6.mp3 | 2022-05-12 11:41 | 14M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Don Omar Danza Kuduro REMIX CAR VIDEO.mp3 | 2022-05-12 11:40 | 3.4M | |
![[SND]](/icons/sound2.gif) | Betriebsart (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-05-12 11:39 | 0 | |
![[SND]](/icons/sound2.gif) | fahe1.mp3 | 2022-05-12 11:38 | 0 | |
![[SND]](/icons/sound2.gif) | Bamse - I En Lille Båd Der Gynger.mp3 | 2022-05-12 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | shifin999.mp3 | 2022-05-12 11:25 | 468K | |
![[SND]](/icons/sound2.gif) | bali.mp3 | 2022-05-12 11:24 | 4.6M | |
![[SND]](/icons/sound2.gif) | rc19.mp3 | 2022-05-12 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | pinas.mp3 | 2022-05-12 11:21 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Gellen Martadinata - Selamat Ulang Tahun ( Official Audio & Lyric ) (128 kbps).mp3 | 2022-05-12 11:20 | 1.3M | |
![[SND]](/icons/sound2.gif) | macan_-_za_vseh_muzati.net.mp3 | 2022-05-12 11:17 | 4.0M | |
![[SND]](/icons/sound2.gif) | rc17.mp3 | 2022-05-12 11:17 | 2.6M | |
![[SND]](/icons/sound2.gif) | wa.mp3 | 2022-05-12 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | Kwento.mp3 | 2022-05-12 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | rc18.mp3 | 2022-05-12 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | an.mp3 | 2022-05-12 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | Lana_Del_Rey_-_Old_Money_47966487.mp3 | 2022-05-12 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | ecrpsong.mp3 | 2022-05-12 11:09 | 0 | |
![[SND]](/icons/sound2.gif) | LeviYo.mp3 | 2022-05-12 11:06 | 0 | |
![[SND]](/icons/sound2.gif) | queen1.mp3 | 2022-05-12 11:06 | 0 | |
![[SND]](/icons/sound2.gif) | eastcity.mp3 | 2022-05-12 11:05 | 0 | |
![[SND]](/icons/sound2.gif) | eastcity1.mp3 | 2022-05-12 11:04 | 0 | |
![[SND]](/icons/sound2.gif) | lungToo.mp3 | 2022-05-12 11:02 | 0 | |
![[SND]](/icons/sound2.gif) | Ja9.mp3 | 2022-05-12 11:00 | 3.7M | |
![[SND]](/icons/sound2.gif) | Ja9 (1).mp3 | 2022-05-12 11:00 | 0 | |
![[SND]](/icons/sound2.gif) | apip.mp3 | 2022-05-12 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | Mattasole.mp3 | 2022-05-12 10:56 | 0 | |
![[SND]](/icons/sound2.gif) | 5_6100195823499347244.mp3 | 2022-05-12 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | 444.mp3 | 2022-05-12 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze-golovy-siyayut-na-moej-yadkoj-katane-file.mp3 | 2022-05-12 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | knowme.mp3 | 2022-05-12 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | 333.mp3 | 2022-05-12 10:53 | 0 | |
![[SND]](/icons/sound2.gif) | 1angel.mp3 | 2022-05-12 10:52 | 140K | |
![[SND]](/icons/sound2.gif) | dota.mp3 | 2022-05-12 10:52 | 4.4M | |
![[SND]](/icons/sound2.gif) | snoop.mp3 | 2022-05-12 10:52 | 8.4M | |
![[SND]](/icons/sound2.gif) | MattAje.mp3 | 2022-05-12 10:51 | 0 | |
![[SND]](/icons/sound2.gif) | Unknown - За тебя калым отдам (Bass Boosted) (www.hotplayer.ru).mp3 | 2022-05-12 10:50 | 0 | |
![[SND]](/icons/sound2.gif) | NM.mp3 | 2022-05-12 10:49 | 0 | |
![[SND]](/icons/sound2.gif) | muzika_v_mashinu_2022_-_gabry_ponte__lumx__prezioso_-_thunder_(z2.fm).mp3 | 2022-05-12 10:48 | 0 | |
![[SND]](/icons/sound2.gif) | muzika_v_mashinu_2022_-_shouse_-_love_tonight_dj_safiter_radio_edit_(z2.fm).mp3 | 2022-05-12 10:47 | 0 | |
![[SND]](/icons/sound2.gif) | hiti_2022_-_imanbek__byor_-_belly_dancer_(z2.fm).mp3 | 2022-05-12 10:47 | 0 | |
![[SND]](/icons/sound2.gif) | apann4.mp3 | 2022-05-12 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | muzika_v_mashinu_2022_-_holy_molly_-_shot_a_friend_(z2.fm).mp3 | 2022-05-12 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | notification_sound.mp3 | 2022-05-12 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | Voice 017.m4a | 2022-05-12 10:45 | 0 | |
![[SND]](/icons/sound2.gif) | MUKKA_Pyrokinesis_-_Dnyami-nochami_(musmore.com).mp3 | 2022-05-12 10:43 | 7.6M | |
![[SND]](/icons/sound2.gif) | tom12.mp3 | 2022-05-12 10:43 | 2.6M | |
![[SND]](/icons/sound2.gif) | tom11.mp3 | 2022-05-12 10:42 | 2.8M | |
![[SND]](/icons/sound2.gif) | GAYAZOV$ BROTHER$ – МАЛИНОВАЯ ЛАДА (1).mp3 | 2022-05-12 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | Мукка - Девочка с каре (8D).mp3 | 2022-05-12 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | ryu1.mp3 | 2022-05-12 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | Пошлая Молли - Ты разбила папину машину.mp3 | 2022-05-12 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | Add the numbers..mp3 | 2022-05-12 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | tom5.mp3 | 2022-05-12 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | tom4.mp3 | 2022-05-12 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | #เพลงแดนซ์ JAK Founder - DoubleG Jungji Jackeyy #สามช่า By ดีเจวิ รีมิกซ์.mp3 | 2022-05-12 10:37 | 0 | |
![[SND]](/icons/sound2.gif) | AidhxhzjzvBzhshsj.mp3 | 2022-05-12 10:34 | 0 | |
![[SND]](/icons/sound2.gif) | НЕ ТУПИ.mp3 | 2022-05-12 10:34 | 0 | |
![[SND]](/icons/sound2.gif) | SLAVA MARLOW - Ты горишь как огонь.mp3 | 2022-05-12 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | GAYAZOV BROTHER, Filatov Karas - Пошла жара.mp3 | 2022-05-12 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | tom3.mp3 | 2022-05-12 10:30 | 4.2M | |
![[SND]](/icons/sound2.gif) | Dede.mp3 | 2022-05-12 10:29 | 0 | |
![[SND]](/icons/sound2.gif) | shido1.mp3 | 2022-05-12 10:29 | 0 | |
![[SND]](/icons/sound2.gif) | tATu - Покажи Мне Любовь (Hard Remix) (mp3-2020.com).mp3 | 2022-05-12 10:29 | 3.5M | |
![[SND]](/icons/sound2.gif) | Мукка - ТАБЛЕТКА.mp3 | 2022-05-12 10:28 | 1.9M | |
![[SND]](/icons/sound2.gif) | tom2.mp3 | 2022-05-12 10:28 | 0 | |
![[SND]](/icons/sound2.gif) | Mee.mp3 | 2022-05-12 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | bigtu.mp3 | 2022-05-12 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | yum1.mp3 | 2022-05-12 10:26 | 0 | |
![[SND]](/icons/sound2.gif) | emdaxaanh.mp3 | 2022-05-12 10:26 | 0 | |
![[SND]](/icons/sound2.gif) | Hutslang.mp3 | 2022-05-12 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | WoW1.mp3 | 2022-05-12 10:23 | 4.7M | |
![[SND]](/icons/sound2.gif) | tar.mp3 | 2022-05-12 10:23 | 0 | |
![[SND]](/icons/sound2.gif) | ECRP.mp3 | 2022-05-12 10:18 | 0 | |
![[SND]](/icons/sound2.gif) | HAPPIER.mp3 | 2022-05-12 10:17 | 0 | |
![[SND]](/icons/sound2.gif) | Zero3.mp3 | 2022-05-12 10:17 | 0 | |
![[SND]](/icons/sound2.gif) | mevl-magnitola-mp3.mp3 | 2022-05-12 10:15 | 5.9M | |
![[SND]](/icons/sound2.gif) | Zero1.mp3 | 2022-05-12 10:12 | 0 | |
![[SND]](/icons/sound2.gif) | DJ CALMA V3 X PAPAPEPAP SURIA PADELE X SAFONAMIX.mp3 | 2022-05-12 10:12 | 3.6M | |
![[SND]](/icons/sound2.gif) | katsu.mp3 | 2022-05-12 10:10 | 1.6M | |
![[SND]](/icons/sound2.gif) | Line.mp3 | 2022-05-12 10:05 | 4.3M | |
![[SND]](/icons/sound2.gif) | TATARKA.mp3 | 2022-05-12 10:04 | 0 | |
![[SND]](/icons/sound2.gif) | djki10.mp3 | 2022-05-12 10:03 | 0 | |
![[SND]](/icons/sound2.gif) | Jessie.mp3 | 2022-05-12 10:02 | 0 | |
![[SND]](/icons/sound2.gif) | Nularm.mp3 | 2022-05-12 10:01 | 0 | |
![[SND]](/icons/sound2.gif) | larm.mp3 | 2022-05-12 09:57 | 0 | |
![[SND]](/icons/sound2.gif) | ZOOM.mp3 | 2022-05-12 09:54 | 2.8M | |
![[SND]](/icons/sound2.gif) | (gudanglagu123.metrolagu.site) - Gellen Martadinata Selamat Ulang Tahun (cover by Moyy).mp3 | 2022-05-12 09:53 | 768K | |
![[SND]](/icons/sound2.gif) | Ryasw.mp3 | 2022-05-12 09:51 | 0 | |
![[SND]](/icons/sound2.gif) | Ashie001.mp3 | 2022-05-12 09:50 | 0 | |
![[SND]](/icons/sound2.gif) | aftonsong1.mp3 | 2022-05-12 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | Dres3.mp3 | 2022-05-12 09:44 | 0 | |
![[SND]](/icons/sound2.gif) | 94256.mp3 | 2022-05-12 09:42 | 0 | |
![[SND]](/icons/sound2.gif) | navyalaram.mp3 | 2022-05-12 09:39 | 0 | |
![[SND]](/icons/sound2.gif) | BGK.mp3 | 2022-05-12 09:38 | 0 | |
![[SND]](/icons/sound2.gif) | Dres0.mp3 | 2022-05-12 09:37 | 0 | |
![[SND]](/icons/sound2.gif) | lenka.mp3 | 2022-05-12 09:34 | 0 | |
![[SND]](/icons/sound2.gif) | Arcade.Mp.mp3 | 2022-05-12 09:28 | 0 | |
![[SND]](/icons/sound2.gif) | zx.mp3 | 2022-05-12 09:27 | 1.2M | |
![[SND]](/icons/sound2.gif) | sapientdream - past lives (lyrics).mp3 | 2022-05-12 09:26 | 0 | |
![[SND]](/icons/sound2.gif) | struc1.mp3 | 2022-05-12 09:17 | 0 | |
![[SND]](/icons/sound2.gif) | Kagome.mp3 | 2022-05-12 09:11 | 3.1M | |
![[SND]](/icons/sound2.gif) | rehan.mp3 | 2022-05-12 09:10 | 0 | |
![[SND]](/icons/sound2.gif) | thunders.mp3 | 2022-05-12 09:08 | 0 | |
![[SND]](/icons/sound2.gif) | dika1.mp3 | 2022-05-12 09:06 | 0 | |
![[SND]](/icons/sound2.gif) | Moon Knigdht Theme V2 - Samuel Kim (FLAC).mp3 | 2022-05-12 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | dika2.mp3 | 2022-05-12 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | Molly.mp3 | 2022-05-12 08:58 | 2.2M | |
![[SND]](/icons/sound2.gif) | Zenn.mp3 | 2022-05-12 08:56 | 0 | |
![[SND]](/icons/sound2.gif) | dhruv.mp3 | 2022-05-12 08:48 | 1.8M | |
![[SND]](/icons/sound2.gif) | djghost.mp3 | 2022-05-12 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | Xann.mp3 | 2022-05-12 08:47 | 0 | |
![[SND]](/icons/sound2.gif) | COG.mp3 | 2022-05-12 08:42 | 104K | |
![[SND]](/icons/sound2.gif) | SAD.mp3 | 2022-05-12 08:42 | 2.6M | |
![[SND]](/icons/sound2.gif) | KNTL.mp3 | 2022-05-12 08:42 | 1.3M | |
![[SND]](/icons/sound2.gif) | Dhyo.mp3 | 2022-05-12 08:38 | 0 | |
![[SND]](/icons/sound2.gif) | Tipe-X.mp3 | 2022-05-12 08:38 | 0 | |
![[SND]](/icons/sound2.gif) | 917229268.mp3 | 2022-05-12 08:37 | 0 | |
![[SND]](/icons/sound2.gif) | eps45.mp3 | 2022-05-12 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | Tipe-X - Selamat Jalan Official Video.mp3 | 2022-05-12 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | Meneketehe.mp3 | 2022-05-12 08:35 | 2.4M | |
![[SND]](/icons/sound2.gif) | AUDIO-2022-04-16-19-12-24.mp3 | 2022-05-12 08:35 | 0 | |
![[SND]](/icons/sound2.gif) | bodiev-million-file.mp3 | 2022-05-12 08:35 | 0 | |
![[SND]](/icons/sound2.gif) | luna1.mp3 | 2022-05-12 08:34 | 12K | |
![[SND]](/icons/sound2.gif) | Wrkz.mp3 | 2022-05-12 08:34 | 0 | |
![[SND]](/icons/sound2.gif) | Xomet.mp3 | 2022-05-12 08:34 | 1.0M | |
![[SND]](/icons/sound2.gif) | me.mp3 | 2022-05-12 08:30 | 3.0M | |
![[SND]](/icons/sound2.gif) | qtq.mp3 | 2022-05-12 08:30 | 0 | |
![[SND]](/icons/sound2.gif) | meneke.mp3 | 2022-05-12 08:28 | 0 | |
![[SND]](/icons/sound2.gif) | Mentahan Lirik Lagu “Angel Baby-Troye Sivan Viral Tiktok.mp3 | 2022-05-12 08:28 | 0 | |
![[SND]](/icons/sound2.gif) | lo165.mp3 | 2022-05-12 08:27 | 0 | |
![[SND]](/icons/sound2.gif) | Undangan Modern Lagu Marry Your Daughter Brian McKnight.mp3 | 2022-05-12 08:25 | 0 | |
![[SND]](/icons/sound2.gif) | drey1.mp3.mp3 | 2022-05-12 08:24 | 0 | |
![[SND]](/icons/sound2.gif) | orkestrix-chechenskaya-lezginka.mp3 | 2022-05-12 08:23 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - MENTAHAN CCP LAGU ANGEL BABY _ YOU'RE MY ANGEL ANGEL BABY, ANGEL (320 kbps).mp3 | 2022-05-12 08:20 | 0 | |
![[SND]](/icons/sound2.gif) | rose1.mp3 | 2022-05-12 08:19 | 0 | |
![[SND]](/icons/sound2.gif) | XBOX.mp3 | 2022-05-12 08:16 | 0 | |
![[SND]](/icons/sound2.gif) | NNN.mp3 | 2022-05-12 08:15 | 3.1M | |
![[SND]](/icons/sound2.gif) | Dangdut1.mp3 | 2022-05-12 08:11 | 0 | |
![[SND]](/icons/sound2.gif) | Dangdut.mp3 | 2022-05-12 08:10 | 0 | |
![[SND]](/icons/sound2.gif) | joy9.mp3 | 2022-05-12 08:06 | 0 | |
![[SND]](/icons/sound2.gif) | rebellion168.mp3 | 2022-05-12 08:03 | 0 | |
![[SND]](/icons/sound2.gif) | audioclip-1651785224000-222336.mp3 | 2022-05-12 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | t2ays.mp3 | 2022-05-12 07:57 | 0 | |
![[SND]](/icons/sound2.gif) | akselregangumilang177.mp3 | 2022-05-12 07:54 | 168K | |
![[SND]](/icons/sound2.gif) | abi12.mp3 | 2022-05-12 07:52 | 4.5M | |
![[SND]](/icons/sound2.gif) | hidden7.mp3 | 2022-05-12 07:52 | 884K | |
![[SND]](/icons/sound2.gif) | abi11.mp3 | 2022-05-12 07:52 | 4.9M | |
![[SND]](/icons/sound2.gif) | kb317.mp3 | 2022-05-12 07:48 | 0 | |
![[SND]](/icons/sound2.gif) | rain.mp3 | 2022-05-12 07:47 | 136K | |
![[SND]](/icons/sound2.gif) | X2Download.com - Arctic Monkeys - Best Tracks (128 kbps).mp3 | 2022-05-12 07:37 | 0 | |
![[VID]](/icons/movie.gif) | X2Download.com-NIKI - Every Summertime (Lyrics).mp4 | 2022-05-12 07:34 | 368K | |
![[SND]](/icons/sound2.gif) | totale.mp3 | 2022-05-12 07:33 | 68K | |
![[SND]](/icons/sound2.gif) | Leo1.mp3 | 2022-05-12 07:21 | 2.7M | |
![[SND]](/icons/sound2.gif) | Babanee - Arapaa (Dirty).mp3 | 2022-05-12 07:20 | 0 | |
![[SND]](/icons/sound2.gif) | slzbrg.mp3 | 2022-05-12 07:18 | 0 | |
![[SND]](/icons/sound2.gif) | morgenshtern-papin-tank-mp3.mp3 | 2022-05-12 07:09 | 0 | |
![[SND]](/icons/sound2.gif) | chanhlong.mp3 | 2022-05-12 07:08 | 0 | |
![[SND]](/icons/sound2.gif) | bajidor.mp3 | 2022-05-12 07:05 | 2.0M | |
![[VID]](/icons/movie.gif) | VID_20220512144129.mp4 | 2022-05-12 07:01 | 0 | |
![[SND]](/icons/sound2.gif) | madridsa.mp3 | 2022-05-12 07:01 | 0 | |
![[SND]](/icons/sound2.gif) | feelkoplo.mp3 | 2022-05-12 07:00 | 0 | |
![[SND]](/icons/sound2.gif) | madrids.mp3 | 2022-05-12 06:58 | 0 | |
![[SND]](/icons/sound2.gif) | arcade2.mp3 | 2022-05-12 06:51 | 2.9M | |
![[SND]](/icons/sound2.gif) | 01 True Love.mp3 | 2022-05-12 06:50 | 9.0M | |
![[SND]](/icons/sound2.gif) | sapi.mp3 | 2022-05-12 06:50 | 2.9M | |
![[SND]](/icons/sound2.gif) | arum1.mp3 | 2022-05-12 06:49 | 3.5M | |
![[SND]](/icons/sound2.gif) | chain.mp3 | 2022-05-12 06:47 | 1.7M | |
![[SND]](/icons/sound2.gif) | guardians_of_the_galaxy_16. Fleetwood Mac - The Chain.mp3 | 2022-05-12 06:46 | 0 | |
![[SND]](/icons/sound2.gif) | kangi-zhit-ne-zapretish-mp3.mp3 | 2022-05-12 06:45 | 0 | |
![[SND]](/icons/sound2.gif) | AnyConv.com__VID_20220512144129.mp3 | 2022-05-12 06:44 | 0 | |
![[SND]](/icons/sound2.gif) | RELA - Ade Astrid ( Live Show Private ) Pangandaran.mp3 | 2022-05-12 06:43 | 0 | |
![[SND]](/icons/sound2.gif) | adeastrid.mp3 | 2022-05-12 06:40 | 7.5M | |
![[SND]](/icons/sound2.gif) | D' S.W.A.T. - Koreografi Seni (Kelompok 1).mp3 | 2022-05-12 06:36 | 0 | |
![[SND]](/icons/sound2.gif) | Rapsodi.mp3 | 2022-05-12 06:34 | 0 | |
![[SND]](/icons/sound2.gif) | Xugador Rambling.mp3 | 2022-05-12 06:34 | 0 | |
![[SND]](/icons/sound2.gif) | lil-morty-ya-pizdatyj-ahuenyj-sovremennyj-nevebennyj.mp3 | 2022-05-12 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | Metan_-_SHnurki_73239954.mp3 | 2022-05-12 06:25 | 0 | |
![[SND]](/icons/sound2.gif) | Needyou.mp3 | 2022-05-12 06:23 | 0 | |
![[SND]](/icons/sound2.gif) | Lil Morty - Я Пиздатый.mp3 | 2022-05-12 06:22 | 736K | |
![[SND]](/icons/sound2.gif) | Pagsamo.mp3 | 2022-05-12 06:21 | 5.4M | |
![[SND]](/icons/sound2.gif) | 5naathiibrrluthrrmaebbsan.mp3 | 2022-05-12 06:20 | 682K | |
![[SND]](/icons/sound2.gif) | sv.mp3 | 2022-05-12 06:19 | 4.0M | |
![[SND]](/icons/sound2.gif) | videoplayback.mp3 | 2022-05-12 06:17 | 1.9M | |
![[SND]](/icons/sound2.gif) | Dimebag_Plugg_-_CVV_(prod_CashMoneyAp)_(mp3shnik.ru).mp3 | 2022-05-12 06:17 | 3.4M | |
![[SND]](/icons/sound2.gif) | Galau3.mp3 | 2022-05-12 06:17 | 0 | |
![[SND]](/icons/sound2.gif) | Galau1.mp3 | 2022-05-12 06:08 | 0 | |
![[SND]](/icons/sound2.gif) | rey1.mp3 | 2022-05-12 06:01 | 0 | |
![[SND]](/icons/sound2.gif) | SIKSA.mp3 | 2022-05-12 05:54 | 0 | |
![[SND]](/icons/sound2.gif) | savet79.mp3 | 2022-05-12 05:50 | 0 | |
![[SND]](/icons/sound2.gif) | SIKSA KUBUR.mp3 | 2022-05-12 05:47 | 0 | |
![[SND]](/icons/sound2.gif) | gavo16.mp3 | 2022-05-12 05:47 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Keane Somewhere Only We Know Official Video.mp3 | 2022-05-12 05:45 | 0 | |
![[SND]](/icons/sound2.gif) | rey.mp3 | 2022-05-12 05:43 | 0 | |
![[SND]](/icons/sound2.gif) | REKBER1.mp3 | 2022-05-12 05:38 | 0 | |
![[SND]](/icons/sound2.gif) | Дора, Мэйби Бэйби - Барбисайз (1).mp3 | 2022-05-12 05:38 | 0 | |
![[SND]](/icons/sound2.gif) | Dan7.mp3 | 2022-05-12 05:38 | 0 | |
![[SND]](/icons/sound2.gif) | Дора, Мэйби Бэйби - Барбисайз.mp3 | 2022-05-12 05:37 | 7.1M | |
![[SND]](/icons/sound2.gif) | dora-mjejjbi-bjejjbi-barbisajjz (1).mp3 | 2022-05-12 05:37 | 0 | |
![[SND]](/icons/sound2.gif) | dora-mjejjbi-bjejjbi-barbisajjz (2).mp3 | 2022-05-12 05:37 | 100K | |
![[SND]](/icons/sound2.gif) | Sam3.mp3 | 2022-05-12 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | Sam1.mp3 | 2022-05-12 05:34 | 0 | |
![[SND]](/icons/sound2.gif) | aljona_shvec_-_Portvejjn_62508628.mp3 | 2022-05-12 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | noob.mp3 | 2022-05-12 05:31 | 0 | |
![[SND]](/icons/sound2.gif) | sl2.mp3 | 2022-05-12 05:20 | 0 | |
![[SND]](/icons/sound2.gif) | sl1.mp3 | 2022-05-12 05:15 | 2.4M | |
![[SND]](/icons/sound2.gif) | dora-mjejjbi-bjejjbi-barbisajjz.mp3 | 2022-05-12 05:15 | 0 | |
![[SND]](/icons/sound2.gif) | DJ_POTA_POTA_COPINES_TIK_TOK_JEDAG_JEDUG___DJ_VIRAL_TIKTOK_TERBARU_2021(256k).mp3 | 2022-05-12 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | TheDevourerOfGods.mp3 | 2022-05-12 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | some time alll i think is about is you.mp3 | 2022-05-12 05:11 | 5.3M | |
![[SND]](/icons/sound2.gif) | Terraria_Calamity_Mod_Music_-_The_Devourer_of_Gods__Nonstop_.mp3 | 2022-05-12 05:10 | 0 | |
![[SND]](/icons/sound2.gif) | soundku.mp3 | 2022-05-12 05:10 | 0 | |
![[SND]](/icons/sound2.gif) | David1.mp3 | 2022-05-12 05:09 | 0 | |
![[SND]](/icons/sound2.gif) | ken.mp3 | 2022-05-12 04:56 | 0 | |
![[SND]](/icons/sound2.gif) | r16.mp3 | 2022-05-12 04:56 | 0 | |
![[SND]](/icons/sound2.gif) | Bohong.mp3 | 2022-05-12 04:56 | 0 | |
![[SND]](/icons/sound2.gif) | r12.mp3 | 2022-05-12 04:56 | 0 | |
![[SND]](/icons/sound2.gif) | nong85544D6.mp3 | 2022-05-12 04:52 | 148K | |
![[SND]](/icons/sound2.gif) | vinahouse.mp3 | 2022-05-12 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | ADI.mp3 | 2022-05-12 04:42 | 0 | |
![[SND]](/icons/sound2.gif) | dcm2.mp3 | 2022-05-12 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | nong85544D5.mp3 | 2022-05-12 04:34 | 0 | |
![[SND]](/icons/sound2.gif) | vip6.mp3 | 2022-05-12 04:33 | 2.6M | |
![[SND]](/icons/sound2.gif) | UponCompletion.mp3 | 2022-05-12 04:31 | 5.4M | |
![[SND]](/icons/sound2.gif) | vip5.mp3 | 2022-05-12 04:31 | 3.8M | |
![[SND]](/icons/sound2.gif) | vip4.mp3 | 2022-05-12 04:30 | 2.8M | |
![[SND]](/icons/sound2.gif) | boomchalaka.mp3 | 2022-05-12 04:29 | 0 | |
![[SND]](/icons/sound2.gif) | neeraj9.mp3 | 2022-05-12 04:28 | 0 | |
![[SND]](/icons/sound2.gif) | Pelik1.mp3 | 2022-05-12 04:27 | 0 | |
![[SND]](/icons/sound2.gif) | Gustixaa.mp3 | 2022-05-12 04:26 | 2.7M | |
![[SND]](/icons/sound2.gif) | anakftit.mp3 | 2022-05-12 04:26 | 0 | |
![[SND]](/icons/sound2.gif) | neeraj8.mp3 | 2022-05-12 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | Traitor.mp3 | 2022-05-12 04:21 | 0 | |
![[SND]](/icons/sound2.gif) | Luxxy.mp3 | 2022-05-12 04:19 | 0 | |
![[SND]](/icons/sound2.gif) | mattgg.mp3 | 2022-05-12 04:19 | 0 | |
![[SND]](/icons/sound2.gif) | asw.mp3 | 2022-05-12 04:14 | 1.1M | |
![[SND]](/icons/sound2.gif) | luxxy.mp3 | 2022-05-12 04:11 | 0 | |
![[SND]](/icons/sound2.gif) | Luxxy1.mp3 | 2022-05-12 04:10 | 8.5M | |
![[SND]](/icons/sound2.gif) | Jk.mp3 | 2022-05-12 04:10 | 25M | |
![[SND]](/icons/sound2.gif) | satria2.mp3 | 2022-05-12 04:03 | 0 | |
![[SND]](/icons/sound2.gif) | satria.mp3 | 2022-05-12 04:03 | 7.1M | |
![[SND]](/icons/sound2.gif) | dj.mp3 | 2022-05-12 03:59 | 0 | |
![[SND]](/icons/sound2.gif) | anjay100.mp3 | 2022-05-12 03:52 | 0 | |
![[SND]](/icons/sound2.gif) | Vip12.mp3 | 2022-05-12 03:50 | 0 | |
![[SND]](/icons/sound2.gif) | THATS_THAT_(getmp3.pro).mp3 | 2022-05-12 03:50 | 0 | |
![[SND]](/icons/sound2.gif) | Chord.mp3 | 2022-05-12 03:49 | 0 | |
![[SND]](/icons/sound2.gif) | Sad25.mp3 | 2022-05-12 03:46 | 0 | |
![[SND]](/icons/sound2.gif) | Overdosing2-[AudioTrimmer.com].mp3 | 2022-05-12 03:45 | 0 | |
![[SND]](/icons/sound2.gif) | tronremix.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | light.mp3 | 2022-05-12 03:44 | 2.3M | |
![[SND]](/icons/sound2.gif) | ansi.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | Dose.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | blue.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | kanda.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | munde.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | Riding.m4a | 2022-05-12 03:44 | 297K | |
![[SND]](/icons/sound2.gif) | cj.mp3 | 2022-05-12 03:44 | 1.3M | |
![[SND]](/icons/sound2.gif) | Luv.mp3 | 2022-05-12 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | NEW Electro House Music Mix 2021 _ DANCE PARTY CLUB MIX #33 Dj Drop G.mp3 | 2022-05-12 03:42 | 0 | |
![[SND]](/icons/sound2.gif) | The Champion.mp3 | 2022-05-12 03:35 | 0 | |
![[SND]](/icons/sound2.gif) | sbh.mp3 | 2022-05-12 03:34 | 0 | |
![[SND]](/icons/sound2.gif) | tbh.mp3 | 2022-05-12 03:33 | 0 | |
![[SND]](/icons/sound2.gif) | mbh.mp3 | 2022-05-12 03:33 | 0 | |
![[SND]](/icons/sound2.gif) | toofanh.mp3 | 2022-05-12 03:31 | 0 | |
![[SND]](/icons/sound2.gif) | LegendsNeverDieRemix.mp3 | 2022-05-12 03:30 | 0 | |
![[VID]](/icons/movie.gif) | t.mp4 | 2022-05-12 03:25 | 0 | |
![[SND]](/icons/sound2.gif) | f.mp3 | 2022-05-12 03:24 | 2.9M | |
![[SND]](/icons/sound2.gif) | Panget.mp3 | 2022-05-12 03:23 | 0 | |
![[SND]](/icons/sound2.gif) | Carrie Underwood - The Champion ft. Ludacris (Official Video).mp3 | 2022-05-12 03:18 | 0 | |
![[SND]](/icons/sound2.gif) | ALL TIME LOW - Jon Bellion - Sam Tsui, Casey Breves, KHS COVER.mp3 | 2022-05-12 03:18 | 0 | |
![[SND]](/icons/sound2.gif) | Legends Never Die Remix (ft. Alan Walker) Worlds 2017 - League of Legends.mp3 | 2022-05-12 03:18 | 0 | |
![[SND]](/icons/sound2.gif) | test.mp3 | 2022-05-12 03:15 | 52K | |
![[SND]](/icons/sound2.gif) | Joo.mp3 | 2022-05-12 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | sara.mp3 | 2022-05-12 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | xxoo.mp3 | 2022-05-12 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | Anton.mp3 | 2022-05-12 03:13 | 0 | |
![[SND]](/icons/sound2.gif) | los del guetto.mp3 | 2022-05-12 03:09 | 0 | |
![[SND]](/icons/sound2.gif) | kel1.mp3 | 2022-05-12 03:09 | 0 | |
![[SND]](/icons/sound2.gif) | los del barrio.mp3 | 2022-05-12 03:09 | 0 | |
![[SND]](/icons/sound2.gif) | NTN.mp3 | 2022-05-12 03:08 | 0 | |
![[SND]](/icons/sound2.gif) | Djgeleng.mp3 | 2022-05-12 03:03 | 0 | |
![[SND]](/icons/sound2.gif) | azriel.mp3 | 2022-05-12 02:57 | 0 | |
![[SND]](/icons/sound2.gif) | DJ GELENG Geleng .mp3 | 2022-05-12 02:52 | 0 | |
![[SND]](/icons/sound2.gif) | marikit.mp3 | 2022-05-12 02:45 | 3.2M | |
![[SND]](/icons/sound2.gif) | uniii.mp3 | 2022-05-12 02:39 | 414K | |
![[SND]](/icons/sound2.gif) | uniiii.mp3 | 2022-05-12 02:39 | 303K | |
![[SND]](/icons/sound2.gif) | jak1.mp3 | 2022-05-12 02:38 | 79K | |
![[SND]](/icons/sound2.gif) | jak2.mp3 | 2022-05-12 02:38 | 0 | |
![[SND]](/icons/sound2.gif) | (downloadlagu321z.net) - Dj industrial wolfgang [ SOUND ZERZ SOFTBOY ] Tiktok viral terbaru 2022.mp3 | 2022-05-12 02:38 | 0 | |
![[SND]](/icons/sound2.gif) | lilnas.mp3 | 2022-05-12 02:31 | 3.6M | |
![[SND]](/icons/sound2.gif) | amen.mp3 | 2022-05-12 02:30 | 2.8M | |
![[SND]](/icons/sound2.gif) | Mister2.mp3 | 2022-05-12 02:29 | 4.0M | |
![[SND]](/icons/sound2.gif) | MAK.mp3 | 2022-05-12 02:21 | 136K | |
![[SND]](/icons/sound2.gif) | Mister9.mp3 | 2022-05-12 02:21 | 0 | |
![[SND]](/icons/sound2.gif) | Mister8.mp3 | 2022-05-12 02:19 | 3.6M | |
![[SND]](/icons/sound2.gif) | Mister4.mp3 | 2022-05-12 02:19 | 3.8M | |
![[SND]](/icons/sound2.gif) | Mister7.mp3 | 2022-05-12 02:19 | 4.7M | |
![[SND]](/icons/sound2.gif) | Mister3.mp3 | 2022-05-12 02:19 | 5.7M | |
![[SND]](/icons/sound2.gif) | Mister5.mp3 | 2022-05-12 02:19 | 5.3M | |
![[SND]](/icons/sound2.gif) | Mister6.mp3 | 2022-05-12 02:19 | 3.5M | |
![[SND]](/icons/sound2.gif) | my song.mp3 | 2022-05-12 02:14 | 0 | |
![[SND]](/icons/sound2.gif) | NieR_ Automata OST-The Tower (Extended).mp3 | 2022-05-12 02:11 | 0 | |
![[SND]](/icons/sound2.gif) | SNOWROOP.mp3 | 2022-05-12 02:11 | 0 | |
![[VID]](/icons/movie.gif) | video-1652166383.mp4 | 2022-05-12 02:08 | 0 | |
![[SND]](/icons/sound2.gif) | heatwave.mp3.mp3 | 2022-05-12 02:04 | 0 | |
![[SND]](/icons/sound2.gif) | Doil.mp3 | 2022-05-12 02:02 | 0 | |
![[SND]](/icons/sound2.gif) | Gm.mp3 | 2022-05-12 02:02 | 0 | |
![[SND]](/icons/sound2.gif) | Cosanostra.mp3 | 2022-05-12 02:00 | 0 | |
![[VID]](/icons/movie.gif) | Anthem.mp4 | 2022-05-12 01:59 | 0 | |
![[SND]](/icons/sound2.gif) | darari.mp3.mp3 | 2022-05-12 01:56 | 0 | |
![[VID]](/icons/movie.gif) | Anthem.mp3.mp4 | 2022-05-12 01:55 | 5.2M | |
![[SND]](/icons/sound2.gif) | blodpop.mp3.mp3 | 2022-05-12 01:52 | 2.2M | |
![[SND]](/icons/sound2.gif) | JJ.mp3 | 2022-05-12 01:48 | 2.7M | |
![[SND]](/icons/sound2.gif) | bruno.mp3.mp3 | 2022-05-12 01:47 | 2.7M | |
![[SND]](/icons/sound2.gif) | juub.mp3.mp3 | 2022-05-12 01:47 | 3.9M | |
![[SND]](/icons/sound2.gif) | takkub.mp3.mp3 | 2022-05-12 01:40 | 3.4M | |
![[SND]](/icons/sound2.gif) | BCFL.mp3 | 2022-05-12 01:39 | 2.8M | |
![[SND]](/icons/sound2.gif) | ทักครับ - Lipta Feat. GUYGEEGEE ⟨ slowed + reverb ⟩.mp3 | 2022-05-12 01:39 | 3.4M | |
![[SND]](/icons/sound2.gif) | tomp3.cc - OneRepublic Counting Stars Lyrics.mp3 | 2022-05-12 01:38 | 4.9M | |
![[SND]](/icons/sound2.gif) | Stage Intro (Adventure) (online-audio-converter.com).mp3 | 2022-05-12 01:32 | 116K | |
![[SND]](/icons/sound2.gif) | nkt.mp3.mp3 | 2022-05-12 01:32 | 3.5M | |
![[SND]](/icons/sound2.gif) | Owen - ในคืนที่ feat.อภิชัย [ Official Video].mp3 | 2022-05-12 01:31 | 3.5M | |
![[SND]](/icons/sound2.gif) | for my bestie.mp3 | 2022-05-12 01:29 | 5.5M | |
![[SND]](/icons/sound2.gif) | Div2.mp3 | 2022-05-12 01:29 | 198K | |
![[SND]](/icons/sound2.gif) | Practice_Training (online-audio-converter.com).mp3 | 2022-05-12 01:23 | 9.1M | |
![[SND]](/icons/sound2.gif) | ura1.mp3 | 2022-05-12 01:21 | 0 | |
![[SND]](/icons/sound2.gif) | uraa.mp3 | 2022-05-12 01:16 | 0 | |
![[SND]](/icons/sound2.gif) | LOCCO - (Original Soundtrack).mp3 | 2022-05-12 01:16 | 2.3M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Gryffin - Tie Me Down (slowed+lyrics) ft. Elley Duhé (128 kbps) (1).mp3 | 2022-05-12 01:07 | 0 | |
![[SND]](/icons/sound2.gif) | AF5.mp3 | 2022-05-12 01:06 | 3.5M | |
![[SND]](/icons/sound2.gif) | Aa.mp3 | 2022-05-12 01:04 | 0 | |
![[SND]](/icons/sound2.gif) | keramat.mp3 | 2022-05-12 01:02 | 3.9M | |
![[SND]](/icons/sound2.gif) | DJ DANZA KUDURO SLOW TIKTOK TERBARU 2021 FULL BASS JEDAG JEDUG TIKTOK.mp3 | 2022-05-12 00:57 | 0 | |
![[SND]](/icons/sound2.gif) | Six.mp3 | 2022-05-12 00:57 | 0 | |
![[SND]](/icons/sound2.gif) | pt2.mp3 | 2022-05-12 00:52 | 0 | |
![[SND]](/icons/sound2.gif) | pt.mp3 | 2022-05-12 00:51 | 0 | |
![[SND]](/icons/sound2.gif) | Vp9.mp3 | 2022-05-12 00:42 | 1.5M | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Pac Man Wakka Wakka Sound For 1 Hour (64kbps).mp3 | 2022-05-12 00:39 | 0 | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Pac Man Wakka Wakka Sound For 1 Hour (128kbps)-[AudioTrimmer.com].mp3 | 2022-05-12 00:36 | 0 | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Pac Man Wakka Wakka Sound For 1 Hour (128kbps).mp3 | 2022-05-12 00:34 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Pac Man Wakka Wakka Sound For 1 Hour (128 kbps)-[AudioTrimmer.com].mp3 | 2022-05-12 00:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - UPIN IPIN LAGU SELAMAT ULANG TAHUN Happy Birthday Song.mp3 | 2022-05-12 00:17 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Pac Man Wakka Wakka Sound For 1 Hour (128 kbps).mp3 | 2022-05-12 00:16 | 7.1M | |
![[SND]](/icons/sound2.gif) | Hollywood Undead - CHAOS (Official Music Video).mp3 | 2022-05-12 00:14 | 2.8M | |
![[SND]](/icons/sound2.gif) | pelangi.mp3 | 2022-05-12 00:10 | 4.7M | |
![[SND]](/icons/sound2.gif) | Coldplay_-_Higher_Power.mp3 | 2022-05-12 00:10 | 0 | |
![[SND]](/icons/sound2.gif) | judi.mp3 | 2022-05-12 00:08 | 0 | |
![[SND]](/icons/sound2.gif) | madiunngawi.mp3 | 2022-05-12 00:07 | 0 | |
![[SND]](/icons/sound2.gif) | Dres2.mp3 | 2022-05-12 00:05 | 4.1M | |
![[SND]](/icons/sound2.gif) | aa.m4a | 2022-05-12 00:01 | 3.0M | |
![[VID]](/icons/movie.gif) | Fantasy_BardTavern_Music_Compilati_(getmp3.pro).mp4 | 2022-05-11 23:57 | 0 | |
![[VID]](/icons/movie.gif) | Pac_Man_Wakka_Wakka_Sound_For_1_Hou_(getmp3.pro).mp4 | 2022-05-11 23:54 | 0 | |
![[SND]](/icons/sound2.gif) | GurtKuli.mp3 | 2022-05-11 23:36 | 0 | |
![[SND]](/icons/sound2.gif) | Zx1.mp3 | 2022-05-11 23:36 | 0 | |
![[SND]](/icons/sound2.gif) | WitnessIntimedation.mp3 | 2022-05-11 23:21 | 0 | |
![[VID]](/icons/movie.gif) | X2Download.com-DJ RIP LOVE NYUNDA DZARIL FREAKOUT VIRAL TIK TOK TERBARU 2022!! SOUND ZERZSOFTBOY.mp4 | 2022-05-11 23:19 | 0 | |
![[VID]](/icons/movie.gif) | X2Download.com-Dj WYD Now X Maine Toh Dheere Se Slow Beat Viral Tiktok Terbaru 2022 Dj Komang Rimex.mp4 | 2022-05-11 23:19 | 42M | |
![[SND]](/icons/sound2.gif) | 11-mai-2022.mp3 | 2022-05-11 22:52 | 0 | |
![[SND]](/icons/sound2.gif) | 1621536760_Galibri_Mavik_-_Federiko_Fellini.mp3 | 2022-05-11 22:35 | 0 | |
![[SND]](/icons/sound2.gif) | SadRitz 2.mp3 | 2022-05-11 22:34 | 0 | |
![[SND]](/icons/sound2.gif) | Engelbert_Humperdinck_Charles_Blackwell_-_A_Man_Without_Love_48701815 (5).mp3 | 2022-05-11 22:32 | 0 | |
![[SND]](/icons/sound2.gif) | SadRitz.mp3 | 2022-05-11 22:32 | 0 | |
![[SND]](/icons/sound2.gif) | Engelbert-Humperdinck_-_A-Man-Without-Love_(mp3home.me).mp3 | 2022-05-11 22:30 | 0 | |
![[SND]](/icons/sound2.gif) | Night_Lovell_-_Dark_Light_72738188 (1).mp3 | 2022-05-11 22:29 | 0 | |
![[SND]](/icons/sound2.gif) | Engelbert_Humperdinck_Charles_Blackwell_-_A_Man_Without_Love_48701815 (7).mp3 | 2022-05-11 22:23 | 0 | |
![[SND]](/icons/sound2.gif) | Scarlet Begonias - Fire on the Mountain.mp3 | 2022-05-11 22:16 | 0 | |
![[SND]](/icons/sound2.gif) | Rev.mp3 | 2022-05-11 22:10 | 16K | |
![[SND]](/icons/sound2.gif) | Sting_-_Mad_About_You_1240.mp3 | 2022-05-11 22:10 | 0 | |
![[SND]](/icons/sound2.gif) | engelbert-humperdinck-06-a-man-without-love.mp3 | 2022-05-11 22:09 | 0 | |
![[SND]](/icons/sound2.gif) | Engelbert_Humperdinck_Charles_Blackwell_-_A_Man_Without_Love_48701815.mp3 | 2022-05-11 22:04 | 28K | |
![[SND]](/icons/sound2.gif) | en-ideal-bip-sesi-2-saniye.mp3 | 2022-05-11 21:57 | 0 | |
![[SND]](/icons/sound2.gif) | 1. Entry Song- Tare Gin Gin.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 9. Tomake Chai ami aro kase.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 11. Gotore Holud Lagaia.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 2. Yad Piya Ki.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 6. Aashona.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 10. Dhakaia Sharee.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 5. Goria Churana + Lungi Dance.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 8. Ambersaria + Chamma Chamma + Sammak Sallo.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 7. Akh Mare-Ye Ladki Akh Mare.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | 4. Muqqabela.mp3 | 2022-05-11 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | chicken.mp3 | 2022-05-11 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | DearRajez.mp3 | 2022-05-11 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | MYG.mp3 | 2022-05-11 21:17 | 0 | |
![[SND]](/icons/sound2.gif) | AM.mp3 | 2022-05-11 21:12 | 4.8M | |
![[SND]](/icons/sound2.gif) | gjne1_bk1_audio_01.mp3 | 2022-05-11 21:09 | 0 | |
![[SND]](/icons/sound2.gif) | Wii Sports Theme (Loud).mp3 | 2022-05-11 21:00 | 0 | |
![[SND]](/icons/sound2.gif) | mayot-killer-mp3.mp3 | 2022-05-11 20:58 | 0 | |
![[SND]](/icons/sound2.gif) | pop-smoke-ap.mp3 | 2022-05-11 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | Vip11.mp3 | 2022-05-11 20:42 | 0 | |
![[SND]](/icons/sound2.gif) | 66.mp3 | 2022-05-11 20:40 | 3.1M | |
![[SND]](/icons/sound2.gif) | A4.mp3 | 2022-05-11 20:40 | 3.3M | |
![[SND]](/icons/sound2.gif) | videoplayback (audio-extractor.net).mp3 | 2022-05-11 20:32 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (audio-extractor.net) (1).mp3 | 2022-05-11 20:27 | 0 | |
![[SND]](/icons/sound2.gif) | A3.mp3 | 2022-05-11 20:21 | 1.2M | |
![[SND]](/icons/sound2.gif) | Павел Воля - Барвиха (megasongs.me) (1).mp3 | 2022-05-11 20:18 | 0 | |
![[SND]](/icons/sound2.gif) | Павел Воля — Барвиха %28Daniel Onyx Moombahton Remix%29 %28www.lightaudio.ru%29 (1).mp3 | 2022-05-11 20:12 | 0 | |
![[SND]](/icons/sound2.gif) | always.mp3 | 2022-05-11 20:11 | 0 | |
![[SND]](/icons/sound2.gif) | Павел Воля - Барвиха (megasongs.me).mp3 | 2022-05-11 20:07 | 6.5M | |
![[SND]](/icons/sound2.gif) | In Essense (256 kbps).mp3 | 2022-05-11 20:03 | 0 | |
![[SND]](/icons/sound2.gif) | Lezginka_-_Original_72502070 (1).mp3 | 2022-05-11 19:59 | 0 | |
![[SND]](/icons/sound2.gif) | LetHerGo.mp3 | 2022-05-11 19:59 | 3.9M | |
![[SND]](/icons/sound2.gif) | TRAVMA_COLDAH_-_Vozrast_soglasiya_71767061.mp3 | 2022-05-11 19:59 | 0 | |
![[SND]](/icons/sound2.gif) | BLADEFEAR_-_In_Essence_73818854.mp3 | 2022-05-11 19:58 | 0 | |
![[SND]](/icons/sound2.gif) | phn4.mp3 | 2022-05-11 19:58 | 0 | |
![[SND]](/icons/sound2.gif) | Satu(2)(2).mp3 | 2022-05-11 19:55 | 0 | |
![[SND]](/icons/sound2.gif) | Children Yay! Sound Effect.mp3 | 2022-05-11 19:55 | 0 | |
![[SND]](/icons/sound2.gif) | dangdut.mp3 | 2022-05-11 19:53 | 2.5M | |
![[SND]](/icons/sound2.gif) | MIX.mp3 | 2022-05-11 19:47 | 2.6M | |
![[SND]](/icons/sound2.gif) | miyagi-feat.-andy-panda-utopia.mp3 | 2022-05-11 19:47 | 0 | |
![[SND]](/icons/sound2.gif) | ADELLA.mp3 | 2022-05-11 19:44 | 0 | |
![[SND]](/icons/sound2.gif) | Guf_Ajo_Aka_vot_vam_dva_kalpaka_CHtob_navernyaka_bolshe_kofe_menshe_moloka_JEto_Gufaka_menshe_valsa_bolshe_kalpaka_YA_vsjo_rezhe_po_muzeyam_i_vsjo_chashhe_-_Tem_kto_s_nami_68468120.mp3 | 2022-05-11 19:44 | 0 | |
![[SND]](/icons/sound2.gif) | Freddie_Dredd_Señorita_Feat_Clifford_Prod_Ryan_C_Неи.mp3 | 2022-05-11 19:43 | 0 | |
![[SND]](/icons/sound2.gif) | Sirp.mp3 | 2022-05-11 19:32 | 0 | |
![[SND]](/icons/sound2.gif) | rbou5tn.mp3 | 2022-05-11 19:28 | 0 | |
![[SND]](/icons/sound2.gif) | 10 Carcassona.mp3 | 2022-05-11 19:23 | 0 | |
![[SND]](/icons/sound2.gif) | 02 Aimeric.mp3 | 2022-05-11 19:23 | 0 | |
![[SND]](/icons/sound2.gif) | 1515401487_gazirovka-black-www_muzonov_net.mp3 | 2022-05-11 19:22 | 0 | |
![[SND]](/icons/sound2.gif) | Алекс Атаман, Finik.Finya - Диалоги тет а тет (MP3SUN.net).mp3 | 2022-05-11 19:19 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Lagu sedih pake gitar sedih _ LuLu Clips (320 kbps).mp3 | 2022-05-11 19:18 | 0 | |
![[SND]](/icons/sound2.gif) | FinikFinya_ALEKS_ATAMAN_-_Muzyka_igraet_gromko_(musmore.com).mp3 | 2022-05-11 19:18 | 0 | |
![[SND]](/icons/sound2.gif) | pd1.mp3 | 2022-05-11 19:13 | 1.1M | |
![[SND]](/icons/sound2.gif) | pd2.mp3 | 2022-05-11 19:13 | 2.9M | |
![[SND]](/icons/sound2.gif) | pd3.mp3 | 2022-05-11 19:12 | 1.9M | |
![[SND]](/icons/sound2.gif) | unnv-muza-mp3.mp3 | 2022-05-11 19:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | KiwKiw1.mp3 | 2022-05-11 19:08 | 208K | |
![[SND]](/icons/sound2.gif) | IOWA-как дельфины-мы уходим в плаванье-kissvk.com.mp3 | 2022-05-11 18:57 | 0 | |
![[SND]](/icons/sound2.gif) | Песня - Ой так нравится долбиться в задницу (Muzten.net) (1).mp3 | 2022-05-11 18:52 | 0 | |
![[SND]](/icons/sound2.gif) | a-cyplenok-pi-pi-piu-a-u-nas-zhivet-cyplenok_(mp3IQ.net).mp3 | 2022-05-11 18:47 | 0 | |
![[SND]](/icons/sound2.gif) | inbound3335927731061686278.mp3 | 2022-05-11 18:40 | 0 | |
![[SND]](/icons/sound2.gif) | В. Цой- Кино-Звезда по имени Солнце-kissvk.com.mp3 | 2022-05-11 18:37 | 0 | |
![[SND]](/icons/sound2.gif) | Sn.mp3 | 2022-05-11 18:14 | 55M | |
![[SND]](/icons/sound2.gif) | (DE)Bo Meditation.m4a | 2022-05-11 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | alone.mp3 | 2022-05-11 18:08 | 0 | |
![[SND]](/icons/sound2.gif) | Elley.mp3 | 2022-05-11 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | inbound8311044357666679113.mp3 | 2022-05-11 17:57 | 0 | |
![[SND]](/icons/sound2.gif) | Metallica feat. Земляне - Fade to иллюминатор.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Ebanko_-_18_Mne_Uzhe_9106.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Ebanko_-_CHudo-gashik_1049101.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Viktor_Cojj_-_Zakrojj_za_mnojj_dver_ya_ukhozhu_47828937.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | FNAF_Security_Breach_OST_-_Daycare_Theme_73602873.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Cojj_Viktor_-_Spokojjnaya_noch_484260.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | zapahlo-vesnoj-svoboda.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Buerak_-_Sportivnye_ochki_56989067.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Buerak_-_Kult_tela_64798632.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | rajonnyj-prokuror........-rajonnyj-prokuror.........mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | ебанько-частушки.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | ебанько-я-ебу-собак.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | UNNV_Marilyn_Manson_-_DROBA_Mjeshap_73786363.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | spokojnaya-noch.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | molchat-doma-sudno.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Seemee_Soda_Luv_Madagaskar_-_Lyublyu_bolshikh_73358179.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | tAtU_-_ya_soshla_s_uma_angl_66616941.mp3 | 2022-05-11 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | Neizvestnyjj_-_U_menya_net_problem_krome_moejj_bashki_73243128.mp3 | 2022-05-11 17:51 | 0 | |
![[SND]](/icons/sound2.gif) | rov999.mp3 | 2022-05-11 17:50 | 0 | |
![[SND]](/icons/sound2.gif) | oldmoney.mp3 | 2022-05-11 17:50 | 0 | |
![[SND]](/icons/sound2.gif) | mylane_-_This_Feeling_(musmore.com).mp3 | 2022-05-11 17:49 | 6.3M | |
![[SND]](/icons/sound2.gif) | Munimuni - Sa Hindi Pag-alala (Lyric Video).mp3 | 2022-05-11 17:49 | 0 | |
![[SND]](/icons/sound2.gif) | MLKO.mp3 | 2022-05-11 17:49 | 25M | |
![[SND]](/icons/sound2.gif) | ramjr1.mp3 | 2022-05-11 17:49 | 771K | |
![[SND]](/icons/sound2.gif) | ramjr1-1.mp3 | 2022-05-11 17:48 | 771K | |
![[SND]](/icons/sound2.gif) | D8.mp3 | 2022-05-11 17:46 | 3.5M | |
![[SND]](/icons/sound2.gif) | ramjr1 (1).mp3 | 2022-05-11 17:46 | 0 | |
![[SND]](/icons/sound2.gif) | dj ghost.mp3 | 2022-05-11 17:41 | 0 | |
![[SND]](/icons/sound2.gif) | 1_2 - FRAUDE - Amine Farsi Freeze Corleone (320).mp3 | 2022-05-11 17:40 | 0 | |
![[SND]](/icons/sound2.gif) | itonlyme.mp3 | 2022-05-11 17:40 | 0 | |
![[SND]](/icons/sound2.gif) | co-to-za-ptak-odglosy-ptakow-ptaki-polski.mp3 | 2022-05-11 17:38 | 5.9M | |
![[SND]](/icons/sound2.gif) | yo_voy_(tiktok_remix)_-_zion_&_lennox_ft._daddy_yankee_[edit_audio].mp3 | 2022-05-11 17:37 | 509K | |
![[SND]](/icons/sound2.gif) | YADDAY, Brany - 1000.mp3 | 2022-05-11 17:34 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Odgłosy ptaków. (128 kbps).mp3 | 2022-05-11 17:32 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Pierwiosnek (128 kbps) (1).mp3 | 2022-05-11 17:32 | 0 | |
![[SND]](/icons/sound2.gif) | rick-astley-never-gonna-give-you-up-official-music-video.mp3 | 2022-05-11 17:26 | 0 | |
![[SND]](/icons/sound2.gif) | mehboobah.mp3 | 2022-05-11 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | Unknown artist - streets x put your head on my shoulder remix 5809046531318753029.mp3 | 2022-05-11 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | Sahibahall.mp3 | 2022-05-11 17:23 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Zięba Śpiew - Śpiew Zięby - Zięba Odgłosy - Zięba ptak - tentilhão (128 kbps).mp3 | 2022-05-11 17:23 | 0 | |
![[SND]](/icons/sound2.gif) | shajip1.mp3 | 2022-05-11 17:21 | 752K | |
![[SND]](/icons/sound2.gif) | Shaji_Pappan_Intro_song_from__Aadu__-_Jayasurya,_Vijay_Babu,_Sandra_Thomas.mp3 | 2022-05-11 17:21 | 752K | |
![[SND]](/icons/sound2.gif) | iya.mp3 | 2022-05-11 17:20 | 2.1M | |
![[SND]](/icons/sound2.gif) | blue eye.mp3 | 2022-05-11 17:20 | 0 | |
![[SND]](/icons/sound2.gif) | vangamon.mp3 | 2022-05-11 17:19 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee3.mp3 | 2022-05-11 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | ambarsariya (slowed + reverb).mp3 | 2022-05-11 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee2.mp3 | 2022-05-11 17:15 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee1.mp3 | 2022-05-11 17:14 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee.mp3 | 2022-05-11 17:14 | 0 | |
![[SND]](/icons/sound2.gif) | ONE DANCE - DRAKE FT.WIZKID [AUDIO_EDIT]-64.mp3 | 2022-05-11 17:13 | 0 | |
![[SND]](/icons/sound2.gif) | Vip.mp3 | 2022-05-11 17:07 | 0 | |
![[SND]](/icons/sound2.gif) | dude2.mp3 | 2022-05-11 17:05 | 0 | |
![[SND]](/icons/sound2.gif) | dude11.mp3 | 2022-05-11 17:04 | 1.5M | |
![[SND]](/icons/sound2.gif) | shayad.mp3 | 2022-05-11 17:04 | 2.9M | |
![[SND]](/icons/sound2.gif) | Waltz Solo.mp3 | 2022-05-11 17:02 | 0 | |
![[SND]](/icons/sound2.gif) | presi.mp3 | 2022-05-11 17:00 | 640K | |
![[SND]](/icons/sound2.gif) | Naughty Boy, Sam Smith - La la la (Lyrics).mp3 | 2022-05-11 16:58 | 198K | |
![[SND]](/icons/sound2.gif) | 14.mp3 | 2022-05-11 16:57 | 2.4M | |
![[SND]](/icons/sound2.gif) | X2Download.com - Naughty Boy, Sam Smith - La la la (Lyrics) (64 kbps).mp3 | 2022-05-11 16:57 | 0 | |
![[SND]](/icons/sound2.gif) | Mista7.mp3 | 2022-05-11 16:56 | 0 | |
![[SND]](/icons/sound2.gif) | Mista6.mp3 | 2022-05-11 16:56 | 0 | |
![[SND]](/icons/sound2.gif) | Parov_Stelar_-_Catgroove_47960882-1.mp3 | 2022-05-11 16:52 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Shaji Pappan Intro By Pachoottan.mp3 | 2022-05-11 16:52 | 0 | |
![[SND]](/icons/sound2.gif) | b.mp3 | 2022-05-11 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | HAWKCRY - Godhand Champ Fivem ft.JUNGJI , HIGHJACK (Prod.by SINATO).mp3 | 2022-05-11 16:50 | 2.8M | |
![[SND]](/icons/sound2.gif) | Leni.mp3 | 2022-05-11 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | 1652287247163-voicemaker.in-speech.mp3 | 2022-05-11 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | dm.mp3 | 2022-05-11 16:47 | 1.8M | |
![[SND]](/icons/sound2.gif) | dkk.mp3 | 2022-05-11 16:46 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee8.mp3 | 2022-05-11 16:43 | 0 | |
![[SND]](/icons/sound2.gif) | Flow.mp3 | 2022-05-11 16:42 | 3.1M | |
![[SND]](/icons/sound2.gif) | djy.mp3 | 2022-05-11 16:40 | 5.1M | |
![[SND]](/icons/sound2.gif) | Lana_Del_Rey_-_Old_Money_(musmore.com).mp3 | 2022-05-11 16:39 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee7.mp3 | 2022-05-11 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee6.mp3 | 2022-05-11 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | vandalazsadboy.mp3 | 2022-05-11 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | ajeee4.mp3 | 2022-05-11 16:36 | 0 | |
![[SND]](/icons/sound2.gif) | PANDA.mp3 | 2022-05-11 16:36 | 0 | |
![[SND]](/icons/sound2.gif) | zka.mp3 | 2022-05-11 16:36 | 0 | |
![[SND]](/icons/sound2.gif) | Fallin.mp3 | 2022-05-11 16:34 | 0 | |
![[SND]](/icons/sound2.gif) | d.mp3 | 2022-05-11 16:31 | 116K | |
![[SND]](/icons/sound2.gif) | e.mp3 | 2022-05-11 16:31 | 2.4M | |
![[SND]](/icons/sound2.gif) | a.mp3 | 2022-05-11 16:31 | 3.2M | |
![[SND]](/icons/sound2.gif) | КАТАННЫЙ В 05 - КАТАННЫЙ.mp3 | 2022-05-11 16:30 | 0 | |
![[SND]](/icons/sound2.gif) | z.mp3 | 2022-05-11 16:30 | 1.3M | |
![[SND]](/icons/sound2.gif) | x.mp3 | 2022-05-11 16:29 | 1.8M | |
![[SND]](/icons/sound2.gif) | Vip10.mp3 | 2022-05-11 16:28 | 0 | |
![[SND]](/icons/sound2.gif) | FILE_20220511_185146_Thoại 008.mp3 | 2022-05-11 16:28 | 0 | |
![[SND]](/icons/sound2.gif) | i1.mp3 | 2022-05-11 16:27 | 0 | |
![[SND]](/icons/sound2.gif) | i2.mp3 | 2022-05-11 16:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Troye Sivan Angel Baby Lyrics.mp3 | 2022-05-11 16:26 | 3.3M | |
![[SND]](/icons/sound2.gif) | a-2.mp3 | 2022-05-11 16:24 | 0 | |
![[SND]](/icons/sound2.gif) | eta-babka-hagi-vagi-kyz9ka.mp3 | 2022-05-11 16:24 | 256K | |
![[SND]](/icons/sound2.gif) | Тайпан, Agunda - Луна не знает пути.mp3 | 2022-05-11 16:23 | 0 | |
![[SND]](/icons/sound2.gif) | T!NE - โง่ Ft.99.26% (Prod. nejdos)-T ! N E.mp3 | 2022-05-11 16:22 | 1.0M | |
![[SND]](/icons/sound2.gif) | e-2.mp3 | 2022-05-11 16:21 | 0 | |
![[SND]](/icons/sound2.gif) | e-1.mp3 | 2022-05-11 16:21 | 788K | |
![[SND]](/icons/sound2.gif) | e-3.mp3 | 2022-05-11 16:21 | 0 | |
![[SND]](/icons/sound2.gif) | Lil Nas X - Old Town Road (Official Video) ft. Billy Ray Cyrus.mp3 | 2022-05-11 16:21 | 0 | |
![[SND]](/icons/sound2.gif) | l3.mp3 | 2022-05-11 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | l2.mp3 | 2022-05-11 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | l4.mp3 | 2022-05-11 16:18 | 0 | |
![[SND]](/icons/sound2.gif) | Darkknight - JungJi (prod. ESKRY).mp3 | 2022-05-11 16:16 | 928K | |
![[SND]](/icons/sound2.gif) | ทักครับ - Lipta Feat. GUYGEEGEE [OFFICIAL MUSIC VIDEO].mp3 | 2022-05-11 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | dm1.mp3 | 2022-05-11 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | dm2.mp3 | 2022-05-11 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | dm3.mp3 | 2022-05-11 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | vp.mp3 | 2022-05-11 16:12 | 0 | |
![[SND]](/icons/sound2.gif) | Bbm.mp3 | 2022-05-11 16:07 | 0 | |
![[SND]](/icons/sound2.gif) | Vip9.mp3 | 2022-05-11 16:06 | 1.7M | |
![[SND]](/icons/sound2.gif) | alex.mp3 | 2022-05-11 16:03 | 0 | |
![[SND]](/icons/sound2.gif) | vandalazgalau.mp3 | 2022-05-11 16:02 | 0 | |
![[SND]](/icons/sound2.gif) | Arcade7.mp3 | 2022-05-11 16:02 | 0 | |
![[SND]](/icons/sound2.gif) | OsuMarathon.mp3 | 2022-05-11 15:58 | 0 | |
![[SND]](/icons/sound2.gif) | Ex.mp3 | 2022-05-11 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | FILE_20220511_185146_Thoại 008.m4a | 2022-05-11 15:54 | 0 | |
![[VID]](/icons/movie.gif) | musicc.mp4 | 2022-05-11 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | Anugrah.mp3 | 2022-05-11 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | Asede.mp3 | 2022-05-11 15:49 | 2.2M | |
![[SND]](/icons/sound2.gif) | Cbl.mp3 | 2022-05-11 15:49 | 1.2M | |
![[SND]](/icons/sound2.gif) | Trickster1.mp3 | 2022-05-11 15:48 | 0 | |
![[SND]](/icons/sound2.gif) | zxkty2022.mp3 | 2022-05-11 15:46 | 0 | |
![[SND]](/icons/sound2.gif) | Arcade6.mp3 | 2022-05-11 15:45 | 0 | |
![[SND]](/icons/sound2.gif) | Tulus.mp3 | 2022-05-11 15:44 | 4.1M | |
![[SND]](/icons/sound2.gif) | kiw1.mp3 | 2022-05-11 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | Ronaldo SIUU Earrape Sound Effect.mp3 | 2022-05-11 15:37 | 0 | |
![[SND]](/icons/sound2.gif) | gorani.mp3 | 2022-05-11 15:34 | 0 | |
![[SND]](/icons/sound2.gif) | aomie.mp3 | 2022-05-11 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | kurd1.mp3 | 2022-05-11 15:30 | 0 | |
![[SND]](/icons/sound2.gif) | дудон-не-знает-что-сказать-бедолага.mp3 | 2022-05-11 15:26 | 0 | |
![[SND]](/icons/sound2.gif) | kurd.mp3 | 2022-05-11 15:25 | 0 | |
![[SND]](/icons/sound2.gif) | BAND4.mp3 | 2022-05-11 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | BAND1.mp3 | 2022-05-11 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | BAND3.mp3 | 2022-05-11 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | BAND2.mp3 | 2022-05-11 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | дудон не знает что сказать бедолага.m4a | 2022-05-11 15:24 | 0 | |
![[SND]](/icons/sound2.gif) | The-Beginning-w-Caturday.mp3 | 2022-05-11 15:23 | 0 | |
![[SND]](/icons/sound2.gif) | kel2.mp3 | 2022-05-11 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | vv.mp3 | 2022-05-11 15:20 | 3.1M | |
![[SND]](/icons/sound2.gif) | candrasad.mp3 | 2022-05-11 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | hsjsjsjsjshhs.mp3 | 2022-05-11 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | ZKA1.mp3 | 2022-05-11 15:15 | 0 | |
![[SND]](/icons/sound2.gif) | 6.mp3 | 2022-05-11 15:15 | 2.7M | |
![[SND]](/icons/sound2.gif) | 1M.mp3 | 2022-05-11 15:14 | 0 | |
![[SND]](/icons/sound2.gif) | No one is alone edit.mp3 | 2022-05-11 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | kurdmkurdm.mp3 | 2022-05-11 15:12 | 0 | |
![[SND]](/icons/sound2.gif) | 1MILL - FIRST DAY OUT SCHOOL FT. DIAMOND (OFFICIAL MV).mp3 | 2022-05-11 15:11 | 0 | |
![[SND]](/icons/sound2.gif) | Zero5.mp3 | 2022-05-11 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Zero4.mp3 | 2022-05-11 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Zero6.mp3 | 2022-05-11 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | Kaleo - Way Down We Go.mp3 | 2022-05-11 15:09 | 8.4M | |
![[SND]](/icons/sound2.gif) | 5.mp3 | 2022-05-11 15:08 | 428K | |
![[SND]](/icons/sound2.gif) | Zero2.mp3 | 2022-05-11 15:08 | 0 | |
![[SND]](/icons/sound2.gif) | antop.mp3 | 2022-05-11 15:07 | 0 | |
![[SND]](/icons/sound2.gif) | machenski-ulkender-tam-tau-adam-ochooou-olzhas-abaj.mp3 | 2022-05-11 15:06 | 0 | |
![[SND]](/icons/sound2.gif) | YT.mp3 | 2022-05-11 15:06 | 2.8M | |
![[SND]](/icons/sound2.gif) | alvarezsad1.mp3 | 2022-05-11 15:06 | 0 | |
![[SND]](/icons/sound2.gif) | TLB.mp3 | 2022-05-11 15:06 | 0 | |
![[SND]](/icons/sound2.gif) | YAAAA.mp3 | 2022-05-11 15:05 | 0 | |
![[SND]](/icons/sound2.gif) | Shean(1).mp3 | 2022-05-11 15:04 | 0 | |
![[SND]](/icons/sound2.gif) | 4.mp3 | 2022-05-11 15:04 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Quando Quando Quando with Nelly Furtado.mp3 | 2022-05-11 15:03 | 0 | |
![[SND]](/icons/sound2.gif) | KERT.mp3 | 2022-05-11 15:03 | 0 | |
![[SND]](/icons/sound2.gif) | bae.mp3 | 2022-05-11 15:01 | 0 | |
![[SND]](/icons/sound2.gif) | Ayub Ali & Gare Sazkar - Kurdim.mp3 | 2022-05-11 14:59 | 2.8M | |
![[SND]](/icons/sound2.gif) | SCIRENA - Конспект.mp3 | 2022-05-11 14:55 | 1.5M | |
![[SND]](/icons/sound2.gif) | vip3.mp3 | 2022-05-11 14:55 | 2.2M | |
![[SND]](/icons/sound2.gif) | HMAWL11.mp3 | 2022-05-11 14:55 | 0 | |
![[SND]](/icons/sound2.gif) | vip2.mp3 | 2022-05-11 14:54 | 917K | |
![[SND]](/icons/sound2.gif) | vip1.mp3 | 2022-05-11 14:54 | 2.2M | |
![[SND]](/icons/sound2.gif) | alger1.mp3 | 2022-05-11 14:53 | 0 | |
![[VID]](/icons/movie.gif) | 497f8b500402e1f757bc18d220b0310f.mp4 | 2022-05-11 14:53 | 0 | |
![[SND]](/icons/sound2.gif) | alger4.mp3 | 2022-05-11 14:53 | 0 | |
![[SND]](/icons/sound2.gif) | alger2.mp3 | 2022-05-11 14:52 | 0 | |
![[SND]](/icons/sound2.gif) | alger3.mp3 | 2022-05-11 14:52 | 0 | |
![[SND]](/icons/sound2.gif) | Maher Zain Baraka Allahu Lakuma ماهر زين.mp3 | 2022-05-11 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | ps11.mp3 | 2022-05-11 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | ps10.mp3 | 2022-05-11 14:50 | 0 | |
![[SND]](/icons/sound2.gif) | Matre_Gims_Sia_-_Je_te_pardonne_48245965.mp3 | 2022-05-11 14:50 | 0 | |
![[SND]](/icons/sound2.gif) | ps9.mp3 | 2022-05-11 14:50 | 0 | |
![[SND]](/icons/sound2.gif) | DJ-PARTY-TEHIBA-KELUD-TEAM-OFFICIAL-BASS-NENDANG-NENDANG_QUTnQ8ZSgHQ.mp3 | 2022-05-11 14:47 | 0 | |
![[SND]](/icons/sound2.gif) | hw123.mp3 | 2022-05-11 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | RIO-FEBRIAN-Maafkan_ZFXs940frmI (1).mp3 | 2022-05-11 14:42 | 0 | |
![[SND]](/icons/sound2.gif) | madiun.mp3 | 2022-05-11 14:40 | 4.0M | |
![[SND]](/icons/sound2.gif) | heaty.mp3 | 2022-05-11 14:40 | 0 | |
![[SND]](/icons/sound2.gif) | Phuh1.mp3 | 2022-05-11 14:39 | 0 | |
![[SND]](/icons/sound2.gif) | Wheels on the Bus CoComelon Nursery Rhymes Kids Songs.mp3 | 2022-05-11 14:39 | 0 | |
![[SND]](/icons/sound2.gif) | D_La_Crem_feat_Rvfv_Chiki_El_De_La_Vaina_-_XOXO_73659059.mp3 | 2022-05-11 14:37 | 0 | |
![[SND]](/icons/sound2.gif) | heatwave.mp3 | 2022-05-11 14:37 | 0 | |
![[SND]](/icons/sound2.gif) | Vocaroo 159xOccbQ2iD_1_1.mp3 | 2022-05-11 14:35 | 0 | |
![[SND]](/icons/sound2.gif) | file_1602770908140.mp3 | 2022-05-11 14:35 | 0 | |
![[SND]](/icons/sound2.gif) | Kambulat - Атомы.mp3 | 2022-05-11 14:34 | 0 | |
![[SND]](/icons/sound2.gif) | gahw.mp3 | 2022-05-11 14:34 | 0 | |
![[SND]](/icons/sound2.gif) | ii.mp3 | 2022-05-11 14:30 | 2.1M | |
![[SND]](/icons/sound2.gif) | Carnival Row Opening Credits (online-audio-converter.com).mp3 | 2022-05-11 14:30 | 1.2M | |
![[SND]](/icons/sound2.gif) | file_1602766250587.mp3 | 2022-05-11 14:30 | 0 | |
![[SND]](/icons/sound2.gif) | lowkey - NIKI.m4a | 2022-05-11 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | Arcade Game Music (from Go Go Space Monkey).mp3 | 2022-05-11 14:24 | 0 | |
![[SND]](/icons/sound2.gif) | Bocil Kematian.mp3 | 2022-05-11 14:23 | 0 | |
![[SND]](/icons/sound2.gif) | Голосовое сообщение.mp3.mp3 | 2022-05-11 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | Someone will love you better.mp3 | 2022-05-11 14:17 | 0 | |
![[SND]](/icons/sound2.gif) | Heat Waves - Slowed Reverb ! English Song.mp3 | 2022-05-11 14:07 | 253K | |
![[SND]](/icons/sound2.gif) | GLOC 9.m4a | 2022-05-11 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (1).m4a | 2022-05-11 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | 2.m4a | 2022-05-11 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | Seri10.mp3 | 2022-05-11 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | ANDREW E.m4a | 2022-05-11 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | Seri8.mp3 | 2022-05-11 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | 1.m4a | 2022-05-11 14:02 | 952K | |
![[SND]](/icons/sound2.gif) | Seri9.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri7.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri6.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri5.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri4.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri3.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri1.mp3 | 2022-05-11 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | Seri2.mp3 | 2022-05-11 14:02 | 2.5M | |
![[VID]](/icons/movie.gif) | romano3.mp4 | 2022-05-11 14:01 | 410K | |
![[SND]](/icons/sound2.gif) | UMM.mp3 | 2022-05-11 14:01 | 2.6M | |
![[VID]](/icons/movie.gif) | romano2.mp4 | 2022-05-11 14:01 | 0 | |
![[VID]](/icons/movie.gif) | romano1.mp4 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio9.mp3 | 2022-05-11 14:01 | 0 | |
![[VID]](/icons/movie.gif) | romano.mp4 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio11.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio12.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio10.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio5.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio6.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio8.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio7.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio4.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio2.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio3.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | akio1.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | ic.mp3 | 2022-05-11 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | laskx3i_nenavizu_(muzebra.net).mp3 | 2022-05-11 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | Heat Waves Mixed.mp3 | 2022-05-11 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | panuan.mp3 | 2022-05-11 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | Maher Zain - For The Rest Of My Life _ Official Music Video.mp3 | 2022-05-11 13:58 | 0 | |
![[SND]](/icons/sound2.gif) | cthi_censored.mp3 | 2022-05-11 13:57 | 0 | |
![[SND]](/icons/sound2.gif) | untitled.mp3 | 2022-05-11 13:56 | 4.8M | |
![[VID]](/icons/movie.gif) | efa6c5a2161d4eef4b444806ac1a4c8c.mp4 | 2022-05-11 13:55 | 0 | |
![[SND]](/icons/sound2.gif) | DJ9.mp3 | 2022-05-11 13:54 | 5.1M | |
![[SND]](/icons/sound2.gif) | gg.mp3 | 2022-05-11 13:53 | 0 | |
![[SND]](/icons/sound2.gif) | alot21.mp3 | 2022-05-11 13:53 | 0 | |
![[SND]](/icons/sound2.gif) | badut.mp3 | 2022-05-11 13:50 | 5.2M | |
![[SND]](/icons/sound2.gif) | lonely.mp3 | 2022-05-11 13:49 | 2.3M | |
![[SND]](/icons/sound2.gif) | litteldontknow.mp3 | 2022-05-11 13:49 | 0 | |
![[SND]](/icons/sound2.gif) | sieupham3in1.mp3 | 2022-05-11 13:49 | 0 | |
![[SND]](/icons/sound2.gif) | Ebanko_-_YA_ebu_sobak_67242899.mp3 | 2022-05-11 13:48 | 0 | |
![[SND]](/icons/sound2.gif) | FISHER.mp3 | 2022-05-11 13:48 | 0 | |
![[SND]](/icons/sound2.gif) | Ebanko_-_YA_ebu_sobak_672.mp3 | 2022-05-11 13:47 | 0 | |
![[SND]](/icons/sound2.gif) | FISHER vs TUJAMO vs 50 CENT - Who Losing It Candy (Rich-Mond Edit).mp3 | 2022-05-11 13:46 | 8.8M | |
![[SND]](/icons/sound2.gif) | song-greenfoot.mp3 | 2022-05-11 13:44 | 3.9M | |
![[SND]](/icons/sound2.gif) | neno.mp3 | 2022-05-11 13:42 | 4.1M | |
![[SND]](/icons/sound2.gif) | MN.mp3 | 2022-05-11 13:40 | 3.1M | |
![[SND]](/icons/sound2.gif) | LQ.mp3 | 2022-05-11 13:40 | 3.8M | |
![[SND]](/icons/sound2.gif) | GH.mp3 | 2022-05-11 13:39 | 3.3M | |
![[SND]](/icons/sound2.gif) | BV.mp3 | 2022-05-11 13:38 | 2.9M | |
![[SND]](/icons/sound2.gif) | ssstiktok_1652275698545 (1).mp3 | 2022-05-11 13:38 | 469K | |
![[SND]](/icons/sound2.gif) | Sabilulungan.mp3 | 2022-05-11 13:36 | 2.4M | |
![[SND]](/icons/sound2.gif) | ssstiktok_1652275698545.mp3 | 2022-05-11 13:31 | 0 | |
![[SND]](/icons/sound2.gif) | Talo.mp3 | 2022-05-11 13:21 | 0 | |
![[SND]](/icons/sound2.gif) | Sweet Fourtheen.mp3 | 2022-05-11 13:21 | 0 | |
![[SND]](/icons/sound2.gif) | Tahan na.mp3 | 2022-05-11 13:21 | 0 | |
![[SND]](/icons/sound2.gif) | Stronghold Soundtrack - Castlejam.mp3 | 2022-05-11 13:18 | 0 | |
![[SND]](/icons/sound2.gif) | monster10.mp3 | 2022-05-11 13:14 | 0 | |
![[SND]](/icons/sound2.gif) | ultah.m4a | 2022-05-11 13:11 | 2.7M | |
![[SND]](/icons/sound2.gif) | SSSSS.mp3 | 2022-05-11 13:11 | 239K | |
![[SND]](/icons/sound2.gif) | SSS.mp3 | 2022-05-11 13:10 | 0 | |
![[SND]](/icons/sound2.gif) | PharaoH - Мой кайф.mp3 | 2022-05-11 13:10 | 0 | |
![[SND]](/icons/sound2.gif) | 960002_CadillacMelody-remix (1).mp3 | 2022-05-11 13:07 | 0 | |
![[SND]](/icons/sound2.gif) | 960002_CadillacMelody-remix.mp3 | 2022-05-11 13:06 | 0 | |
![[SND]](/icons/sound2.gif) | Enyindiya uzoma OGWUGWO M OBI. wapcodenaija (1).mp3 | 2022-05-11 13:06 | 0 | |
![[SND]](/icons/sound2.gif) | 1573251662_pharaoh_vyrodok.mp3 | 2022-05-11 13:04 | 0 | |
![[SND]](/icons/sound2.gif) | ถูกที่ ผิดเวลา - Hobbit Cover by Sumlee Whatcity.mp3 | 2022-05-11 13:02 | 0 | |
![[SND]](/icons/sound2.gif) | 2NE1 - LONELY M-V.mp3 | 2022-05-11 13:00 | 0 | |
![[SND]](/icons/sound2.gif) | TørnQuiz Bar Runde 2 - Musikkquiz.mp3 | 2022-05-11 12:59 | 0 | |
![[SND]](/icons/sound2.gif) | ฝากติดตามเพจนำเด้อออ ( รายละเอียดใต้คลิป ).mp3 | 2022-05-11 12:59 | 0 | |
![[SND]](/icons/sound2.gif) | eodslofi.mp3 | 2022-05-11 12:59 | 0 | |
![[SND]](/icons/sound2.gif) | ATIN.mp3 | 2022-05-11 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | Design-_1.mp3 | 2022-05-11 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | BLADEFEAR - In Essense_(MP3Ball.ru).mp3 | 2022-05-11 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | BLADEFEAR - IN ESSENCE (256 kbps).mp3 | 2022-05-11 12:46 | 0 | |
![[SND]](/icons/sound2.gif) | Kawaii.mp3 | 2022-05-11 12:41 | 1.6M | |
![[SND]](/icons/sound2.gif) | BLADEFEAR — IN ESSENSE (www.lightaudio.ru).mp3 | 2022-05-11 12:40 | 0 | |
![[SND]](/icons/sound2.gif) | blvck-ft-sanfara-7oumti-homty-official-music-video.mp3 | 2022-05-11 12:39 | 0 | |
![[SND]](/icons/sound2.gif) | kgfm.mp3 | 2022-05-11 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | My Movie_0.mp3 | 2022-05-11 12:36 | 0 | |
![[SND]](/icons/sound2.gif) | 31223.mp3 | 2022-05-11 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | bolerovina.mp3 | 2022-05-11 12:32 | 0 | |
![[SND]](/icons/sound2.gif) | [33,35,37Hz]Crystal Castles - Transgender [Low Bass By OnRea.mp3 | 2022-05-11 12:31 | 0 | |
![[SND]](/icons/sound2.gif) | KGF.mp3 | 2022-05-11 12:29 | 3.3M | |
![[SND]](/icons/sound2.gif) | ajas12.mp3 | 2022-05-11 12:29 | 1.0M | |
![[SND]](/icons/sound2.gif) | 19 - Town.mp3 | 2022-05-11 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | memories.mp3 | 2022-05-11 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | hk.mp3 | 2022-05-11 12:24 | 0 | |
![[SND]](/icons/sound2.gif) | ajas11.mp3 | 2022-05-11 12:23 | 2.1M | |
![[SND]](/icons/sound2.gif) | Selamat Ulang Tahun - Jamrud_1652271468_musicaldown.com.mp3 | 2022-05-11 12:23 | 2.8M | |
![[SND]](/icons/sound2.gif) | gta1.mp3 | 2022-05-11 12:18 | 3.2M | |
![[SND]](/icons/sound2.gif) | kuylahgas.mp3 | 2022-05-11 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | THAI1.mp3 | 2022-05-11 12:11 | 0 | |
![[SND]](/icons/sound2.gif) | nyanyikuy.mp3 | 2022-05-11 12:07 | 0 | |
![[SND]](/icons/sound2.gif) | Sheva.mp3 | 2022-05-11 12:07 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - #กำลังฮิดในTikTok ( SANFONA )โกรามี V.เเดนช์สายย่อ2021 DJ KI REMIX2 (128 kbps).mp3 | 2022-05-11 12:03 | 564K | |
![[SND]](/icons/sound2.gif) | ak2.mp3 | 2022-05-11 12:02 | 2.5M | |
![[SND]](/icons/sound2.gif) | MeRu.mp3 | 2022-05-11 11:57 | 1.5M | |
![[SND]](/icons/sound2.gif) | ak1.mp3 | 2022-05-11 11:55 | 2.9M | |
![[SND]](/icons/sound2.gif) | WII.mp3 | 2022-05-11 11:55 | 0 | |
![[SND]](/icons/sound2.gif) | thaai.mp3.mp3 | 2022-05-11 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | Sea24.mp3 | 2022-05-11 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | RiceGum - Sucky Sucky (Love Me Long Time) [Official FULL Music Video].mp3 | 2022-05-11 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | Jogja.mp3 | 2022-05-11 11:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | KananKiri.mp3 | 2022-05-11 11:52 | 0 | |
![[SND]](/icons/sound2.gif) | Multikejjs_-_O_tojj_vesne_53846450.mp3 | 2022-05-11 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | thaai.mp3 | 2022-05-11 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | Sovetskie_voennye_pesni_-_Svyashhennaya_Vojjna_34886906.mp3 | 2022-05-11 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | RoyJones.mp3 | 2022-05-11 11:49 | 0 | |
![[SND]](/icons/sound2.gif) | PartyFavor.mp3 | 2022-05-11 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | ghostemane-mercury-mp3.mp3 | 2022-05-11 11:47 | 4.8M | |
![[SND]](/icons/sound2.gif) | Roy Jones - Can`t be touch - (Bassboosted by JuK).mp3 | 2022-05-11 11:47 | 0 | |
![[SND]](/icons/sound2.gif) | VP11.mp3 | 2022-05-11 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | jLa1.mp3 | 2022-05-11 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | Gayle.mp3 | 2022-05-11 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | JIN-prat.mp3 | 2022-05-11 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | Skus.mp3 | 2022-05-11 11:44 | 3.9M | |
![[SND]](/icons/sound2.gif) | Rama4.mp3 | 2022-05-11 11:42 | 0 | |
![[SND]](/icons/sound2.gif) | supernatural.mp3 | 2022-05-11 11:42 | 152K | |
![[SND]](/icons/sound2.gif) | phai chia tay thoi.mp3 | 2022-05-11 11:41 | 4.0M | |
![[SND]](/icons/sound2.gif) | Los_Retros_-_Someone_To_Spend_Time_With.mp3 | 2022-05-11 11:40 | 0 | |
![[SND]](/icons/sound2.gif) | fyo.mp3 | 2022-05-11 11:38 | 0 | |
![[SND]](/icons/sound2.gif) | Landtagswahl (DJ Cannabis Coffeeshops Deutschland).mp3 | 2022-05-11 11:36 | 1.7M | |
![[SND]](/icons/sound2.gif) | santuy.mp3 | 2022-05-11 11:28 | 4.6M | |
![[SND]](/icons/sound2.gif) | SiaDJ.mp3 | 2022-05-11 11:27 | 0 | |
![[SND]](/icons/sound2.gif) | asekk.mp3 | 2022-05-11 11:27 | 0 | |
![[SND]](/icons/sound2.gif) | Feels.mp3 | 2022-05-11 11:27 | 0 | |
![[SND]](/icons/sound2.gif) | Liwanag.mp3 | 2022-05-11 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | MusicTrapLife.mp3 | 2022-05-11 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | bensound-creativeminds.mp3 | 2022-05-11 11:20 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - DJ REGGAE SLOW SANTAI TERBARU 2022 FULL BASS VIRAL TIKTOK ( 69PROJECT X GEMPAR MUSIC ) (128 kbps).mp3 | 2022-05-11 11:19 | 3.2M | |
![[SND]](/icons/sound2.gif) | Jroa.mp3 | 2022-05-11 11:19 | 6.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIA SIA KU BERJUANG MERANTAU DI NEGERI ORANG REMIX VIRAL TIKTOK TERBARU 2021 SIA SIA BERJUANG.mp3 | 2022-05-11 11:18 | 0 | |
![[SND]](/icons/sound2.gif) | ALOKI_szkic1.mp3 | 2022-05-11 11:16 | 340K | |
![[SND]](/icons/sound2.gif) | A.L.A - Piano (feat. Didine Canon 16).mp3 | 2022-05-11 11:15 | 3.0M | |
![[SND]](/icons/sound2.gif) | เพลงตื้ดๆ 2021!!! เปิดในผับ 2021!! แดนซ์ สายย่อ เบสแน่นๆ 2021 !! EDM 2021 !!!.mp3 | 2022-05-11 11:14 | 920K | |
![[SND]](/icons/sound2.gif) | Vk.mp3 | 2022-05-11 11:13 | 3.8M | |
![[SND]](/icons/sound2.gif) | traplife.mp3 | 2022-05-11 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | alib_-_val_s_muzati.net.mp3 | 2022-05-11 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | whole.mp3 | 2022-05-11 11:09 | 964K | |
![[SND]](/icons/sound2.gif) | ttm.mp3 | 2022-05-11 11:08 | 3.6M | |
![[SND]](/icons/sound2.gif) | takkan.mp3 | 2022-05-11 11:08 | 0 | |
![[SND]](/icons/sound2.gif) | salah.mp3 | 2022-05-11 11:08 | 0 | |
![[SND]](/icons/sound2.gif) | milik sp.mp3 | 2022-05-11 11:08 | 0 | |
![[SND]](/icons/sound2.gif) | nabila.mp3 | 2022-05-11 11:07 | 2.6M | |
![[SND]](/icons/sound2.gif) | arti cinta.mp3 | 2022-05-11 11:06 | 0 | |
![[SND]](/icons/sound2.gif) | dancin.mp3 | 2022-05-11 11:05 | 3.4M | |
![[SND]](/icons/sound2.gif) | apa kabar.mp3 | 2022-05-11 11:05 | 0 | |
![[SND]](/icons/sound2.gif) | rickym.mp3 | 2022-05-11 11:03 | 892K | |
![[SND]](/icons/sound2.gif) | ga3satatbnatl97ab.mp3 | 2022-05-11 11:02 | 0 | |
![[SND]](/icons/sound2.gif) | alliwant.mp3 | 2022-05-11 11:01 | 0 | |
![[SND]](/icons/sound2.gif) | london.mp3 | 2022-05-11 10:59 | 3.0M | |
![[SND]](/icons/sound2.gif) | mornings-swoop-main-version-02-03-12897.mp3 | 2022-05-11 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | Cosa2.mp3 | 2022-05-11 10:50 | 0 | |
![[SND]](/icons/sound2.gif) | gina.mp3 | 2022-05-11 10:50 | 0 | |
![[SND]](/icons/sound2.gif) | DAN1.mp3 | 2022-05-11 10:50 | 0 | |
![[SND]](/icons/sound2.gif) | Cosa1.mp3 | 2022-05-11 10:47 | 0 | |
![[SND]](/icons/sound2.gif) | Next.mp3 | 2022-05-11 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | hmawl1.mp3 | 2022-05-11 10:45 | 0 | |
![[SND]](/icons/sound2.gif) | MixTape 17-1 mxd by V.mp3 | 2022-05-11 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | MT21 Part 1 Continuous Mix by V (2021).mp3 | 2022-05-11 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | MT 2020-1 Compiled And Mxd by V.mp3 | 2022-05-11 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | MT21 Part 2 Continuous Mix by V (2021).mp3 | 2022-05-11 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | MT22 Continuous Mix by V (2022).mp3 | 2022-05-11 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | larx1.mp3 | 2022-05-11 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | HOUSE by V Pt.2 (2021).mp3 | 2022-05-11 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | HOUSE by V Pt.1 (2021).mp3 | 2022-05-11 10:40 | 0 | |
![[SND]](/icons/sound2.gif) | I.P.R. 3 mxd by V.mp3 | 2022-05-11 10:40 | 0 | |
![[SND]](/icons/sound2.gif) | I.P.R. 4 Compiled And Mixed by V.mp3 | 2022-05-11 10:40 | 0 | |
![[SND]](/icons/sound2.gif) | IPR5 Continuous Mix by V (2021).mp3 | 2022-05-11 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | IPR6 Continuous Mix by V (2021).mp3 | 2022-05-11 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | IPR7 Continuous Mix by V (2022).mp3 | 2022-05-11 10:38 | 0 | |
![[SND]](/icons/sound2.gif) | IPR8 Continuous Mix by V (2022).mp3 | 2022-05-11 10:38 | 0 | |
![[SND]](/icons/sound2.gif) | HMAWL2.mp3 | 2022-05-11 10:36 | 0 | |
![[SND]](/icons/sound2.gif) | Cosa.mp3 | 2022-05-11 10:35 | 0 | |
![[SND]](/icons/sound2.gif) | wyw.mp3 | 2022-05-11 10:34 | 0 | |
![[SND]](/icons/sound2.gif) | cereza.mp3 | 2022-05-11 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | play.mp3 | 2022-05-11 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | cereza.m4a | 2022-05-11 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | kadina.mp3 | 2022-05-11 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | manado.mp3 | 2022-05-11 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | Sub Urban - Cradles.mp3 | 2022-05-11 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | maladyosa.mp3 | 2022-05-11 10:24 | 0 | |
![[SND]](/icons/sound2.gif) | 01.mp3 | 2022-05-11 10:23 | 0 | |
![[SND]](/icons/sound2.gif) | kow.mp3 | 2022-05-11 10:22 | 700K | |
![[SND]](/icons/sound2.gif) | Lagu9.mp3 | 2022-05-11 10:21 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu10.mp3 | 2022-05-11 10:21 | 0 | |
![[SND]](/icons/sound2.gif) | SDM.mp3 | 2022-05-11 10:20 | 3.5M | |
![[SND]](/icons/sound2.gif) | รวมเพลงแดนซ์ แก๊งใน FiveM.mp3 | 2022-05-11 10:18 | 0 | |
![[SND]](/icons/sound2.gif) | Ronin.mp3 | 2022-05-11 10:16 | 592K | |
![[SND]](/icons/sound2.gif) | Azriel.mp3 | 2022-05-11 10:13 | 939K | |
![[SND]](/icons/sound2.gif) | kontol memek anjing.mp3 | 2022-05-11 10:05 | 0 | |
![[SND]](/icons/sound2.gif) | dj0.1.mp3 | 2022-05-11 10:04 | 0 | |
![[SND]](/icons/sound2.gif) | Vass3.mp3 | 2022-05-11 10:04 | 0 | |
![[SND]](/icons/sound2.gif) | pr.mp3 | 2022-05-11 10:00 | 1.1M | |
![[SND]](/icons/sound2.gif) | Bohemian.mp3 | 2022-05-11 09:58 | 0 | |
![[SND]](/icons/sound2.gif) | pan2.mp3 | 2022-05-11 09:54 | 0 | |
![[SND]](/icons/sound2.gif) | mark.mp3 | 2022-05-11 09:51 | 3.3M | |
![[SND]](/icons/sound2.gif) | kp.mp3 | 2022-05-11 09:50 | 1.0M | |
![[SND]](/icons/sound2.gif) | TRICKSTER1.mp3 | 2022-05-11 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | OVER - TANTHAM x ATSNEE x DOH (Official MV).mp3 | 2022-05-11 09:49 | 5.1M | |
![[VID]](/icons/movie.gif) | burik.mp4 | 2022-05-11 09:47 | 0 | |
![[SND]](/icons/sound2.gif) | แจกลิ้งเอฟเฟคalight motion 5mb เพลงไทย 🔥🎶 (online-audio-converter.com).mp3 | 2022-05-11 09:46 | 0 | |
![[SND]](/icons/sound2.gif) | MARKIPAT.mp3 | 2022-05-11 09:45 | 0 | |
![[SND]](/icons/sound2.gif) | Nadya Fatira - Bila (official audio video).m4a | 2022-05-11 09:44 | 0 | |
![[SND]](/icons/sound2.gif) | Aku Masih Disini.m4a | 2022-05-11 09:41 | 180K | |
![[SND]](/icons/sound2.gif) | เจิ๊ดเอยเจิ๊ด เเดนซ์ กันตรึม เบสหนักๆ ( กำลังฮิตในTiktok ) 2022 DJ GEZ MUSIC.mp3 | 2022-05-11 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | cc1.mp3 | 2022-05-11 09:40 | 1.0M | |
![[SND]](/icons/sound2.gif) | KGF_JUKEBOX.mp3 | 2022-05-11 09:40 | 0 | |
![[SND]](/icons/sound2.gif) | Bila.m4a | 2022-05-11 09:40 | 876K | |
![[VID]](/icons/movie.gif) | Soa1.mp4 | 2022-05-11 09:38 | 0 | |
![[VID]](/icons/movie.gif) | Soa3.mp4 | 2022-05-11 09:38 | 0 | |
![[VID]](/icons/movie.gif) | Soa2.mp4 | 2022-05-11 09:37 | 0 | |
![[SND]](/icons/sound2.gif) | sampebawah.mp3 | 2022-05-11 09:37 | 276K | |
![[SND]](/icons/sound2.gif) | demi's pornotitels_reactie ben.mp3 | 2022-05-11 09:36 | 0 | |
![[SND]](/icons/sound2.gif) | angrybirdsremix.mp3 | 2022-05-11 09:36 | 1.3M | |
![[SND]](/icons/sound2.gif) | la.mp3 | 2022-05-11 09:36 | 3.1M | |
![[SND]](/icons/sound2.gif) | demi's pornotitels_rapding.mp3 | 2022-05-11 09:35 | 0 | |
![[VID]](/icons/movie.gif) | SoA1.mp4 | 2022-05-11 09:34 | 0 | |
![[SND]](/icons/sound2.gif) | Vip8.mp3 | 2022-05-11 09:33 | 0 | |
![[VID]](/icons/movie.gif) | SoA2.mp4 | 2022-05-11 09:31 | 0 | |
![[SND]](/icons/sound2.gif) | Angry Birds Remix(tiktok).mp3 | 2022-05-11 09:31 | 0 | |
![[VID]](/icons/movie.gif) | Nunca.mp4 | 2022-05-11 09:31 | 8.0K | |
![[VID]](/icons/movie.gif) | op.mp4 | 2022-05-11 09:30 | 0 | |
![[SND]](/icons/sound2.gif) | Mic209.mp3 | 2022-05-11 09:30 | 0 | |
![[SND]](/icons/sound2.gif) | io.mp3 | 2022-05-11 09:23 | 0 | |
![[SND]](/icons/sound2.gif) | lagu1.mp3 | 2022-05-11 09:22 | 2.5M | |
![[SND]](/icons/sound2.gif) | Beats.mp3 | 2022-05-11 09:21 | 0 | |
![[SND]](/icons/sound2.gif) | m3.mp3 | 2022-05-11 09:19 | 0 | |
![[SND]](/icons/sound2.gif) | ki.mp3 | 2022-05-11 09:12 | 0 | |
![[SND]](/icons/sound2.gif) | Rollin 90s Neighborhood Crips.mp3 | 2022-05-11 09:11 | 0 | |
![[SND]](/icons/sound2.gif) | ps3.mp3 | 2022-05-11 09:08 | 1.0M | |
![[SND]](/icons/sound2.gif) | ps1.mp3 | 2022-05-11 09:06 | 800K | |
![[SND]](/icons/sound2.gif) | Lagu5.mp3 | 2022-05-11 09:05 | 3.8M | |
![[SND]](/icons/sound2.gif) | crh.mp3 | 2022-05-11 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | BB1-NAFF.mp3 | 2022-05-11 09:05 | 0 | |
![[SND]](/icons/sound2.gif) | Zxc.mp3 | 2022-05-11 09:04 | 8.1M | |
![[SND]](/icons/sound2.gif) | Zo.mp3 | 2022-05-11 09:04 | 4.0M | |
![[SND]](/icons/sound2.gif) | Xo.mp3 | 2022-05-11 09:04 | 2.3M | |
![[SND]](/icons/sound2.gif) | Wo.mp3 | 2022-05-11 09:04 | 3.8M | |
![[SND]](/icons/sound2.gif) | Vo.mp3 | 2022-05-11 09:04 | 4.9M | |
![[SND]](/icons/sound2.gif) | Jhonats.mp3 | 2022-05-11 09:03 | 0 | |
![[SND]](/icons/sound2.gif) | J5.mp3 | 2022-05-11 09:00 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Mashup of absolutely every TheFatRat song ever (Super Extended) (128 kbps).mp3 | 2022-05-11 08:57 | 0 | |
![[SND]](/icons/sound2.gif) | Jonat5.mp3 | 2022-05-11 08:57 | 0 | |
![[SND]](/icons/sound2.gif) | soni1.mp3 | 2022-05-11 08:49 | 0 | |
![[SND]](/icons/sound2.gif) | sad457.mp3 | 2022-05-11 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | Jollibee.mp3 | 2022-05-11 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | Acimalaka9.mp3 | 2022-05-11 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | Heather__X__Eyes_Blue__X__Terpikat_Senyum_Mu_(Lirik_Lagu_Terjemahan)_-_TikTok_Cover_Mashup(128k).mp3 | 2022-05-11 08:45 | 0 | |
![[SND]](/icons/sound2.gif) | Justin_Bieber_-_Ghost(128k).mp3 | 2022-05-11 08:45 | 0 | |
![[SND]](/icons/sound2.gif) | โกโกวา.mp3 | 2022-05-11 08:45 | 2.5M | |
![[SND]](/icons/sound2.gif) | Treasure_-_다라리_(Darari)_(speed_up+reverb)(128k).m4a | 2022-05-11 08:44 | 0 | |
![[SND]](/icons/sound2.gif) | Chord_Overstreet_-_Hold_On_(Lyric_Video)(128k).m4a | 2022-05-11 08:43 | 0 | |
![[SND]](/icons/sound2.gif) | armadah.mp3 | 2022-05-11 08:42 | 0 | |
![[SND]](/icons/sound2.gif) | dontcare.mp3 | 2022-05-11 08:42 | 0 | |
![[SND]](/icons/sound2.gif) | shajip01.mp3 | 2022-05-11 08:34 | 0 | |
![[SND]](/icons/sound2.gif) | Chad Threatening Me.mp3 | 2022-05-11 08:34 | 0 | |
![[SND]](/icons/sound2.gif) | HatiJalan.mp3 | 2022-05-11 08:31 | 0 | |
![[SND]](/icons/sound2.gif) | AgMupAJl EDITS😈🥀 - Лютый фонк для дрифта (www.hotplayer.ru).mp3 | 2022-05-11 08:26 | 0 | |
![[SND]](/icons/sound2.gif) | bgzxen.mp3 | 2022-05-11 08:22 | 0 | |
![[SND]](/icons/sound2.gif) | Vann.mp3 | 2022-05-11 08:22 | 0 | |
![[SND]](/icons/sound2.gif) | wedontcare.mp3 | 2022-05-11 08:22 | 0 | |
![[SND]](/icons/sound2.gif) | get.mp3 | 2022-05-11 08:21 | 0 | |
![[SND]](/icons/sound2.gif) | Get.mp3 | 2022-05-11 08:15 | 0 | |
![[SND]](/icons/sound2.gif) | KGFJUKEBOX.m4a | 2022-05-11 08:10 | 3.1M | |
![[SND]](/icons/sound2.gif) | Vass1.mp3 | 2022-05-11 08:09 | 816K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Beatzlen Tuhan Yesus Tidak Berubah Remix.mp3 | 2022-05-11 08:08 | 816K | |
![[SND]](/icons/sound2.gif) | NR.mp3 | 2022-05-11 08:07 | 3.5M | |
![[SND]](/icons/sound2.gif) | zxennn.mp3 | 2022-05-11 08:05 | 2.1M | |
![[SND]](/icons/sound2.gif) | DDD.mp3 | 2022-05-11 08:04 | 0 | |
![[SND]](/icons/sound2.gif) | xii_vvy.mp3 | 2022-05-11 08:02 | 0 | |
![[SND]](/icons/sound2.gif) | likekings.mp3 | 2022-05-11 08:01 | 0 | |
![[SND]](/icons/sound2.gif) | LN.mp3 | 2022-05-11 08:00 | 0 | |
![[SND]](/icons/sound2.gif) | aintnofun.mp3 | 2022-05-11 07:57 | 196K | |
![[SND]](/icons/sound2.gif) | s13.mp3 | 2022-05-11 07:56 | 4.1M | |
![[SND]](/icons/sound2.gif) | s14.mp3 | 2022-05-11 07:56 | 2.7M | |
![[SND]](/icons/sound2.gif) | MA.mp3 | 2022-05-11 07:54 | 2.5M | |
![[SND]](/icons/sound2.gif) | TYLERSDAW.mp3 | 2022-05-11 07:53 | 0 | |
![[SND]](/icons/sound2.gif) | pullup.mp3 | 2022-05-11 07:52 | 784K | |
![[SND]](/icons/sound2.gif) | JKL.mp3 | 2022-05-11 07:44 | 0 | |
![[SND]](/icons/sound2.gif) | KGF_Chapter_2_Songs_Jukebox__Hindi____Rocking_Star_Yash___Prashanth_Neel___Ravi_Basrur___Hombale(128k).m4a | 2022-05-11 07:40 | 4.3M | |
![[SND]](/icons/sound2.gif) | caves.mp3 | 2022-05-11 07:39 | 0 | |
![[SND]](/icons/sound2.gif) | ZLM.mp3 | 2022-05-11 07:37 | 0 | |
![[SND]](/icons/sound2.gif) | ZZZ.mp3 | 2022-05-11 07:36 | 0 | |
![[SND]](/icons/sound2.gif) | Zaa.mp3 | 2022-05-11 07:35 | 0 | |
![[SND]](/icons/sound2.gif) | MEKSIKO.mp3 | 2022-05-11 07:34 | 0 | |
![[SND]](/icons/sound2.gif) | jimy1.mp3 | 2022-05-11 07:34 | 0 | |
![[SND]](/icons/sound2.gif) | please.mp3 | 2022-05-11 07:33 | 0 | |
![[SND]](/icons/sound2.gif) | enest2022.mp3 | 2022-05-11 07:33 | 848K | |
![[SND]](/icons/sound2.gif) | yt1s.io - 🍃Woda i Ptaki w Lesie #1 - Odgłosy Natury Muzyka Relaksacyjna Tło Muzyczne🎧👍 (128 kbps).mp3 | 2022-05-11 07:28 | 512K | |
![[SND]](/icons/sound2.gif) | YU.mp3 | 2022-05-11 07:26 | 3.6M | |
![[SND]](/icons/sound2.gif) | SD.mp3 | 2022-05-11 07:24 | 2.3M | |
![[SND]](/icons/sound2.gif) | RT.mp3 | 2022-05-11 07:23 | 0 | |
![[SND]](/icons/sound2.gif) | PL.mp3 | 2022-05-11 07:23 | 4.4M | |
![[SND]](/icons/sound2.gif) | LLL.mp3 | 2022-05-11 07:20 | 2.0M | |
![[SND]](/icons/sound2.gif) | gandj7.mp3 | 2022-05-11 07:19 | 0 | |
![[SND]](/icons/sound2.gif) | WWRR.mp3 | 2022-05-11 07:19 | 0 | |
![[SND]](/icons/sound2.gif) | NETSUJOU NO SPECTRUM.mp3 | 2022-05-11 07:16 | 0 | |
![[SND]](/icons/sound2.gif) | DVRMJ131.mp3 | 2022-05-11 07:16 | 0 | |
![[SND]](/icons/sound2.gif) | wans.mp3 | 2022-05-11 07:15 | 0 | |
![[SND]](/icons/sound2.gif) | LOL.mp3 | 2022-05-11 07:14 | 2.3M | |
![[SND]](/icons/sound2.gif) | bbbb.mp3 | 2022-05-11 07:09 | 3.2M | |
![[SND]](/icons/sound2.gif) | Garmi.mp3 | 2022-05-11 07:06 | 0 | |
![[SND]](/icons/sound2.gif) | Bad Boy x Bad Girl.mp3 | 2022-05-11 07:04 | 0 | |
![[SND]](/icons/sound2.gif) | DVRMJ.mp3 | 2022-05-11 07:02 | 0 | |
![[SND]](/icons/sound2.gif) | part_2_gasskenn____anime__animeedit__fypanime__viral__tonikakukawaii__gotoubunnohanayome2__horimiya_.mp3 | 2022-05-11 06:57 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - BLACKBIRD SONG (128 kbps).mp3 | 2022-05-11 06:57 | 0 | |
![[SND]](/icons/sound2.gif) | Imagine Dragons Enemy.mp3 | 2022-05-11 06:56 | 1.8M | |
![[SND]](/icons/sound2.gif) | Record (online-voice-recorder.com).mp3 | 2022-05-11 06:54 | 317K | |
![[SND]](/icons/sound2.gif) | Worth It.mp3 | 2022-05-11 06:53 | 0 | |
![[SND]](/icons/sound2.gif) | scriptnya_di_bio_ya👀#CodingBucin_#fyp.m4a | 2022-05-11 06:51 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Morning on the River and the Gentle Singing of Spring Birds (128 kbps) (1).mp3 | 2022-05-11 06:51 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Rozpoznawanie głosów ptaków (128 kbps).mp3 | 2022-05-11 06:50 | 728K | |
![[SND]](/icons/sound2.gif) | JK.mp3 | 2022-05-11 06:48 | 2.9M | |
![[SND]](/icons/sound2.gif) | Jm2.mp3 | 2022-05-11 06:47 | 0 | |
![[SND]](/icons/sound2.gif) | kk1.mp3 | 2022-05-11 06:40 | 79K | |
![[SND]](/icons/sound2.gif) | Toofan_Song_Bass_Boosted_KGF_CHAPTER_2_New_Song__Rocking_Star_Yash(128k).mp3 | 2022-05-11 06:39 | 0 | |
![[SND]](/icons/sound2.gif) | mp3juice1s.cc - RUDE Eternal Youth (128kbps).mp3 | 2022-05-11 06:38 | 0 | |
![[SND]](/icons/sound2.gif) | chingchonghanji.mp3 | 2022-05-11 06:34 | 3.4M | |
![[SND]](/icons/sound2.gif) | marceldj.mp3 | 2022-05-11 06:33 | 0 | |
![[SND]](/icons/sound2.gif) | NasSbaha.mp3 | 2022-05-11 06:22 | 0 | |
![[SND]](/icons/sound2.gif) | awfultune-Maggot Belly-mp3sova.com.mp3 | 2022-05-11 06:22 | 0 | |
![[SND]](/icons/sound2.gif) | stice23.mp3 | 2022-05-11 06:15 | 0 | |
![[SND]](/icons/sound2.gif) | School Bus Shuffle di Freedom Trail Studio.mp3 | 2022-05-11 06:14 | 0 | |
![[SND]](/icons/sound2.gif) | Cover Here Without You Nu Rev Full respeed (1).mp3 | 2022-05-11 06:11 | 2.0M | |
![[SND]](/icons/sound2.gif) | gtasan.mp3 | 2022-05-11 06:11 | 1.4M | |
![[SND]](/icons/sound2.gif) | Valz1.mp3 | 2022-05-11 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | Valz6.mp3 | 2022-05-11 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | Valz3.mp3 | 2022-05-11 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | Valz4.mp3 | 2022-05-11 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | Valz5.mp3 | 2022-05-11 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | Valz2.mp3 | 2022-05-11 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | v1.mp3 | 2022-05-11 06:03 | 14M | |
![[SND]](/icons/sound2.gif) | kmu.mp3 | 2022-05-11 06:02 | 0 | |
![[SND]](/icons/sound2.gif) | v2.mp3 | 2022-05-11 06:02 | 0 | |
![[SND]](/icons/sound2.gif) | s12.mp3 | 2022-05-11 06:00 | 3.0M | |
![[SND]](/icons/sound2.gif) | TaiBaiHat.Net - Despacito.mp3 | 2022-05-11 05:45 | 2.5M | |
![[SND]](/icons/sound2.gif) | Demons.mp3 | 2022-05-11 05:34 | 2.2M | |
![[SND]](/icons/sound2.gif) | dj hantu.mp3 | 2022-05-11 05:27 | 0 | |
![[VID]](/icons/movie.gif) | Shaji_Pappan_Intro_song_from_%22Aadu%22_-_Jayasurya,_Vijay_Babu,_Sandra_Thomas(480p).mp4 | 2022-05-11 05:21 | 0 | |
![[SND]](/icons/sound2.gif) | Drink_A_Yak.mp3 | 2022-05-11 05:20 | 0 | |
![[SND]](/icons/sound2.gif) | om2.mp3 | 2022-05-11 05:17 | 0 | |
![[SND]](/icons/sound2.gif) | shaji2.mp3 | 2022-05-11 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | AUD-20211216-WA0068.m4a | 2022-05-11 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | UwU_-_SOUND_EFFECT(256k).mp3 | 2022-05-11 05:13 | 0 | |
![[SND]](/icons/sound2.gif) | U2 City of Blinding Lights.mp3 | 2022-05-11 05:10 | 0 | |
![[SND]](/icons/sound2.gif) | messenger-seri meloboom.mp3 | 2022-05-11 05:07 | 0 | |
![[SND]](/icons/sound2.gif) | mixkit-sci-fi-click-900.mp3 | 2022-05-11 05:05 | 0 | |
![[SND]](/icons/sound2.gif) | shaji1.mp3 | 2022-05-11 05:02 | 0 | |
![[SND]](/icons/sound2.gif) | Enoch Drebber _ The Link between Apples and Pens.mp3 | 2022-05-11 04:59 | 0 | |
![[SND]](/icons/sound2.gif) | Hold.mp3 | 2022-05-11 04:59 | 0 | |
![[SND]](/icons/sound2.gif) | aku.mp3 | 2022-05-11 04:58 | 4.4M | |
![[SND]](/icons/sound2.gif) | Ravens Rock - Scriptonite - Polozhenie.mp3 | 2022-05-11 04:51 | 0 | |
![[SND]](/icons/sound2.gif) | AzrielDimeo.mp3 | 2022-05-11 04:49 | 2.6M | |
![[SND]](/icons/sound2.gif) | 1027.mp3 | 2022-05-11 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | thunder1.mp3 | 2022-05-11 04:45 | 0 | |
![[SND]](/icons/sound2.gif) | baby.mp3 | 2022-05-11 04:44 | 3.4M | |
![[SND]](/icons/sound2.gif) | DJSoni1.mp3 | 2022-05-11 04:44 | 0 | |
![[SND]](/icons/sound2.gif) | DMHO.mp3 | 2022-05-11 04:41 | 0 | |
![[SND]](/icons/sound2.gif) | lomati.mp3 | 2022-05-11 04:39 | 360K | |
![[SND]](/icons/sound2.gif) | pikachu7.mp3 | 2022-05-11 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | [YT2mp3.info] - Perfect OK _ Malayalam Dialogue With Beats _ Ashwin Bhaskar (320kbps).mp3 | 2022-05-11 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | pikachu6.mp3 | 2022-05-11 04:38 | 0 | |
![[SND]](/icons/sound2.gif) | Ikawlang.mp3 | 2022-05-11 04:35 | 0 | |
![[SND]](/icons/sound2.gif) | Vv.mp3 | 2022-05-11 04:34 | 964K | |
![[SND]](/icons/sound2.gif) | yonz.mp3 | 2022-05-11 04:32 | 0 | |
![[SND]](/icons/sound2.gif) | dimatamu.mp3 | 2022-05-11 04:24 | 2.2M | |
![[SND]](/icons/sound2.gif) | r14.mp3 | 2022-05-11 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | r13.mp3 | 2022-05-11 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | AzrielSong.mp3 | 2022-05-11 04:18 | 0 | |
![[SND]](/icons/sound2.gif) | ffkakmak364.mp3 | 2022-05-11 04:17 | 0 | |
![[SND]](/icons/sound2.gif) | taneiei2009.mp3 | 2022-05-11 04:17 | 0 | |
![[SND]](/icons/sound2.gif) | RedScarf如果可以Ringtone2.mp3 | 2022-05-11 04:17 | 837K | |
![[SND]](/icons/sound2.gif) | ycl-ruyuan-2.MP.mp3 | 2022-05-11 04:16 | 0 | |
![[SND]](/icons/sound2.gif) | TK.mp3 | 2022-05-11 04:15 | 2.9M | |
![[SND]](/icons/sound2.gif) | Yonz1.mp3 | 2022-05-11 04:12 | 0 | |
![[SND]](/icons/sound2.gif) | Lugowoo.mp3 | 2022-05-11 04:09 | 0 | |
![[SND]](/icons/sound2.gif) | AMA.mp3 | 2022-05-11 04:05 | 0 | |
![[SND]](/icons/sound2.gif) | TIWAKAL.mp3 | 2022-05-11 04:04 | 756K | |
![[SND]](/icons/sound2.gif) | tannaja13.mp3 | 2022-05-11 04:03 | 0 | |
![[SND]](/icons/sound2.gif) | WAIIAN - 12 AM (Prod. by Jwudz) (Official Music Video).mp3 | 2022-05-11 03:58 | 0 | |
![[SND]](/icons/sound2.gif) | usbegneysjs.mp3 | 2022-05-11 03:50 | 0 | |
![[SND]](/icons/sound2.gif) | gkjxhsmsj.mp3 | 2022-05-11 03:48 | 0 | |
![[SND]](/icons/sound2.gif) | Mfx.mp3 | 2022-05-11 03:45 | 0 | |
![[SND]](/icons/sound2.gif) | Hjj.mp3 | 2022-05-11 03:31 | 0 | |
![[SND]](/icons/sound2.gif) | Back-Number-Happy-Birthday-Lyric-Terjemahan_jbkl0R0osTE.mp3 | 2022-05-11 03:28 | 0 | |
![[SND]](/icons/sound2.gif) | hey buddy1.mp3 | 2022-05-11 03:23 | 0 | |
![[SND]](/icons/sound2.gif) | II.mp3 | 2022-05-11 03:20 | 2.4M | |
![[SND]](/icons/sound2.gif) | habibb.mp3 | 2022-05-11 03:18 | 0 | |
![[SND]](/icons/sound2.gif) | pepek2.mp3 | 2022-05-11 03:16 | 0 | |
![[SND]](/icons/sound2.gif) | Armaan_Oru_-_Baby_(getmp3.pro).mp3 | 2022-05-11 03:15 | 0 | |
![[SND]](/icons/sound2.gif) | LoveStory.mp3 | 2022-05-11 03:12 | 0 | |
![[SND]](/icons/sound2.gif) | Turn to Allah (1).mp3 | 2022-05-11 03:03 | 0 | |
![[SND]](/icons/sound2.gif) | dubi.mp3 | 2022-05-11 03:01 | 0 | |
![[SND]](/icons/sound2.gif) | om3.mp3 | 2022-05-11 02:59 | 0 | |
![[SND]](/icons/sound2.gif) | djremix.mp3 | 2022-05-11 02:50 | 21M | |
![[SND]](/icons/sound2.gif) | Before You Go.mp3 | 2022-05-11 02:48 | 256K | |
![[SND]](/icons/sound2.gif) | DS.mp3 | 2022-05-11 02:48 | 2.8M | |
![[SND]](/icons/sound2.gif) | Armada1.mp3 | 2022-05-11 02:46 | 0 | |
![[SND]](/icons/sound2.gif) | BE1.mp3 | 2022-05-11 02:43 | 0 | |
![[SND]](/icons/sound2.gif) | BE.mp3 | 2022-05-11 02:42 | 0 | |
![[SND]](/icons/sound2.gif) | hriday.mp3 | 2022-05-11 02:40 | 0 | |
![[SND]](/icons/sound2.gif) | aum1.mp3 | 2022-05-11 02:37 | 0 | |
![[SND]](/icons/sound2.gif) | aum2.mp3 | 2022-05-11 02:36 | 0 | |
![[SND]](/icons/sound2.gif) | aum3.mp3 | 2022-05-11 02:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lil Nas X THATS WHAT I WANT Lyrics.mp3 | 2022-05-11 02:36 | 0 | |
![[SND]](/icons/sound2.gif) | DANDELIONS_1648657946_musicaldown.com.mp3 | 2022-05-11 02:35 | 0 | |
![[SND]](/icons/sound2.gif) | Sed_all.mp3 | 2022-05-11 02:35 | 0 | |
![[SND]](/icons/sound2.gif) | FM.mp3 | 2022-05-11 02:32 | 42M | |
![[SND]](/icons/sound2.gif) | Gives.mp3 | 2022-05-11 02:31 | 2.8M | |
![[VID]](/icons/movie.gif) | lagu2.mp4 | 2022-05-11 02:30 | 0 | |
![[SND]](/icons/sound2.gif) | Amnmv1.mp3 | 2022-05-11 02:30 | 0 | |
![[VID]](/icons/movie.gif) | lagu.mp4 | 2022-05-11 02:30 | 0 | |
![[SND]](/icons/sound2.gif) | sa0ran.mp3 | 2022-05-11 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | ดอกไม้ไฟ - Mirrr __ FLUKIE COVER.mp3 | 2022-05-11 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | gtav5.mp3 | 2022-05-11 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | ke0me.mp3 | 2022-05-11 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | Lil Nas X - Old Town Road (feat. Billy Ray Cyrus) (Nolan van Lith Remix).mp3 | 2022-05-11 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | Heartukulla.mp3 | 2022-05-11 02:27 | 0 | |
![[SND]](/icons/sound2.gif) | 🔥ꎇꍏ꓄ꍏ꒒ꀤ꓄ꌩ🔥-🔥ПРОСТО ПОСМОТРИ🔥-kissvk.com.mp3 | 2022-05-11 02:27 | 2.5M | |
![[SND]](/icons/sound2.gif) | LI.mp3 | 2022-05-11 02:26 | 3.7M | |
![[SND]](/icons/sound2.gif) | 90sVs2KKids.mp3 | 2022-05-11 02:26 | 8.0K | |
![[SND]](/icons/sound2.gif) | Privatep.mp3 | 2022-05-11 02:24 | 0 | |
![[SND]](/icons/sound2.gif) | Hinder0.mp3 | 2022-05-11 02:19 | 0 | |
![[SND]](/icons/sound2.gif) | Wahran.mp3 | 2022-05-11 02:18 | 0 | |
![[SND]](/icons/sound2.gif) | Dippam Dappam.mp3 | 2022-05-11 02:17 | 0 | |
![[SND]](/icons/sound2.gif) | ICE.mp3 | 2022-05-11 02:16 | 0 | |
![[SND]](/icons/sound2.gif) | PANUNUBOS.mp3 | 2022-05-11 02:15 | 0 | |
![[SND]](/icons/sound2.gif) | 7vnspd.mp3 | 2022-05-11 02:14 | 0 | |
![[SND]](/icons/sound2.gif) | dongalo.mp3 | 2022-05-11 02:13 | 0 | |
![[SND]](/icons/sound2.gif) | Miyagi_JEndshpil_-_Malinovyjj_rassvet_(musmore.com).mp3 | 2022-05-11 02:04 | 0 | |
![[SND]](/icons/sound2.gif) | Kimi dattara.mp3 | 2022-05-11 01:59 | 0 | |
![[SND]](/icons/sound2.gif) | Xcho_Mr_Lambo_Pablo_Zhizn_tak_prosta_i_bez_vashej_falshi.mp3 | 2022-05-11 01:54 | 0 | |
![[SND]](/icons/sound2.gif) | 1577183606_1577178482_-moskva-lyubit (1).mp3 | 2022-05-11 01:49 | 6.9M | |
![[SND]](/icons/sound2.gif) | SonicPanic.mp3 | 2022-05-11 01:49 | 253K | |
![[SND]](/icons/sound2.gif) | nong85544D2.mp3 | 2022-05-11 01:49 | 4.1M | |
![[SND]](/icons/sound2.gif) | nong85544D4.mp3 | 2022-05-11 01:48 | 18M | |
![[SND]](/icons/sound2.gif) | nong85544D3.mp3 | 2022-05-11 01:48 | 4.0M | |
![[SND]](/icons/sound2.gif) | nong85544D1.mp3 | 2022-05-11 01:48 | 2.7M | |
![[SND]](/icons/sound2.gif) | 1577183606_1577178482_-moskva-lyubit.mp3 | 2022-05-11 01:46 | 0 | |
![[SND]](/icons/sound2.gif) | Alter Bridge - The Other Side.mp3 | 2022-05-11 01:40 | 0 | |
![[SND]](/icons/sound2.gif) | MOK.mp3 | 2022-05-11 01:33 | 0 | |
![[SND]](/icons/sound2.gif) | MT4.mp3 | 2022-05-11 01:31 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Call of Duty Black Ops 2 Main Menu Theme (128 kbps).mp3 | 2022-05-11 01:29 | 0 | |
![[SND]](/icons/sound2.gif) | bear56.mp3 | 2022-05-11 01:28 | 0 | |
![[SND]](/icons/sound2.gif) | zae121.mp3 | 2022-05-11 01:26 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - #กำลังฮิตในTikTok_ ( เต้นไม่อร่อย ถ้ามีเด็กน้...อกัน ) ขอร้องวัยรุ่น - คำมอด พรขุนเดช book remix (128 kbps).mp3 | 2022-05-11 01:24 | 0 | |
![[SND]](/icons/sound2.gif) | sadd1.mp3 | 2022-05-11 01:21 | 0 | |
![[SND]](/icons/sound2.gif) | Black Ops 2 Soundtrack_ Main Theme.mp3 | 2022-05-11 01:18 | 0 | |
![[SND]](/icons/sound2.gif) | Kesuksesan Kebijakan Estonia.MP.mp3 | 2022-05-11 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | Остап Парфёнов-ТЫ НЕ КОРОЛЕВА-kissvk.com.mp3 | 2022-05-11 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | ᴀᴜʀᴏʀᴀ🌹 - Ревную (slowed + reverb) (www.hotplayer.ru).mp3 | 2022-05-11 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | Белый мерин - Ехал я домой с работы.mp3 | 2022-05-11 01:10 | 7.9M | |
![[SND]](/icons/sound2.gif) | mos.mp3 | 2022-05-11 01:10 | 2.5M | |
![[SND]](/icons/sound2.gif) | Vp41.mp3 | 2022-05-11 01:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | [muzmo.ru] шансон 2017 - Я Пацанчик хулиганчик [muzmo.ru].mp3 | 2022-05-11 01:07 | 0 | |
![[SND]](/icons/sound2.gif) | ᴘʀᴏᴋᴜʀᴀᴛᴜʀᴀ ♨️ - малый павзрослел.mp3 | 2022-05-11 01:04 | 820K | |
![[SND]](/icons/sound2.gif) | kitti.mp3 | 2022-05-11 01:04 | 0 | |
![[SND]](/icons/sound2.gif) | BITTUEV - Братик.mp3 | 2022-05-11 01:03 | 1.8M | |
![[SND]](/icons/sound2.gif) | Vp40.mp3 | 2022-05-11 01:03 | 2.0M | |
![[SND]](/icons/sound2.gif) | 🥀MarkobraZZers 🥀 - О глубоком🥀🚀.mp3 | 2022-05-11 01:03 | 0 | |
![[SND]](/icons/sound2.gif) | Алина Орлова - Люби меня, люби (cut).mp3 | 2022-05-11 01:03 | 0 | |
![[SND]](/icons/sound2.gif) | sᴜᴇᴛᴏʟᴏɢɪ ʀғ - платина rmx.mp3 | 2022-05-11 01:03 | 0 | |
![[SND]](/icons/sound2.gif) | SYETA⠀ོ - Юности года 🥀-1.mp3 | 2022-05-11 00:58 | 0 | |
![[SND]](/icons/sound2.gif) | seng2.mp3 | 2022-05-11 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | seng3.mp3 | 2022-05-11 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | Gt3.mp3 | 2022-05-11 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | seng1.mp3 | 2022-05-11 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | 𝐾𝑎𝑦𝑓𝑎𝑟𝑖𝑘⁴²-Простыни😐-kissvk.com.mp3 | 2022-05-11 00:42 | 0 | |
![[SND]](/icons/sound2.gif) | KI.mp3 | 2022-05-11 00:30 | 0 | |
![[SND]](/icons/sound2.gif) | Rx7.mp3 | 2022-05-11 00:26 | 0 | |
![[SND]](/icons/sound2.gif) | Lagu22.mp3 | 2022-05-11 00:22 | 0 | |
![[SND]](/icons/sound2.gif) | DGOD1.mp3 | 2022-05-11 00:20 | 0 | |
![[SND]](/icons/sound2.gif) | Tang_Pod.mp3 | 2022-05-11 00:04 | 0 | |
![[SND]](/icons/sound2.gif) | Marvin_-_Vaka_Vaka_68869629-1.mp3 | 2022-05-10 23:50 | 0 | |
![[SND]](/icons/sound2.gif) | Wanwan.mp3 | 2022-05-10 23:49 | 0 | |
![[SND]](/icons/sound2.gif) | tima-belarusskih_-_vesnushki.mp3 | 2022-05-10 23:39 | 0 | |
![[SND]](/icons/sound2.gif) | ma-cherie-naika_456239873.mp3 | 2022-05-10 23:39 | 0 | |
![[SND]](/icons/sound2.gif) | DJ_Spinall_Ft_Asake_-_Palazzo_(zagaempire.com)_.mp3 | 2022-05-10 23:18 | 0 | |
![[SND]](/icons/sound2.gif) | dije.mp3 | 2022-05-10 23:18 | 0 | |
![[SND]](/icons/sound2.gif) | 如果可以 (Diiton cover).mp3 | 2022-05-10 23:12 | 0 | |
![[SND]](/icons/sound2.gif) | StaryMirVodkyPy.mp3 | 2022-05-10 23:12 | 0 | |
![[SND]](/icons/sound2.gif) | Enter Sandman.mp3 | 2022-05-10 23:03 | 3.3M | |
![[SND]](/icons/sound2.gif) | Wellerman_Nathan_Evans.mp3 | 2022-05-10 22:27 | 5.9M | |
![[SND]](/icons/sound2.gif) | 「Nightcore」→ Like A Vampire (Lyrics) by Catrien Maxwell.mp3 | 2022-05-10 22:21 | 4.0M | |
![[SND]](/icons/sound2.gif) | go.mp3 | 2022-05-10 22:21 | 4.1M | |
![[SND]](/icons/sound2.gif) | nal.mp3 | 2022-05-10 22:21 | 3.4M | |
![[SND]](/icons/sound2.gif) | SARAN - GOLOGOSO (โกโรโกโส) FEAT. JONIN, DIAMOND MQT [เนื้อเพลง Lyric Video].mp3 | 2022-05-10 22:20 | 4.1M | |
![[VID]](/icons/movie.gif) | VID-20220505-WA0044.mp4 | 2022-05-10 22:18 | 741K | |
![[SND]](/icons/sound2.gif) | cygan-aj-digi-digi-digi-daj_(Krolik.biz).mp3 | 2022-05-10 22:17 | 8.4M | |
![[SND]](/icons/sound2.gif) | Gravação.mp3 | 2022-05-10 22:16 | 26K | |
![[VID]](/icons/movie.gif) | nal.mp4 | 2022-05-10 22:10 | 4.4M | |
![[SND]](/icons/sound2.gif) | AB.mp3 | 2022-05-10 22:05 | 48M | |
![[SND]](/icons/sound2.gif) | yes.mp3 | 2022-05-10 22:05 | 857K | |
![[SND]](/icons/sound2.gif) | vo.mp3 | 2022-05-10 22:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | middle.mp3 | 2022-05-10 21:58 | 0 | |
![[SND]](/icons/sound2.gif) | X2Download.com - Melepas Lajang - Arvian Dwi Ft Tri Suaka _ Lirik Lagu Indonesia (128 kbps).mp3 | 2022-05-10 21:51 | 0 | |
![[SND]](/icons/sound2.gif) | Taukan Beats X Чабдаров - Любэ - Солдат.mp3 | 2022-05-10 21:42 | 0 | |
![[SND]](/icons/sound2.gif) | EMIWAY - CHUSAMBA (OFFICIAL MUSIC VIDEO) (EXPLICIT).mp3 | 2022-05-10 21:15 | 0 | |
![[SND]](/icons/sound2.gif) | LVM.mp3 | 2022-05-10 21:12 | 0 | |
![[SND]](/icons/sound2.gif) | SOY.mp3 | 2022-05-10 21:12 | 0 | |
![[SND]](/icons/sound2.gif) | Nekodex - Circles!.mp3 | 2022-05-10 21:09 | 0 | |
![[SND]](/icons/sound2.gif) | RM2.mp3 | 2022-05-10 21:05 | 872K | |
![[SND]](/icons/sound2.gif) | ssstiktok_1652212007312.mp3 | 2022-05-10 20:56 | 204K | |
![[SND]](/icons/sound2.gif) | nyaman.mp3 | 2022-05-10 20:55 | 1.1M | |
![[SND]](/icons/sound2.gif) | debat.mp3 | 2022-05-10 20:50 | 0 | |
![[SND]](/icons/sound2.gif) | Chasto ushki.mp3 | 2022-05-10 20:44 | 0 | |
![[SND]](/icons/sound2.gif) | Частушки - Минусовка (слова здесь).mp3 | 2022-05-10 20:44 | 0 | |
![[SND]](/icons/sound2.gif) | Rolso & Jefe - На плаге.mp3 | 2022-05-10 20:43 | 0 | |
![[SND]](/icons/sound2.gif) | bandu (1).mp3 | 2022-05-10 20:37 | 0 | |
![[SND]](/icons/sound2.gif) | miyagi-endshpil_-_polovina-moya.mp3 | 2022-05-10 20:34 | 0 | |
![[SND]](/icons/sound2.gif) | FEDUK - Tour de France-2.mp3 | 2022-05-10 20:33 | 0 | |
![[SND]](/icons/sound2.gif) | Михаил Шуфутинский - 3-е Сентября.mp3 | 2022-05-10 20:33 | 0 | |
![[SND]](/icons/sound2.gif) | Audio_08-03-2022_15-32-15 (online-audio-converter.com).mp3 | 2022-05-10 20:30 | 0 | |
![[SND]](/icons/sound2.gif) | merdeka.mp3 | 2022-05-10 20:30 | 1.3M | |
![[SND]](/icons/sound2.gif) | 02 Apple Orchard (Virgin 4 Track Recording).mp3 | 2022-05-10 20:28 | 0 | |
![[SND]](/icons/sound2.gif) | bandu.mp3 | 2022-05-10 20:26 | 0 | |
![[SND]](/icons/sound2.gif) | Бандурин - Частушки без слов.mp3 | 2022-05-10 20:24 | 0 | |
![[SND]](/icons/sound2.gif) | Rumah-Singgah.mp3 | 2022-05-10 20:23 | 0 | |
![[SND]](/icons/sound2.gif) | fa.mp3 | 2022-05-10 20:20 | 0 | |
![[SND]](/icons/sound2.gif) | l.mp3 | 2022-05-10 20:15 | 3.5M | |
![[SND]](/icons/sound2.gif) | Little-Einsteins-Theme-Song(2).mp3 | 2022-05-10 20:15 | 0 | |
![[SND]](/icons/sound2.gif) | kkkk.mp3 | 2022-05-10 20:12 | 0 | |
![[SND]](/icons/sound2.gif) | kasihan.mp3 | 2022-05-10 20:12 | 1.8M | |
![[SND]](/icons/sound2.gif) | Oya.mp3 | 2022-05-10 20:05 | 7.3M | |
![[SND]](/icons/sound2.gif) | dongeng.mp3 | 2022-05-10 20:03 | 0 | |
![[SND]](/icons/sound2.gif) | Rembulan.mp3 | 2022-05-10 20:03 | 0 | |
![[SND]](/icons/sound2.gif) | buta.mp3 | 2022-05-10 20:02 | 0 | |
![[SND]](/icons/sound2.gif) | marcoo.mp3 | 2022-05-10 20:01 | 0 | |
![[SND]](/icons/sound2.gif) | Moodring_-_SYNCwav_Official_Music_(getmp3.pro).mp3 | 2022-05-10 20:01 | 0 | |
![[SND]](/icons/sound2.gif) | ghos.mp3 | 2022-05-10 20:00 | 0 | |
![[SND]](/icons/sound2.gif) | Hycez31.mp3 | 2022-05-10 19:59 | 0 | |
![[SND]](/icons/sound2.gif) | ATT.mp3 | 2022-05-10 19:56 | 2.8M | |
![[SND]](/icons/sound2.gif) | My Chemical Romance - Cancer(MP3_320K).mp3 | 2022-05-10 19:53 | 0 | |
![[SND]](/icons/sound2.gif) | 505(MP3_320K).mp3 | 2022-05-10 19:53 | 0 | |
![[SND]](/icons/sound2.gif) | Tiara Andini - Merasa Indah (underwater tiktok version)(MP3_320K).mp3 | 2022-05-10 19:53 | 0 | |
![[SND]](/icons/sound2.gif) | Sakura - Fariz RM (underwater tiktok version)(MP3_320K).mp3 | 2022-05-10 19:53 | 0 | |
![[SND]](/icons/sound2.gif) | FABIO ASHER - RUMAH SINGGAH (OFFICIAL MUSIC VIDEO)(MP3_320K).mp3 | 2022-05-10 19:53 | 0 | |
![[SND]](/icons/sound2.gif) | juice-wrld-lil-uzi-vert-wasted-murkish-huken-nightcore-remix.mp3 | 2022-05-10 19:52 | 4.2M | |
![[SND]](/icons/sound2.gif) | old4.mp3 | 2022-05-10 19:43 | 0 | |
![[SND]](/icons/sound2.gif) | old3.mp3 | 2022-05-10 19:43 | 0 | |
![[SND]](/icons/sound2.gif) | old2.mp3 | 2022-05-10 19:43 | 0 | |
![[SND]](/icons/sound2.gif) | old1.mp3 | 2022-05-10 19:42 | 0 | |
![[SND]](/icons/sound2.gif) | old.mp3 | 2022-05-10 19:42 | 4.8M | |
![[SND]](/icons/sound2.gif) | Light of the Seven.mp3 | 2022-05-10 19:35 | 0 | |
![[SND]](/icons/sound2.gif) | dinda.mp3 | 2022-05-10 19:35 | 4.2M | |
![[SND]](/icons/sound2.gif) | live_imagine.mp3 | 2022-05-10 19:34 | 0 | |
![[SND]](/icons/sound2.gif) | set_upchoppa_boyft_xavier_the_godking_c (1).mp3 | 2022-05-10 19:30 | 0 | |
![[SND]](/icons/sound2.gif) | machine-gun-01.mp3 | 2022-05-10 19:28 | 0 | |
![[SND]](/icons/sound2.gif) | Człowiek z głuchej nocy- [-W oczach Zachodu-] - J. Conrad (1911_1981) - słuchowisko.mp3 | 2022-05-10 19:25 | 0 | |
![[SND]](/icons/sound2.gif) | TOBIAS SAMMET’S AVANTASIA feat. CANDICE NIGHT – Moonglow (OFFICIAL MUSIC VIDEO) (128 kbps) (1).mp3 | 2022-05-10 19:25 | 0 | |
![[SND]](/icons/sound2.gif) | creepy.mp3 | 2022-05-10 19:25 | 0 | |
![[SND]](/icons/sound2.gif) | yarmak-moya-strana-ne-upadet-na-koleni-ukrayna.mp3 | 2022-05-10 19:21 | 0 | |
![[SND]](/icons/sound2.gif) | Nirvana - Something In The Way The Batman OST.mp3 | 2022-05-10 19:21 | 0 | |
![[SND]](/icons/sound2.gif) | lagihigh.mp3 | 2022-05-10 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | ZER3.mp3 | 2022-05-10 19:11 | 0 | |
![[SND]](/icons/sound2.gif) | DJ DINDA.mp3 | 2022-05-10 19:10 | 0 | |
![[SND]](/icons/sound2.gif) | mboy1.mp3 | 2022-05-10 19:08 | 0 | |
![[SND]](/icons/sound2.gif) | lidan12.mp3 | 2022-05-10 19:01 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Pierwiosnek (128 kbps).mp3 | 2022-05-10 19:00 | 0 | |
![[SND]](/icons/sound2.gif) | Macan - За за за всех кто на нас ставил.mp3 | 2022-05-10 19:00 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Zięba Śpiew - Śpiew Zięby - Zięba Odgłosy - Zięba ptak - tentilhão (128 kbps) (1).mp3 | 2022-05-10 19:00 | 0 | |
![[SND]](/icons/sound2.gif) | Моргенштерн - Знаешь почему.mp3 | 2022-05-10 18:59 | 6.3M | |
![[SND]](/icons/sound2.gif) | applause.mp3 | 2022-05-10 18:59 | 0 | |
![[SND]](/icons/sound2.gif) | morgenshtern-dulo-mp3.mp3 | 2022-05-10 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | macan-77-mp3.mp3 | 2022-05-10 18:57 | 0 | |
![[SND]](/icons/sound2.gif) | NIGHT.mp3 | 2022-05-10 18:56 | 3.9M | |
![[SND]](/icons/sound2.gif) | Meybi_Beybi_Askorbinka(_cover).mp3 | 2022-05-10 18:50 | 0 | |
![[SND]](/icons/sound2.gif) | Paradise_Type_Beat.mp3 | 2022-05-10 18:47 | 0 | |
![[SND]](/icons/sound2.gif) | hotline_miami_20. Scattle - It's Safe Now.mp3 | 2022-05-10 18:42 | 0 | |
![[SND]](/icons/sound2.gif) | 88century_-_petit_poney_73935141.mp3 | 2022-05-10 18:38 | 0 | |
![[SND]](/icons/sound2.gif) | shadowraze_LXNER_quiizzzmeow_-_adaptive_strike_73793462.mp3 | 2022-05-10 18:34 | 5.3M | |
![[SND]](/icons/sound2.gif) | -askorbinka.mp3 | 2022-05-10 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | dzhama-jaspa-zvuki-urbana-mp3.mp3 | 2022-05-10 18:31 | 0 | |
![[SND]](/icons/sound2.gif) | sparkle.mp3 | 2022-05-10 18:30 | 0 | |
![[SND]](/icons/sound2.gif) | gta0v.mp3 | 2022-05-10 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | haims4.mp3 | 2022-05-10 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | haims3.mp3 | 2022-05-10 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | haims2.mp3 | 2022-05-10 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | Big_Baby_Tape_kizaru_-_So_Icy_Nihao_73212021.mp3 | 2022-05-10 18:28 | 0 | |
![[SND]](/icons/sound2.gif) | -askorbinka-mejbi-bejbi-kaver.mp3 | 2022-05-10 18:28 | 0 | |
![[SND]](/icons/sound2.gif) | baby14s.mp3 | 2022-05-10 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | Big_Baby_Tape_kizaru_-_Ride_Or_Die_73212033.mp3 | 2022-05-10 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | BabySantana & KA$HDAMI - 14 (Directed by Cole Bennett).mp3 | 2022-05-10 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | KROKOT_Neproshyonnyj.mp3 | 2022-05-10 18:23 | 0 | |
![[SND]](/icons/sound2.gif) | Underworld.mp3 | 2022-05-10 18:22 | 5.7M | |
![[SND]](/icons/sound2.gif) | Big_Baby_Tape_kizaru_-_Big_Tymers_73212022.mp3 | 2022-05-10 18:21 | 7.4M | |
![[SND]](/icons/sound2.gif) | Mirami-Sokoli.mp3 | 2022-05-10 18:20 | 0 | |
![[SND]](/icons/sound2.gif) | 5905-e6bd936b211cda0a19062b4adf77e729 (1).mp3 | 2022-05-10 18:17 | 0 | |
![[SND]](/icons/sound2.gif) | nampol.mp3 | 2022-05-10 18:12 | 0 | |
![[SND]](/icons/sound2.gif) | Kara_Deri_Mozhet_ty_verneshsya_ili_ne_verneshsya.mp3 | 2022-05-10 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | gtav0.mp3 | 2022-05-10 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | keme0.mp3 | 2022-05-10 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | saran0.mp3 | 2022-05-10 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | ttt0.mp3 | 2022-05-10 18:10 | 228K | |
![[SND]](/icons/sound2.gif) | Yamaguchi.mp3 | 2022-05-10 18:07 | 2.6M | |
![[SND]](/icons/sound2.gif) | shadowraze-astral-step.mp3 | 2022-05-10 18:04 | 4.7M | |
![[SND]](/icons/sound2.gif) | p02.mp3 | 2022-05-10 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | p01.mp3 | 2022-05-10 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | camon.mp3 | 2022-05-10 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | heli.mp3 | 2022-05-10 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | br.mp3 | 2022-05-10 18:03 | 0 | |
![[SND]](/icons/sound2.gif) | helikopter.mp3 | 2022-05-10 18:02 | 0 | |
![[SND]](/icons/sound2.gif) | bro1.mp3 | 2022-05-10 18:02 | 0 | |
![[SND]](/icons/sound2.gif) | o1.mp3 | 2022-05-10 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | o0.mp3 | 2022-05-10 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | od.mp3 | 2022-05-10 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | odo.mp3 | 2022-05-10 18:00 | 0 | |
![[SND]](/icons/sound2.gif) | markpr.mp3 | 2022-05-10 18:00 | 0 | |
![[SND]](/icons/sound2.gif) | rhn116.mp3 | 2022-05-10 17:58 | 0 | |
![[SND]](/icons/sound2.gif) | mark222.mp3 | 2022-05-10 17:56 | 0 | |
![[SND]](/icons/sound2.gif) | kdrpshaji1.mp3 | 2022-05-10 17:56 | 0 | |
![[SND]](/icons/sound2.gif) | MORGENSHTERN_-_Novyjj_Merin_66404393.mp3 | 2022-05-10 17:56 | 5.9M | |
![[SND]](/icons/sound2.gif) | INSTASAMKA - И ЧТОЭ (prod. realmoneyken) (prod. realmoneyken).mp3 | 2022-05-10 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | Big Baby Tape, kizaru - Million (1).mp3 | 2022-05-10 17:50 | 5.1M | |
![[SND]](/icons/sound2.gif) | edxa.mp3 | 2022-05-10 17:49 | 0 | |
![[SND]](/icons/sound2.gif) | covtc.mp3 | 2022-05-10 17:49 | 0 | |
![[SND]](/icons/sound2.gif) | vba.mp3 | 2022-05-10 17:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - 𝒿𝒶𝓎𝓂𝑒𝓈 𝓎𝑜𝓊𝓃𝑔 infinity (slowed+reverb) (128 kbps).mp3 | 2022-05-10 17:38 | 0 | |
![[SND]](/icons/sound2.gif) | Фогель - Пуля.mp3 | 2022-05-10 17:37 | 0 | |
![[SND]](/icons/sound2.gif) | Артем Пивоваров - Дежавю.mp3 | 2022-05-10 17:36 | 0 | |
![[SND]](/icons/sound2.gif) | AMAN_ZHU_-_Mojo_iskusstvo_(musmore.com).mp3 | 2022-05-10 17:31 | 0 | |
![[SND]](/icons/sound2.gif) | Sh1.mp3 | 2022-05-10 17:26 | 0 | |
![[SND]](/icons/sound2.gif) | FORTNITE.mp3 | 2022-05-10 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | Luftwaffe_March_-_Luftwaffe_March_69346969.mp3 | 2022-05-10 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | lagu8.mp3 | 2022-05-10 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | Project_05-10(1)_Full HD 1080p_MEDIUM_FR30.mp3 | 2022-05-10 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | aing.mp3 | 2022-05-10 17:21 | 0 | |
![[SND]](/icons/sound2.gif) | Sj2.mp3 | 2022-05-10 17:21 | 0 | |
![[SND]](/icons/sound2.gif) | ABD2.mp3 | 2022-05-10 17:20 | 260K | |
![[SND]](/icons/sound2.gif) | ABD1.mp3 | 2022-05-10 17:20 | 0 | |
![[SND]](/icons/sound2.gif) | Sj1.mp3 | 2022-05-10 17:19 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Happy Birthday Indian Funny _v240P.mp4 | 2022-05-10 17:14 | 0 | |
![[SND]](/icons/sound2.gif) | yt5s.com - Lil Whyte - Oxy Cotton (128 kbps).mp3 | 2022-05-10 17:12 | 0 | |
![[SND]](/icons/sound2.gif) | ในทุกเช้าที่กูต้องแบกร่างกายออกไปทำงานSARAN (128K).mp3 | 2022-05-10 17:11 | 0 | |
![[VID]](/icons/movie.gif) | 4b1cc415884d532d7cae7575e44f9a3e.mp4 | 2022-05-10 17:10 | 0 | |
![[SND]](/icons/sound2.gif) | _26_30Hz_GHOSTEMANE_Venom_Slow_Low_by_Дядя_Дима_muzlome_com.mp3 | 2022-05-10 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | b50a4960faee9c40b34126ae4ee5ab74.mp3 | 2022-05-10 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | Snaptik_7092351807820746011_m-o-n-a_Full_HD.mp3 | 2022-05-10 17:05 | 0 | |
![[SND]](/icons/sound2.gif) | Muse - The Groove HD.mp3 | 2022-05-10 17:03 | 0 | |
![[SND]](/icons/sound2.gif) | ANSON SEABRA - Trying My Best - WIDMA Acoustic Cover.mp3 | 2022-05-10 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | HAPPY BIRTHDAY GENHALILINTAR 11 KIDS MUSIC VIDEO.mp3 | 2022-05-10 16:58 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Radosne bzyczenie pszczół. Powiało wiosną (128 kbps).mp3 | 2022-05-10 16:53 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Bzyczenie pszczoły - dźwięk pszczół - odgłos pszczoły (128 kbps).mp3 | 2022-05-10 16:53 | 0 | |
![[SND]](/icons/sound2.gif) | Дежурный🇷🇺DAMA.mp3 | 2022-05-10 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | Дежурный🇷🇺 - Пиковая дама.mp3 | 2022-05-10 16:48 | 0 | |
![[SND]](/icons/sound2.gif) | 主的那衣角.m4a | 2022-05-10 16:44 | 0 | |
![[SND]](/icons/sound2.gif) | Дежурный🇷🇺-Пиковая дама-kissvk.com.mp3 | 2022-05-10 16:42 | 0 | |
![[SND]](/icons/sound2.gif) | Yeah.mp3 | 2022-05-10 16:41 | 0 | |
![[SND]](/icons/sound2.gif) | alapaap.mp3 | 2022-05-10 16:41 | 0 | |
![[SND]](/icons/sound2.gif) | |